Solvents
Various organic solvents suitable for industrial, analytical, educational, medical, and research applications, including chromatography, chemical and organic syntheses, and purification processes. Products, including an extensive line of water products, an essential solvent for any laboratory, are available in a range of chemical compositions, quantities, purity levels, and reagent grades, and are curated to optimize your workflows.
Filtered Search Results
1,4-Dioxane, 99+%, stab. with ca 5-10ppm BHT
CAS: 123-91-1 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00006571 InChI Key: RYHBNJHYFVUHQT-UHFFFAOYSA-N Synonym: dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin PubChem CID: 31275 ChEBI: CHEBI:47032 IUPAC Name: 1,4-dioxane SMILES: C1COCCO1
| PubChem CID | 31275 |
|---|---|
| CAS | 123-91-1 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:47032 |
| MDL Number | MFCD00006571 |
| SMILES | C1COCCO1 |
| Synonym | dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin |
| IUPAC Name | 1,4-dioxane |
| InChI Key | RYHBNJHYFVUHQT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Bromobenzene-d{5}, 99% (Isotopic)
CAS: 4165-57-5 Molecular Formula: C6H5Br Molecular Weight (g/mol): 162.04 MDL Number: MFCD00000056 InChI Key: QARVLSVVCXYDNA-RALIUCGRSA-N Synonym: bromobenzene-d5,bromo 2h5 benzene,1-bromo 2 h? benzene,bromobenzene d5,benzene-d5, bromo,1-bromo 2h5 benzene,c6d5br,bromobenzene-d5, 99.5 atom % d,bromobenzene-d5, reagent grade, ≥99 atom % d cp PubChem CID: 2723968 SMILES: [2H]C1=C([2H])C([2H])=C(Br)C([2H])=C1[2H]
| PubChem CID | 2723968 |
|---|---|
| CAS | 4165-57-5 |
| Molecular Weight (g/mol) | 162.04 |
| MDL Number | MFCD00000056 |
| SMILES | [2H]C1=C([2H])C([2H])=C(Br)C([2H])=C1[2H] |
| Synonym | bromobenzene-d5,bromo 2h5 benzene,1-bromo 2 h? benzene,bromobenzene d5,benzene-d5, bromo,1-bromo 2h5 benzene,c6d5br,bromobenzene-d5, 99.5 atom % d,bromobenzene-d5, reagent grade, ≥99 atom % d cp |
| InChI Key | QARVLSVVCXYDNA-RALIUCGRSA-N |
| Molecular Formula | C6H5Br |
Chlorobenzene-d{5}, 99% (Isotopic), Thermo Scientific Chemicals
CAS: 3114-55-4 Molecular Formula: C6H5Cl Molecular Weight (g/mol): 117.587 MDL Number: MFCD00000531 InChI Key: MVPPADPHJFYWMZ-RALIUCGRSA-N Synonym: chlorobenzene-d5,chloro 2h5 benzene,1-chloro 2 h? benzene,chlorobenzene d5,benzene-d5, chloro,2h5 phenyl chloride,1-chloro 2h5 benzene,benzene-d5-, chloro,chlorobenzene, perdeutero,chlorobenzene-d5, 99 atom % d PubChem CID: 575975 IUPAC Name: 1-chloro-2,3,4,5,6-pentadeuteriobenzene SMILES: C1=CC=C(C=C1)Cl
| PubChem CID | 575975 |
|---|---|
| CAS | 3114-55-4 |
| Molecular Weight (g/mol) | 117.587 |
| MDL Number | MFCD00000531 |
| SMILES | C1=CC=C(C=C1)Cl |
| Synonym | chlorobenzene-d5,chloro 2h5 benzene,1-chloro 2 h? benzene,chlorobenzene d5,benzene-d5, chloro,2h5 phenyl chloride,1-chloro 2h5 benzene,benzene-d5-, chloro,chlorobenzene, perdeutero,chlorobenzene-d5, 99 atom % d |
| IUPAC Name | 1-chloro-2,3,4,5,6-pentadeuteriobenzene |
