Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Tetrahydrofuran-D8, deuteration degree min 99.5% for NMR spectroscopy MagniSolv™, MilliporeSigma™
CAS: 1693-74-9 Molecular Formula: C4H8O Molecular Weight (g/mol): 80.16 MDL Number: MFCD00044238 InChI Key: WYURNTSHIVDZCO-SVYQBANQSA-N Synonym: tetrahydrofuran-d8,deuterated thf,octadeuterotetrahydrofuran,deuterated tetrahydrofuran,tetrahydrofuran-d8 thf-d8,tetrahydrofuran-d8, ≥99.5 atom % d,2h4 tetrahydro 2h4 furan,thf-d8,2h8 tetrahydrofuran,furan-d4-, tetrahydro-d4 PubChem CID: 80290 IUPAC Name: (²H₈)oxolane SMILES: [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H]
| PubChem CID | 80290 |
|---|---|
| CAS | 1693-74-9 |
| Molecular Weight (g/mol) | 80.16 |
| MDL Number | MFCD00044238 |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| Synonym | tetrahydrofuran-d8,deuterated thf,octadeuterotetrahydrofuran,deuterated tetrahydrofuran,tetrahydrofuran-d8 thf-d8,tetrahydrofuran-d8, ≥99.5 atom % d,2h4 tetrahydro 2h4 furan,thf-d8,2h8 tetrahydrofuran,furan-d4-, tetrahydro-d4 |
| IUPAC Name | (²H₈)oxolane |
| InChI Key | WYURNTSHIVDZCO-SVYQBANQSA-N |
| Molecular Formula | C4H8O |
Chloroform-d, for NMR, 99.8% atom D, packaged in 1mL ampoules, Thermo Scientific Chemicals
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Toluene-d8, 99.6%(Isotopic), Thermo Scientific Chemicals
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 MDL Number: MFCD00044638 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| MDL Number | MFCD00044638 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
Methanol-d4, for NMR, with 0.03% TMS, in 0.75 ml ampoules, 99.8 atom % D
CAS: 811-98-3 Molecular Formula: CH4O Molecular Weight (g/mol): 36.066 MDL Number: MFCD00044637 InChI Key: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d PubChem CID: 71568 IUPAC Name: trideuterio(deuteriooxy)methane SMILES: CO
| PubChem CID | 71568 |
|---|---|
| CAS | 811-98-3 |
| Molecular Weight (g/mol) | 36.066 |
| MDL Number | MFCD00044637 |
| SMILES | CO |
| Synonym | methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d |
| IUPAC Name | trideuterio(deuteriooxy)methane |
| InChI Key | OKKJLVBELUTLKV-MZCSYVLQSA-N |
| Molecular Formula | CH4O |
Thermo Scientific Chemicals Toluene-d8, for NMR, 99.8 atom % D
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N IUPAC Name: 1-(²H₃)methyl(²H₅)benzene SMILES: [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])C([2H])([2H])[2H]
| CAS | 2037-26-5 |
|---|---|
| Molecular Weight (g/mol) | 100.19 |
| SMILES | [2H]C1=C([2H])C([2H])=C(C([2H])=C1[2H])C([2H])([2H])[2H] |
| IUPAC Name | 1-(²H₃)methyl(²H₅)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
Dichloromethane-d{2}, 99.9% (Isotopic)
CAS: 1665-00-5 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 86.939 MDL Number: MFCD00000882 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC Name: dichloro(dideuterio)methane SMILES: C(Cl)Cl
| PubChem CID | 160586 |
|---|---|
| CAS | 1665-00-5 |
| Molecular Weight (g/mol) | 86.939 |
| MDL Number | MFCD00000882 |
| SMILES | C(Cl)Cl |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
| IUPAC Name | dichloro(dideuterio)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CH2Cl2 |
Methanol-d{4}, 100%(Isotopic)
