Alkyl Halides
Filtered Search Results
Heptafluorobutyric acid, 99%
CAS: 375-22-4 Molecular Formula: C4HF7O2 Molecular Weight (g/mol): 214.039 MDL Number: MFCD00004171 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Synonym: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| PubChem CID | 9777 |
|---|---|
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.039 |
| ChEBI | CHEBI:39426 |
| MDL Number | MFCD00004171 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| Synonym | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Molecular Formula | C4HF7O2 |
Bromoform, 96%, stab. with ethanol
CAS: 75-25-2 Molecular Formula: CHBr3 Molecular Weight (g/mol): 252.731 MDL Number: MFCD00000128 InChI Key: DIKBFYAXUHHXCS-UHFFFAOYSA-N Synonym: tribromomethane,methane, tribromo,tribrommethan,methenyl tribromide,methyl tribromide,tribrommethaan,tribromometan,bromoforme,bromoformio,rcra waste number u225 PubChem CID: 5558 ChEBI: CHEBI:38682 IUPAC Name: bromoform SMILES: C(Br)(Br)Br
| PubChem CID | 5558 |
|---|---|
| CAS | 75-25-2 |
| Molecular Weight (g/mol) | 252.731 |
| ChEBI | CHEBI:38682 |
| MDL Number | MFCD00000128 |
| SMILES | C(Br)(Br)Br |
| Synonym | tribromomethane,methane, tribromo,tribrommethan,methenyl tribromide,methyl tribromide,tribrommethaan,tribromometan,bromoforme,bromoformio,rcra waste number u225 |
| IUPAC Name | bromoform |
| InChI Key | DIKBFYAXUHHXCS-UHFFFAOYSA-N |
| Molecular Formula | CHBr3 |
Perfluoropentanoic acid, 97%
CAS: 2706-90-3 Molecular Formula: C5HF9O2 Molecular Weight (g/mol): 264.05 MDL Number: MFCD00040211 InChI Key: CXZGQIAOTKWCDB-UHFFFAOYSA-N Synonym: perfluoropentanoic acid,perfluorovaleric acid,nonafluoropentanoic acid,nonafluorovaleric acid,pentanoic acid, nonafluoro,nonafluoro-1-pentanoic acid,valeric acid, nonafluoro,n-perfluoropentanoic acid,perfluoro-n-pentanoic acid,2,2,3,3,4,4,5,5,5-nonafluoro-pentanoic acid PubChem CID: 75921 ChEBI: CHEBI:83491 IUPAC Name: 2,2,3,3,4,4,5,5,5-nonafluoropentanoic acid SMILES: OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 75921 |
|---|---|
| CAS | 2706-90-3 |
| Molecular Weight (g/mol) | 264.05 |
| ChEBI | CHEBI:83491 |
| MDL Number | MFCD00040211 |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | perfluoropentanoic acid,perfluorovaleric acid,nonafluoropentanoic acid,nonafluorovaleric acid,pentanoic acid, nonafluoro,nonafluoro-1-pentanoic acid,valeric acid, nonafluoro,n-perfluoropentanoic acid,perfluoro-n-pentanoic acid,2,2,3,3,4,4,5,5,5-nonafluoro-pentanoic acid |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoropentanoic acid |
| InChI Key | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| Molecular Formula | C5HF9O2 |
Bromocyclopentane, 98+%
