Organic acids and derivatives
Filtered Search Results
2-Methyl-2h-indazole-3-carboxylic acid, 97%, Thermo Scientific™
CAS: 34252-44-3 Molecular Formula: C9H8N2O2 Molecular Weight (g/mol): 176.175 InChI Key: ABRISPFTOZIXMP-UHFFFAOYSA-N Synonym: 2-methyl-2h-indazole-3-carboxylic acid,2h-indazole-3-carboxylic acid, 2-methyl PubChem CID: 7060537 IUPAC Name: 2-methylindazole-3-carboxylic acid SMILES: CN1C(=C2C=CC=CC2=N1)C(=O)O
| PubChem CID | 7060537 |
|---|---|
| CAS | 34252-44-3 |
| Molecular Weight (g/mol) | 176.175 |
| SMILES | CN1C(=C2C=CC=CC2=N1)C(=O)O |
| Synonym | 2-methyl-2h-indazole-3-carboxylic acid,2h-indazole-3-carboxylic acid, 2-methyl |
| IUPAC Name | 2-methylindazole-3-carboxylic acid |
| InChI Key | ABRISPFTOZIXMP-UHFFFAOYSA-N |
| Molecular Formula | C9H8N2O2 |
Benzyl acrylate, 98%, stab. with ca 150ppm 4-methoxyphenol
CAS: 2495-35-4 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00048147 InChI Key: GCTPMLUUWLLESL-UHFFFAOYSA-N Synonym: benzyl acrylate,benzylacrylate,2-propenoic acid, phenylmethyl ester,sartomer sr 432,acrylic acid, benzyl ester,acrylic acid benzyl ester,phenylmethyl prop-2-enoate,benzyl 2-propenoate,fancryl fa-bza,acrylic acid benzyl PubChem CID: 75617 IUPAC Name: benzyl prop-2-enoate SMILES: C=CC(=O)OCC1=CC=CC=C1
| PubChem CID | 75617 |
|---|---|
| CAS | 2495-35-4 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00048147 |
| SMILES | C=CC(=O)OCC1=CC=CC=C1 |
| Synonym | benzyl acrylate,benzylacrylate,2-propenoic acid, phenylmethyl ester,sartomer sr 432,acrylic acid, benzyl ester,acrylic acid benzyl ester,phenylmethyl prop-2-enoate,benzyl 2-propenoate,fancryl fa-bza,acrylic acid benzyl |
| IUPAC Name | benzyl prop-2-enoate |
| InChI Key | GCTPMLUUWLLESL-UHFFFAOYSA-N |
| Molecular Formula | C10H10O2 |
3-Methylbutanamide, 97%, Thermo Scientific™
CAS: 541-46-8 Molecular Formula: C5H11NO Molecular Weight (g/mol): 101.149 MDL Number: MFCD00014807 InChI Key: SANOUVWGPVYVAV-UHFFFAOYSA-N Synonym: isovaleramide,butanamide, 3-methyl,3-methylbutyramide,isovaleric amide,isopentanamide,beta-methylbutyramide,isovaleric acid amide,unii-9cp4kb634m,isovaleramide usan,.beta.-methylbutyramide PubChem CID: 10930 IUPAC Name: 3-methylbutanamide SMILES: CC(C)CC(=O)N
| PubChem CID | 10930 |
|---|---|
| CAS | 541-46-8 |
| Molecular Weight (g/mol) | 101.149 |
| MDL Number | MFCD00014807 |
| SMILES | CC(C)CC(=O)N |
| Synonym | isovaleramide,butanamide, 3-methyl,3-methylbutyramide,isovaleric amide,isopentanamide,beta-methylbutyramide,isovaleric acid amide,unii-9cp4kb634m,isovaleramide usan,.beta.-methylbutyramide |
| IUPAC Name | 3-methylbutanamide |
| InChI Key | SANOUVWGPVYVAV-UHFFFAOYSA-N |
| Molecular Formula | C5H11NO |
5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylic acid, 97%, Thermo Scientific™
CAS: 22300-56-7 Molecular Formula: C10H9N3O2 Molecular Weight (g/mol): 203.201 MDL Number: MFCD00051653 InChI Key: GQYQHAGPALBYDO-UHFFFAOYSA-N Synonym: 5-methyl-2-phenyl-2h-1,2,3-triazole-4-carboxylic acid,4-methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid,5-methyl-2-phenyl-1,2,3-triazole-4-carboxylic acid,4-methyl-2-phenyl-2h-1,2,3-triazole-5-carboxylic acid,2h-1,2,3-triazole-4-carboxylic acid, 5-methyl-2-phenyl,acmc-20ame3,maybridge1_002457,4-carboxy-5-methyl-2-phenyl-1,2,3-triazole,2-phenyl-5-methyl-4-carboxy-2h-1,2,3-triazole,2h-1,2,3-triazole-4-carboxylicacid,5-methyl-2-phenyl PubChem CID: 519936 IUPAC Name: 5-methyl-2-phenyltriazole-4-carboxylic acid SMILES: CC1=NN(N=C1C(=O)O)C2=CC=CC=C2