CAS: 811-98-3 Molecular Formula: CH4O Molecular Weight (g/mol): 36.066 MDL Number: MFCD00044637 InChI Key: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d PubChem CID: 71568 IUPAC Name: trideuterio(deuteriooxy)methane SMILES: CO
| PubChem CID | 71568 |
|---|---|
| CAS | 811-98-3 |
| Molecular Weight (g/mol) | 36.066 |
| MDL Number | MFCD00044637 |
| SMILES | CO |
| Synonym | methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d |
| IUPAC Name | trideuterio(deuteriooxy)methane |
| InChI Key | OKKJLVBELUTLKV-MZCSYVLQSA-N |
| Molecular Formula | CH4O |
o-Xylene-d{10}, 98+% (Isotopic)
CAS: 56004-61-6 Molecular Formula: C8H10 Molecular Weight (g/mol): 116.23 MDL Number: MFCD00037698 InChI Key: CTQNGGLPUBDAKN-ZGYYUIRESA-N Synonym: o-xylene-d10,2h10-o-xylene,1,2-dimethylbenzene-d10 99.5 atom % d,1,2-xylene-d10,o-xylene-d10, 99 atom % d,bis 2 h? methyl 2 h? benzene,1,2,3,4-tetradeuterio-5,6-bis trideuteriomethyl benzene PubChem CID: 91976 IUPAC Name: 1,2,3,4-tetradeuterio-5,6-bis(trideuteriomethyl)benzene SMILES: [2H]C1=C([2H])C([2H])=C(C(=C1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H]
| PubChem CID | 91976 |
|---|---|
| CAS | 56004-61-6 |
| Molecular Weight (g/mol) | 116.23 |
| MDL Number | MFCD00037698 |
| SMILES | [2H]C1=C([2H])C([2H])=C(C(=C1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Synonym | o-xylene-d10,2h10-o-xylene,1,2-dimethylbenzene-d10 99.5 atom % d,1,2-xylene-d10,o-xylene-d10, 99 atom % d,bis 2 h? methyl 2 h? benzene,1,2,3,4-tetradeuterio-5,6-bis trideuteriomethyl benzene |
| IUPAC Name | 1,2,3,4-tetradeuterio-5,6-bis(trideuteriomethyl)benzene |
| InChI Key | CTQNGGLPUBDAKN-ZGYYUIRESA-N |
| Molecular Formula | C8H10 |
Pyridine-d5, 99.5%(Isotopic), Thermo Scientific Chemicals
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: (²H₅)pyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | (²H₅)pyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |
Sodium deuteroxide, for NMR, 30 wt% solution in D2O, 99+ atom % D
CAS: 14014-06-3 Molecular Formula: HNaO Molecular Weight (g/mol): 41.003 MDL Number: MFCD00037669 InChI Key: HEMHJVSKTPXQMS-DYCDLGHISA-M Synonym: sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci PubChem CID: 23676750 SMILES: [OH-].[Na+]
| PubChem CID | 23676750 |
|---|---|
| CAS | 14014-06-3 |
| Molecular Weight (g/mol) | 41.003 |
| MDL Number | MFCD00037669 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium deuteroxide,sodium hydroxide na od,sodium deuteroxide, 40 wt% in deuterium oxide,naod,sodium hydroxide-d,sodium deuteroxide solution,sodium deuteroxide, 1 m in deuterium oxide,sodium deuteroxide, 0.1 m in deuterium oxide,sodium deuteroxide, 30 wt% in deuterium oxide,sodium hydroxide na od 6ci,7ci,8ci,9ci |
| InChI Key | HEMHJVSKTPXQMS-DYCDLGHISA-M |
| Molecular Formula | HNaO |
Chloroform-d, 99.8% (Isotopic)
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Diethyl ether-d{10}, 99%(Isotopic)
CAS: 2679-89-2 Molecular Formula: C4H10O Molecular Weight (g/mol): 84.18 MDL Number: MFCD00062316 InChI Key: RTZKZFJDLAIYFH-MWUKXHIBSA-N Synonym: ether-d10,diethyl ether-d10,2,2'-oxybis 2h5 ethane,diethylether-d10,di ethyl-d5 ether,ether-d10, 99 atom % d,2,2/'-oxybis 2h5 ethane,diethyl ether-d isotopic,1-2 h? ethoxy 2 h? ethane,1,1,1,2,2-pentadeuterio-2-1,1,2,2,2-pentadeuterioethoxy ethane PubChem CID: 2723765 IUPAC Name: 1-[(1,1,2,2,2-²H₅)ethoxy](²H₅)ethane SMILES: [2H]C([2H])([2H])C([2H])([2H])OC([2H])([2H])C([2H])([2H])[2H]
