Organic acids and derivatives
Filtered Search Results
3-(Trimethoxysilyl)propyl acrylate, 90%, stabilized
CAS: 4369-14-6 Molecular Formula: C9H18O5Si Molecular Weight (g/mol): 234.32 MDL Number: MFCD00054803 InChI Key: KBQVDAIIQCXKPI-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl acrylate,3-acryloyloxy propyltrimethoxysilane,3-acryloxypropyltrimethoxysilane,2-propenoic acid, 3-trimethoxysilyl propyl ester,3-acryloxypropyl trimethoxysilane,3-trimethoxysilyl propyl 2-propenoate,3-acryloyloxypropyltrimethoxysilane,3-acryloxypropyltrimethoxysilane, stab. with 100ppm bht,acmc-1aoz6,acrylic acid, 3-trimethoxysilyl propyl ester PubChem CID: 151204 IUPAC Name: 3-trimethoxysilylpropyl prop-2-enoate SMILES: CO[Si](CCCOC(=O)C=C)(OC)OC
| PubChem CID | 151204 |
|---|---|
| CAS | 4369-14-6 |
| Molecular Weight (g/mol) | 234.32 |
| MDL Number | MFCD00054803 |
| SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl acrylate,3-acryloyloxy propyltrimethoxysilane,3-acryloxypropyltrimethoxysilane,2-propenoic acid, 3-trimethoxysilyl propyl ester,3-acryloxypropyl trimethoxysilane,3-trimethoxysilyl propyl 2-propenoate,3-acryloyloxypropyltrimethoxysilane,3-acryloxypropyltrimethoxysilane, stab. with 100ppm bht,acmc-1aoz6,acrylic acid, 3-trimethoxysilyl propyl ester |
| IUPAC Name | 3-trimethoxysilylpropyl prop-2-enoate |
| InChI Key | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| Molecular Formula | C9H18O5Si |
4-tert-Butylbenzamide, 98%
CAS: 56108-12-4 Molecular Formula: C11H15NO MDL Number: MFCD00017139 Synonym: 4-tert-butyl benzamide,benzamide, 4-1,1-dimethylethyl,p-tert-butyl benzamide,4-tert-butyl benzenecarboxamide,unii-5e7907z6bm,4-1,1-dimethylethyl benzamide,p-t-butylbenzamide,4-t-butylbenzamide,acmc-20amap,butylbenzenecarboxamide
| CAS | 56108-12-4 |
|---|---|
| MDL Number | MFCD00017139 |
| Synonym | 4-tert-butyl benzamide,benzamide, 4-1,1-dimethylethyl,p-tert-butyl benzamide,4-tert-butyl benzenecarboxamide,unii-5e7907z6bm,4-1,1-dimethylethyl benzamide,p-t-butylbenzamide,4-t-butylbenzamide,acmc-20amap,butylbenzenecarboxamide |
| Molecular Formula | C11H15NO |
1-Acetyl-5-bromoindole, 97%, Thermo Scientific Chemicals
CAS: 61995-52-6 Molecular Formula: C10H8BrNO Molecular Weight (g/mol): 238.084 MDL Number: MFCD00238530 InChI Key: BOMKWHSZGCMFEG-UHFFFAOYSA-N Synonym: 1-acetyl-5-bromoindole,1-acetyl-5-bromo-1h-indole,1-5-bromo-1h-indol-1-yl ethanone,1-5-bromoindol-1-yl ethanone,1-5-bromo-1h-indol-1-yl ethan-1-one,ethanone, 1-5-bromo-1h-indol-1-yl PubChem CID: 12318076 IUPAC Name: 1-(5-bromoindol-1-yl)ethanone SMILES: CC(=O)N1C=CC2=C1C=CC(=C2)Br
| PubChem CID | 12318076 |
|---|---|
| CAS | 61995-52-6 |
| Molecular Weight (g/mol) | 238.084 |
| MDL Number | MFCD00238530 |
| SMILES | CC(=O)N1C=CC2=C1C=CC(=C2)Br |
| Synonym | 1-acetyl-5-bromoindole,1-acetyl-5-bromo-1h-indole,1-5-bromo-1h-indol-1-yl ethanone,1-5-bromoindol-1-yl ethanone,1-5-bromo-1h-indol-1-yl ethan-1-one,ethanone, 1-5-bromo-1h-indol-1-yl |
| IUPAC Name | 1-(5-bromoindol-1-yl)ethanone |
| InChI Key | BOMKWHSZGCMFEG-UHFFFAOYSA-N |
| Molecular Formula | C10H8BrNO |
Formic acid hydrazide, 90%
CAS: 624-84-0 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 MDL Number: MFCD00007589 InChI Key: XZBIXDPGRMLSTC-UHFFFAOYSA-N Synonym: formylhydrazine,formic acid hydrazide,formic hydrazide,hydrazinecarboxaldehyde,formhydrazide,n-formylhydrazine,carbazaldehyde,formylhydrazide,hydrazine, formyl,formal hydrazine PubChem CID: 12229 IUPAC Name: formohydrazide SMILES: C(=O)NN
| PubChem CID | 12229 |
|---|---|
| CAS | 624-84-0 |
| Molecular Weight (g/mol) | 60.06 |
| MDL Number | MFCD00007589 |
| SMILES | C(=O)NN |
| Synonym | formylhydrazine,formic acid hydrazide,formic hydrazide,hydrazinecarboxaldehyde,formhydrazide,n-formylhydrazine,carbazaldehyde,formylhydrazide,hydrazine, formyl,formal hydrazine |
| IUPAC Name | formohydrazide |
| InChI Key | XZBIXDPGRMLSTC-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
1-Decylboronic acid, 98%
CAS: 24464-63-9 Molecular Formula: C10H23BO2 Molecular Weight (g/mol): 186.102 MDL Number: MFCD01074638 InChI Key: TUTSEMMBKGBUGD-UHFFFAOYSA-N Synonym: n-decylboronic acid,boronic acid, decyl,decylboranic acid,n-decaneboronic acid,n-,boronicacid, b-decyl,1-decylboronic acid,ksc199m8d PubChem CID: 4186635 IUPAC Name: decylboronic acid SMILES: B(CCCCCCCCCC)(O)O
| PubChem CID | 4186635 |
|---|---|
| CAS | 24464-63-9 |
| Molecular Weight (g/mol) | 186.102 |
| MDL Number | MFCD01074638 |
| SMILES | B(CCCCCCCCCC)(O)O |
| Synonym | n-decylboronic acid,boronic acid, decyl,decylboranic acid,n-decaneboronic acid,n-,boronicacid, b-decyl,1-decylboronic acid,ksc199m8d |
| IUPAC Name | decylboronic acid |
| InChI Key | TUTSEMMBKGBUGD-UHFFFAOYSA-N |
| Molecular Formula | C10H23BO2 |
Methyl 3-phenylpropionate, 98%
CAS: 103-25-3 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.204 MDL Number: MFCD00017209 InChI Key: RPUSRLKKXPQSGP-UHFFFAOYSA-N Synonym: methyl 3-phenylpropionate,methyl hydrocinnamate,benzenepropanoic acid, methyl ester,3-phenylpropionic acid methyl ester,methyl benzenepropanoate,hydrocinnamic acid, methyl ester,methyl dihydrocinnamate,methyl beta-phenylpropionate,methyl b-phenylpropionate,unii-111lc1gi10 PubChem CID: 7643 IUPAC Name: methyl 3-phenylpropanoate SMILES: COC(=O)CCC1=CC=CC=C1
| PubChem CID | 7643 |
|---|---|
| CAS | 103-25-3 |
| Molecular Weight (g/mol) | 164.204 |
| MDL Number | MFCD00017209 |
| SMILES | COC(=O)CCC1=CC=CC=C1 |
| Synonym | methyl 3-phenylpropionate,methyl hydrocinnamate,benzenepropanoic acid, methyl ester,3-phenylpropionic acid methyl ester,methyl benzenepropanoate,hydrocinnamic acid, methyl ester,methyl dihydrocinnamate,methyl beta-phenylpropionate,methyl b-phenylpropionate,unii-111lc1gi10 |
| IUPAC Name | methyl 3-phenylpropanoate |
| InChI Key | RPUSRLKKXPQSGP-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
Ethyl methanesulfonate, 99%
CAS: 62-50-0 Molecular Formula: C3H8O3S Molecular Weight (g/mol): 124.15 MDL Number: MFCD00007559 InChI Key: PLUBXMRUUVWRLT-UHFFFAOYSA-N Synonym: ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid PubChem CID: 6113 ChEBI: CHEBI:23994 IUPAC Name: ethyl methanesulfonate SMILES: CCOS(=O)(=O)C
| PubChem CID | 6113 |
|---|---|
| CAS | 62-50-0 |
| Molecular Weight (g/mol) | 124.15 |
| ChEBI | CHEBI:23994 |
| MDL Number | MFCD00007559 |
| SMILES | CCOS(=O)(=O)C |
| Synonym | ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid |
| IUPAC Name | ethyl methanesulfonate |
