Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
Methanol-d{4}, 99.8% (Isotopic), contains 0.05% v/v TMS
CAS: 811-98-3 Molecular Formula: CH4O Molecular Weight (g/mol): 36.066 MDL Number: MFCD00044637 InChI Key: OKKJLVBELUTLKV-MZCSYVLQSA-N Synonym: methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d PubChem CID: 71568 IUPAC Name: trideuterio(deuteriooxy)methane SMILES: CO
| PubChem CID | 71568 |
|---|---|
| CAS | 811-98-3 |
| Molecular Weight (g/mol) | 36.066 |
| MDL Number | MFCD00044637 |
| SMILES | CO |
| Synonym | methanol-d4,perdeuteromethanol,tetradeuteromethanol,methan-d3-ol-d,2h4 methanol,methyl alcohol-d4,cd3od,methyl-d3 alcohol-d,trideuterio deuteriooxy methane,methanol-d4, 99.8 atom % d |
| IUPAC Name | trideuterio(deuteriooxy)methane |
| InChI Key | OKKJLVBELUTLKV-MZCSYVLQSA-N |
| Molecular Formula | CH4O |
1,2-Dibromoethane-d{4}, 99%(Isotopic)
CAS: 22581-63-1 Molecular Formula: C2H4Br2 Molecular Weight (g/mol): 191.886 MDL Number: MFCD00037499 InChI Key: PAAZPARNPHGIKF-LNLMKGTHSA-N Synonym: 1,2-dibromoethane-d4,1,2-dibromo-1,1,2,2-2h4 ethane,dibromo 2 h? ethane,dibromoethane-d4,ethane-d4, 1,2-dibromo,ethylene-d4 dibromide,2h4-edb,tetradeutero-1,2-dibromoethane,1,2-dibromoethane-d4, 99 atom % d,1,2-dibromoethane-d4 99.0 atom % d PubChem CID: 123404 IUPAC Name: 1,2-dibromo-1,1,2,2-tetradeuterioethane SMILES: C(CBr)Br
| PubChem CID | 123404 |
|---|---|
| CAS | 22581-63-1 |
| Molecular Weight (g/mol) | 191.886 |
| MDL Number | MFCD00037499 |
| SMILES | C(CBr)Br |
| Synonym | 1,2-dibromoethane-d4,1,2-dibromo-1,1,2,2-2h4 ethane,dibromo 2 h? ethane,dibromoethane-d4,ethane-d4, 1,2-dibromo,ethylene-d4 dibromide,2h4-edb,tetradeutero-1,2-dibromoethane,1,2-dibromoethane-d4, 99 atom % d,1,2-dibromoethane-d4 99.0 atom % d |
| IUPAC Name | 1,2-dibromo-1,1,2,2-tetradeuterioethane |
| InChI Key | PAAZPARNPHGIKF-LNLMKGTHSA-N |
| Molecular Formula | C2H4Br2 |
n-Hexane-d{14}, 99%(Isotopic)
CAS: 21666-38-6 Molecular Formula: C6H14 Molecular Weight (g/mol): 100.26 MDL Number: MFCD00037562 InChI Key: VLKZOEOYAKHREP-ZLKPZJALSA-N Synonym: hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d PubChem CID: 140854 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]
| PubChem CID | 140854 |
|---|---|
| CAS | 21666-38-6 |
| Molecular Weight (g/mol) | 100.26 |
| MDL Number | MFCD00037562 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Synonym | hexane-d14,tetradecadeuterohexane,n-hexane-d 14,2h14 hexane,2 h?? hexane,hexane-d14, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane |
| InChI Key | VLKZOEOYAKHREP-ZLKPZJALSA-N |
| Molecular Formula | C6H14 |
Dimethyl sulfoxide-d6, 100% (Isotopic), Thermo Scientific Chemicals
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
