Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Nickel Chloride Hexahydrate (Crystalline/Certified), Fisher Chemical™
CAS: 7791-20-0 Molecular Formula: Cl2Ni · 6 H2O MDL Number: MFCD00149809 Synonym: Nickel (II) Chloride Hexahydrate
| CAS | 7791-20-0 |
|---|---|
| MDL Number | MFCD00149809 |
| Synonym | Nickel (II) Chloride Hexahydrate |
| Molecular Formula | Cl2Ni · 6 H2O |
Baker-flex™, Aluminum Oxide IB-F, J.T. Baker™
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Sodium hypochlorite, 4-6%
CAS: 7681-52-9 Molecular Formula: ClNaO Molecular Weight (g/mol): 74.44 MDL Number: MFCD00011120 InChI Key: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonym: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution PubChem CID: 23665760 ChEBI: CHEBI:32146 IUPAC Name: sodium;hypochlorite SMILES: [O-]Cl.[Na+]
| PubChem CID | 23665760 |
|---|---|
| CAS | 7681-52-9 |
| Molecular Weight (g/mol) | 74.44 |
| ChEBI | CHEBI:32146 |
| MDL Number | MFCD00011120 |
| SMILES | [O-]Cl.[Na+] |
| Synonym | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| IUPAC Name | sodium;hypochlorite |
| InChI Key | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| Molecular Formula | ClNaO |
(6-Bromohexyloxy)-tert-butyldimethylsilane, 99%
CAS: 129368-70-3 Molecular Formula: C12H27BrOSi Molecular Weight (g/mol): 295.336 MDL Number: MFCD01863708 InChI Key: PBKXRKYUUXKNSL-UHFFFAOYSA-N Synonym: 6-bromohexyloxy-tert-butyldimethylsilane,6-bromohexyl oxy tert-butyl dimethylsilane,silane, 6-bromohexyl oxy 1,1-dimethylethyl dimethyl,acmc-20apme,1-t-butyldimethylsilyloxy-6-bromohexane,6-bromohexyloxy-tert-butyidimethylsilane,6-bromohexyloxy tert-butyldimethylsilane,6-bromohexyl tert-butyldimethylsilyl ether PubChem CID: 4260352 IUPAC Name: 6-bromohexoxy-tert-butyl-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)OCCCCCCBr
| PubChem CID | 4260352 |
|---|---|
| CAS | 129368-70-3 |
| Molecular Weight (g/mol) | 295.336 |
| MDL Number | MFCD01863708 |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCBr |
| Synonym | 6-bromohexyloxy-tert-butyldimethylsilane,6-bromohexyl oxy tert-butyl dimethylsilane,silane, 6-bromohexyl oxy 1,1-dimethylethyl dimethyl,acmc-20apme,1-t-butyldimethylsilyloxy-6-bromohexane,6-bromohexyloxy-tert-butyidimethylsilane,6-bromohexyloxy tert-butyldimethylsilane,6-bromohexyl tert-butyldimethylsilyl ether |
| IUPAC Name | 6-bromohexoxy-tert-butyl-dimethylsilane |
| InChI Key | PBKXRKYUUXKNSL-UHFFFAOYSA-N |
| Molecular Formula | C12H27BrOSi |
Silver hexafluorophosphate, 98%, -6 mesh
CAS: 26042-63-7 Molecular Formula: AgF6P Molecular Weight (g/mol): 252.83 MDL Number: MFCD00003415 InChI Key: SCQBROMTFBBDHF-UHFFFAOYSA-N Synonym: silver hexafluorophosphate,silver hexafluorophosphate v,ag.f6p,silver i hexafluorophosphate,agpf6,acmc-1ceef,phosphate 1-, hexafluoro-, silver 1+,phosphate 1-, hexafluoro-, silver 1+ 1:1,silver i hexafluorophosphate v PubChem CID: 168464 IUPAC Name: silver;hexafluorophosphate SMILES: F[P-](F)(F)(F)(F)F.[Ag+]
| PubChem CID | 168464 |
|---|---|
| CAS | 26042-63-7 |
| Molecular Weight (g/mol) | 252.83 |
| MDL Number | MFCD00003415 |
