Organic Acids
eMolecules 65-85-0 | Benzoic acid | Chem-Impex | MFCD00002398 | 122.123 | C7H6O2 | 99.000 | OC(=O)c1ccccc1 | 1kg | 603114504
Benzoic acid | Chem-Impex | 65-85-0 | MFCD00002398 | 122.123 | C7H6O2 | 99.000 | OC(=O)c1ccccc1 | 1kg | 603114504
Medchemexpress LLC Benzoic anhydride | 93-97-0 | MFCD00003073 | 1mL
Benzoic anhydride is a catalyst that can be used for organic synthesis reactions Benzoic anhydride is used as a chemical titration reagent for selective quantification and deactivation of phenolic hydroxyl groups on the surface of carbon nanotubes[1][2]
Aobchem Benzoic acid 3-(2-fluoroethoxy)- | ≥97% | CAS 1365939-11-2 | C9H9FO3 | 250mg
Benzoic acid 3-(2-fluoroethoxy)- | ≥97% | CAS 1365939-11-2 | C9H9FO3 | 250mg
Aobchem Benzoic acid 3-(2-fluoroethoxy)- | ≥97% | CAS 1365939-11-2 | C9H9FO3 | 1g
Benzoic acid 3-(2-fluoroethoxy)- | ≥97% | CAS 1365939-11-2 | C9H9FO3 | 1g
eMolecules 65-85-0 | Benzoic acid | Chem-Impex | MFCD00002398 | 122.123 | C7H6O2 | 99.000 | OC(=O)c1ccccc1 | 1kg | 490847745
Benzoic acid | Chem-Impex | 65-85-0 | MFCD00002398 | 122.123 | C7H6O2 | 99.000 | OC(=O)c1ccccc1 | 1kg | 490847745
Aobchem 3-(Phenoxymethyl)benzoic acid | ≥95% | CAS 31719-75-2 | C14H12O3 | 500mg
3-(Phenoxymethyl)benzoic acid | ≥95% | CAS 31719-75-2 | C14H12O3 | 500mg
eMolecules 65-85-0 | Benzoic acid | Chem-Impex | MFCD00002398 | 122.123 | C7H6O2 | 99.000 | OC(=O)c1ccccc1 | 100g | 490847743
Benzoic acid | Chem-Impex | 65-85-0 | MFCD00002398 | 122.123 | C7H6O2 | 99.000 | OC(=O)c1ccccc1 | 100g | 490847743
Aobchem 3-(Diphenylamino)benzoic acid | 95% | CAS 14377-15-2 | C19H15NO2 | 1g
3-(Diphenylamino)benzoic acid | 95% | CAS 14377-15-2 | C19H15NO2 | 1g
Aobchem 3-(Isopropylthio)benzoic acid | ≥95% | CAS 114838-12-9 | C10H12O2S | 1g
3-(Isopropylthio)benzoic acid | ≥95% | CAS 114838-12-9 | C10H12O2S | 1g
Aobchem 3-(Isopropylthio)benzoic acid | ≥95% | CAS 114838-12-9 | C10H12O2S | 250mg
3-(Isopropylthio)benzoic acid | ≥95% | CAS 114838-12-9 | C10H12O2S | 250mg
Aobchem 4-(Isopropylthio)benzoic acid | ≥95% | CAS 13205-50-0 | C10H12O2S | 1g
4-(Isopropylthio)benzoic acid | ≥95% | CAS 13205-50-0 | C10H12O2S | 1g
Apexbio Technology LLC 2-hydroxymethyl-benzoic-acid
2-hydroxymethyl benzoic acid (CAS No 612-20-4) is an important compound in biomedical research particularly within the fields of pharmacology and medicinal chemistry Originating from the salicylic acid family this compound targets specific biochemical pathways including those involved in inflammation and pain modulation It exhibits common in vitro activity within the nanomolar to low micromolar range making it effective for study in various experimental models In cell models it is utilized to assess anti-inflammatory properties and pain-relief potential often serving as a reference substance in drug screening assays In animal studies it aids in the exploration of therapeutic effects and toxicity profiles contributing valuable insights for preclinical evaluations Experimental concentrations typically depend on the specific research design allowing for flexibility in its application across diverse experimental settings
Apexbio Technology LLC Benzoic acid lithium 553-54-8 200g
Lithium benzoate (553-54-8) is a small-molecule inhibitor It exerts its biological activity primarily through disruption of microbial cell membrane integrity and inhibition of microbial enzyme function In in vitro studies lithium benzoate demonstrates antimicrobial activity with reported inhibitory concentrations (IC50) ranging from micromolar to millimolar against common microbial strains depending on organism sensitivity and experimental conditions Based on these pharmacological properties lithium benzoate holds research potential in pharmacological formulation development cell culture medium preservation and microbial contamination control studies in biomedical laboratories
C(O)=O | 0.1g | 771345948](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502464603.JPG-250.jpg)
eMolecules 1276055-49-2 | (S)-2-(AMINOMETHYL)-4-METHYLPENTANOIC ACID-HCL | AstaTech | MFCD12198201 | 181.660 | C7H16ClNO2 | 99.000 | Cl.CC(C)C[C@@H](CN)C(O)=O | 0.1g | 771345948
(S)-2-(AMINOMETHYL)-4-METHYLPENTANOIC ACID-HCL | AstaTech | 1276055-49-2 | MFCD12198201 | 181.660 | C7H16ClNO2 | 99.000 | Cl.CC(C)C[C@@H](CN)C(O)=O | 0.1g | 771345948