3-Chloro-2-methylbenzeneboronic acid, 97%
CAS: 313545-20-9 Molecular Formula: C7H8BClO2 Molecular Weight (g/mol): 170.399 MDL Number: MFCD04115641 InChI Key: BJPNVVXTUYMJPN-UHFFFAOYSA-N Synonym: 3-chloro-2-methylphenyl boronic acid,2-borono-6-chlorotoluene,3-chloro-2-methylbenzeneboronic acid,3-chloro-2-methylphenyboronic acid,boronic acid, 3-chloro-2-methylphenyl,boronic acid,b-3-chloro-2-methylphenyl,3-chloro-2-methyl-phenyl boronic acid,acmc-209hls,3-chloro-2-methylphenboronic acid,3-chloro-2-methyl-phenylboronic acid PubChem CID: 3744103 IUPAC Name: (3-chloro-2-methylphenyl)boronic acid SMILES: B(C1=C(C(=CC=C1)Cl)C)(O)O
| PubChem CID | 3744103 |
|---|---|
| CAS | 313545-20-9 |
| Molecular Weight (g/mol) | 170.399 |
| MDL Number | MFCD04115641 |
| SMILES | B(C1=C(C(=CC=C1)Cl)C)(O)O |
| Synonym | 3-chloro-2-methylphenyl boronic acid,2-borono-6-chlorotoluene,3-chloro-2-methylbenzeneboronic acid,3-chloro-2-methylphenyboronic acid,boronic acid, 3-chloro-2-methylphenyl,boronic acid,b-3-chloro-2-methylphenyl,3-chloro-2-methyl-phenyl boronic acid,acmc-209hls,3-chloro-2-methylphenboronic acid,3-chloro-2-methyl-phenylboronic acid |
| IUPAC Name | (3-chloro-2-methylphenyl)boronic acid |
| InChI Key | BJPNVVXTUYMJPN-UHFFFAOYSA-N |
| Molecular Formula | C7H8BClO2 |
2-Bromo-4,6-dimethylaniline, 98%
CAS: 41825-73-4 Molecular Formula: C8H10BrN Molecular Weight (g/mol): 200.08 MDL Number: MFCD00047826 InChI Key: YOSJCQJJIHEUKA-UHFFFAOYSA-N Synonym: 2-bromo-4,6-dimethyl-aniline,6-bromo-2,4-xylidine,benzenamine, 2-bromo-4,6-dimethyl,2-bromo-4,6-dimethylphenylamine,4-amino-5-bromo-m-xylene,2-bromo-4,6-dimethylbenzenamine,2-bromo-4,6-dimethyl-phenylamine,2-amino-3,5-dimethyl-1-bromobenzene,pubchem3761 PubChem CID: 170579 IUPAC Name: 2-bromo-4,6-dimethylaniline SMILES: CC1=CC(C)=C(N)C(Br)=C1
| PubChem CID | 170579 |
|---|---|
| CAS | 41825-73-4 |
| Molecular Weight (g/mol) | 200.08 |
| MDL Number | MFCD00047826 |
| SMILES | CC1=CC(C)=C(N)C(Br)=C1 |
| Synonym | 2-bromo-4,6-dimethyl-aniline,6-bromo-2,4-xylidine,benzenamine, 2-bromo-4,6-dimethyl,2-bromo-4,6-dimethylphenylamine,4-amino-5-bromo-m-xylene,2-bromo-4,6-dimethylbenzenamine,2-bromo-4,6-dimethyl-phenylamine,2-amino-3,5-dimethyl-1-bromobenzene,pubchem3761 |
| IUPAC Name | 2-bromo-4,6-dimethylaniline |
| InChI Key | YOSJCQJJIHEUKA-UHFFFAOYSA-N |
| Molecular Formula | C8H10BrN |
4-Fluoro-2,6-dimethylaniline, 97%
CAS: 392-70-1 Molecular Formula: C8H10FN Molecular Weight (g/mol): 139.173 MDL Number: MFCD03792669 InChI Key: MPNDLCBMLBACDD-UHFFFAOYSA-N Synonym: 4-fluoro-2,6-dimethylphenylamine,2,6-dimethyl-4-fluoroaniline,acmc-20amil,pubchem4426,4-fluoro-2,6-dimethyl-aniline,4-fluoranyl-2,6-dimethyl-aniline,benzenamine,4-fluoro-2,6-dimethyl PubChem CID: 1403908 IUPAC Name: 4-fluoro-2,6-dimethylaniline SMILES: CC1=CC(=CC(=C1N)C)F
