Organic acids and derivatives
Filtered Search Results
Iron(II) oxalate hydrate, 96%
CAS: 516-03-0 Molecular Formula: C2FeO4 Molecular Weight (g/mol): 143.86 MDL Number: MFCD00012475 InChI Key: OWZIYWAUNZMLRT-UHFFFAOYSA-L Synonym: ferrous oxalate,iron ii oxalate,unii-dzp4yv3icv,dzp4yv3icv,iron protoxalate,iron, ethanedioato 2--.kappa.o1,.kappa.o2,iron 2+ oxalate,iron oxalate fec2o4,hsdb 463,iron 2+ ; oxalate PubChem CID: 10589 IUPAC Name: iron(2+);oxalate SMILES: [Fe++].[O-]C(=O)C([O-])=O
| PubChem CID | 10589 |
|---|---|
| CAS | 516-03-0 |
| Molecular Weight (g/mol) | 143.86 |
| MDL Number | MFCD00012475 |
| SMILES | [Fe++].[O-]C(=O)C([O-])=O |
| Synonym | ferrous oxalate,iron ii oxalate,unii-dzp4yv3icv,dzp4yv3icv,iron protoxalate,iron, ethanedioato 2--.kappa.o1,.kappa.o2,iron 2+ oxalate,iron oxalate fec2o4,hsdb 463,iron 2+ ; oxalate |
| IUPAC Name | iron(2+);oxalate |
| InChI Key | OWZIYWAUNZMLRT-UHFFFAOYSA-L |
| Molecular Formula | C2FeO4 |
Lithium isobutyrate, 98+%
CAS: 25179-23-1 Molecular Formula: C4H7LiO2 Molecular Weight (g/mol): 94.038 MDL Number: MFCD00210622 InChI Key: IIDVGIFOWJJSIJ-UHFFFAOYSA-M Synonym: lithium isobutyrate,lithium 2-methylpropanoate,acmc-1ccd2,isobutyric acid lithium salt,lithium 1+ isobutyrate,lithium 1+ ion isobutyrate PubChem CID: 23665557 IUPAC Name: lithium;2-methylpropanoate SMILES: [Li+].CC(C)C(=O)[O-]
| PubChem CID | 23665557 |
|---|---|
| CAS | 25179-23-1 |
| Molecular Weight (g/mol) | 94.038 |
| MDL Number | MFCD00210622 |
| SMILES | [Li+].CC(C)C(=O)[O-] |
| Synonym | lithium isobutyrate,lithium 2-methylpropanoate,acmc-1ccd2,isobutyric acid lithium salt,lithium 1+ isobutyrate,lithium 1+ ion isobutyrate |
| IUPAC Name | lithium;2-methylpropanoate |
| InChI Key | IIDVGIFOWJJSIJ-UHFFFAOYSA-M |
| Molecular Formula | C4H7LiO2 |
Potassium methanesulfonate, 99%
CAS: 2386-56-3 Molecular Formula: CH3KO3S Molecular Weight (g/mol): 134.19 MDL Number: MFCD00070544 InChI Key: XWIJIXWOZCRYEL-UHFFFAOYSA-M Synonym: potassium methanesulfonate,methanesulfonic acid, potassium salt,potassium mesylate,potassium methylsulfonate,potassium methyl sulfonate,potassium methanesulphonate,unii-s99ib3em17,methanesulfonic acid potassium salt,methanesulfonic acid,potassium salt 1:1,methanesulfonic acid, potassium salt 1:1 PubChem CID: 23666501 IUPAC Name: potassium;methanesulfonate SMILES: CS(=O)(=O)[O-].[K+]
| PubChem CID | 23666501 |
|---|---|
| CAS | 2386-56-3 |
| Molecular Weight (g/mol) | 134.19 |
| MDL Number | MFCD00070544 |
| SMILES | CS(=O)(=O)[O-].[K+] |
| Synonym | potassium methanesulfonate,methanesulfonic acid, potassium salt,potassium mesylate,potassium methylsulfonate,potassium methyl sulfonate,potassium methanesulphonate,unii-s99ib3em17,methanesulfonic acid potassium salt,methanesulfonic acid,potassium salt 1:1,methanesulfonic acid, potassium salt 1:1 |
| IUPAC Name | potassium;methanesulfonate |
| InChI Key | XWIJIXWOZCRYEL-UHFFFAOYSA-M |
| Molecular Formula | CH3KO3S |
Nickel(II) oxalate dihydrate
CAS: 6018-94-6 Molecular Formula: C2H4NiO6 Molecular Weight (g/mol): 182.741 MDL Number: MFCD00167155 InChI Key: VNYOIRCILMCTHO-UHFFFAOYSA-L Synonym: nickel oxalate,nickel ii oxalate dihydrate,nickel oxalate dihydrate,acmc-1b92x,nickel 2+ ; oxalate; dihydrate,nickel oxalate,,nickel 2+ dihydrate oxalate,nickel 2+ ion dihydrate oxalate PubChem CID: 516789 IUPAC Name: nickel(2+);oxalate;dihydrate SMILES: C(=O)(C(=O)[O-])[O-].O.O.[Ni+2]