| PubChem CID | 519936 |
|---|---|
| CAS | 22300-56-7 |
| Molecular Weight (g/mol) | 203.201 |
| MDL Number | MFCD00051653 |
| SMILES | CC1=NN(N=C1C(=O)O)C2=CC=CC=C2 |
| Synonym | 5-methyl-2-phenyl-2h-1,2,3-triazole-4-carboxylic acid,4-methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid,5-methyl-2-phenyl-1,2,3-triazole-4-carboxylic acid,4-methyl-2-phenyl-2h-1,2,3-triazole-5-carboxylic acid,2h-1,2,3-triazole-4-carboxylic acid, 5-methyl-2-phenyl,acmc-20ame3,maybridge1_002457,4-carboxy-5-methyl-2-phenyl-1,2,3-triazole,2-phenyl-5-methyl-4-carboxy-2h-1,2,3-triazole,2h-1,2,3-triazole-4-carboxylicacid,5-methyl-2-phenyl |
| IUPAC Name | 5-methyl-2-phenyltriazole-4-carboxylic acid |
| InChI Key | GQYQHAGPALBYDO-UHFFFAOYSA-N |
| Molecular Formula | C10H9N3O2 |
MilliporeSigma™ Calbiochem™ OmniPur™ EDTA, Disodium Salt Dihydrate Solution 0.5M
Used as Analytical reagent.
Sodium Citrate, Anhydrous, Powder, FCC, 99-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 68-04-2 Molecular Formula: C6H5Na3O7 Molecular Weight (g/mol): 258.07 MDL Number: MFCD00012462 InChI Key: HRXKRNGNAMMEHJ-UHFFFAOYSA-K IUPAC Name: trisodium 2-hydroxypropane-1,2,3-tricarboxylate SMILES: [Na+].[Na+].[Na+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| CAS | 68-04-2 |
|---|---|
| Molecular Weight (g/mol) | 258.07 |
| MDL Number | MFCD00012462 |
| SMILES | [Na+].[Na+].[Na+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| IUPAC Name | trisodium 2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | HRXKRNGNAMMEHJ-UHFFFAOYSA-K |
| Molecular Formula | C6H5Na3O7 |
DL-Homocysteine thiolactone hydrochloride, 99%
CAS: 6038-19-3 Molecular Formula: C4H8ClNOS Molecular Weight (g/mol): 153.624 MDL Number: MFCD00012724 InChI Key: ZSEGSUBKDDEALH-UHFFFAOYSA-N Synonym: dl-homocysteine thiolactone hydrochloride,3-aminodihydrothiophen-2 3h-one hydrochloride,3-aminothiolan-2-one hydrochloride,hctl hydrochloride,dl-homocysteinethiolactone hydrochloride,d,l-homocysteine thiolactone hydrochloride,d,l-homocysteinthiolakton chlorid german,+--dihydro-3-amino-2 3h-thiophenone hydrochloride,2 3h-thiophenone, dihydro-3-amino-, hydrochloride, +-,l-2-amino-4-mercaptobutyric acid 1,4-thiolactone hydrochloride PubChem CID: 110753 IUPAC Name: 3-aminothiolan-2-one;hydrochloride SMILES: C1CSC(=O)C1N.Cl
| PubChem CID | 110753 |
|---|---|
| CAS | 6038-19-3 |
| Molecular Weight (g/mol) | 153.624 |
| MDL Number | MFCD00012724 |
| SMILES | C1CSC(=O)C1N.Cl |
| Synonym | dl-homocysteine thiolactone hydrochloride,3-aminodihydrothiophen-2 3h-one hydrochloride,3-aminothiolan-2-one hydrochloride,hctl hydrochloride,dl-homocysteinethiolactone hydrochloride,d,l-homocysteine thiolactone hydrochloride,d,l-homocysteinthiolakton chlorid german,+--dihydro-3-amino-2 3h-thiophenone hydrochloride,2 3h-thiophenone, dihydro-3-amino-, hydrochloride, +-,l-2-amino-4-mercaptobutyric acid 1,4-thiolactone hydrochloride |