| PubChem CID | 1403908 |
|---|---|
| CAS | 392-70-1 |
| Molecular Weight (g/mol) | 139.173 |
| MDL Number | MFCD03792669 |
| SMILES | CC1=CC(=CC(=C1N)C)F |
| Synonym | 4-fluoro-2,6-dimethylphenylamine,2,6-dimethyl-4-fluoroaniline,acmc-20amil,pubchem4426,4-fluoro-2,6-dimethyl-aniline,4-fluoranyl-2,6-dimethyl-aniline,benzenamine,4-fluoro-2,6-dimethyl |
| IUPAC Name | 4-fluoro-2,6-dimethylaniline |
| InChI Key | MPNDLCBMLBACDD-UHFFFAOYSA-N |
| Molecular Formula | C8H10FN |
3-Nitro-o-xylene, 99%
CAS: 83-41-0 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.17 MDL Number: MFCD00007162 InChI Key: FVHAWXWFPBPFOS-UHFFFAOYSA-N Synonym: 3-nitro-o-xylene,2,3-dimethylnitrobenzene,nitroxylene,o-xylene, 3-nitro,benzene, 1,2-dimethyl-3-nitro,xylene, ar-nitro,benzene, dimethylnitro,unii-49gnx4cy5w,ccris 3117,49gnx4cy5w PubChem CID: 6739 IUPAC Name: 1,2-dimethyl-3-nitrobenzene SMILES: CC1=CC=CC(=C1C)[N+]([O-])=O
| PubChem CID | 6739 |
|---|---|
| CAS | 83-41-0 |
| Molecular Weight (g/mol) | 151.17 |
| MDL Number | MFCD00007162 |
| SMILES | CC1=CC=CC(=C1C)[N+]([O-])=O |
| Synonym | 3-nitro-o-xylene,2,3-dimethylnitrobenzene,nitroxylene,o-xylene, 3-nitro,benzene, 1,2-dimethyl-3-nitro,xylene, ar-nitro,benzene, dimethylnitro,unii-49gnx4cy5w,ccris 3117,49gnx4cy5w |
| IUPAC Name | 1,2-dimethyl-3-nitrobenzene |
| InChI Key | FVHAWXWFPBPFOS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
3-Chloro-alpha-toluenesulfonyl chloride, 96%
CAS: 24974-73-0 Molecular Formula: C7H6Cl2O2S Molecular Weight (g/mol): 225.083 MDL Number: MFCD02683111 InChI Key: LXTGNVLBPVVMSL-UHFFFAOYSA-N Synonym: 3-chlorophenyl methanesulfonyl chloride,3-chloro-phenyl-methanesulfonyl chloride,chloro 3-chlorophenyl methyl sulfone,benzenemethanesulfonyl chloride, 3-chloro,pubchem5501,acmc-20an5u,3-chlorobenzylsulfonyl chloride,3-chlorophenyl methanesulfonylchloride,benzenemethanesulfonylchloride,3-chloro,benzenemethanesulfonylchloride, 3-chloro PubChem CID: 2757802 IUPAC Name: (3-chlorophenyl)methanesulfonyl chloride SMILES: C1=CC(=CC(=C1)Cl)CS(=O)(=O)Cl
| PubChem CID | 2757802 |
|---|---|
| CAS | 24974-73-0 |
| Molecular Weight (g/mol) | 225.083 |
| MDL Number | MFCD02683111 |
| SMILES | C1=CC(=CC(=C1)Cl)CS(=O)(=O)Cl |
| Synonym | 3-chlorophenyl methanesulfonyl chloride,3-chloro-phenyl-methanesulfonyl chloride,chloro 3-chlorophenyl methyl sulfone,benzenemethanesulfonyl chloride, 3-chloro,pubchem5501,acmc-20an5u,3-chlorobenzylsulfonyl chloride,3-chlorophenyl methanesulfonylchloride,benzenemethanesulfonylchloride,3-chloro,benzenemethanesulfonylchloride, 3-chloro |
| IUPAC Name | (3-chlorophenyl)methanesulfonyl chloride |
| InChI Key | LXTGNVLBPVVMSL-UHFFFAOYSA-N |
