Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Chlorobenzene-d{5}, 99% (Isotopic), Thermo Scientific Chemicals
CAS: 3114-55-4 Molecular Formula: C6H5Cl Molecular Weight (g/mol): 117.587 MDL Number: MFCD00000531 InChI Key: MVPPADPHJFYWMZ-RALIUCGRSA-N Synonym: chlorobenzene-d5,chloro 2h5 benzene,1-chloro 2 h? benzene,chlorobenzene d5,benzene-d5, chloro,2h5 phenyl chloride,1-chloro 2h5 benzene,benzene-d5-, chloro,chlorobenzene, perdeutero,chlorobenzene-d5, 99 atom % d PubChem CID: 575975 IUPAC Name: 1-chloro-2,3,4,5,6-pentadeuteriobenzene SMILES: C1=CC=C(C=C1)Cl
| PubChem CID | 575975 |
|---|---|
| CAS | 3114-55-4 |
| Molecular Weight (g/mol) | 117.587 |
| MDL Number | MFCD00000531 |
| SMILES | C1=CC=C(C=C1)Cl |
| Synonym | chlorobenzene-d5,chloro 2h5 benzene,1-chloro 2 h? benzene,chlorobenzene d5,benzene-d5, chloro,2h5 phenyl chloride,1-chloro 2h5 benzene,benzene-d5-, chloro,chlorobenzene, perdeutero,chlorobenzene-d5, 99 atom % d |
| IUPAC Name | 1-chloro-2,3,4,5,6-pentadeuteriobenzene |
| InChI Key | MVPPADPHJFYWMZ-RALIUCGRSA-N |
| Molecular Formula | C6H5Cl |
Pyridine-d{5}, 99.5% (Isotopic), contains 0.05% v/v TMS
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
4-Chlorophenylacetic acid, 98%
CAS: 1878-66-6 Molecular Formula: C8H7ClO2 Molecular Weight (g/mol): 170.59 MDL Number: MFCD00004344 InChI Key: CDPKJZJVTHSESZ-UHFFFAOYSA-N Synonym: 4-chlorophenylacetic acid,2-4-chlorophenyl acetic acid,4-chlorophenyl acetic acid,4-chlorobenzeneacetic acid,p-chlorophenylacetic acid,benzeneacetic acid, 4-chloro,p-chlorophenyl acetic acid,2-p-chlorophenyl acetic acid,acetic acid, p-chlorophenyl PubChem CID: 15880 ChEBI: CHEBI:30749 IUPAC Name: 2-(4-chlorophenyl)acetic acid SMILES: OC(=O)CC1=CC=C(Cl)C=C1
| PubChem CID | 15880 |
|---|---|
| CAS | 1878-66-6 |
| Molecular Weight (g/mol) | 170.59 |
| ChEBI | CHEBI:30749 |
| MDL Number | MFCD00004344 |
| SMILES | OC(=O)CC1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorophenylacetic acid,2-4-chlorophenyl acetic acid,4-chlorophenyl acetic acid,4-chlorobenzeneacetic acid,p-chlorophenylacetic acid,benzeneacetic acid, 4-chloro,p-chlorophenyl acetic acid,2-p-chlorophenyl acetic acid,acetic acid, p-chlorophenyl |
| IUPAC Name | 2-(4-chlorophenyl)acetic acid |
| InChI Key | CDPKJZJVTHSESZ-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO2 |
5-Fluoro-m-xylene, 97%
CAS: 461-97-2 Molecular Formula: C8H9F Molecular Weight (g/mol): 124.158 MDL Number: MFCD00052366 InChI Key: RCWIWNUVHNAUQC-UHFFFAOYSA-N Synonym: 3,5-dimethylfluorobenzene,5-fluoro-m-xylene,1,3-dimethyl-5-fluorobenzene,benzene, 1-fluoro-3,5-dimethyl,pubchem4410,5-fluoro-1,3-xylene,acmc-1ahss,3,5-dimethyl-fluorobenzene,3,5-dimethylphenyl fluoride,ksc497s5r PubChem CID: 521192 IUPAC Name: 1-fluoro-3,5-dimethylbenzene SMILES: CC1=CC(=CC(=C1)F)C
