Organic acids and derivatives
Filtered Search Results
Benzamide 99.0+%, TCI America™
CAS: 55-21-0 Molecular Formula: C7H7NO Molecular Weight (g/mol): 121.139 MDL Number: MFCD00007968 InChI Key: KXDAEFPNCMNJSK-UHFFFAOYSA-N Synonym: benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide PubChem CID: 2331 ChEBI: CHEBI:28179 IUPAC Name: benzamide SMILES: C1=CC=C(C=C1)C(=O)N
| PubChem CID | 2331 |
|---|---|
| CAS | 55-21-0 |
| Molecular Weight (g/mol) | 121.139 |
| ChEBI | CHEBI:28179 |
| MDL Number | MFCD00007968 |
| SMILES | C1=CC=C(C=C1)C(=O)N |
| Synonym | benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide |
| IUPAC Name | benzamide |
| InChI Key | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO |
Ethyl Cinnamate 99.0+%, TCI America™
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.215 MDL Number: MFCD00009189 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.215 |
| ChEBI | CHEBI:4895 |
| MDL Number | MFCD00009189 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
Dibutyl Sulfate 96.0+%, TCI America™
CAS: 625-22-9 Molecular Formula: C8H18O4S Molecular Weight (g/mol): 210.288 MDL Number: MFCD00059420 InChI Key: LMEDOLJKVASKTP-UHFFFAOYSA-N Synonym: dibutylsulfate,di-n-butylsulfat,sulfuric acid, dibutyl ester,di-n-butylsulfate,di-n-butyl sulfate,dibutyl sulphate,di-n-butylsulfat german,sulfuric acid dibutyl ester,sulphuric acid dibutyl ester,dibutylsulfat PubChem CID: 12239 IUPAC Name: dibutyl sulfate SMILES: CCCCOS(=O)(=O)OCCCC
| PubChem CID | 12239 |
|---|---|
| CAS | 625-22-9 |
| Molecular Weight (g/mol) | 210.288 |
| MDL Number | MFCD00059420 |
| SMILES | CCCCOS(=O)(=O)OCCCC |
| Synonym | dibutylsulfate,di-n-butylsulfat,sulfuric acid, dibutyl ester,di-n-butylsulfate,di-n-butyl sulfate,dibutyl sulphate,di-n-butylsulfat german,sulfuric acid dibutyl ester,sulphuric acid dibutyl ester,dibutylsulfat |
| IUPAC Name | dibutyl sulfate |
| InChI Key | LMEDOLJKVASKTP-UHFFFAOYSA-N |
| Molecular Formula | C8H18O4S |
1,3,5-Pentanetricarboxylic Acid 98.0+%, TCI America™
CAS: 6940-58-5 Molecular Formula: C8H12O6 Molecular Weight (g/mol): 204.18 MDL Number: MFCD00020546 InChI Key: ROTJZTYLACIJIG-UHFFFAOYSA-N PubChem CID: 96220 IUPAC Name: pentane-1,3,5-tricarboxylic acid SMILES: OC(=O)CCC(CCC(O)=O)C(O)=O
| PubChem CID | 96220 |
|---|---|
| CAS | 6940-58-5 |
| Molecular Weight (g/mol) | 204.18 |
| MDL Number | MFCD00020546 |
| SMILES | OC(=O)CCC(CCC(O)=O)C(O)=O |
| IUPAC Name | pentane-1,3,5-tricarboxylic acid |
| InChI Key | ROTJZTYLACIJIG-UHFFFAOYSA-N |
| Molecular Formula | C8H12O6 |
Sodium Formate 97.0+%, TCI America™
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.007 MDL Number: MFCD00013101 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.007 |
| ChEBI | CHEBI:62965 |
| MDL Number | MFCD00013101 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
Temozolomide 98.0+%, TCI America™
CAS: 85622-93-1 Molecular Formula: C6H6N6O2 Molecular Weight (g/mol): 194.154 MDL Number: MFCD00866492 InChI Key: BPEGJWRSRHCHSN-UHFFFAOYSA-N Synonym: temozolomide,methazolastone,temodal,temodar,temozolamide,temozolomidum,3-methyl-4-oxo-3,4-dihydroimidazo 5,1-d 1,2,3,5 tetrazine-8-carboxamide,temozolomidum latin,temozolodida spanish,temozolodida PubChem CID: 5394 ChEBI: CHEBI:72564 IUPAC Name: 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide SMILES: CN1C(=O)N2C=NC(=C2N=N1)C(=O)N
