Organic acids and derivatives
Filtered Search Results
Lithium L-lactate, 97%
CAS: 27848-80-2 Molecular Formula: C3H5LiO3 Molecular Weight (g/mol): 96.01 MDL Number: MFCD00065399 InChI Key: GKQWYZBANWAFMQ-DKWTVANSSA-M Synonym: lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li PubChem CID: 23687877 IUPAC Name: lithium;(2S)-2-hydroxypropanoate SMILES: [Li+].CC(C(=O)[O-])O
| PubChem CID | 23687877 |
|---|---|
| CAS | 27848-80-2 |
| Molecular Weight (g/mol) | 96.01 |
| MDL Number | MFCD00065399 |
| SMILES | [Li+].CC(C(=O)[O-])O |
| Synonym | lithium s-2-hydroxypropanoate,l-lactic acid lithium salt,lithium l-lactate,s-2-hydroxypropionic acid lithium salt,sarcolactic acid lithium salt,lithium 1+ l-+-lactate,lithiuml-lactate,lithotab l-lactate,lactic acid lithium salt,c3h5o3.li |
| IUPAC Name | lithium;(2S)-2-hydroxypropanoate |
| InChI Key | GKQWYZBANWAFMQ-DKWTVANSSA-M |
| Molecular Formula | C3H5LiO3 |
n-Propyl acetate, 99%
CAS: 109-60-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00009372 InChI Key: YKYONYBAUNKHLG-UHFFFAOYSA-N Synonym: n-propyl acetate,acetic acid, propyl ester,propyl ethanoate,1-acetoxypropane,n-propyl ethanoate,1-propyl acetate,acetic acid n-propyl ester,octan propylu,propylacetate,acetic acid propyl ester PubChem CID: 7997 ChEBI: CHEBI:40116 IUPAC Name: propyl acetate SMILES: CCCOC(C)=O
| PubChem CID | 7997 |
|---|---|
| CAS | 109-60-4 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:40116 |
| MDL Number | MFCD00009372 |
| SMILES | CCCOC(C)=O |
| Synonym | n-propyl acetate,acetic acid, propyl ester,propyl ethanoate,1-acetoxypropane,n-propyl ethanoate,1-propyl acetate,acetic acid n-propyl ester,octan propylu,propylacetate,acetic acid propyl ester |
| IUPAC Name | propyl acetate |
| InChI Key | YKYONYBAUNKHLG-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
1,6-Hexanediol diacrylate, 99% (reactive esters), stab. with 90ppm hydroquinone
CAS: 13048-33-4 Molecular Formula: C12H18O4 Molecular Weight (g/mol): 226.27 MDL Number: MFCD00008631 InChI Key: FIHBHSQYSYVZQE-UHFFFAOYSA-N Synonym: 1,6-hexanediol diacrylate,hexamethylene diacrylate,kayarad hdda,hexane-1,6-diyl diacrylate,1,6-hexamethylene diacrylate,hexamethylene glycol diacrylate,sartomer 238,hdoda,viscoat 230,hexamethylene acrylate PubChem CID: 25644 IUPAC Name: 6-prop-2-enoyloxyhexyl prop-2-enoate SMILES: C=CC(=O)OCCCCCCOC(=O)C=C
| PubChem CID | 25644 |
|---|---|
| CAS | 13048-33-4 |
| Molecular Weight (g/mol) | 226.27 |
| MDL Number | MFCD00008631 |
| SMILES | C=CC(=O)OCCCCCCOC(=O)C=C |
| Synonym | 1,6-hexanediol diacrylate,hexamethylene diacrylate,kayarad hdda,hexane-1,6-diyl diacrylate,1,6-hexamethylene diacrylate,hexamethylene glycol diacrylate,sartomer 238,hdoda,viscoat 230,hexamethylene acrylate |
| IUPAC Name | 6-prop-2-enoyloxyhexyl prop-2-enoate |
| InChI Key | FIHBHSQYSYVZQE-UHFFFAOYSA-N |
| Molecular Formula | C12H18O4 |
Benzamide, 98+%
CAS: 55-21-0 Molecular Formula: C7H7NO Molecular Weight (g/mol): 121.139 MDL Number: MFCD00007968 InChI Key: KXDAEFPNCMNJSK-UHFFFAOYSA-N Synonym: benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide PubChem CID: 2331 ChEBI: CHEBI:28179 IUPAC Name: benzamide SMILES: C1=CC=C(C=C1)C(=O)N
| PubChem CID | 2331 |
|---|---|
| CAS | 55-21-0 |
| Molecular Weight (g/mol) | 121.139 |
| ChEBI | CHEBI:28179 |
| MDL Number | MFCD00007968 |
| SMILES | C1=CC=C(C=C1)C(=O)N |
| Synonym | benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide |
| IUPAC Name | benzamide |
| InChI Key | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO |
1-Hexanesulfonic acid, sodium salt hydrate, 98%, HPLC grade