| SMILES | F[P-](F)(F)(F)(F)F.[Ag+] |
| Synonym | silver hexafluorophosphate,silver hexafluorophosphate v,ag.f6p,silver i hexafluorophosphate,agpf6,acmc-1ceef,phosphate 1-, hexafluoro-, silver 1+,phosphate 1-, hexafluoro-, silver 1+ 1:1,silver i hexafluorophosphate v |
| IUPAC Name | silver;hexafluorophosphate |
| InChI Key | SCQBROMTFBBDHF-UHFFFAOYSA-N |
| Molecular Formula | AgF6P |
Magnesium Chloride, 6-Hydrate, Crystal, U.S.P. - F.C.C., J.T. Baker™
CAS: 7791-18-6 Molecular Weight (g/mol): 203.30 MDL Number: MFCD00149781 InChI Key: DHRRIBDTHFBPNG-UHFFFAOYSA-L IUPAC Name: magnesium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Mg++].[Cl-].[Cl-]
| CAS | 7791-18-6 |
|---|---|
| Molecular Weight (g/mol) | 203.30 |
| MDL Number | MFCD00149781 |
| SMILES | O.O.O.O.O.O.[Mg++].[Cl-].[Cl-] |
| IUPAC Name | magnesium(2+) hexahydrate dichloride |
| InChI Key | DHRRIBDTHFBPNG-UHFFFAOYSA-L |
Iron powder, spherical, APS 6-10 micron, reduced, 99.5%, Thermo Scientific Chemicals
CAS: 7439-89-6 Molecular Formula: Fe Molecular Weight (g/mol): 55.85 MDL Number: MFCD00010999 InChI Key: XEEYBQQBJWHFJM-UHFFFAOYSA-N Synonym: ferrum,iron, elemental,ferrous,remko,armco,ferrovac,hoeganaes eh,3zhp,ancor b,atomiron 5m PubChem CID: 23925 ChEBI: CHEBI:82664 IUPAC Name: iron SMILES: [Fe]
| PubChem CID | 23925 |
|---|---|
| CAS | 7439-89-6 |
| Molecular Weight (g/mol) | 55.85 |
| ChEBI | CHEBI:82664 |
| MDL Number | MFCD00010999 |
| SMILES | [Fe] |
| Synonym | ferrum,iron, elemental,ferrous,remko,armco,ferrovac,hoeganaes eh,3zhp,ancor b,atomiron 5m |
| IUPAC Name | iron |
| InChI Key | XEEYBQQBJWHFJM-UHFFFAOYSA-N |
| Molecular Formula | Fe |
Sodium Periodate, 6% w/v, Reagents
CAS: 7732-18-5 Molecular Formula: H2O Molecular Weight (g/mol): 18.02 InChI Key: XLYOFNOQVPJJNP-UHFFFAOYSA-N Synonym: Sodium Tetraoxoiodate(VII) IUPAC Name: water SMILES: O
| CAS | 7732-18-5 |
|---|---|
| Molecular Weight (g/mol) | 18.02 |
| SMILES | O |
| Synonym | Sodium Tetraoxoiodate(VII) |
| IUPAC Name | water |
| InChI Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Molecular Formula | H2O |
Dihydrogen dinitrosulfatoplatinate(II) solution, Pt 4-6% (cont. Pt)
CAS: 12033-81-7 Molecular Formula: H2N2O8PtS Molecular Weight (g/mol): 385.16 MDL Number: MFCD00064668 InChI Key: SPPCQWREVYSZTJ-UHFFFAOYSA-N Synonym: dihydrogen dinitrosulfatoplatinate ii,dinitroplatinum; sulfuric acid,dihydrogen dinitrosulfatoplatinate ii solution, pt cont. pt PubChem CID: 102602532 IUPAC Name: platinum;sulfuric acid;dinitrite SMILES: [H+].[H+].[O-]S([O-])(=O)=O.[O-][N+](=O)[Pt++][N+]([O-])=O
| PubChem CID | 102602532 |
|---|---|
| CAS | 12033-81-7 |
| Molecular Weight (g/mol) | 385.16 |
| MDL Number | MFCD00064668 |
| SMILES | [H+].[H+].[O-]S([O-])(=O)=O.[O-][N+](=O)[Pt++][N+]([O-])=O |
| Synonym | dihydrogen dinitrosulfatoplatinate ii,dinitroplatinum; sulfuric acid,dihydrogen dinitrosulfatoplatinate ii solution, pt cont. pt |
| IUPAC Name | platinum;sulfuric acid;dinitrite |
| InChI Key | SPPCQWREVYSZTJ-UHFFFAOYSA-N |
| Molecular Formula | H2N2O8PtS |
Zinc Nitrate, 6-Hydrate, Crystal, BAKER ANALYZED™ Reagent, J.T. Baker™