CAS: 137-43-9 Molecular Formula: C5H9Br Molecular Weight (g/mol): 149.031 MDL Number: MFCD00001359 InChI Key: BRTFVKHPEHKBQF-UHFFFAOYSA-N Synonym: cyclopentyl bromide,cyclopentylbromide,cyclopentane, bromo,bromo cyclopentane,bromo-cyclopentane,bromocyclopentan,cylopentylbromide,cyclopentyl-bromide,sfphabilimup@,4-bromocyclopentane PubChem CID: 8728 IUPAC Name: bromocyclopentane SMILES: C1CCC(C1)Br
| PubChem CID | 8728 |
|---|---|
| CAS | 137-43-9 |
| Molecular Weight (g/mol) | 149.031 |
| MDL Number | MFCD00001359 |
| SMILES | C1CCC(C1)Br |
| Synonym | cyclopentyl bromide,cyclopentylbromide,cyclopentane, bromo,bromo cyclopentane,bromo-cyclopentane,bromocyclopentan,cylopentylbromide,cyclopentyl-bromide,sfphabilimup@,4-bromocyclopentane |
| IUPAC Name | bromocyclopentane |
| InChI Key | BRTFVKHPEHKBQF-UHFFFAOYSA-N |
| Molecular Formula | C5H9Br |
1-Bromo-3-methylbutane, 98%
CAS: 107-82-4 Molecular Formula: C5H11Br Molecular Weight (g/mol): 151.05 MDL Number: MFCD00000253 InChI Key: YXZFFTJAHVMMLF-UHFFFAOYSA-N Synonym: isoamyl bromide,isopentyl bromide,butane, 1-bromo-3-methyl,3-methylbutyl bromide,4-bromo-2-methylbutane,isobutylmethyl bromide,isopentylbromide,1-bromo-3-methyl-butane,iso-pentyl bromide,unii-czm50594qa PubChem CID: 7891 IUPAC Name: 1-bromo-3-methylbutane SMILES: CC(C)CCBr
| PubChem CID | 7891 |
|---|---|
| CAS | 107-82-4 |
| Molecular Weight (g/mol) | 151.05 |
| MDL Number | MFCD00000253 |
| SMILES | CC(C)CCBr |
| Synonym | isoamyl bromide,isopentyl bromide,butane, 1-bromo-3-methyl,3-methylbutyl bromide,4-bromo-2-methylbutane,isobutylmethyl bromide,isopentylbromide,1-bromo-3-methyl-butane,iso-pentyl bromide,unii-czm50594qa |
| IUPAC Name | 1-bromo-3-methylbutane |
| InChI Key | YXZFFTJAHVMMLF-UHFFFAOYSA-N |
| Molecular Formula | C5H11Br |
Bromomethyl acetate, 95%
CAS: 590-97-6 Molecular Formula: C3H5BrO2 Molecular Weight (g/mol): 152.98 MDL Number: MFCD00000170 InChI Key: NHYXMAKLBXBVEO-UHFFFAOYSA-N Synonym: bromomethanol acetate,methanol, bromo-, acetate,acetic acid bromomethyl ester,acetoxymethyl bromide,methanol, 1-bromo-, 1-acetate,brommethylacetat,acetoxymethylbromid,bromo-methyl acetate,acmc-20aljy,1-bromomethyl acetate PubChem CID: 68536 IUPAC Name: bromomethyl acetate SMILES: CC(=O)OCBr
| PubChem CID | 68536 |
|---|---|
| CAS | 590-97-6 |
| Molecular Weight (g/mol) | 152.98 |
| MDL Number | MFCD00000170 |
| SMILES | CC(=O)OCBr |
| Synonym | bromomethanol acetate,methanol, bromo-, acetate,acetic acid bromomethyl ester,acetoxymethyl bromide,methanol, 1-bromo-, 1-acetate,brommethylacetat,acetoxymethylbromid,bromo-methyl acetate,acmc-20aljy,1-bromomethyl acetate |
| IUPAC Name | bromomethyl acetate |
| InChI Key | NHYXMAKLBXBVEO-UHFFFAOYSA-N |
| Molecular Formula | C3H5BrO2 |
Heptafluorobutyric Acid, 99.6%, MP Biomedicals™