| PubChem CID | 2723765 |
|---|---|
| CAS | 2679-89-2 |
| Molecular Weight (g/mol) | 84.18 |
| MDL Number | MFCD00062316 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC([2H])([2H])C([2H])([2H])[2H] |
| Synonym | ether-d10,diethyl ether-d10,2,2'-oxybis 2h5 ethane,diethylether-d10,di ethyl-d5 ether,ether-d10, 99 atom % d,2,2/'-oxybis 2h5 ethane,diethyl ether-d isotopic,1-2 h? ethoxy 2 h? ethane,1,1,1,2,2-pentadeuterio-2-1,1,2,2,2-pentadeuterioethoxy ethane |
| IUPAC Name | 1-[(1,1,2,2,2-²H₅)ethoxy](²H₅)ethane |
| InChI Key | RTZKZFJDLAIYFH-MWUKXHIBSA-N |
| Molecular Formula | C4H10O |
1,4-Dioxane-d{8}, 99% (Isotopic)
CAS: 17647-74-4 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 96.155 MDL Number: MFCD00044239 InChI Key: RYHBNJHYFVUHQT-SVYQBANQSA-N Synonym: 1,4-dioxane-d8,2h8-1,4-dioxane,1,4-dioxane-d8, 99 atom % d,2 h?-1,4-dioxane,1,4-dioxane-2lh8,1,4-dioxane d8,1,4-dioxane-d8, ≥99 atom % d,1,4-dioxane-d isotopic 1g,1,4-dioxane-d8 >99.0 atom % d,1 4-dioxane-d8 99 atom % d PubChem CID: 87209 IUPAC Name: 2,2,3,3,5,5,6,6-octadeuterio-1,4-dioxane SMILES: C1COCCO1
| PubChem CID | 87209 |
|---|---|
| CAS | 17647-74-4 |
| Molecular Weight (g/mol) | 96.155 |
| MDL Number | MFCD00044239 |
| SMILES | C1COCCO1 |
| Synonym | 1,4-dioxane-d8,2h8-1,4-dioxane,1,4-dioxane-d8, 99 atom % d,2 h?-1,4-dioxane,1,4-dioxane-2lh8,1,4-dioxane d8,1,4-dioxane-d8, ≥99 atom % d,1,4-dioxane-d isotopic 1g,1,4-dioxane-d8 >99.0 atom % d,1 4-dioxane-d8 99 atom % d |
| IUPAC Name | 2,2,3,3,5,5,6,6-octadeuterio-1,4-dioxane |
| InChI Key | RYHBNJHYFVUHQT-SVYQBANQSA-N |
| Molecular Formula | C4H8O2 |
Trifluoroacetic acid-d, for NMR, packaged in 1 ml ampoules, 99.5 atom % D
CAS: 599-00-8 Molecular Formula: C2HF3O2 Molecular Weight (g/mol): 115.029 MDL Number: MFCD00044563 InChI Key: DTQVDTLACAAQTR-DYCDLGHISA-N Synonym: trifluoroacetic acid-d,deuterotrifluoroacetic acid,acetic acid-d, trifluoro,acetic acid-d,2,2,2-trifluoro,acetic acid-d, 2,2,2-trifluoro,trifluoroacetic acid-d tfa-d,trifluoroacetic acid-d, 99.5 atom % d,tfa-d,cf3cood,trifluoroacetic 2h acid PubChem CID: 71502 IUPAC Name: deuterio 2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)O
| PubChem CID | 71502 |
|---|---|
| CAS | 599-00-8 |
| Molecular Weight (g/mol) | 115.029 |
| MDL Number | MFCD00044563 |
| SMILES | C(=O)(C(F)(F)F)O |
| Synonym | trifluoroacetic acid-d,deuterotrifluoroacetic acid,acetic acid-d, trifluoro,acetic acid-d,2,2,2-trifluoro,acetic acid-d, 2,2,2-trifluoro,trifluoroacetic acid-d tfa-d,trifluoroacetic acid-d, 99.5 atom % d,tfa-d,cf3cood,trifluoroacetic 2h acid |
| IUPAC Name | deuterio 2,2,2-trifluoroacetate |
| InChI Key | DTQVDTLACAAQTR-DYCDLGHISA-N |
| Molecular Formula | C2HF3O2 |
Deuterium chloride, for NMR, 1M solution in D2O, 99.8 atom% D, AcroSeal™
CAS: 7698-05-7 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00044642 InChI Key: VEXZGXHMUGYJMC-FTGQXOHASA-N Synonym: deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide PubChem CID: 522634 SMILES: Cl
| PubChem CID | 522634 |
|---|---|
| CAS | 7698-05-7 |
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00044642 |
| SMILES | Cl |
| Synonym | deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide |
| InChI Key | VEXZGXHMUGYJMC-FTGQXOHASA-N |
| Molecular Formula | ClH |