| IUPAC Name | 3-aminothiolan-2-one;hydrochloride |
| InChI Key | ZSEGSUBKDDEALH-UHFFFAOYSA-N |
| Molecular Formula | C4H8ClNOS |
Cycloheptylacetic acid, 99%
CAS: 4401-20-1 Molecular Formula: C9H16O2 Molecular Weight (g/mol): 156.225 MDL Number: MFCD01075701 InChI Key: DQNWKASPZFJVMJ-UHFFFAOYSA-N Synonym: cycloheptylacetic acid,cycloheptaneacetic acid,2-cycloheptylaceticacid,pubchem16200,acmc-20ald3 PubChem CID: 227401 IUPAC Name: 2-cycloheptylacetic acid SMILES: C1CCCC(CC1)CC(=O)O
| PubChem CID | 227401 |
|---|---|
| CAS | 4401-20-1 |
| Molecular Weight (g/mol) | 156.225 |
| MDL Number | MFCD01075701 |
| SMILES | C1CCCC(CC1)CC(=O)O |
| Synonym | cycloheptylacetic acid,cycloheptaneacetic acid,2-cycloheptylaceticacid,pubchem16200,acmc-20ald3 |
| IUPAC Name | 2-cycloheptylacetic acid |
| InChI Key | DQNWKASPZFJVMJ-UHFFFAOYSA-N |
| Molecular Formula | C9H16O2 |
Sodium diphenylamine-4-sulfonate, ACS
CAS: 6152-67-6 Molecular Formula: C12H11NNaO3S Molecular Weight (g/mol): 272.27 MDL Number: MFCD00036468 InChI Key: VMVSDVIYIMNZBS-UHFFFAOYSA-N Synonym: sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt PubChem CID: 517002 IUPAC Name: sodium;4-anilinobenzenesulfonate SMILES: [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1
| PubChem CID | 517002 |
|---|---|
| CAS | 6152-67-6 |
| Molecular Weight (g/mol) | 272.27 |
| MDL Number | MFCD00036468 |
| SMILES | [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1 |
| Synonym | sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt |
| IUPAC Name | sodium;4-anilinobenzenesulfonate |
| InChI Key | VMVSDVIYIMNZBS-UHFFFAOYSA-N |
| Molecular Formula | C12H11NNaO3S |
Methyl difluoroacetate, 98%
CAS: 433-53-4 Molecular Formula: C3H4F2O2 Molecular Weight (g/mol): 110.06 MDL Number: MFCD00039276 InChI Key: CSSYKHYGURSRAZ-UHFFFAOYSA-N Synonym: methyl difluoroacetate,methyl2,2-difluoroacetate,difluoroacetic acid methyl ester,acetic acid, difluoro-, methyl ester,methyldifluoroacetate,methyl difluoroacetate #,acmc-209ju0,methyl 2,2-difluoroethanoate PubChem CID: 79012 IUPAC Name: methyl 2,2-difluoroacetate SMILES: COC(=O)C(F)F
| PubChem CID | 79012 |
|---|---|
| CAS | 433-53-4 |
| Molecular Weight (g/mol) | 110.06 |
| MDL Number | MFCD00039276 |
| SMILES | COC(=O)C(F)F |
| Synonym | methyl difluoroacetate,methyl2,2-difluoroacetate,difluoroacetic acid methyl ester,acetic acid, difluoro-, methyl ester,methyldifluoroacetate,methyl difluoroacetate #,acmc-209ju0,methyl 2,2-difluoroethanoate |
| IUPAC Name | methyl 2,2-difluoroacetate |
| InChI Key | CSSYKHYGURSRAZ-UHFFFAOYSA-N |
| Molecular Formula | C3H4F2O2 |
1-Octanesulfonic Acid Sodium Salt, HPLC Grade, J.T. Baker™
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M Synonym: sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 PubChem CID: 23669624 SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23669624 |
|---|---|
| CAS | 5324-84-5 |
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |
Methyl (S)-(-)-lactate, 97%