| InChI Key | PLUBXMRUUVWRLT-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3S |
Ethyl 2-butynoate, 98%
CAS: 4341-76-8 Molecular Formula: C6H8O2 Molecular Weight (g/mol): 112.128 MDL Number: MFCD00015182 InChI Key: FCJJZKCJURDYNF-UHFFFAOYSA-N Synonym: ethyl 2-butynoate,ethyl tetrolate,2-butynoic acid ethyl ester,but-2-ynoic acid ethyl ester,2-butynoic acid, ethyl ester,tetrolic acid ethyl ester,ethyl-2-butynoate,ethyl 3-methylpropiolate,acmc-1aeo2,ethyl 1-propynecarboxylate PubChem CID: 78043 IUPAC Name: ethyl but-2-ynoate SMILES: CCOC(=O)C#CC
| PubChem CID | 78043 |
|---|---|
| CAS | 4341-76-8 |
| Molecular Weight (g/mol) | 112.128 |
| MDL Number | MFCD00015182 |
| SMILES | CCOC(=O)C#CC |
| Synonym | ethyl 2-butynoate,ethyl tetrolate,2-butynoic acid ethyl ester,but-2-ynoic acid ethyl ester,2-butynoic acid, ethyl ester,tetrolic acid ethyl ester,ethyl-2-butynoate,ethyl 3-methylpropiolate,acmc-1aeo2,ethyl 1-propynecarboxylate |
| IUPAC Name | ethyl but-2-ynoate |
| InChI Key | FCJJZKCJURDYNF-UHFFFAOYSA-N |
| Molecular Formula | C6H8O2 |
Methyl m-toluate, 98%
CAS: 99-36-5 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00008436 InChI Key: CPXCDEMFNPKOEF-UHFFFAOYSA-N Synonym: methyl m-toluate,methyl 3-toluate,benzoic acid, 3-methyl-, methyl ester,methyl m-methylbenzoate,meta-toluic acid, methyl ester,3-methylbenzoic acid methyl ester,methyl-m-methyl benzoate,m-toluic acid, methyl ester,methyl3-methylbenzoate,m-toluic acid methyl ester PubChem CID: 7435 IUPAC Name: methyl 3-methylbenzoate SMILES: CC1=CC=CC(=C1)C(=O)OC
| PubChem CID | 7435 |
|---|---|
| CAS | 99-36-5 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00008436 |
| SMILES | CC1=CC=CC(=C1)C(=O)OC |
| Synonym | methyl m-toluate,methyl 3-toluate,benzoic acid, 3-methyl-, methyl ester,methyl m-methylbenzoate,meta-toluic acid, methyl ester,3-methylbenzoic acid methyl ester,methyl-m-methyl benzoate,m-toluic acid, methyl ester,methyl3-methylbenzoate,m-toluic acid methyl ester |
| IUPAC Name | methyl 3-methylbenzoate |
| InChI Key | CPXCDEMFNPKOEF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
1-Pentanesulfonic Acid Sodium Salt, Monohydrate, HPLC Grade, 98%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 207605-40-1 Molecular Formula: C5H11O3S Molecular Weight (g/mol): 151.20 InChI Key: RJQRCOMHVBLQIH-UHFFFAOYSA-M IUPAC Name: pentane-1-sulfonate SMILES: CCCCCS([O-])(=O)=O
| CAS | 207605-40-1 |
|---|---|
| Molecular Weight (g/mol) | 151.20 |
| SMILES | CCCCCS([O-])(=O)=O |
| IUPAC Name | pentane-1-sulfonate |
| InChI Key | RJQRCOMHVBLQIH-UHFFFAOYSA-M |
| Molecular Formula | C5H11O3S |
Sodium Gluconate, FCC, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 527-07-1 Molecular Formula: C6H11NaO7 Molecular Weight (g/mol): 218.14 InChI Key: UPMFZISCCZSDND-UHFFFAOYNA-M IUPAC Name: sodium 2,3,4,5,6-pentahydroxyhexanoate SMILES: [Na+].OCC(O)C(O)C(O)C(O)C([O-])=O
| CAS | 527-07-1 |
|---|---|
| Molecular Weight (g/mol) | 218.14 |
| SMILES | [Na+].OCC(O)C(O)C(O)C(O)C([O-])=O |
| IUPAC Name | sodium 2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | UPMFZISCCZSDND-UHFFFAOYNA-M |
| Molecular Formula | C6H11NaO7 |
DL-3-Hydroxybutyric acid, sodium salt, 99%