| Molecular Formula | C7H6Cl2O2S |
3-Bromo-o-xylene, 99%
CAS: 576-23-8 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.06 MDL Number: MFCD00000069 InChI Key: WLPXNBYWDDYJTN-UHFFFAOYSA-N Synonym: 3-bromo-o-xylene,3-bromo-1,2-dimethylbenzene,2,3-dimethylbromobenzene,2,3-dimethyl bromobenzene,benzene, bromodimethyl,1-bromo-2,3-dimethyl-benzene,benzene, 1-bromo-2,3-dimethyl,bromoxilene,xylylbromid,bromo-o-xylene PubChem CID: 68472 IUPAC Name: 1-bromo-2,3-dimethylbenzene SMILES: CC1=CC=CC(Br)=C1C
| PubChem CID | 68472 |
|---|---|
| CAS | 576-23-8 |
| Molecular Weight (g/mol) | 185.06 |
| MDL Number | MFCD00000069 |
| SMILES | CC1=CC=CC(Br)=C1C |
| Synonym | 3-bromo-o-xylene,3-bromo-1,2-dimethylbenzene,2,3-dimethylbromobenzene,2,3-dimethyl bromobenzene,benzene, bromodimethyl,1-bromo-2,3-dimethyl-benzene,benzene, 1-bromo-2,3-dimethyl,bromoxilene,xylylbromid,bromo-o-xylene |
| IUPAC Name | 1-bromo-2,3-dimethylbenzene |
| InChI Key | WLPXNBYWDDYJTN-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
2-(3-Chlorophenyl)ethylboronic acid pinacol ester, 97%
CAS: 1315277-53-2 Molecular Formula: C14H20BClO2 Molecular Weight (g/mol): 266.572 MDL Number: MFCD12546188 InChI Key: WZAJMSPJXKZSTL-UHFFFAOYSA-N Synonym: 2-2-3-chlorophenyl ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenyl ethylboronic acid pinacol ester PubChem CID: 73995113 IUPAC Name: 2-[2-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)CCC2=CC(=CC=C2)Cl
| PubChem CID | 73995113 |
|---|---|
| CAS | 1315277-53-2 |
| Molecular Weight (g/mol) | 266.572 |
| MDL Number | MFCD12546188 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2=CC(=CC=C2)Cl |
| Synonym | 2-2-3-chlorophenyl ethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3-chlorophenyl ethylboronic acid pinacol ester |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | WZAJMSPJXKZSTL-UHFFFAOYSA-N |
| Molecular Formula | C14H20BClO2 |
1,4-Dioxane, HPLC Grade, 99% min, packaged under Argon in resealable ChemSeal™ bottles
CAS: 123-91-1 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00006571 InChI Key: RYHBNJHYFVUHQT-UHFFFAOYSA-N Synonym: dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin PubChem CID: 31275 ChEBI: CHEBI:47032 IUPAC Name: 1,4-dioxane SMILES: C1COCCO1
| PubChem CID | 31275 |
|---|---|
| CAS | 123-91-1 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:47032 |
| MDL Number | MFCD00006571 |
| SMILES | C1COCCO1 |
| Synonym | dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin |
| IUPAC Name | 1,4-dioxane |
| InChI Key | RYHBNJHYFVUHQT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Succinic anhydride, MilliporeSigma™