CAS: 375-22-4 Molecular Formula: C4HF7O2 Molecular Weight (g/mol): 214.039 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Synonym: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| PubChem CID | 9777 |
|---|---|
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.039 |
| ChEBI | CHEBI:39426 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| Synonym | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Molecular Formula | C4HF7O2 |
Bromomethyl acetate, 95%
CAS: 590-97-6 Molecular Formula: C3H5BrO2 Molecular Weight (g/mol): 152.98 MDL Number: MFCD00000170 InChI Key: NHYXMAKLBXBVEO-UHFFFAOYSA-N Synonym: bromomethanol acetate,methanol, bromo-, acetate,acetic acid bromomethyl ester,acetoxymethyl bromide,methanol, 1-bromo-, 1-acetate,brommethylacetat,acetoxymethylbromid,bromo-methyl acetate,acmc-20aljy,1-bromomethyl acetate PubChem CID: 68536 IUPAC Name: bromomethyl acetate SMILES: CC(=O)OCBr
| PubChem CID | 68536 |
|---|---|
| CAS | 590-97-6 |
| Molecular Weight (g/mol) | 152.98 |
| MDL Number | MFCD00000170 |
| SMILES | CC(=O)OCBr |
| Synonym | bromomethanol acetate,methanol, bromo-, acetate,acetic acid bromomethyl ester,acetoxymethyl bromide,methanol, 1-bromo-, 1-acetate,brommethylacetat,acetoxymethylbromid,bromo-methyl acetate,acmc-20aljy,1-bromomethyl acetate |
| IUPAC Name | bromomethyl acetate |
| InChI Key | NHYXMAKLBXBVEO-UHFFFAOYSA-N |
| Molecular Formula | C3H5BrO2 |
3-Bromo-2-(bromomethyl)propionic acid, 98%
CAS: 41459-42-1 Molecular Formula: C4H5Br2O2 Molecular Weight (g/mol): 244.89 MDL Number: MFCD00010643 InChI Key: QQZJWQCLWOQDQV-UHFFFAOYSA-M Synonym: 3-bromo-2-bromomethyl propionic acid,3-bromo-2-bromomethyl propanoic acid,propanoic acid, 3-bromo-2-bromomethyl,.beta.,.beta.-dibromoisobutyric acid,3-bromo-2-bromomethyl propionicacid,bis bromomethyl acetic acid,zlchem 161,acmc-209jkh,beta,beta'-dibromoisobutyric acid,2-bromomethyl-3-bromopropanoic acid PubChem CID: 318915 IUPAC Name: 3-bromo-2-(bromomethyl)propanoic acid SMILES: [O-]C(=O)C(CBr)CBr
| PubChem CID | 318915 |
|---|---|
| CAS | 41459-42-1 |
| Molecular Weight (g/mol) | 244.89 |
| MDL Number | MFCD00010643 |
| SMILES | [O-]C(=O)C(CBr)CBr |
| Synonym | 3-bromo-2-bromomethyl propionic acid,3-bromo-2-bromomethyl propanoic acid,propanoic acid, 3-bromo-2-bromomethyl,.beta.,.beta.-dibromoisobutyric acid,3-bromo-2-bromomethyl propionicacid,bis bromomethyl acetic acid,zlchem 161,acmc-209jkh,beta,beta'-dibromoisobutyric acid,2-bromomethyl-3-bromopropanoic acid |
| IUPAC Name | 3-bromo-2-(bromomethyl)propanoic acid |
| InChI Key | QQZJWQCLWOQDQV-UHFFFAOYSA-M |
| Molecular Formula | C4H5Br2O2 |
Heptafluorobutyric anhydride, 98%
CAS: 336-59-4 Molecular Formula: C8F14O3 Molecular Weight (g/mol): 410.06 MDL Number: MFCD00000432 InChI Key: UFFSXJKVKBQEHC-UHFFFAOYSA-N Synonym: heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization PubChem CID: 67643 ChEBI: CHEBI:39424 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate SMILES: FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 67643 |