| PubChem CID | 5394 |
|---|---|
| CAS | 85622-93-1 |
| Molecular Weight (g/mol) | 194.154 |
| ChEBI | CHEBI:72564 |
| MDL Number | MFCD00866492 |
| SMILES | CN1C(=O)N2C=NC(=C2N=N1)C(=O)N |
| Synonym | temozolomide,methazolastone,temodal,temodar,temozolamide,temozolomidum,3-methyl-4-oxo-3,4-dihydroimidazo 5,1-d 1,2,3,5 tetrazine-8-carboxamide,temozolomidum latin,temozolodida spanish,temozolodida |
| IUPAC Name | 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| InChI Key | BPEGJWRSRHCHSN-UHFFFAOYSA-N |
| Molecular Formula | C6H6N6O2 |
Ethylenediaminetetraacetic Acid Magnesium Disodium Salt Hydrate 99.0+%, TCI America™
CAS: 14402-88-1 Molecular Formula: C10H12MgN2Na2O8 Molecular Weight (g/mol): 358.50 MDL Number: MFCD00078217 InChI Key: AWNVVAMWLMUZOZ-UHFFFAOYSA-J Synonym: unii-ndt563s5vz,edta magnesium disodium,magnesium disodium edta,ndt563s5vz,magnesium disodium ethylenediaminetetraacetate,edta magnesium disodium salt hydrate,ethylenediaminetetraacetic acid magnesium disodium salt,ethylenediaminetetraacetic acid disodium magnesium salt,ethylenediaminetetraacetic acid disodium magnesium salt hydrate,magnesium sodium ethylenediaminetetraacetate PubChem CID: 161064 IUPAC Name: magnesium(2+) disodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate SMILES: [Na+].[Na+].[Mg++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 161064 |
|---|---|
| CAS | 14402-88-1 |
| Molecular Weight (g/mol) | 358.50 |
| MDL Number | MFCD00078217 |
| SMILES | [Na+].[Na+].[Mg++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | unii-ndt563s5vz,edta magnesium disodium,magnesium disodium edta,ndt563s5vz,magnesium disodium ethylenediaminetetraacetate,edta magnesium disodium salt hydrate,ethylenediaminetetraacetic acid magnesium disodium salt,ethylenediaminetetraacetic acid disodium magnesium salt,ethylenediaminetetraacetic acid disodium magnesium salt hydrate,magnesium sodium ethylenediaminetetraacetate |
| IUPAC Name | magnesium(2+) disodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate |
| InChI Key | AWNVVAMWLMUZOZ-UHFFFAOYSA-J |
| Molecular Formula | C10H12MgN2Na2O8 |
Methyl Formate 95.0+%, TCI America™
CAS: 107-31-3 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00003291 InChI Key: TZIHFWKZFHZASV-UHFFFAOYSA-N Synonym: formic acid, methyl ester,methyl methanoate,methylformiat,formic acid methyl ester,formiate de methyle,methylformiaat,mravencan methylnaty,methylformate,caswell no. 570,hcooch3 PubChem CID: 7865 ChEBI: CHEBI:77699 IUPAC Name: methyl formate SMILES: COC=O
| PubChem CID | 7865 |
|---|---|
| CAS | 107-31-3 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:77699 |
| MDL Number | MFCD00003291 |
| SMILES | COC=O |
| Synonym | formic acid, methyl ester,methyl methanoate,methylformiat,formic acid methyl ester,formiate de methyle,methylformiaat,mravencan methylnaty,methylformate,caswell no. 570,hcooch3 |
| IUPAC Name | methyl formate |
| InChI Key | TZIHFWKZFHZASV-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Dibutyl L-(+)-Tartrate 98.0+%, TCI America™