CAS: 27871-49-4 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.11 MDL Number: MFCD00064265 InChI Key: LPEKGGXMPWTOCB-VKHMYHEASA-N Synonym: methyl s---lactate,methyl l-lactate,s-methyl lactate,--methyl l-lactate,s-lactic acid methyl ester,methyl 2s-2-hydroxypropanoate,--methyl lactate,methyl s-2-hydroxypropionate,propanoic acid, 2-hydroxy-, methyl ester, 2s,--lactic acid methyl ester PubChem CID: 94386 ChEBI: CHEBI:83222 IUPAC Name: methyl (2S)-2-hydroxypropanoate SMILES: COC(=O)[C@H](C)O
| PubChem CID | 94386 |
|---|---|
| CAS | 27871-49-4 |
| Molecular Weight (g/mol) | 104.11 |
| ChEBI | CHEBI:83222 |
| MDL Number | MFCD00064265 |
| SMILES | COC(=O)[C@H](C)O |
| Synonym | methyl s---lactate,methyl l-lactate,s-methyl lactate,--methyl l-lactate,s-lactic acid methyl ester,methyl 2s-2-hydroxypropanoate,--methyl lactate,methyl s-2-hydroxypropionate,propanoic acid, 2-hydroxy-, methyl ester, 2s,--lactic acid methyl ester |
| IUPAC Name | methyl (2S)-2-hydroxypropanoate |
| InChI Key | LPEKGGXMPWTOCB-VKHMYHEASA-N |
| Molecular Formula | C4H8O3 |
Edetate Disodium, Dihydrate, BiotechGrade, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Pyrrole-2-carboxylic acid, 97%
CAS: 634-97-9 Molecular Formula: C5H5NO2 Molecular Weight (g/mol): 111.1 MDL Number: MFCD00005219 InChI Key: WRHZVMBBRYBTKZ-UHFFFAOYSA-N Synonym: pyrrole-2-carboxylic acid,minaline,minalin,2-pyrrolecarboxylic acid,pyrrole-2-carboxylicacid,pyrrole-2-carboxylate,2-carboxypyrrole,1h-pyrrolecarboxylic acid,9ci,pyc PubChem CID: 12473 ChEBI: CHEBI:36751 IUPAC Name: 1H-pyrrole-2-carboxylic acid SMILES: C1=CNC(=C1)C(=O)O
| PubChem CID | 12473 |
|---|---|
| CAS | 634-97-9 |
| Molecular Weight (g/mol) | 111.1 |
| ChEBI | CHEBI:36751 |
| MDL Number | MFCD00005219 |
| SMILES | C1=CNC(=C1)C(=O)O |
| Synonym | pyrrole-2-carboxylic acid,minaline,minalin,2-pyrrolecarboxylic acid,pyrrole-2-carboxylicacid,pyrrole-2-carboxylate,2-carboxypyrrole,1h-pyrrolecarboxylic acid,9ci,pyc |
| IUPAC Name | 1H-pyrrole-2-carboxylic acid |
| InChI Key | WRHZVMBBRYBTKZ-UHFFFAOYSA-N |
| Molecular Formula | C5H5NO2 |
Methyl Potassium Sulfate, MP Biomedicals
CAS: 562-54-9 Molecular Formula: CH3KO4S Molecular Weight (g/mol): 150.19 MDL Number: MFCD00040472 InChI Key: WBGWGHYJIFOATF-UHFFFAOYSA-M Synonym: potassium methyl sulfate,methyl potassium sulfate,methylsulfuric acid potassium salt,unii-9b0jf05o1c,sulfuric acid, monomethyl ester, potassium salt,potassium methyl sulphate,potassium monomethylsulfate,sulfuric acid, monomethyl ester, potassium salt 1:1,75-93-4 parent,potassium methylsulfate PubChem CID: 2733094 IUPAC Name: potassium methyl sulfate SMILES: [K+].COS([O-])(=O)=O
| PubChem CID | 2733094 |
|---|---|
| CAS | 562-54-9 |
| Molecular Weight (g/mol) | 150.19 |
| MDL Number | MFCD00040472 |
| SMILES | [K+].COS([O-])(=O)=O |
| Synonym | potassium methyl sulfate,methyl potassium sulfate,methylsulfuric acid potassium salt,unii-9b0jf05o1c,sulfuric acid, monomethyl ester, potassium salt,potassium methyl sulphate,potassium monomethylsulfate,sulfuric acid, monomethyl ester, potassium salt 1:1,75-93-4 parent,potassium methylsulfate |
| IUPAC Name | potassium methyl sulfate |
| InChI Key | WBGWGHYJIFOATF-UHFFFAOYSA-M |
| Molecular Formula | CH3KO4S |