| InChI Key | MVPPADPHJFYWMZ-RALIUCGRSA-N |
| Molecular Formula | C6H5Cl |
Isopropyl Alcohol, 99%, USP, EP, BP, JP, FCC, ACS, bioCERTIFIED™, 5 gal., Spectrum Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 67-63-0 Molecular Weight (g/mol): 60.1
| CAS | 67-63-0 |
|---|---|
| Molecular Weight (g/mol) | 60.1 |
Diethyl ether, 99+%, pure, stabilized with BHT
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
| CAS | 67-64-1 |
|---|---|
| Molecular Weight (g/mol) | 58.08 |
Sodium borodeuteride, 99% (Isotopic)
CAS: 15681-89-7 Molecular Formula: BH4Na Molecular Weight (g/mol): 37.83 MDL Number: MFCD00003519 InChI Key: YOQDYZUWIQVZSF-UHFFFAOYSA-N Synonym: sodium borodeuteride,sodium tetradeuterioboron,sodium borohydride-d4,sodium 2h4 tetrahydroborate 1-,sulfatase,borate 1-, tetrahydro-d4-, sodium,nabd4,sodium 2h4 boranuide,deuterated sodium borohydride PubChem CID: 23673181 IUPAC Name: sodium boranuide SMILES: [BH4-].[Na+]
| PubChem CID | 23673181 |
|---|---|
| CAS | 15681-89-7 |
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003519 |
| SMILES | [BH4-].[Na+] |
| Synonym | sodium borodeuteride,sodium tetradeuterioboron,sodium borohydride-d4,sodium 2h4 tetrahydroborate 1-,sulfatase,borate 1-, tetrahydro-d4-, sodium,nabd4,sodium 2h4 boranuide,deuterated sodium borohydride |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
3,5-Dimethylbenzoic acid, 99%
CAS: 499-06-9 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002525 InChI Key: UMVOQQDNEYOJOK-UHFFFAOYSA-N Synonym: mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid PubChem CID: 10356 ChEBI: CHEBI:64821 IUPAC Name: 3,5-dimethylbenzoic acid SMILES: CC1=CC(=CC(=C1)C(=O)O)C
| PubChem CID | 10356 |
|---|---|
| CAS | 499-06-9 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64821 |
| MDL Number | MFCD00002525 |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C |
| Synonym | mesitylenic acid,benzoic acid, 3,5-dimethyl,unii-ed8av34n0y,3,5-dimethyl benzoic acid,3,5-dimethyl-benzoic acid,ed8av34n0y,3,5-dimethylbenzoicacid,pubchem15440,3,5-dimethylbezoic acid,3,5 dimethylbenzoic acid |
| IUPAC Name | 3,5-dimethylbenzoic acid |
| InChI Key | UMVOQQDNEYOJOK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Succinic Anhydride, 99%
CAS: 108-30-5 Molecular Formula: C4H4O3 Molecular Weight (g/mol): 100.07 MDL Number: MFCD00005525 InChI Key: RINCXYDBBGOEEQ-UHFFFAOYSA-N Synonym: succinic anhydride,dihydrofuran-2,5-dione,succinic acid anhydride,succinyl oxide,2,5-diketotetrahydrofuran,dihydro-2,5-furandione,butanedioic anhydride,2,5-furandione, dihydro,succinyl anhydride,rikacid sa PubChem CID: 7922 ChEBI: CHEBI:36595 IUPAC Name: oxolane-2,5-dione SMILES: O=C1CCC(=O)O1
| PubChem CID | 7922 |
|---|---|
| CAS | 108-30-5 |
| Molecular Weight (g/mol) | 100.07 |
| ChEBI | CHEBI:36595 |
| MDL Number | MFCD00005525 |
| SMILES | O=C1CCC(=O)O1 |
