Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Pyridine, 99+%, ACS reagent
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
Ethyl Acetate, OmniSolv™, MilliporeSigma™
CAS: 141-78-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 InChI Key: XEKOWRVHYACXOJ-UHFFFAOYSA-N Synonym: ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester PubChem CID: 8857 ChEBI: CHEBI:27750 IUPAC Name: ethyl acetate SMILES: CCOC(=O)C
| PubChem CID | 8857 |
|---|---|
| CAS | 141-78-6 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:27750 |
| SMILES | CCOC(=O)C |
| Synonym | ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester |
| IUPAC Name | ethyl acetate |
| InChI Key | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Methanol (HPLC), Fisher Chemical™
CAS: 67-56-1 Molecular Formula: CH4O Molecular Weight (g/mol): 32.04 MDL Number: MFCD00004595 InChI Key: OKKJLVBELUTLKV-UHFFFAOYSA-N Synonym: methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit PubChem CID: 887 ChEBI: CHEBI:17790 IUPAC Name: methanol SMILES: CO
| PubChem CID | 887 |
|---|---|
| CAS | 67-56-1 |
| Molecular Weight (g/mol) | 32.04 |
| ChEBI | CHEBI:17790 |
| MDL Number | MFCD00004595 |
| SMILES | CO |
| Synonym | methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit |
| IUPAC Name | methanol |
| InChI Key | OKKJLVBELUTLKV-UHFFFAOYSA-N |
| Molecular Formula | CH4O |
Dimethyl sulfoxide - D6, deuteration degree min. 99.8% for NMR spectroscopy, MagniSolv™, MilliporeSigma™
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | (²H₃)methanesulfinyl(²H₃)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
n-Hexane, 99%
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
sec-Butanol, 99%, Extra Pure
CAS: 78-92-2 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00004569 InChI Key: BTANRVKWQNVYAZ-UHFFFAOYNA-N Synonym: 2-butanol,sec-butanol,sec-butyl alcohol,2-hydroxybutane,2-butyl alcohol,s-butyl alcohol,butylene hydrate,s-butanol,1-methyl-1-propanol,1-methylpropyl alcohol PubChem CID: 6568 ChEBI: CHEBI:35687 IUPAC Name: butan-2-ol SMILES: CCC(C)O
| PubChem CID | 6568 |
|---|---|
| CAS | 78-92-2 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35687 |
| MDL Number | MFCD00004569 |
| SMILES | CCC(C)O |
| Synonym | 2-butanol,sec-butanol,sec-butyl alcohol,2-hydroxybutane,2-butyl alcohol,s-butyl alcohol,butylene hydrate,s-butanol,1-methyl-1-propanol,1-methylpropyl alcohol |
| IUPAC Name | butan-2-ol |
| InChI Key | BTANRVKWQNVYAZ-UHFFFAOYNA-N |
| Molecular Formula | C4H10O |
Methyl sulfoxide, 99.7%, pure, Thermo Scientific Chemicals
CAS: 67-68-5 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00002089 InChI Key: IAZDPXIOMUYVGZ-UHFFFAOYSA-N Synonym: dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide PubChem CID: 679 ChEBI: CHEBI:28262 IUPAC Name: methylsulfinylmethane SMILES: CS(C)=O
| PubChem CID | 679 |
|---|---|
| CAS | 67-68-5 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:28262 |
| MDL Number | MFCD00002089 |
| SMILES | CS(C)=O |
| Synonym | dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide |
| IUPAC Name | methylsulfinylmethane |
| InChI Key | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
| Water | 0.1% max. (K.F.) |
|---|---|
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Density | 0.8670g/mL |
| Name Note | Stabilized with BHT |
| Percent Purity | ≥99% |
| Fieser | 01,267; 02,143; 16,229 |
| Infrared Spectrum | Authentic |
| pH | 6 to 7.5 (1:9) |
| Formula Weight | 90.12 |
| Melting Point | -69.0°C |
| Boiling Point | 84.0°C to 86.0°C |
| Physical Form | Liquid |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Pure |
| Merck Index | 15, 3245 |
| Assay Percent Range | 99+% |
| CAS | 128-37-0 |