CAS: 2832-45-3 Molecular Formula: C6H13NaO3S Molecular Weight (g/mol): 188.22 MDL Number: MFCD00007542 InChI Key: QWSZRRAAFHGKCH-UHFFFAOYSA-M Synonym: sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt PubChem CID: 23677630 IUPAC Name: sodium;hexane-1-sulfonate SMILES: [Na+].CCCCCCS([O-])(=O)=O
| PubChem CID | 23677630 |
|---|---|
| CAS | 2832-45-3 |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt |
| IUPAC Name | sodium;hexane-1-sulfonate |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Molecular Formula | C6H13NaO3S |
2,2,4-Trimethyl-1,3-pentanediol 1-monoisobutyrate
CAS: 25265-77-4 Molecular Formula: C12H24O3 Molecular Weight (g/mol): 216.321 MDL Number: MFCD00148967 InChI Key: DAFHKNAQFPVRKR-UHFFFAOYSA-N Synonym: texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate PubChem CID: 6490 IUPAC Name: (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate SMILES: CC(C)C(C(C)(C)COC(=O)C(C)C)O
| PubChem CID | 6490 |
|---|---|
| CAS | 25265-77-4 |
| Molecular Weight (g/mol) | 216.321 |
| MDL Number | MFCD00148967 |
| SMILES | CC(C)C(C(C)(C)COC(=O)C(C)C)O |
| Synonym | texanol,2,2,4-trimethyl-1,3-pentanediol monoisobutyrate,chissocizer cs 12,propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester,2,2,4-trimethylpentane-1,3-diol monoisobutyrate,3-hydroxy-2,2,4-trimethylpentyl isobutyrate,ccris 8966,isobutyraldehyde tishchenko trimer,propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol,2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate |
| IUPAC Name | (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate |
| InChI Key | DAFHKNAQFPVRKR-UHFFFAOYSA-N |
| Molecular Formula | C12H24O3 |
Methyl methanesulfonate, 99%
CAS: 66-27-3 Molecular Formula: C2H6O3S Molecular Weight (g/mol): 110.127 MDL Number: MFCD00007557 InChI Key: MBABOKRGFJTBAE-UHFFFAOYSA-N Synonym: methyl mesylate,methanesulfonic acid methyl ester,methanesulfonic acid, methyl ester,methylmethane sulfonate,methylmethansulfonat,methyl methanesulphonate,as-dimethyl sulfite,as-dimethyl sulphite,methylmethanesulfonate,methyl methansulfonate PubChem CID: 4156 ChEBI: CHEBI:25255 IUPAC Name: methyl methanesulfonate SMILES: COS(=O)(=O)C
| PubChem CID | 4156 |
|---|---|
| CAS | 66-27-3 |
| Molecular Weight (g/mol) | 110.127 |
| ChEBI | CHEBI:25255 |
| MDL Number | MFCD00007557 |
| SMILES | COS(=O)(=O)C |
| Synonym | methyl mesylate,methanesulfonic acid methyl ester,methanesulfonic acid, methyl ester,methylmethane sulfonate,methylmethansulfonat,methyl methanesulphonate,as-dimethyl sulfite,as-dimethyl sulphite,methylmethanesulfonate,methyl methansulfonate |
| IUPAC Name | methyl methanesulfonate |
| InChI Key | MBABOKRGFJTBAE-UHFFFAOYSA-N |
| Molecular Formula | C2H6O3S |
N,N-Dimethylacetamide, anhydrous, 99.8%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Allyl methacrylate, 98%, stabilized
CAS: 96-05-9 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00008592 InChI Key: FBCQUCJYYPMKRO-UHFFFAOYSA-N Synonym: allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech PubChem CID: 7274 IUPAC Name: prop-2-enyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC=C
| PubChem CID | 7274 |
|---|---|
| CAS | 96-05-9 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00008592 |
| SMILES | CC(=C)C(=O)OCC=C |
| Synonym | allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech |
| IUPAC Name | prop-2-enyl 2-methylprop-2-enoate |
| InChI Key | FBCQUCJYYPMKRO-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
2-Hydroxyethyl acrylate, 97%, stabilized