| PubChem CID | 521192 |
|---|---|
| CAS | 461-97-2 |
| Molecular Weight (g/mol) | 124.158 |
| MDL Number | MFCD00052366 |
| SMILES | CC1=CC(=CC(=C1)F)C |
| Synonym | 3,5-dimethylfluorobenzene,5-fluoro-m-xylene,1,3-dimethyl-5-fluorobenzene,benzene, 1-fluoro-3,5-dimethyl,pubchem4410,5-fluoro-1,3-xylene,acmc-1ahss,3,5-dimethyl-fluorobenzene,3,5-dimethylphenyl fluoride,ksc497s5r |
| IUPAC Name | 1-fluoro-3,5-dimethylbenzene |
| InChI Key | RCWIWNUVHNAUQC-UHFFFAOYSA-N |
| Molecular Formula | C8H9F |
2-Chloromandelic acid, 98%
CAS: 10421-85-9 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.59 MDL Number: MFCD00084962 InChI Key: RWOLDZZTBNYTMS-UHFFFAOYNA-N Synonym: 2-chloromandelic acid,2-2-chlorophenyl-2-hydroxyacetic acid,dl-2-chloromandelic acid,2-chlorophenyl hydroxy acetic acid,dl-2-chloro mandelic acid,2-2-chlorophenyl-2-hydroxy-acetic acid,2-chlorophenyl glycolic acid,2-chloromandelicacid,2-chloro-mandelic acid,pubchem15895 PubChem CID: 97720 IUPAC Name: 2-(2-chlorophenyl)-2-hydroxyacetic acid SMILES: OC(C(O)=O)C1=CC=CC=C1Cl
| PubChem CID | 97720 |
|---|---|
| CAS | 10421-85-9 |
| Molecular Weight (g/mol) | 186.59 |
| MDL Number | MFCD00084962 |
| SMILES | OC(C(O)=O)C1=CC=CC=C1Cl |
| Synonym | 2-chloromandelic acid,2-2-chlorophenyl-2-hydroxyacetic acid,dl-2-chloromandelic acid,2-chlorophenyl hydroxy acetic acid,dl-2-chloro mandelic acid,2-2-chlorophenyl-2-hydroxy-acetic acid,2-chlorophenyl glycolic acid,2-chloromandelicacid,2-chloro-mandelic acid,pubchem15895 |
| IUPAC Name | 2-(2-chlorophenyl)-2-hydroxyacetic acid |
| InChI Key | RWOLDZZTBNYTMS-UHFFFAOYNA-N |
| Molecular Formula | C8H7ClO3 |
2,6-Dimethylanisole, 98+%
CAS: 1004-66-6 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.19 MDL Number: MFCD00008380 InChI Key: GFNZJAUVJCGWLW-UHFFFAOYSA-N Synonym: 2,6-dimethylanisole,2-methoxy-m-xylene,benzene, 2-methoxy-1,3-dimethyl,1,3-dimethyl-2-methoxybenzene,pubchem4115,2,6-dimethyl anisole,acmc-1buuc,ksc493q8r,2,6-dimethylphenyl methyl ether PubChem CID: 66088 IUPAC Name: 2-methoxy-1,3-dimethylbenzene SMILES: COC1=C(C)C=CC=C1C
| PubChem CID | 66088 |
|---|---|
| CAS | 1004-66-6 |
| Molecular Weight (g/mol) | 136.19 |
| MDL Number | MFCD00008380 |
| SMILES | COC1=C(C)C=CC=C1C |
| Synonym | 2,6-dimethylanisole,2-methoxy-m-xylene,benzene, 2-methoxy-1,3-dimethyl,1,3-dimethyl-2-methoxybenzene,pubchem4115,2,6-dimethyl anisole,acmc-1buuc,ksc493q8r,2,6-dimethylphenyl methyl ether |
| IUPAC Name | 2-methoxy-1,3-dimethylbenzene |
| InChI Key | GFNZJAUVJCGWLW-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
2,3-Dimethylanisole, 97%