| Health Hazard 3 | GHS P Statement: Obtain special instructions before use. IF exposed or concerned: Get medical advice/attention. Keep container tightly closed. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Health Hazard 2 | GHS H Statement: Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. May form explosive peroxides. |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Beilstein | 01, 467 |
| Specific Gravity | 0.867 |
1,1,2,2-Tetrachloroethane-d2, for NMR, 99.5+ atom% D
CAS: 33685-54-0 Molecular Formula: C2H2Cl4 Molecular Weight (g/mol): 169.85 MDL Number: MFCD00037672 InChI Key: QPFMBZIOSGYJDE-QDNHWIQGSA-N Synonym: 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d PubChem CID: 118531 IUPAC Name: 1,1,2,2-tetrachloro-1,2-dideuterioethane SMILES: C(C(Cl)Cl)(Cl)Cl
| PubChem CID | 118531 |
|---|---|
| CAS | 33685-54-0 |
| Molecular Weight (g/mol) | 169.85 |
| MDL Number | MFCD00037672 |
| SMILES | C(C(Cl)Cl)(Cl)Cl |
| Synonym | 1,1,2,2-tetrachloroethane-d2,1,2-dideutero-1,1,2,2-tetrachloroethane,tetrachloro 2 h? ethane,1,1,2,2-tetrachloroethane-d2 tce-d2,ethane-d2, 1,1,2,2-tetrachloro,ethane-1,2-d2, 1,1,2,2-tetrachloro,1,1,2,2-tetrachloro-1,2-2h2 ethane,de87d,1,1,2,2-tetrachloroethane-d2 >99.50 atom % d,1,1,2,2-tetrachloroethane-d2, ≥99.5 atom % d |
| IUPAC Name | 1,1,2,2-tetrachloro-1,2-dideuterioethane |
| InChI Key | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| Molecular Formula | C2H2Cl4 |
tert-Butyl methyl ether, 99%, pure
CAS: 1634-04-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00008812 InChI Key: BZLVMXJERCGZMT-UHFFFAOYSA-N Synonym: tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane PubChem CID: 15413 ChEBI: CHEBI:27642 IUPAC Name: 2-methoxy-2-methylpropane SMILES: CC(C)(C)OC
| PubChem CID | 15413 |
|---|---|
| CAS | 1634-04-4 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:27642 |
| MDL Number | MFCD00008812 |
| SMILES | CC(C)(C)OC |
| Synonym | tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane |
| IUPAC Name | 2-methoxy-2-methylpropane |
| InChI Key | BZLVMXJERCGZMT-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Carbon disulfide, ACS, 99.9+%
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 MDL Number: MFCD00011321 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| MDL Number | MFCD00011321 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
Chloroform-d, for NMR, 99.8 atom % D, stabilized with silver foil
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
Methanol, 99.9% min., OmniSolv™, MilliporeSigma™
CAS: 67-56-1 Molecular Formula: CH4O Molecular Weight (g/mol): 32.04 MDL Number: MFCD00004595 InChI Key: OKKJLVBELUTLKV-UHFFFAOYSA-N Synonym: methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit PubChem CID: 887 ChEBI: CHEBI:17790 IUPAC Name: methanol SMILES: CO
| PubChem CID | 887 |
|---|---|
| CAS | 67-56-1 |
| Molecular Weight (g/mol) | 32.04 |
| ChEBI | CHEBI:17790 |
| MDL Number | MFCD00004595 |
| SMILES | CO |
| Synonym | methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit |
| IUPAC Name | methanol |
| InChI Key | OKKJLVBELUTLKV-UHFFFAOYSA-N |
| Molecular Formula | CH4O |
Toluene, OmniSolv, MilliporeSigma™
CAS: 108-88-3 Molecular Formula: C7H8 Molecular Weight (g/mol): 92.14 MDL Number: MFCD00008512 InChI Key: YXFVVABEGXRONW-UHFFFAOYSA-N Synonym: methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene PubChem CID: 1140 ChEBI: CHEBI:17578 IUPAC Name: toluene SMILES: CC1=CC=CC=C1
| PubChem CID | 1140 |
|---|---|
| CAS | 108-88-3 |
| Molecular Weight (g/mol) | 92.14 |
| ChEBI | CHEBI:17578 |
| MDL Number | MFCD00008512 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene |
| IUPAC Name | toluene |
| InChI Key | YXFVVABEGXRONW-UHFFFAOYSA-N |
| Molecular Formula | C7H8 |
Carbon disulfide, HPLC Grade, 99.8+%
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 MDL Number: MFCD00011321 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| MDL Number | MFCD00011321 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |