Organic acids and derivatives
Filtered Search Results
Calcium propionate, 98+%
CAS: 4075-81-4 Molecular Formula: C6H10CaO4 Molecular Weight (g/mol): 186.22 MDL Number: MFCD00167354 InChI Key: BCZXFFBUYPCTSJ-UHFFFAOYSA-L Synonym: calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 PubChem CID: 19999 ChEBI: CHEBI:81716 IUPAC Name: calcium;propanoate SMILES: [Ca++].CCC([O-])=O.CCC([O-])=O
| PubChem CID | 19999 |
|---|---|
| CAS | 4075-81-4 |
| Molecular Weight (g/mol) | 186.22 |
| ChEBI | CHEBI:81716 |
| MDL Number | MFCD00167354 |
| SMILES | [Ca++].CCC([O-])=O.CCC([O-])=O |
| Synonym | calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 |
| IUPAC Name | calcium;propanoate |
| InChI Key | BCZXFFBUYPCTSJ-UHFFFAOYSA-L |
| Molecular Formula | C6H10CaO4 |
Silver(I) citrate hydrate
CAS: 206986-90-5 Molecular Formula: C6H5Ag3O7 Molecular Weight (g/mol): 512.70 MDL Number: MFCD00150589 InChI Key: QUTYHQJYVDNJJA-UHFFFAOYSA-K Synonym: silver i citrate hydrate,trisilver 1+ citrate hydrate PubChem CID: 16212313 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;silver;hydrate SMILES: [Ag+].[Ag+].[Ag+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| PubChem CID | 16212313 |
|---|---|
| CAS | 206986-90-5 |
| Molecular Weight (g/mol) | 512.70 |
| MDL Number | MFCD00150589 |
| SMILES | [Ag+].[Ag+].[Ag+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | silver i citrate hydrate,trisilver 1+ citrate hydrate |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;silver;hydrate |
| InChI Key | QUTYHQJYVDNJJA-UHFFFAOYSA-K |
| Molecular Formula | C6H5Ag3O7 |
Zinc propionate, 97%
CAS: 557-28-8 Molecular Formula: C6H10O4Zn Molecular Weight (g/mol): 211.52 MDL Number: MFCD00045937 InChI Key: XDWXRAYGALQIFG-UHFFFAOYSA-L Synonym: zinc propionate,unii-81pxa87xvc,81pxa87xvc,propanoic acid, zinc salt 2:1,gyna-plex,propionic acid, zinc salt,zinc dipropionate,propanoic acid, zinc salt,zinc propanoate,propanoic acid, zinc salt, basic PubChem CID: 11189 IUPAC Name: zinc;propanoate SMILES: [Zn++].CCC([O-])=O.CCC([O-])=O
| PubChem CID | 11189 |
|---|---|
| CAS | 557-28-8 |
| Molecular Weight (g/mol) | 211.52 |
| MDL Number | MFCD00045937 |
| SMILES | [Zn++].CCC([O-])=O.CCC([O-])=O |
| Synonym | zinc propionate,unii-81pxa87xvc,81pxa87xvc,propanoic acid, zinc salt 2:1,gyna-plex,propionic acid, zinc salt,zinc dipropionate,propanoic acid, zinc salt,zinc propanoate,propanoic acid, zinc salt, basic |
| IUPAC Name | zinc;propanoate |
| InChI Key | XDWXRAYGALQIFG-UHFFFAOYSA-L |
| Molecular Formula | C6H10O4Zn |
Sodium Pyruvate, MP Biomedicals
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.044 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Sodium glycolate, 97%
CAS: 2836-32-0 Molecular Formula: C2H3NaO3 Molecular Weight (g/mol): 98.033 MDL Number: MFCD00065358 InChI Key: VILMUCRZVVVJCA-UHFFFAOYSA-M Synonym: sodium glycolate,sodium hydroxyacetate,sodium 2-hydroxyacetate,sodium lycolate,monosodium glycolate,glycolic acid sodium salt,natriumglykolat,sodium glycollate,acetic acid, hydroxy-, monosodium salt,glycolic acid, monosodium salt PubChem CID: 517347 IUPAC Name: sodium;2-hydroxyacetate SMILES: C(C(=O)[O-])O.[Na+]
| PubChem CID | 517347 |
|---|---|
| CAS | 2836-32-0 |
| Molecular Weight (g/mol) | 98.033 |
| MDL Number | MFCD00065358 |
| SMILES | C(C(=O)[O-])O.[Na+] |
| Synonym | sodium glycolate,sodium hydroxyacetate,sodium 2-hydroxyacetate,sodium lycolate,monosodium glycolate,glycolic acid sodium salt,natriumglykolat,sodium glycollate,acetic acid, hydroxy-, monosodium salt,glycolic acid, monosodium salt |
| IUPAC Name | sodium;2-hydroxyacetate |
| InChI Key | VILMUCRZVVVJCA-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO3 |
Sodium succinate hexahydrate