CAS: 2944-49-2 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.194 MDL Number: MFCD00008376 InChI Key: BLMBNEVGYRXFNA-UHFFFAOYSA-N Synonym: 2,3-dimethylanisole,3-methoxy-o-xylene,benzene, 1-methoxy-2,3-dimethyl,benzene, methoxydimethyl,1,2-dimethyl-6-methoxybenzene,1-methoxy-2,3-dimethyl-benzene,dimethylanisole,pubchem4114,2,3-dimethyl anisole,2,3-dimethyl-anisole PubChem CID: 76269 IUPAC Name: 1-methoxy-2,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)OC)C
| PubChem CID | 76269 |
|---|---|
| CAS | 2944-49-2 |
| Molecular Weight (g/mol) | 136.194 |
| MDL Number | MFCD00008376 |
| SMILES | CC1=C(C(=CC=C1)OC)C |
| Synonym | 2,3-dimethylanisole,3-methoxy-o-xylene,benzene, 1-methoxy-2,3-dimethyl,benzene, methoxydimethyl,1,2-dimethyl-6-methoxybenzene,1-methoxy-2,3-dimethyl-benzene,dimethylanisole,pubchem4114,2,3-dimethyl anisole,2,3-dimethyl-anisole |
| IUPAC Name | 1-methoxy-2,3-dimethylbenzene |
| InChI Key | BLMBNEVGYRXFNA-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
2-Iodo-m-xylene, 98%
CAS: 608-28-6 Molecular Formula: C8H9I Molecular Weight (g/mol): 232.064 MDL Number: MFCD00019012 InChI Key: QTUGGVBKWIYQSS-UHFFFAOYSA-N Synonym: 2-iodo-m-xylene,2,6-dimethyliodobenzene,m-xylene, 2-iodo,benzene, 2-iodo-1,3-dimethyl,1,3-dimethyl-2-iodobenzene,2-iodo-1,3-dimethyl-benzene,2,6-dimethyl-1-iodobenzene,2-iodo-o-xylene,pubchem3867,acmc-1axwc PubChem CID: 69097 IUPAC Name: 2-iodo-1,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)C)I
| PubChem CID | 69097 |
|---|---|
| CAS | 608-28-6 |
| Molecular Weight (g/mol) | 232.064 |
| MDL Number | MFCD00019012 |
| SMILES | CC1=C(C(=CC=C1)C)I |
| Synonym | 2-iodo-m-xylene,2,6-dimethyliodobenzene,m-xylene, 2-iodo,benzene, 2-iodo-1,3-dimethyl,1,3-dimethyl-2-iodobenzene,2-iodo-1,3-dimethyl-benzene,2,6-dimethyl-1-iodobenzene,2-iodo-o-xylene,pubchem3867,acmc-1axwc |
| IUPAC Name | 2-iodo-1,3-dimethylbenzene |
| InChI Key | QTUGGVBKWIYQSS-UHFFFAOYSA-N |
| Molecular Formula | C8H9I |
4-Fluoro-o-xylene, 98%
CAS: 452-64-2 Molecular Formula: C8H9F Molecular Weight (g/mol): 124.158 MDL Number: MFCD00039217 InChI Key: WYHBENDEZDFJNU-UHFFFAOYSA-N Synonym: 4-fluoro-o-xylene,1,2-dimethyl-4-fluorobenzene,3,4-dimethylfluorobenzene,4-fluoro-1,2-xylene,1-fluoro-3,4-dimethylbenzene,benzene, 4-fluoro-1,2-dimethyl,o-xylene, 4-fluoro,pubchem14118,acmc-1afww,3,4-dimethyl fluorobenzene PubChem CID: 253306 IUPAC Name: 4-fluoro-1,2-dimethylbenzene SMILES: CC1=C(C=C(C=C1)F)C
| PubChem CID | 253306 |
|---|---|
| CAS | 452-64-2 |
| Molecular Weight (g/mol) | 124.158 |
| MDL Number | MFCD00039217 |
| SMILES | CC1=C(C=C(C=C1)F)C |
| Synonym | 4-fluoro-o-xylene,1,2-dimethyl-4-fluorobenzene,3,4-dimethylfluorobenzene,4-fluoro-1,2-xylene,1-fluoro-3,4-dimethylbenzene,benzene, 4-fluoro-1,2-dimethyl,o-xylene, 4-fluoro,pubchem14118,acmc-1afww,3,4-dimethyl fluorobenzene |
| IUPAC Name | 4-fluoro-1,2-dimethylbenzene |