| PubChem CID | 516789 |
|---|---|
| CAS | 6018-94-6 |
| Molecular Weight (g/mol) | 182.741 |
| MDL Number | MFCD00167155 |
| SMILES | C(=O)(C(=O)[O-])[O-].O.O.[Ni+2] |
| Synonym | nickel oxalate,nickel ii oxalate dihydrate,nickel oxalate dihydrate,acmc-1b92x,nickel 2+ ; oxalate; dihydrate,nickel oxalate,,nickel 2+ dihydrate oxalate,nickel 2+ ion dihydrate oxalate |
| IUPAC Name | nickel(2+);oxalate;dihydrate |
| InChI Key | VNYOIRCILMCTHO-UHFFFAOYSA-L |
| Molecular Formula | C2H4NiO6 |
Methyl indole-2-carboxylate, 97%
CAS: 1202-04-6 Molecular Formula: C10H9NO2 Molecular Weight (g/mol): 175.19 MDL Number: MFCD00460779 InChI Key: NQPIEWBAWBFGOB-UHFFFAOYSA-N Synonym: methyl indole-2-carboxylate,indole-2-carboxylic acid methyl ester,methyl 2-indolecarboxylate,1h-indole-2-carboxylic acid methyl ester,1h-indole-2-carboxylic acid, methyl ester,ethyl-indole-2-caboxylate,pubchem7284,2-methoxycarbonylindole,methylindole-2-carboxylate,buttpark 99\04-61 PubChem CID: 70992 IUPAC Name: methyl 1H-indole-2-carboxylate SMILES: COC(=O)C1=CC2=CC=CC=C2N1
| PubChem CID | 70992 |
|---|---|
| CAS | 1202-04-6 |
| Molecular Weight (g/mol) | 175.19 |
| MDL Number | MFCD00460779 |
| SMILES | COC(=O)C1=CC2=CC=CC=C2N1 |
| Synonym | methyl indole-2-carboxylate,indole-2-carboxylic acid methyl ester,methyl 2-indolecarboxylate,1h-indole-2-carboxylic acid methyl ester,1h-indole-2-carboxylic acid, methyl ester,ethyl-indole-2-caboxylate,pubchem7284,2-methoxycarbonylindole,methylindole-2-carboxylate,buttpark 99\04-61 |
| IUPAC Name | methyl 1H-indole-2-carboxylate |
| InChI Key | NQPIEWBAWBFGOB-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO2 |
3-Butynyl p-toluenesulfonate, 96%
CAS: 23418-85-1 Molecular Formula: C11H12O3S Molecular Weight (g/mol): 224.274 MDL Number: MFCD00041687 InChI Key: STOASOOVVADOKH-UHFFFAOYSA-N Synonym: 3-butynyl p-toluenesulfonate,but-3-yn-1-yl 4-methylbenzenesulfonate,3-butynyl tosylate,3-butynyl 4-toluenesulfonate,3-1-butynyl-4-toluenesulphonate,3-butynyl 4-methylbenzenesulfonate,p-toluenesulfonic acid 3-butynyl ester,but-3-ynyl tosylate,4-tosyloxy-1-butyne,acmc-1cgfq PubChem CID: 272020 IUPAC Name: but-3-ynyl 4-methylbenzenesulfonate SMILES: CC1=CC=C(C=C1)S(=O)(=O)OCCC#C
| PubChem CID | 272020 |
|---|---|
| CAS | 23418-85-1 |
| Molecular Weight (g/mol) | 224.274 |
| MDL Number | MFCD00041687 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC#C |
| Synonym | 3-butynyl p-toluenesulfonate,but-3-yn-1-yl 4-methylbenzenesulfonate,3-butynyl tosylate,3-butynyl 4-toluenesulfonate,3-1-butynyl-4-toluenesulphonate,3-butynyl 4-methylbenzenesulfonate,p-toluenesulfonic acid 3-butynyl ester,but-3-ynyl tosylate,4-tosyloxy-1-butyne,acmc-1cgfq |
| IUPAC Name | but-3-ynyl 4-methylbenzenesulfonate |
| InChI Key | STOASOOVVADOKH-UHFFFAOYSA-N |
| Molecular Formula | C11H12O3S |
2-Aminoethyl methacrylate hydrochloride, 90%, stabilized
CAS: 2420-94-2 Molecular Formula: C6H11NO2·HCl Molecular Weight (g/mol): 165.62 MDL Number: MFCD00078260 InChI Key: XSHISXQEKIKSGC-UHFFFAOYSA-N Synonym: 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 PubChem CID: 75495 IUPAC Name: 2-aminoethyl 2-methylprop-2-enoate;hydrochloride SMILES: CC(=C)C(=O)OCCN.Cl