CAS: 108-30-5 Molecular Formula: C4H4O3 Molecular Weight (g/mol): 100.07 MDL Number: MFCD00005525 InChI Key: RINCXYDBBGOEEQ-UHFFFAOYSA-N Synonym: succinic anhydride,dihydrofuran-2,5-dione,succinic acid anhydride,succinyl oxide,2,5-diketotetrahydrofuran,dihydro-2,5-furandione,butanedioic anhydride,2,5-furandione, dihydro,succinyl anhydride,rikacid sa PubChem CID: 7922 ChEBI: CHEBI:36595 IUPAC Name: oxolane-2,5-dione SMILES: O=C1CCC(=O)O1
| PubChem CID | 7922 |
|---|---|
| CAS | 108-30-5 |
| Molecular Weight (g/mol) | 100.07 |
| ChEBI | CHEBI:36595 |
| MDL Number | MFCD00005525 |
| SMILES | O=C1CCC(=O)O1 |
| Synonym | succinic anhydride,dihydrofuran-2,5-dione,succinic acid anhydride,succinyl oxide,2,5-diketotetrahydrofuran,dihydro-2,5-furandione,butanedioic anhydride,2,5-furandione, dihydro,succinyl anhydride,rikacid sa |
| IUPAC Name | oxolane-2,5-dione |
| InChI Key | RINCXYDBBGOEEQ-UHFFFAOYSA-N |
| Molecular Formula | C4H4O3 |
Acetone-d{6}, 99.9% (Isotopic), contains 1% v/v TMS
CAS: 666-52-4 Molecular Formula: C3H6O Molecular Weight (g/mol): 64.117 MDL Number: MFCD00044635 InChI Key: CSCPPACGZOOCGX-WFGJKAKNSA-N Synonym: acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone PubChem CID: 522220 ChEBI: CHEBI:78217 IUPAC Name: 1,1,1,3,3,3-hexadeuteriopropan-2-one SMILES: CC(=O)C
| PubChem CID | 522220 |
|---|---|
| CAS | 666-52-4 |
| Molecular Weight (g/mol) | 64.117 |
| ChEBI | CHEBI:78217 |
| MDL Number | MFCD00044635 |
| SMILES | CC(=O)C |
| Synonym | acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone |
| IUPAC Name | 1,1,1,3,3,3-hexadeuteriopropan-2-one |
| InChI Key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Molecular Formula | C3H6O |
1-(4-Chlorophenyl)-3-buten-1-ol, 97%
CAS: 14506-33-3 Molecular Formula: C10H11ClO Molecular Weight (g/mol): 182.647 MDL Number: MFCD03427246 InChI Key: GJODRJDLQVBTMF-UHFFFAOYSA-N Synonym: 1-4-chlorophenyl-3-buten-1-ol,1-4-chlorophenyl but-3-en-1-ol,benzenemethanol,4-chloro-a-2-propen-1-yl,4-4-chlorophenyl-1-buten-4-ol,1-4-chloro-phenyl-but-3-en-1-ol,acmc-20apb1,4-chloro-alpha-allylbenzyl alcohol,4-4-chlorophenyl but-1-en-4-ol,1-4-chlorophenyl-but-3-en-1-ol PubChem CID: 2757771 IUPAC Name: 1-(4-chlorophenyl)but-3-en-1-ol SMILES: C=CCC(C1=CC=C(C=C1)Cl)O
| PubChem CID | 2757771 |
|---|---|
| CAS | 14506-33-3 |
| Molecular Weight (g/mol) | 182.647 |
| MDL Number | MFCD03427246 |
| SMILES | C=CCC(C1=CC=C(C=C1)Cl)O |
| Synonym | 1-4-chlorophenyl-3-buten-1-ol,1-4-chlorophenyl but-3-en-1-ol,benzenemethanol,4-chloro-a-2-propen-1-yl,4-4-chlorophenyl-1-buten-4-ol,1-4-chloro-phenyl-but-3-en-1-ol,acmc-20apb1,4-chloro-alpha-allylbenzyl alcohol,4-4-chlorophenyl but-1-en-4-ol,1-4-chlorophenyl-but-3-en-1-ol |
| IUPAC Name | 1-(4-chlorophenyl)but-3-en-1-ol |
| InChI Key | GJODRJDLQVBTMF-UHFFFAOYSA-N |
| Molecular Formula | C10H11ClO |