|---|---|
| CAS | 336-59-4 |
| Molecular Weight (g/mol) | 410.06 |
| ChEBI | CHEBI:39424 |
| MDL Number | MFCD00000432 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChI Key | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
| Molecular Formula | C8F14O3 |
4-Nitrophenethyl bromide, 98%
CAS: 5339-26-4 Molecular Formula: C8H8BrNO2 Molecular Weight (g/mol): 230.06 MDL Number: MFCD00007386 InChI Key: NTURQZFFJDCTMZ-UHFFFAOYSA-N Synonym: 4-nitrophenethyl bromide,1-2-bromoethyl-4-nitrobenzene,benzene, 1-2-bromoethyl-4-nitro,4-nitrophenethylbromide,p-nitrophenethyl bromide,2-4-nitrophenyl ethyl bromide,4-2-bromoethyl nitrobenzene,4-nitrophenylethyl bromide,.beta.-p-nitrophenyl ethyl bromide,phenethylbromide4nitro PubChem CID: 79266 IUPAC Name: 1-(2-bromoethyl)-4-nitrobenzene SMILES: C1=CC(=CC=C1CCBr)[N+](=O)[O-]
| PubChem CID | 79266 |
|---|---|
| CAS | 5339-26-4 |
| Molecular Weight (g/mol) | 230.06 |
| MDL Number | MFCD00007386 |
| SMILES | C1=CC(=CC=C1CCBr)[N+](=O)[O-] |
| Synonym | 4-nitrophenethyl bromide,1-2-bromoethyl-4-nitrobenzene,benzene, 1-2-bromoethyl-4-nitro,4-nitrophenethylbromide,p-nitrophenethyl bromide,2-4-nitrophenyl ethyl bromide,4-2-bromoethyl nitrobenzene,4-nitrophenylethyl bromide,.beta.-p-nitrophenyl ethyl bromide,phenethylbromide4nitro |
| IUPAC Name | 1-(2-bromoethyl)-4-nitrobenzene |
| InChI Key | NTURQZFFJDCTMZ-UHFFFAOYSA-N |
| Molecular Formula | C8H8BrNO2 |
(2-Bromoethyl)benzene 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 103-63-9 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.064 MDL Number: MFCD00000240 InChI Key: WMPPDTMATNBGJN-UHFFFAOYSA-N Synonym: 2-bromoethyl benzene,phenethyl bromide,2-phenylethyl bromide,1-bromo-2-phenylethane,phenylethyl bromide,benzene, 2-bromoethyl,2-phenethyl bromide,beta-bromoethylbenzene,2-phenyl-1-bromoethane,phenethylbromide PubChem CID: 7666 IUPAC Name: 2-bromoethylbenzene SMILES: C1=CC=C(C=C1)CCBr
| PubChem CID | 7666 |
|---|---|
| CAS | 103-63-9 |
| Molecular Weight (g/mol) | 185.064 |
| MDL Number | MFCD00000240 |
| SMILES | C1=CC=C(C=C1)CCBr |
| Synonym | 2-bromoethyl benzene,phenethyl bromide,2-phenylethyl bromide,1-bromo-2-phenylethane,phenylethyl bromide,benzene, 2-bromoethyl,2-phenethyl bromide,beta-bromoethylbenzene,2-phenyl-1-bromoethane,phenethylbromide |
| IUPAC Name | 2-bromoethylbenzene |
| InChI Key | WMPPDTMATNBGJN-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