CAS: 87-92-3 Molecular Formula: C12H22O6 Molecular Weight (g/mol): 262.302 MDL Number: MFCD00009443 InChI Key: PCYQQSKDZQTOQG-NXEZZACHSA-N Synonym: 2r,3r-dibutyl 2,3-dihydroxysuccinate,dibutyl l-+-tartrate,dibutyl l-tartrate,unii-2d1v32if1e,dibutyl tartrate, +,l-+-tartaric acid di-n-butyl ester,dibutyl 2r,3r-2,3-dihydroxybutanedioate,butanedioic acid, 2,3-dihydroxy-2r,3r-, dibutyl ester,1,4-dibutyl 2r,3r-2,3-dihydroxybutanedioate,dibutyll-+-tartrate PubChem CID: 6910 IUPAC Name: dibutyl (2R,3R)-2,3-dihydroxybutanedioate SMILES: CCCCOC(=O)C(C(C(=O)OCCCC)O)O
| PubChem CID | 6910 |
|---|---|
| CAS | 87-92-3 |
| Molecular Weight (g/mol) | 262.302 |
| MDL Number | MFCD00009443 |
| SMILES | CCCCOC(=O)C(C(C(=O)OCCCC)O)O |
| Synonym | 2r,3r-dibutyl 2,3-dihydroxysuccinate,dibutyl l-+-tartrate,dibutyl l-tartrate,unii-2d1v32if1e,dibutyl tartrate, +,l-+-tartaric acid di-n-butyl ester,dibutyl 2r,3r-2,3-dihydroxybutanedioate,butanedioic acid, 2,3-dihydroxy-2r,3r-, dibutyl ester,1,4-dibutyl 2r,3r-2,3-dihydroxybutanedioate,dibutyll-+-tartrate |
| IUPAC Name | dibutyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChI Key | PCYQQSKDZQTOQG-NXEZZACHSA-N |
| Molecular Formula | C12H22O6 |
Dimethyl L-(+)-Tartrate 98.0+%, TCI America™
CAS: 608-68-4 Molecular Formula: C6H10O6 Molecular Weight (g/mol): 178.14 MDL Number: MFCD00064437 InChI Key: PVRATXCXJDHJJN-QWWZWVQMSA-N Synonym: +-dimethyl l-tartrate,dimethyl l-tartrate,2r,3r-dimethyl 2,3-dihydroxysuccinate,dimethyl +-tartrate,l-+-tartaric acid dimethyl ester,dimethyl l-+-tartrate,1,4-dimethyl 2r,3r-2,3-dihydroxybutanedioate,butanedioic acid, 2,3-dihydroxy-2r,3r-, 1,4-dimethyl ester,dimethyl 2r,3r-2,3-dihydroxybutanedioate,l-tartaric acid, dimethyl ester PubChem CID: 11851 IUPAC Name: dimethyl (2R,3R)-2,3-dihydroxybutanedioate SMILES: COC(=O)C(C(C(=O)OC)O)O
| PubChem CID | 11851 |
|---|---|
| CAS | 608-68-4 |
| Molecular Weight (g/mol) | 178.14 |
| MDL Number | MFCD00064437 |
| SMILES | COC(=O)C(C(C(=O)OC)O)O |
| Synonym | +-dimethyl l-tartrate,dimethyl l-tartrate,2r,3r-dimethyl 2,3-dihydroxysuccinate,dimethyl +-tartrate,l-+-tartaric acid dimethyl ester,dimethyl l-+-tartrate,1,4-dimethyl 2r,3r-2,3-dihydroxybutanedioate,butanedioic acid, 2,3-dihydroxy-2r,3r-, 1,4-dimethyl ester,dimethyl 2r,3r-2,3-dihydroxybutanedioate,l-tartaric acid, dimethyl ester |
| IUPAC Name | dimethyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChI Key | PVRATXCXJDHJJN-QWWZWVQMSA-N |
| Molecular Formula | C6H10O6 |
Phenazine Methyl Sulfate 98.0+%, TCI America™
CAS: 299-11-6 Molecular Formula: C14H14N2O4S Molecular Weight (g/mol): 306.336 MDL Number: MFCD00011923 InChI Key: RXGJTUSBYWCRBK-UHFFFAOYSA-M Synonym: phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate PubChem CID: 9285 ChEBI: CHEBI:8055 IUPAC Name: 5-methylphenazin-5-ium;methyl sulfate SMILES: C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-]
| PubChem CID | 9285 |
|---|---|
| CAS | 299-11-6 |
| Molecular Weight (g/mol) | 306.336 |
| ChEBI | CHEBI:8055 |
| MDL Number | MFCD00011923 |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Synonym | phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Molecular Formula | C14H14N2O4S |
Methyl Methacrylate (stabilized with 6-tert-Butyl-2,4-xylenol) 99.8+%, TCI America™
CAS: 80-62-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.117 MDL Number: MFCD00008587 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| Molecular Weight (g/mol) | 100.117 |
| ChEBI | CHEBI:34840 |
| MDL Number | MFCD00008587 |