| PubChem CID | 75495 |
|---|---|
| CAS | 2420-94-2 |
| Molecular Weight (g/mol) | 165.62 |
| MDL Number | MFCD00078260 |
| SMILES | CC(=C)C(=O)OCCN.Cl |
| Synonym | 2-aminoethyl methacrylate hydrochloride,2-aminoethylmethacrylate hydrochloride,2-aminoethyl 2-methylacrylate hydrochloride,methacrylic acid, 2-aminoethyl ester, hydrochloride, polymers,2-aminoethyl 2-methylprop-2-enoate hydrochloride,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride 1:1,2-propenoic acid, 2-methyl-, 2-aminoethyl ester, hydrochloride,aminoethylmethacrylate,acmc-209wgm,timtec-bb sbb003905 |
| IUPAC Name | 2-aminoethyl 2-methylprop-2-enoate;hydrochloride |
| InChI Key | XSHISXQEKIKSGC-UHFFFAOYSA-N |
| Molecular Formula | C6H11NO2·HCl |
Sodium Benzoate, Powder, FCC, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 532-32-1 Molecular Formula: C7H5NaO2 Molecular Weight (g/mol): 144.11 MDL Number: MFCD00012463 InChI Key: WXMKPNITSTVMEF-UHFFFAOYSA-M IUPAC Name: sodium benzoate SMILES: [Na+].[O-]C(=O)C1=CC=CC=C1
| CAS | 532-32-1 |
|---|---|
| Molecular Weight (g/mol) | 144.11 |
| MDL Number | MFCD00012463 |
| SMILES | [Na+].[O-]C(=O)C1=CC=CC=C1 |
| IUPAC Name | sodium benzoate |
| InChI Key | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO2 |
Dimethyl phthalate, 99%
CAS: 131-11-3 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00008425 InChI Key: NIQCNGHVCWTJSM-UHFFFAOYSA-N Synonym: dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm PubChem CID: 8554 ChEBI: CHEBI:4609 SMILES: COC(=O)C1=CC=CC=C1C(=O)OC
| PubChem CID | 8554 |
|---|---|
| CAS | 131-11-3 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:4609 |
| MDL Number | MFCD00008425 |
| SMILES | COC(=O)C1=CC=CC=C1C(=O)OC |
| Synonym | dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm |
| InChI Key | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
Methyl Methacrylate, Stabilized with hydroquinone, BAKER™, J.T. Baker™
CAS: 80-62-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.117 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| Molecular Weight (g/mol) | 100.117 |
| ChEBI | CHEBI:34840 |
| SMILES | CC(=C)C(=O)OC |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Pyruvic acid sodium salt, 99.3%, Cell Culture Reagent, MP Biomedicals™
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.044 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
5-Fluoropyridine-3-boronic acid, 98%
CAS: 872041-86-6 Molecular Formula: C5H5BFNO2 Molecular Weight (g/mol): 140.908 MDL Number: MFCD07368243 InChI Key: FVEDGBRHTGXPOK-UHFFFAOYSA-N Synonym: 5-fluoropyridine-3-boronic acid,5-fluoropyridin-3-yl boronic acid,5-fluoropyridin-3-yl-3-boronic acid,5-fluoropyridine-3-boronicacid,5-fluoro-3-pyridylboronic acid,3-fluoropyridine-5-boronic acid,5-fluoro-3-pyridyl boronic acid,acmc-209qir,boric acid fluoride-3-5,3-borono-5-fluoropyridine PubChem CID: 44717403 IUPAC Name: (5-fluoropyridin-3-yl)boronic acid SMILES: B(C1=CC(=CN=C1)F)(O)O
| PubChem CID | 44717403 |
|---|---|
| CAS | 872041-86-6 |
| Molecular Weight (g/mol) | 140.908 |
| MDL Number | MFCD07368243 |
| SMILES | B(C1=CC(=CN=C1)F)(O)O |