| InChI Key | WYHBENDEZDFJNU-UHFFFAOYSA-N |
| Molecular Formula | C8H9F |
2-Chloro-4-fluorobenzonitrile, 98%
CAS: 60702-69-4 Molecular Formula: C7H3ClFN Molecular Weight (g/mol): 155.56 MDL Number: MFCD00042523 InChI Key: PGKPNNMOFHNZJX-UHFFFAOYSA-N Synonym: 4-fluoro-2-chlorobenzonitrile,benzonitrile, 2-chloro-4-fluoro,2-chloro-4-fluoro benzonitrile,2-chloro-4-fluoro-benzonitrile,2-chloro-4-fluorobenzenecarbonitrile,ncr bg df,pubchem3422,acmc-209mll,2-chloro-4fluorobenzonitrile,2-chloro4-fluorobenzonitrile PubChem CID: 109000 IUPAC Name: 2-chloro-4-fluorobenzonitrile SMILES: FC1=CC=C(C#N)C(Cl)=C1
| PubChem CID | 109000 |
|---|---|
| CAS | 60702-69-4 |
| Molecular Weight (g/mol) | 155.56 |
| MDL Number | MFCD00042523 |
| SMILES | FC1=CC=C(C#N)C(Cl)=C1 |
| Synonym | 4-fluoro-2-chlorobenzonitrile,benzonitrile, 2-chloro-4-fluoro,2-chloro-4-fluoro benzonitrile,2-chloro-4-fluoro-benzonitrile,2-chloro-4-fluorobenzenecarbonitrile,ncr bg df,pubchem3422,acmc-209mll,2-chloro-4fluorobenzonitrile,2-chloro4-fluorobenzonitrile |
| IUPAC Name | 2-chloro-4-fluorobenzonitrile |
| InChI Key | PGKPNNMOFHNZJX-UHFFFAOYSA-N |
| Molecular Formula | C7H3ClFN |
4,5-Dimethyl-2-nitroaniline, 97%
CAS: 6972-71-0 Molecular Formula: C8H10N2O2 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00007811 InChI Key: PINGKGKKUSYUAW-UHFFFAOYSA-N Synonym: 6-nitro-3,4-xylidine,benzenamine, 4,5-dimethyl-2-nitro,3,4-xylidine, 6-nitro,2-nitro-4,5-dimethylaniline,4,5-dimethyl-2-nitrophenylamine,2-nitro-4,5-xylidine,3,4-dimethyl-6-nitroaniline,acmc-20amrx,3, 6-nitro,4-amino-5-nitro-o-xylene PubChem CID: 81445 IUPAC Name: 4,5-dimethyl-2-nitroaniline SMILES: CC1=CC(=C(C=C1C)[N+](=O)[O-])N
| PubChem CID | 81445 |
|---|---|
| CAS | 6972-71-0 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00007811 |
| SMILES | CC1=CC(=C(C=C1C)[N+](=O)[O-])N |
| Synonym | 6-nitro-3,4-xylidine,benzenamine, 4,5-dimethyl-2-nitro,3,4-xylidine, 6-nitro,2-nitro-4,5-dimethylaniline,4,5-dimethyl-2-nitrophenylamine,2-nitro-4,5-xylidine,3,4-dimethyl-6-nitroaniline,acmc-20amrx,3, 6-nitro,4-amino-5-nitro-o-xylene |
| IUPAC Name | 4,5-dimethyl-2-nitroaniline |
| InChI Key | PINGKGKKUSYUAW-UHFFFAOYSA-N |
| Molecular Formula | C8H10N2O2 |
Chloroform ACS AR, Macron Fine Chemicals™
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 IUPAC Name: trichloromethane SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | trichloromethane |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Tetrahydrofurfuryl bromide, 95%
CAS: 1192-30-9 Molecular Formula: C5H9BrO Molecular Weight (g/mol): 165.03 MDL Number: MFCD00016894 InChI Key: VOHILFSOWRNVJJ-UHFFFAOYNA-N Synonym: tetrahydrofurfuryl bromide,2-bromomethyl tetrahydrofuran,2-bromomethyl oxolane,furan, 2-bromomethyl tetrahydro,2-bromomethyl-tetrahydrofuran,furan, tetrahydro-2-bromomethyl,tetrahydrofurfurylbromide,tetrahydrofrufryl bromide,2-bromomethyltetrahydrofuran PubChem CID: 14501 IUPAC Name: 2-(bromomethyl)oxolane SMILES: BrCC1CCCO1