| Synonym | succinic anhydride,dihydrofuran-2,5-dione,succinic acid anhydride,succinyl oxide,2,5-diketotetrahydrofuran,dihydro-2,5-furandione,butanedioic anhydride,2,5-furandione, dihydro,succinyl anhydride,rikacid sa |
| IUPAC Name | oxolane-2,5-dione |
| InChI Key | RINCXYDBBGOEEQ-UHFFFAOYSA-N |
| Molecular Formula | C4H4O3 |
n-Heptane, 99+%, pure
CAS: 142-82-5 Molecular Formula: C7H16 Molecular Weight (g/mol): 100.21 MDL Number: MFCD00009544 InChI Key: IMNFDUFMRHMDMM-UHFFFAOYSA-N Synonym: n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish PubChem CID: 8900 ChEBI: CHEBI:43098 IUPAC Name: heptane SMILES: CCCCCCC
| PubChem CID | 8900 |
|---|---|
| CAS | 142-82-5 |
| Molecular Weight (g/mol) | 100.21 |
| ChEBI | CHEBI:43098 |
| MDL Number | MFCD00009544 |
| SMILES | CCCCCCC |
| Synonym | n-heptane,dipropylmethane,heptan,heptyl hydride,dipropyl methane,gettysolve-c,skellysolve c,heptanen,eptani,heptan polish |
| IUPAC Name | heptane |
| InChI Key | IMNFDUFMRHMDMM-UHFFFAOYSA-N |
| Molecular Formula | C7H16 |
3-Bromo-o-xylene, 99%, Thermo Scientific™
CAS: 576-23-8 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.06 MDL Number: MFCD00000069 InChI Key: WLPXNBYWDDYJTN-UHFFFAOYSA-N Synonym: 3-bromo-o-xylene,3-bromo-1,2-dimethylbenzene,2,3-dimethylbromobenzene,2,3-dimethyl bromobenzene,benzene, bromodimethyl,1-bromo-2,3-dimethyl-benzene,benzene, 1-bromo-2,3-dimethyl,bromoxilene,xylylbromid,bromo-o-xylene PubChem CID: 68472 IUPAC Name: 1-bromo-2,3-dimethylbenzene SMILES: CC1=CC=CC(Br)=C1C
| PubChem CID | 68472 |
|---|---|
| CAS | 576-23-8 |
| Molecular Weight (g/mol) | 185.06 |
| MDL Number | MFCD00000069 |
| SMILES | CC1=CC=CC(Br)=C1C |
| Synonym | 3-bromo-o-xylene,3-bromo-1,2-dimethylbenzene,2,3-dimethylbromobenzene,2,3-dimethyl bromobenzene,benzene, bromodimethyl,1-bromo-2,3-dimethyl-benzene,benzene, 1-bromo-2,3-dimethyl,bromoxilene,xylylbromid,bromo-o-xylene |
| IUPAC Name | 1-bromo-2,3-dimethylbenzene |
| InChI Key | WLPXNBYWDDYJTN-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
1-(4-Chlorophenyl)cyclopropanecarboxylic acid, 99%
CAS: 72934-37-3 Molecular Formula: C10H9ClO2 Molecular Weight (g/mol): 196.63 MDL Number: MFCD00001289 InChI Key: YAHLWSGIQJATGG-UHFFFAOYSA-N Synonym: 1-4-chlorophenyl cyclopropanecarboxylic acid,1-4-chlorophenyl cyclopropane-1-carboxylic acid,1-4-chlorophenyl-1-cyclopropanecarboxylic acid,cyclopropanecarboxylic acid, 1-4-chlorophenyl,1-p-chlorophenyl cyclopropanecarboxylic acid,acmc-209oos,1-4-chlorophenyl cyclopropanecarboxylicacid,1-4chloro-phenyl-cyclopropylcarboxylic acid,1-4-chloro-phenyl-cyclopropylcarboxylic acid PubChem CID: 98606 IUPAC Name: 1-(4-chlorophenyl)cyclopropane-1-carboxylic acid SMILES: C1CC1(C2=CC=C(C=C2)Cl)C(=O)O
| PubChem CID | 98606 |
|---|---|
| CAS | 72934-37-3 |
| Molecular Weight (g/mol) | 196.63 |
| MDL Number | MFCD00001289 |
| SMILES | C1CC1(C2=CC=C(C=C2)Cl)C(=O)O |