CAS: 150-83-4 Molecular Formula: C4H7NaO3 Molecular Weight (g/mol): 126.09 MDL Number: MFCD00016716 InChI Key: NBPUSGBJDWCHKC-UHFFFAOYSA-M Synonym: sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt PubChem CID: 23676771 IUPAC Name: sodium;3-hydroxybutanoate SMILES: CC(CC(=O)[O-])O.[Na+]
| PubChem CID | 23676771 |
|---|---|
| CAS | 150-83-4 |
| Molecular Weight (g/mol) | 126.09 |
| MDL Number | MFCD00016716 |
| SMILES | CC(CC(=O)[O-])O.[Na+] |
| Synonym | sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt |
| IUPAC Name | sodium;3-hydroxybutanoate |
| InChI Key | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| Molecular Formula | C4H7NaO3 |
L(+)-Potassium hydrogen tartrate, 99%
CAS: 868-14-4 Molecular Formula: C4H5KO6 Molecular Weight (g/mol): 188.18 MDL Number: MFCD00065392,MFCD00071626,MFCD00064206 InChI Key: KYKNRZGSIGMXFH-ZVGUSBNCSA-M Synonym: potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 PubChem CID: 24193652 IUPAC Name: 2,3-dihydroxybutanedioic acid;potassium SMILES: [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O
| PubChem CID | 24193652 |
|---|---|
| CAS | 868-14-4 |
| Molecular Weight (g/mol) | 188.18 |
| MDL Number | MFCD00065392,MFCD00071626,MFCD00064206 |
| SMILES | [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| Synonym | potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;potassium |
| InChI Key | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
| Molecular Formula | C4H5KO6 |
D-(+)-Malic acid, 98+%
CAS: 636-61-3 Molecular Formula: C4H6O5 Molecular Weight (g/mol): 134.09 MDL Number: MFCD00004245 InChI Key: BJEPYKJPYRNKOW-UHFFFAOYNA-N Synonym: d-+-malic acid,d-malic acid,d +-malic acid,r-2-hydroxysuccinic acid,r-malic acid,malic acid, d,2r-2-hydroxybutanedioic acid,l +-malic acid,d-malate PubChem CID: 92824 ChEBI: CHEBI:30796 IUPAC Name: (2R)-2-hydroxybutanedioic acid SMILES: OC(CC(O)=O)C(O)=O
| PubChem CID | 92824 |
|---|---|
| CAS | 636-61-3 |
| Molecular Weight (g/mol) | 134.09 |
| ChEBI | CHEBI:30796 |
| MDL Number | MFCD00004245 |
| SMILES | OC(CC(O)=O)C(O)=O |
| Synonym | d-+-malic acid,d-malic acid,d +-malic acid,r-2-hydroxysuccinic acid,r-malic acid,malic acid, d,2r-2-hydroxybutanedioic acid,l +-malic acid,d-malate |
| IUPAC Name | (2R)-2-hydroxybutanedioic acid |
| InChI Key | BJEPYKJPYRNKOW-UHFFFAOYNA-N |
| Molecular Formula | C4H6O5 |
(+)-Diethyl L-tartrate, 98%
CAS: 87-91-2 Molecular Formula: C8H14O6 Molecular Weight (g/mol): 206.19 MDL Number: MFCD00009143 InChI Key: YSAVZVORKRDODB-UHFFFAOYNA-N Synonym: diethyl l-+-tartrate,2r,3r-diethyl 2,3-dihydroxysuccinate,l +-diethyl l-tartrate,+-diethyl l-tartrate,diethyl l-tartrate,diethyl-l-tartrate,unii-oq72cpy58z,l-+-tartaric acid diethyl ester,diethyl l-tartarate,tartaric acid, diethyl ester, r,r PubChem CID: 6993580 SMILES: CCOC(=O)C(O)C(O)C(=O)OCC
| PubChem CID | 6993580 |
|---|---|
| CAS | 87-91-2 |
| Molecular Weight (g/mol) | 206.19 |
| MDL Number | MFCD00009143 |
| SMILES | CCOC(=O)C(O)C(O)C(=O)OCC |
| Synonym | diethyl l-+-tartrate,2r,3r-diethyl 2,3-dihydroxysuccinate,l +-diethyl l-tartrate,+-diethyl l-tartrate,diethyl l-tartrate,diethyl-l-tartrate,unii-oq72cpy58z,l-+-tartaric acid diethyl ester,diethyl l-tartarate,tartaric acid, diethyl ester, r,r |
| InChI Key | YSAVZVORKRDODB-UHFFFAOYNA-N |
| Molecular Formula | C8H14O6 |