CAS: 818-61-1 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.12 MDL Number: MFCD00002865 InChI Key: OMIGHNLMNHATMP-UHFFFAOYSA-N Synonym: 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate PubChem CID: 13165 IUPAC Name: 2-hydroxyethyl prop-2-enoate SMILES: C=CC(=O)OCCO
| PubChem CID | 13165 |
|---|---|
| CAS | 818-61-1 |
| Molecular Weight (g/mol) | 116.12 |
| MDL Number | MFCD00002865 |
| SMILES | C=CC(=O)OCCO |
| Synonym | 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate |
| InChI Key | OMIGHNLMNHATMP-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
Thermo Scientific Chemicals Urea, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Thermo Scientific Chemicals Tris(2-carboxyethyl)phosphine hydrochloride, 98%, Molecular Biology Grade
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
Phloroglucinol dihydrate, 98%
CAS: 6099-90-7 Molecular Formula: C6H10O5 Molecular Weight (g/mol): 162.141 MDL Number: MFCD00149090 InChI Key: MPYXTIHPALVENR-UHFFFAOYSA-N Synonym: phloroglucinol dihydrate,benzene-1,3,5-triol dihydrate,1,3,5-trihydroxybenzene dihydrate,1,3,5-benzenetriol, dihydrate,phloroglucinol, dihydrate,sym-trihydroxybenze,unii-0x7b22brg1,ccris 6521,1,3,5-benzoltrioldihydrat,phloroglucinoldihydrate PubChem CID: 80196 IUPAC Name: benzene-1,3,5-triol;dihydrate SMILES: C1=C(C=C(C=C1O)O)O.O.O
| PubChem CID | 80196 |
|---|---|
| CAS | 6099-90-7 |
| Molecular Weight (g/mol) | 162.141 |
| MDL Number | MFCD00149090 |
| SMILES | C1=C(C=C(C=C1O)O)O.O.O |
| Synonym | phloroglucinol dihydrate,benzene-1,3,5-triol dihydrate,1,3,5-trihydroxybenzene dihydrate,1,3,5-benzenetriol, dihydrate,phloroglucinol, dihydrate,sym-trihydroxybenze,unii-0x7b22brg1,ccris 6521,1,3,5-benzoltrioldihydrat,phloroglucinoldihydrate |
| IUPAC Name | benzene-1,3,5-triol;dihydrate |
| InChI Key | MPYXTIHPALVENR-UHFFFAOYSA-N |
| Molecular Formula | C6H10O5 |
Ethyl formate, 97%
CAS: 109-94-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00003294 InChI Key: WBJINCZRORDGAQ-UHFFFAOYSA-N Synonym: areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat PubChem CID: 8025 ChEBI: CHEBI:52342 IUPAC Name: ethyl formate SMILES: CCOC=O
| PubChem CID | 8025 |
|---|---|
| CAS | 109-94-4 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:52342 |
| MDL Number | MFCD00003294 |
| SMILES | CCOC=O |
| Synonym | areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat |
| IUPAC Name | ethyl formate |
| InChI Key | WBJINCZRORDGAQ-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Thermo Scientific Chemicals Diethylenetriaminepentaacetic acid, pentasodium salt, tech., 40% aqueous solution
CAS: 140-01-2 | C14H18N3Na5O10 | 503.26 g/mol
| Linear Formula | NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Density | 1.2900g/mL |
| PubChem CID | 8779 |
| Name Note | 40% Aqueous Solution |
| Percent Purity | 39 to 41% |
| pH | 11.0 to 12.0 (1% aq. soln.) |
| Formula Weight | 503.26 |
| Melting Point | -40°C |
| Boiling Point | 106°C |
| Physical Form | Solution |
| Chemical Name or Material | Diethylenetriaminepentaacetic acid, pentasodium salt |
| Grade | Technical |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| MDL Number | MFCD00051016 |
| Health Hazard 2 | GHS H Statement Causes serious eye irritation. |
| Solubility Information | Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Packaging | Glass bottle |
| Flash Point | >100°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Refractive Index | 1.4185 to 1.4205 |
| Synonym | pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| IUPAC Name | pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate |
| Beilstein | 04, III, 1190 |
| Molecular Formula | C14H18N3Na5O10 |
| EINECS Number | 205-391-3 |
| Specific Gravity | 1.29 |