| Synonym | 1-4-chlorophenyl cyclopropanecarboxylic acid,1-4-chlorophenyl cyclopropane-1-carboxylic acid,1-4-chlorophenyl-1-cyclopropanecarboxylic acid,cyclopropanecarboxylic acid, 1-4-chlorophenyl,1-p-chlorophenyl cyclopropanecarboxylic acid,acmc-209oos,1-4-chlorophenyl cyclopropanecarboxylicacid,1-4chloro-phenyl-cyclopropylcarboxylic acid,1-4-chloro-phenyl-cyclopropylcarboxylic acid |
| IUPAC Name | 1-(4-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChI Key | YAHLWSGIQJATGG-UHFFFAOYSA-N |
| Molecular Formula | C10H9ClO2 |
n-Octane-d{18}, 99% (Isotopic)
CAS: 17252-77-6 Molecular Formula: C8H18 Molecular Weight (g/mol): 132.342 MDL Number: MFCD00037626 InChI Key: TVMXDCGIABBOFY-VAZJTQEUSA-N Synonym: octane-d18,2h18 octane,n-octane-d18,2 h?? octane,octane-d18, 98 atom % d,n-octane-d isotopic 1g PubChem CID: 519375 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecadeuteriooctane SMILES: CCCCCCCC
| PubChem CID | 519375 |
|---|---|
| CAS | 17252-77-6 |
| Molecular Weight (g/mol) | 132.342 |
| MDL Number | MFCD00037626 |
| SMILES | CCCCCCCC |
| Synonym | octane-d18,2h18 octane,n-octane-d18,2 h?? octane,octane-d18, 98 atom % d,n-octane-d isotopic 1g |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecadeuteriooctane |
| InChI Key | TVMXDCGIABBOFY-VAZJTQEUSA-N |
| Molecular Formula | C8H18 |
N,N-Dimethylacetamide-d{9}, 99% (Isotopic)
CAS: 116057-81-9 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00066061 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: n,n-dimethylacetamide-d9,n,n-bis ∼2∼h_3_ methyl ∼2∼h_3_ acetamide,an,n-dimethylacetamide-d9,n,n-dimethylacetamide-d9, 99 atom % d,n,n-bis 2 h? methyl 2 h? acetamide,n,n-di 2 h? methyl 2 h? acetamide PubChem CID: 22789542 SMILES: CN(C)C(C)=O
| PubChem CID | 22789542 |
|---|---|
| CAS | 116057-81-9 |
| Molecular Weight (g/mol) | 87.12 |
| MDL Number | MFCD00066061 |
| SMILES | CN(C)C(C)=O |
| Synonym | n,n-dimethylacetamide-d9,n,n-bis ∼2∼h_3_ methyl ∼2∼h_3_ acetamide,an,n-dimethylacetamide-d9,n,n-dimethylacetamide-d9, 99 atom % d,n,n-bis 2 h? methyl 2 h? acetamide,n,n-di 2 h? methyl 2 h? acetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
(S)-(+)-3-Hydroxytetrahydrofuran, 99%
CAS: 86087-23-2 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.11 MDL Number: MFCD00064327 InChI Key: XDPCNPCKDGQBAN-BYPYZUCNSA-N Synonym: s-+-3-hydroxytetrahydrofuran,s-tetrahydrofuran-3-ol,s-3-hydroxytetrahydrofuran,3s-oxolan-3-ol,s-+-tetrahydro-3-furanol,s-tetrahydro-3-furanol,s-+-tetrahyro-3-furanol,3s-tetrahydrofuran-3-ol,s-tetrahydro-furan-3-ol,3-furanol, tetrahydro-, 3s PubChem CID: 2733227 IUPAC Name: (3S)-oxolan-3-ol SMILES: C1COCC1O
| PubChem CID | 2733227 |
|---|---|
| CAS | 86087-23-2 |
| Molecular Weight (g/mol) | 88.11 |
| MDL Number | MFCD00064327 |
| SMILES | C1COCC1O |
| Synonym | s-+-3-hydroxytetrahydrofuran,s-tetrahydrofuran-3-ol,s-3-hydroxytetrahydrofuran,3s-oxolan-3-ol,s-+-tetrahydro-3-furanol,s-tetrahydro-3-furanol,s-+-tetrahyro-3-furanol,3s-tetrahydrofuran-3-ol,s-tetrahydro-furan-3-ol,3-furanol, tetrahydro-, 3s |
| IUPAC Name | (3S)-oxolan-3-ol |
| InChI Key | XDPCNPCKDGQBAN-BYPYZUCNSA-N |
| Molecular Formula | C4H8O2 |