trans-1,2-Dichlorocyclohexane 96.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 822-86-6 Molecular Formula: C6H10Cl2 Molecular Weight (g/mol): 153.05 MDL Number: MFCD00003824 InChI Key: GZEZIBFVJYNETN-UHFFFAOYNA-N Synonym: trans-1,2-dichlorocyclohexane,1r,2r-1,2-dichlorocyclohexane,t-1,2-dichlorocyclohexane,cyclohexane, 1,2-dichloro-, 1r,2r-rel,trans-1,2-dichlorcyclohexan,1beta,2alpha-dichlorocyclohexane,gzezibfvjynetn-phdidxhhsa,1,2-dichlorocyclohexane, trans PubChem CID: 2723623 IUPAC Name: 1,2-dichlorocyclohexane SMILES: ClC1CCCCC1Cl
| PubChem CID | 2723623 |
|---|---|
| CAS | 822-86-6 |
| Molecular Weight (g/mol) | 153.05 |
| MDL Number | MFCD00003824 |
| SMILES | ClC1CCCCC1Cl |
| Synonym | trans-1,2-dichlorocyclohexane,1r,2r-1,2-dichlorocyclohexane,t-1,2-dichlorocyclohexane,cyclohexane, 1,2-dichloro-, 1r,2r-rel,trans-1,2-dichlorcyclohexan,1beta,2alpha-dichlorocyclohexane,gzezibfvjynetn-phdidxhhsa,1,2-dichlorocyclohexane, trans |
| IUPAC Name | 1,2-dichlorocyclohexane |
| InChI Key | GZEZIBFVJYNETN-UHFFFAOYNA-N |
| Molecular Formula | C6H10Cl2 |
Iodoacetonitrile, 97%
CAS: 624-75-9 Molecular Formula: C2H2IN Molecular Weight (g/mol): 166.949 MDL Number: MFCD00001886 InChI Key: VODKOOOHHCAWFR-UHFFFAOYSA-N Synonym: iodoacetonitrile,acetonitrile, iodo,iodo-acetonitrile,2-iodoethanenitrile,2-iodo acetonitrile,2-iodoaceto-nitrile,2-iodanylethanenitrile,pubchem12543,acmc-1ba3n PubChem CID: 69356 IUPAC Name: 2-iodoacetonitrile SMILES: C(C#N)I
| PubChem CID | 69356 |
|---|---|
| CAS | 624-75-9 |
| Molecular Weight (g/mol) | 166.949 |
| MDL Number | MFCD00001886 |
| SMILES | C(C#N)I |
| Synonym | iodoacetonitrile,acetonitrile, iodo,iodo-acetonitrile,2-iodoethanenitrile,2-iodo acetonitrile,2-iodoaceto-nitrile,2-iodanylethanenitrile,pubchem12543,acmc-1ba3n |
| IUPAC Name | 2-iodoacetonitrile |
| InChI Key | VODKOOOHHCAWFR-UHFFFAOYSA-N |
| Molecular Formula | C2H2IN |
3,3'-Difluorobiphenyl, 97%
CAS: 396-64-5 Molecular Formula: C12H8F2 Molecular Weight (g/mol): 190.19 MDL Number: MFCD00039216 InChI Key: GAYJHUJLHJWCTH-UHFFFAOYSA-N Synonym: 3,3'-difluorobiphenyl,3,3'-difluoro-1,1'-biphenyl,1-fluoro-3-3-fluorophenyl benzene,1,1'-biphenyl,3,3'-difluoro,1,1'-biphenyl, 3,3'-difluoro,3-fluoro-1-3-fluorophenyl benzene,acmc-1agdg,3,3'-difluoro biphenyl,gayjhujlhjwcth-uhfffaoysa,3,3'-difluoro-1,1'-biphenyl # PubChem CID: 123058 IUPAC Name: 1-fluoro-3-(3-fluorophenyl)benzene SMILES: FC1=CC(=CC=C1)C1=CC(F)=CC=C1
| PubChem CID | 123058 |
|---|---|
| CAS | 396-64-5 |
| Molecular Weight (g/mol) | 190.19 |
| MDL Number | MFCD00039216 |
| SMILES | FC1=CC(=CC=C1)C1=CC(F)=CC=C1 |
| Synonym | 3,3'-difluorobiphenyl,3,3'-difluoro-1,1'-biphenyl,1-fluoro-3-3-fluorophenyl benzene,1,1'-biphenyl,3,3'-difluoro,1,1'-biphenyl, 3,3'-difluoro,3-fluoro-1-3-fluorophenyl benzene,acmc-1agdg,3,3'-difluoro biphenyl,gayjhujlhjwcth-uhfffaoysa,3,3'-difluoro-1,1'-biphenyl # |
| IUPAC Name | 1-fluoro-3-(3-fluorophenyl)benzene |
| InChI Key | GAYJHUJLHJWCTH-UHFFFAOYSA-N |
| Molecular Formula | C12H8F2 |