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 MDL Number: MFCD00149117 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| MDL Number | MFCD00149117 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
Trifluoroacetic acid, sodium salt, 97%
CAS: 2923-18-4 Molecular Formula: C2F3NaO2 Molecular Weight (g/mol): 136.01 MDL Number: MFCD00013217 InChI Key: UYCAUPASBSROMS-UHFFFAOYSA-M Synonym: sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt PubChem CID: 517019 IUPAC Name: sodium;2,2,2-trifluoroacetate SMILES: [Na+].[O-]C(=O)C(F)(F)F
| PubChem CID | 517019 |
|---|---|
| CAS | 2923-18-4 |
| Molecular Weight (g/mol) | 136.01 |
| MDL Number | MFCD00013217 |
| SMILES | [Na+].[O-]C(=O)C(F)(F)F |
| Synonym | sodium trifluoroacetate,trifluoroacetic acid sodium salt,acetic acid, trifluoro-, sodium salt,sodium perfluoroacetate,trifluoroacetate sodium,sodium 2,2,2-trifluoroacetate,trifluoroacetic acid sodium,trifluoroacetic acid,sodium salt,acetic acid, 2,2,2-trifluoro-, sodium salt 1:1,trifluoroacetic acid, sodium salt |
| IUPAC Name | sodium;2,2,2-trifluoroacetate |
| InChI Key | UYCAUPASBSROMS-UHFFFAOYSA-M |
| Molecular Formula | C2F3NaO2 |
Trifluoroacetic acid, ammonium salt, 98%
CAS: 3336-58-1 Molecular Formula: C2H5F3NO2 Molecular Weight (g/mol): 132.06 MDL Number: MFCD00012615,MFCD03095537 InChI Key: YCNIBOIOWCTRCL-UHFFFAOYSA-O Synonym: ammonium trifluoroacetate,azanium 2,2,2-trifluoroacetate,ammoniumtrifluoroacetate,ammonium triflouroacetate,cf3coonh4,acmc-1cq68,2,2,2-trifluoroacetic acid, azamethane,acetic acid, trifluoro-, ammonium salt 8ci 9ci PubChem CID: 86601334 IUPAC Name: azanium;2,2,2-trifluoroacetic acid SMILES: [NH4+].OC(=O)C(F)(F)F
| PubChem CID | 86601334 |
|---|---|
| CAS | 3336-58-1 |
| Molecular Weight (g/mol) | 132.06 |
| MDL Number | MFCD00012615,MFCD03095537 |
| SMILES | [NH4+].OC(=O)C(F)(F)F |
| Synonym | ammonium trifluoroacetate,azanium 2,2,2-trifluoroacetate,ammoniumtrifluoroacetate,ammonium triflouroacetate,cf3coonh4,acmc-1cq68,2,2,2-trifluoroacetic acid, azamethane,acetic acid, trifluoro-, ammonium salt 8ci 9ci |
| IUPAC Name | azanium;2,2,2-trifluoroacetic acid |
| InChI Key | YCNIBOIOWCTRCL-UHFFFAOYSA-O |
| Molecular Formula | C2H5F3NO2 |
α-Ketoglutaric acid disodium salt hydrate, ≥95%, MilliporeSigma™ Supelco™
MDL Number: MFCD00150702 Synonym: 2-Oxopentanedioic acid disodium salt hydrate; Sodium 2-oxoglutarate dibasic hydrate
| MDL Number | MFCD00150702 |
|---|---|
| Synonym | 2-Oxopentanedioic acid disodium salt hydrate; Sodium 2-oxoglutarate dibasic hydrate |
Naproxen Sodium, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 26159-34-2 Molecular Formula: C14H13NaO3 Molecular Weight (g/mol): 252.25 MDL Number: MFCD00058507 InChI Key: CDBRNDSHEYLDJV-FVGYRXGTSA-M IUPAC Name: sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate SMILES: [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O
| CAS | 26159-34-2 |
|---|---|
| Molecular Weight (g/mol) | 252.25 |
| MDL Number | MFCD00058507 |
| SMILES | [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O |
| IUPAC Name | sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChI Key | CDBRNDSHEYLDJV-FVGYRXGTSA-M |
| Molecular Formula | C14H13NaO3 |
Magnesium lactate trihydrate, 99%
CAS: 18917-96-9 Molecular Formula: C6H16MgO9 Molecular Weight (g/mol): 256.49 MDL Number: MFCD00156534 Synonym: magnesium lactate trihydrate,c6h10mgo6.3h2o,2-hydroxypropanoyl oxy magnesio 2-hydroxypropanoate trihydrate PubChem CID: 91668363 IUPAC Name: magnesium;2-hydroxypropanoate;trihydrate
| PubChem CID | 91668363 |
|---|---|
| CAS | 18917-96-9 |
| Molecular Weight (g/mol) | 256.49 |
| MDL Number | MFCD00156534 |
