Organic oxoazanium compounds
![eMolecules 86156-93-6 | 3-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Ambeed | MFCD03412240 | 239.600 | C6H3ClFNO4S | 95.000 | [O-][N+](=O)c1ccc(cc1F)S(Cl)(=O)=O | 1g | 570996422](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000489283.jpg-250.jpg)
eMolecules 86156-93-6 | 3-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Ambeed | MFCD03412240 | 239.600 | C6H3ClFNO4S | 95.000 | [O-][N+](=O)c1ccc(cc1F)S(Cl)(=O)=O | 1g | 570996422
3-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Ambeed | 86156-93-6 | MFCD03412240 | 239.600 | C6H3ClFNO4S | 95.000 | [O-][N+](=O)c1ccc(cc1F)S(Cl)(=O)=O | 1g | 570996422
![eMolecules 1146290-36-9 | 2-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Combi-Blocks, Inc. | MFCD11858095 | 239.600 | C6H3ClFNO4S | 97.000 | [O-][N+](=O)c1ccc(c(F)c1)S(Cl)(=O)=O | 5g | 586076922](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159125.jpg-250.jpg)
eMolecules 1146290-36-9 | 2-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Combi-Blocks, Inc. | MFCD11858095 | 239.600 | C6H3ClFNO4S | 97.000 | [O-][N+](=O)c1ccc(c(F)c1)S(Cl)(=O)=O | 5g | 586076922
2-Fluoro-4-nitrobenzene-1-sulfonyl chloride | Combi-Blocks, Inc. | 1146290-36-9 | MFCD11858095 | 239.600 | C6H3ClFNO4S | 97.000 | [O-][N+](=O)c1ccc(c(F)c1)S(Cl)(=O)=O | 5g | 586076922
eMolecules 89791-96-8 | 5-Methyl-3-nitrobenzene-1,2-diol | 100mg
Ambeed | 5-Methyl-3-nitrobenzene-1,2-diol | 100mg | 602849177 | A1151457 | 89791-96-8 | 169.136 | C7H7NO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aobchem 4-Bromo-1-ethyl-2-nitrobenzene | ≥97% | CAS 10342-66-2 | C8H8BrNO2 | 1g
4-Bromo-1-ethyl-2-nitrobenzene | ≥97% | CAS 10342-66-2 | C8H8BrNO2 | 1g
Aobchem 2 4 6-Trichlorobenzonitrile | ≥97% | CAS 6575-05-9 | C7H2Cl3N | 25g
2 4 6-Trichlorobenzonitrile | ≥97% | CAS 6575-05-9 | C7H2Cl3N | 25g
Aobchem 1 2 5-Trichloro-3-nitrobenzene | ≥97% | CAS 34283-94-8 | C6H2Cl3NO2 | 10g
1 2 5-Trichloro-3-nitrobenzene | ≥97% | CAS 34283-94-8 | C6H2Cl3NO2 | 10g
Sigma Aldrich Fine Chemicals Biosciences 1-Fluoro-2,4-dinitrobenzene for HPLC derivatization, LiChropur(TM), >=99.0% (GC) | 70-34-8 | MFCD00007056 | 1G
1-Fluoro-2,4-dinitrobenzene for HPLC derivatization, LiChropur(TM), >=99.0% (GC) | Purity: >=99.0% (GC) | Mol Wt: 186.1 | 70-34-8 | MFCD00007056 | 1G
Sigma Aldrich Fine Chemicals Biosciences 1-Nitropropane >=98.5% | 108-03-2 | MFCD00007407 | 100ML
1-Nitropropane >=98.5% | Purity: >=98.5% | Mol Wt: 89.09 | 108-03-2 | MFCD00007407 | 100ML
Sigma Aldrich Fine Chemicals Biosciences Thimet Oligopeptidase from Bacillus licheniformis | 100UN
Thimet Oligopeptidase from Bacillus licheniformis | 100UN
Chem-Impex International, Inc. 4-Nitrobenzyl chloroformate | MFCD00007375 | 25G
4-Nitrobenzyl chloroformate, MFCD00007375, 25G
Sigma Aldrich Fine Chemicals Biosciences 1 Fluoro 24 dinitrobenzene
1-Fluoro-2 4-dinitrobenzene (DNFB) is a reagent that modifies the N-terminal amino acids of proteins and peptides. DNFB is also commonly known as Sangerprimes Reagent named after Frederick Sanger who reported in a classic 1945 paper the use of DNFB for derivatization of proteins and peptides specifically at their N-termini.x2020
Chem-Impex International, Inc. 5-Nitroindole | 6146-52-7 | MFCD00005673 | 25G
5-Nitroindole, 6146-52-7, MFCD00005673, 25G
Sigma Aldrich Fine Chemicals Biosciences 5-Bromo-3-nitropyridine-2-carbonitrile 95% | Purity: 95% | Mol Wt: 228 | 573675-25-9 | MFCD06657551 | 25G
5-Bromo-3-nitropyridine-2-carbonitrile 95% | Purity: 95% | Mol Wt: 228 | 573675-25-9 | MFCD06657551 | 25G
Sigma Aldrich Fine Chemicals Biosciences Nitrobenzene-13C6 99 atom % 13C | 89059-37-0 | MFCD00144924 | 500MG
Nitrobenzene-13C6 99 atom % 13C | Purity: 99% (CP) | Mol Wt: 129.07 | 89059-37-0 | MFCD00144924 | 500MG
Aobchem 1-Bromo-4-ethoxy-2-nitrobenzene | 95% | CAS 139085-95-3 | C8H8BrNO3 | 250mg
1-Bromo-4-ethoxy-2-nitrobenzene | 95% | CAS 139085-95-3 | C8H8BrNO3 | 250mg