CAS: 10196-18-6 Molecular Formula: H12N2O12Zn Molecular Weight (g/mol): 297.48 MDL Number: MFCD00149889 InChI Key: JGPSMWXKRPZZRG-UHFFFAOYSA-N Synonym: zinc nitrate hexahydrate,zinc ii nitrte,zincnitratehexahydrate,acmc-1bzdd,n2o6zn.6h2o,ksc176g7t,zinc nitrate hexahydrate, puratronic,zinc nitrate,zinc 2+ hexahydrate dinitrate,zinc nitrate hexahydrate, p.a PubChem CID: 15865313 IUPAC Name: zinc;dinitrate;hexahydrate SMILES: O.O.O.O.O.O.[Zn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 15865313 |
|---|---|
| CAS | 10196-18-6 |
| Molecular Weight (g/mol) | 297.48 |
| MDL Number | MFCD00149889 |
| SMILES | O.O.O.O.O.O.[Zn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | zinc nitrate hexahydrate,zinc ii nitrte,zincnitratehexahydrate,acmc-1bzdd,n2o6zn.6h2o,ksc176g7t,zinc nitrate hexahydrate, puratronic,zinc nitrate,zinc 2+ hexahydrate dinitrate,zinc nitrate hexahydrate, p.a |
| IUPAC Name | zinc;dinitrate;hexahydrate |
| InChI Key | JGPSMWXKRPZZRG-UHFFFAOYSA-N |
| Molecular Formula | H12N2O12Zn |
Sodium Hypochlorite Solution, 6% available Chlorine, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: ClNaO Molecular Weight (g/mol): 74.439 InChI Key: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonym: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution PubChem CID: 23665760 ChEBI: CHEBI:32146 IUPAC Name: sodium;hypochlorite SMILES: [O-]Cl.[Na+]
| PubChem CID | 23665760 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 74.439 |
| ChEBI | CHEBI:32146 |
| SMILES | [O-]Cl.[Na+] |
| Synonym | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| IUPAC Name | sodium;hypochlorite |
| InChI Key | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| Molecular Formula | ClNaO |
Magnesium Chloride, 6-Hydrate, Crystal, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 7791-18-6 Molecular Formula: Cl2H12MgO6 Molecular Weight (g/mol): 203.30 MDL Number: MFCD00149781 InChI Key: DHRRIBDTHFBPNG-UHFFFAOYSA-L IUPAC Name: magnesium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Mg++].[Cl-].[Cl-]
| CAS | 7791-18-6 |
|---|---|
| Molecular Weight (g/mol) | 203.30 |
| MDL Number | MFCD00149781 |
| SMILES | O.O.O.O.O.O.[Mg++].[Cl-].[Cl-] |
| IUPAC Name | magnesium(2+) hexahydrate dichloride |
| InChI Key | DHRRIBDTHFBPNG-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12MgO6 |
| Name Note | Both ends open (Thin walls) |
|---|---|
| TSCA | U |
| Recommended Storage | Ambient temperatures |
Tungsten powder, APS 4-6 micron, Puratronic™, 99.999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
Ferrous Ammonium Sulfate, 6-Hydrate, Fine Crystal, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 7783-85-9 Molecular Weight (g/mol): 392.13 MDL Number: MFCD00150530 InChI Key: MQLVWQSVRZVNIP-UHFFFAOYSA-L IUPAC Name: λ²-iron(2+) diammonium hexahydrate disulfate SMILES: [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 7783-85-9 |
|---|---|
| Molecular Weight (g/mol) | 392.13 |
| MDL Number | MFCD00150530 |
| SMILES | [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| IUPAC Name | λ²-iron(2+) diammonium hexahydrate disulfate |
| InChI Key | MQLVWQSVRZVNIP-UHFFFAOYSA-L |