| Synonym | magnesium lactate trihydrate,c6h10mgo6.3h2o,2-hydroxypropanoyl oxy magnesio 2-hydroxypropanoate trihydrate |
| IUPAC Name | magnesium;2-hydroxypropanoate;trihydrate |
| Molecular Formula | C6H16MgO9 |
Sodium Succinate Granular, Macron Fine Chemicals™
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
Methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate, 97%, Thermo Scientific™
CAS: 209912-44-7 Molecular Formula: C11H10N2O3 Molecular Weight (g/mol): 218.212 MDL Number: MFCD08690288 InChI Key: PJYMNVKGDLTDJE-UHFFFAOYSA-N Synonym: methyl 4-3-methyl-1,2,4-oxadiazol-5-yl benzoate,4-3-methyl-1,2,4-oxadiazole-5-yl benzoic acid methyl ester,benzoicacid, 4-3-methyl-1,2,4-oxadiazol-5-yl-, methyl ester PubChem CID: 11096067 IUPAC Name: methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate SMILES: CC1=NOC(=N1)C2=CC=C(C=C2)C(=O)OC
| PubChem CID | 11096067 |
|---|---|
| CAS | 209912-44-7 |
| Molecular Weight (g/mol) | 218.212 |
| MDL Number | MFCD08690288 |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)C(=O)OC |
| Synonym | methyl 4-3-methyl-1,2,4-oxadiazol-5-yl benzoate,4-3-methyl-1,2,4-oxadiazole-5-yl benzoic acid methyl ester,benzoicacid, 4-3-methyl-1,2,4-oxadiazol-5-yl-, methyl ester |
| IUPAC Name | methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate |
| InChI Key | PJYMNVKGDLTDJE-UHFFFAOYSA-N |
| Molecular Formula | C11H10N2O3 |
n-Hexyl methacrylate, 97%, stab. with 100ppm 4-methoxyphenol
CAS: 142-09-6 Molecular Formula: C10H18O2 Molecular Weight (g/mol): 170.25 MDL Number: MFCD00015283 InChI Key: LNCPIMCVTKXXOY-UHFFFAOYSA-N Synonym: hexyl methacrylate,n-hexyl methacrylate,hexyl 2-methyl-2-propenoate,methacrylic acid, hexyl ester,2-propenoic acid, 2-methyl-, hexyl ester,unii-538b2q3hsv,ccris 4824,hexyl 2-methylacrylate,methacrylic acid hexyl ester,dsstox_cid_5406 PubChem CID: 8872 IUPAC Name: hexyl 2-methylprop-2-enoate SMILES: CCCCCCOC(=O)C(C)=C
| PubChem CID | 8872 |
|---|---|
| CAS | 142-09-6 |
| Molecular Weight (g/mol) | 170.25 |
| MDL Number | MFCD00015283 |
| SMILES | CCCCCCOC(=O)C(C)=C |
| Synonym | hexyl methacrylate,n-hexyl methacrylate,hexyl 2-methyl-2-propenoate,methacrylic acid, hexyl ester,2-propenoic acid, 2-methyl-, hexyl ester,unii-538b2q3hsv,ccris 4824,hexyl 2-methylacrylate,methacrylic acid hexyl ester,dsstox_cid_5406 |
| IUPAC Name | hexyl 2-methylprop-2-enoate |
| InChI Key | LNCPIMCVTKXXOY-UHFFFAOYSA-N |
| Molecular Formula | C10H18O2 |
Methyl 2,6-dichlorophenylacetate, 99%
CAS: 54551-83-6 Molecular Formula: C9H8Cl2O2 Molecular Weight (g/mol): 219.07 MDL Number: MFCD00191640 InChI Key: FCWRUYPZZJPCCG-UHFFFAOYSA-N Synonym: methyl 2,6-dichlorophenylacetate,methyl 2-2,6-dichlorophenyl acetate,2,6-dichlorophenylacetic acid methyl ester,benzeneacetic acid,2,6-dichloro-, methyl ester,benzeneacetic acid, 2,6-dichloro-, methyl ester,acmc-209lhf,methyl2,6-dichlorophenylacetate,guanfacine methyl ester impurity,methyl 2,6-dichlorophenyl acetate,2,6-dichloro-phenylacetic acid methyl ester PubChem CID: 2734107 IUPAC Name: methyl 2-(2,6-dichlorophenyl)acetate SMILES: COC(=O)CC1=C(C=CC=C1Cl)Cl
| PubChem CID | 2734107 |
|---|---|
| CAS | 54551-83-6 |
| Molecular Weight (g/mol) | 219.07 |
| MDL Number | MFCD00191640 |
| SMILES | COC(=O)CC1=C(C=CC=C1Cl)Cl |
| Synonym | methyl 2,6-dichlorophenylacetate,methyl 2-2,6-dichlorophenyl acetate,2,6-dichlorophenylacetic acid methyl ester,benzeneacetic acid,2,6-dichloro-, methyl ester,benzeneacetic acid, 2,6-dichloro-, methyl ester,acmc-209lhf,methyl2,6-dichlorophenylacetate,guanfacine methyl ester impurity,methyl 2,6-dichlorophenyl acetate,2,6-dichloro-phenylacetic acid methyl ester |
| IUPAC Name | methyl 2-(2,6-dichlorophenyl)acetate |
| InChI Key | FCWRUYPZZJPCCG-UHFFFAOYSA-N |
| Molecular Formula | C9H8Cl2O2 |