| Synonym | 5-fluoropyridine-3-boronic acid,5-fluoropyridin-3-yl boronic acid,5-fluoropyridin-3-yl-3-boronic acid,5-fluoropyridine-3-boronicacid,5-fluoro-3-pyridylboronic acid,3-fluoropyridine-5-boronic acid,5-fluoro-3-pyridyl boronic acid,acmc-209qir,boric acid fluoride-3-5,3-borono-5-fluoropyridine |
| IUPAC Name | (5-fluoropyridin-3-yl)boronic acid |
| InChI Key | FVEDGBRHTGXPOK-UHFFFAOYSA-N |
| Molecular Formula | C5H5BFNO2 |
Methyl DL-lactate, 99%
CAS: 547-64-8 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.105 MDL Number: MFCD00066367 InChI Key: LPEKGGXMPWTOCB-UHFFFAOYSA-N Synonym: methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate PubChem CID: 11040 ChEBI: CHEBI:83221 IUPAC Name: methyl 2-hydroxypropanoate SMILES: CC(C(=O)OC)O
| PubChem CID | 11040 |
|---|---|
| CAS | 547-64-8 |
| Molecular Weight (g/mol) | 104.105 |
| ChEBI | CHEBI:83221 |
| MDL Number | MFCD00066367 |
| SMILES | CC(C(=O)OC)O |
| Synonym | methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate |
| IUPAC Name | methyl 2-hydroxypropanoate |
| InChI Key | LPEKGGXMPWTOCB-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3 |
Calcium Lactate, Pentahydrate, FCC, EP, USP, 98-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 5743-47-5 Molecular Formula: C6H20CaO11 Molecular Weight (g/mol): 308.29 MDL Number: MFCD00287281 (5H2O) InChI Key: HPVJXNNKHRNBOY-UHFFFAOYNA-L IUPAC Name: calcium bis(2-hydroxypropanoate) pentahydrate SMILES: O.O.O.O.O.[Ca++].CC(O)C([O-])=O.CC(O)C([O-])=O
| CAS | 5743-47-5 |
|---|---|
| Molecular Weight (g/mol) | 308.29 |
| MDL Number | MFCD00287281 (5H2O) |
| SMILES | O.O.O.O.O.[Ca++].CC(O)C([O-])=O.CC(O)C([O-])=O |
| IUPAC Name | calcium bis(2-hydroxypropanoate) pentahydrate |
| InChI Key | HPVJXNNKHRNBOY-UHFFFAOYNA-L |
| Molecular Formula | C6H20CaO11 |
4-(Isopropylcarbamoyl)benzeneboronic acid, 95%
CAS: 397843-67-3 Molecular Formula: C10H14BNO3 Molecular Weight (g/mol): 207.036 MDL Number: MFCD04039353 InChI Key: GBCSEYKTZAKRMT-UHFFFAOYSA-N Synonym: 4-isopropylcarbamoyl phenyl boronic acid,4-n-isopropylaminocarbonyl phenylboronic acid,4-isopropylcarbamoyl benzeneboronic acid,4-isopropylcarbamoyl phenylboronic acid,4-propan-2-ylcarbamoyl phenyl boronic acid,4-n-isopropylaminocarbonyl phenyl boronic acid,n-isopropyl 4-boronobenzamide,boronic acid, 4-1-methylethyl amino carbonyl phenyl,4-1-methylethyl amino carbonyl phenyl-boronic acid PubChem CID: 2773475 IUPAC Name: [4-(propan-2-ylcarbamoyl)phenyl]boronic acid SMILES: B(C1=CC=C(C=C1)C(=O)NC(C)C)(O)O
| PubChem CID | 2773475 |
|---|---|
| CAS | 397843-67-3 |
| Molecular Weight (g/mol) | 207.036 |
| MDL Number | MFCD04039353 |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC(C)C)(O)O |
| Synonym | 4-isopropylcarbamoyl phenyl boronic acid,4-n-isopropylaminocarbonyl phenylboronic acid,4-isopropylcarbamoyl benzeneboronic acid,4-isopropylcarbamoyl phenylboronic acid,4-propan-2-ylcarbamoyl phenyl boronic acid,4-n-isopropylaminocarbonyl phenyl boronic acid,n-isopropyl 4-boronobenzamide,boronic acid, 4-1-methylethyl amino carbonyl phenyl,4-1-methylethyl amino carbonyl phenyl-boronic acid |
| IUPAC Name | [4-(propan-2-ylcarbamoyl)phenyl]boronic acid |
| InChI Key | GBCSEYKTZAKRMT-UHFFFAOYSA-N |
| Molecular Formula | C10H14BNO3 |