| SMILES | CC(=C)C(=O)OC |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Disodium DL-Malate Hydrate 98.0+%, TCI America™
CAS: 676-46-0 Molecular Formula: C4H4Na2O5 Molecular Weight (g/mol): 178.051 MDL Number: MFCD00012466 InChI Key: WPUMTJGUQUYPIV-UHFFFAOYSA-L Synonym: disodium malate,sodium malate,disodium dl-malate,dl-malic acid disodium salt,disodium 2-hydroxybutanedioate,natriummalat german,sodium dl-malate,butanedioic acid, hydroxy-, disodium salt,malic acid, disodium salt,sodium dl-maleate PubChem CID: 8736 IUPAC Name: disodium;2-hydroxybutanedioate SMILES: C(C(C(=O)[O-])O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 8736 |
|---|---|
| CAS | 676-46-0 |
| Molecular Weight (g/mol) | 178.051 |
| MDL Number | MFCD00012466 |
| SMILES | C(C(C(=O)[O-])O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium malate,sodium malate,disodium dl-malate,dl-malic acid disodium salt,disodium 2-hydroxybutanedioate,natriummalat german,sodium dl-malate,butanedioic acid, hydroxy-, disodium salt,malic acid, disodium salt,sodium dl-maleate |
| IUPAC Name | disodium;2-hydroxybutanedioate |
| InChI Key | WPUMTJGUQUYPIV-UHFFFAOYSA-L |
| Molecular Formula | C4H4Na2O5 |
Silver Trifluoromethanesulfonate 98.0+%, TCI America™
CAS: 2923-28-6 Molecular Formula: CAgF3O3S Molecular Weight (g/mol): 256.93 MDL Number: MFCD00013226 InChI Key: QRUBYZBWAOOHSV-UHFFFAOYSA-M Synonym: silver trifluoromethanesulfonate,silver triflate,agotf,silver trifluoromethanesulphonate,trifluoromethanesulfonic acid silver salt,silver i trifluoromethanesulfonate,silver trifluoromethylsulfonate,methanesulfonic acid, trifluoro-, silver 1+ salt,silver i trifluoromethanesulphonate,silver 1+ ion triflate PubChem CID: 76223 IUPAC Name: silver(1+) trifluoromethanesulfonate SMILES: [Ag+].[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 76223 |
|---|---|
| CAS | 2923-28-6 |
| Molecular Weight (g/mol) | 256.93 |
| MDL Number | MFCD00013226 |
| SMILES | [Ag+].[O-]S(=O)(=O)C(F)(F)F |
| Synonym | silver trifluoromethanesulfonate,silver triflate,agotf,silver trifluoromethanesulphonate,trifluoromethanesulfonic acid silver salt,silver i trifluoromethanesulfonate,silver trifluoromethylsulfonate,methanesulfonic acid, trifluoro-, silver 1+ salt,silver i trifluoromethanesulphonate,silver 1+ ion triflate |
| IUPAC Name | silver(1+) trifluoromethanesulfonate |
| InChI Key | QRUBYZBWAOOHSV-UHFFFAOYSA-M |
| Molecular Formula | CAgF3O3S |
Ethylenediaminetetraacetic Acid Disodium Zinc Salt Hydrate 98.0+%, TCI America™
CAS: 14025-21-9 Molecular Formula: C10H12N2Na2O8Zn Molecular Weight (g/mol): 399.57 MDL Number: MFCD00135187 InChI Key: UBLOJEHIINPTTG-UHFFFAOYSA-J Synonym: Disodium Zinc Ethylenediaminetetraacetate PubChem CID: 51808 IUPAC Name: zinc(2+) disodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate SMILES: [Na+].[Na+].[Zn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 51808 |
|---|---|
| CAS | 14025-21-9 |
| Molecular Weight (g/mol) | 399.57 |
| MDL Number | MFCD00135187 |
| SMILES | [Na+].[Na+].[Zn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | Disodium Zinc Ethylenediaminetetraacetate |
| IUPAC Name | zinc(2+) disodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate |
| InChI Key | UBLOJEHIINPTTG-UHFFFAOYSA-J |
| Molecular Formula | C10H12N2Na2O8Zn |