Organolead
Aobchem Methyl 3 4-difluoro-2-isopropoxybenzoate | 97% | CAS 2110176-82-2 | C11H12F2O3 | 250mg
Methyl 3 4-difluoro-2-isopropoxybenzoate | 97% | CAS 2110176-82-2 | C11H12F2O3 | 250mg
![eMolecules 286-22-6 | 3,7-Dioxabicyclo[4.1.0]heptane | Apollo Scientific | MFCD11226853 | 100.117 | C5H8O2 | 95.000 | C1CC2OC2CO1 | 1g | 600856287](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000158778.jpg-250.jpg)
eMolecules 286-22-6 | 3,7-Dioxabicyclo[4.1.0]heptane | Apollo Scientific | MFCD11226853 | 100.117 | C5H8O2 | 95.000 | C1CC2OC2CO1 | 1g | 600856287
3,7-Dioxabicyclo[4.1.0]heptane | Apollo Scientific | 286-22-6 | MFCD11226853 | 100.117 | C5H8O2 | 95.000 | C1CC2OC2CO1 | 1g | 600856287
Cayman Chemical 5 S 6 R7trihydroxymethyl Hept
A potent bioactive analog of lipoxin A4; inhibits LTB4-induced chemotaxis of PMNs (IC50 = 5 nM)
Cayman Chemical 5 S 6 R7trihydroxymethyl Hept
A potent bioactive analog of lipoxin A4; inhibits LTB4-induced chemotaxis of PMNs (IC50 = 5 nM)
eMolecules 1172446-48-8 | ChemScene | Ethyl 3-amino-4-isopropoxybenzoate | 100mg | 714264899 | CS-0348052 | MFCD13967254 | 223.272 | C12H17NO3
ChemScene | (S)-4-Bromo-23-dihydro-1H-inden-1-amine | 100mg | 569144518 | CS-0054965 | 1228570-71-5 | MFCD07373952 | 212.090 | C9H10BrN
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1087798-38-6 | 6-(Boc-amino)spiro[3.3]heptane-2-carboxylic acid | J & W PharmLab LLC | MFCD11099888 | 255.314 | C13H21NO4 | 96.000 | CC(C)(C)OC(=O)NC1CC2(C1)CC(C2)C(O)=O | 1g | 525292221
6-(Boc-amino)spiro[3.3]heptane-2-carboxylic acid | J & W PharmLab LLC | 1087798-38-6 | MFCD11099888 | 255.314 | C13H21NO4 | 96.000 | CC(C)(C)OC(=O)NC1CC2(C1)CC(C2)C(O)=O | 1g | 525292221
Aobchem Methyl 3 5-dichloro-4-isopropoxybenzoate | ≥97% | CAS 856165-88-3 | C11H12Cl2O3 | 5g
Methyl 3 5-dichloro-4-isopropoxybenzoate | ≥97% | CAS 856165-88-3 | C11H12Cl2O3 | 5g
Thermo Scientific Chemicals Lead(II) niobium(V) 2-ethylhexanoate decaethoxide, 99% (metals basis), 10% w/v in ethanol, Thermo Scientific™
MDL Number: MFCD00171335 Synonym: Lead(II) niobium(V) 2-ethylhexano-ethoxide