| PubChem CID | 14501 |
|---|---|
| CAS | 1192-30-9 |
| Molecular Weight (g/mol) | 165.03 |
| MDL Number | MFCD00016894 |
| SMILES | BrCC1CCCO1 |
| Synonym | tetrahydrofurfuryl bromide,2-bromomethyl tetrahydrofuran,2-bromomethyl oxolane,furan, 2-bromomethyl tetrahydro,2-bromomethyl-tetrahydrofuran,furan, tetrahydro-2-bromomethyl,tetrahydrofurfurylbromide,tetrahydrofrufryl bromide,2-bromomethyltetrahydrofuran |
| IUPAC Name | 2-(bromomethyl)oxolane |
| InChI Key | VOHILFSOWRNVJJ-UHFFFAOYNA-N |
| Molecular Formula | C5H9BrO |
2-Chloro-6-fluoroaniline, 98%
CAS: 363-51-9 Molecular Formula: C6H5ClFN Molecular Weight (g/mol): 145.56 MDL Number: MFCD00040309 InChI Key: ZJLAWMDJTMMTQB-UHFFFAOYSA-N Synonym: benzenamine, 2-chloro-6-fluoro,2-chloro-6-fluoro-aniline,2-chloro-6-fluoro-phenylamine,6-chloro-2-fluorophenylamine,pubchem1528,2-fluoro-6-chloroaniline,acmc-209im1,2-chloro-6-fluoro aniline,2-chloro-6-fluorobenzenamine,2-chloro-6-fluorophenylamine PubChem CID: 2734205 IUPAC Name: 2-chloro-6-fluoroaniline SMILES: NC1=C(F)C=CC=C1Cl
| PubChem CID | 2734205 |
|---|---|
| CAS | 363-51-9 |
| Molecular Weight (g/mol) | 145.56 |
| MDL Number | MFCD00040309 |
| SMILES | NC1=C(F)C=CC=C1Cl |
| Synonym | benzenamine, 2-chloro-6-fluoro,2-chloro-6-fluoro-aniline,2-chloro-6-fluoro-phenylamine,6-chloro-2-fluorophenylamine,pubchem1528,2-fluoro-6-chloroaniline,acmc-209im1,2-chloro-6-fluoro aniline,2-chloro-6-fluorobenzenamine,2-chloro-6-fluorophenylamine |
| IUPAC Name | 2-chloro-6-fluoroaniline |
| InChI Key | ZJLAWMDJTMMTQB-UHFFFAOYSA-N |
| Molecular Formula | C6H5ClFN |
4-Chloro-m-xylene, 97%
CAS: 95-66-9 Molecular Formula: C8H9Cl Molecular Weight (g/mol): 140.61 MDL Number: MFCD00060644 InChI Key: UIEVCEQLNUHDIF-UHFFFAOYSA-N Synonym: 4-chloro-m-xylene,m-xylene, 4-chloro,2,4-dimethylchlorobenzene,benzene, 1-chloro-2,4-dimethyl,mxylene4chloro,1-chloro-2,4-dimethyl-benzene,4-chlor-m-xylol,pubchem3639,acmc-209rzq,4-chloro-meta-xylene PubChem CID: 523153 IUPAC Name: 1-chloro-2,4-dimethylbenzene SMILES: CC1=CC(=C(C=C1)Cl)C
| PubChem CID | 523153 |
|---|---|
| CAS | 95-66-9 |
| Molecular Weight (g/mol) | 140.61 |
| MDL Number | MFCD00060644 |
| SMILES | CC1=CC(=C(C=C1)Cl)C |
| Synonym | 4-chloro-m-xylene,m-xylene, 4-chloro,2,4-dimethylchlorobenzene,benzene, 1-chloro-2,4-dimethyl,mxylene4chloro,1-chloro-2,4-dimethyl-benzene,4-chlor-m-xylol,pubchem3639,acmc-209rzq,4-chloro-meta-xylene |
| IUPAC Name | 1-chloro-2,4-dimethylbenzene |
| InChI Key | UIEVCEQLNUHDIF-UHFFFAOYSA-N |
| Molecular Formula | C8H9Cl |