Organic acids and derivatives
Filtered Search Results
Methacrylamide, 98%
CAS: 79-39-0 Molecular Formula: C4H7NO Molecular Weight (g/mol): 85.106 MDL Number: MFCD00008018 InChI Key: FQPSGWSUVKBHSU-UHFFFAOYSA-N Synonym: methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide PubChem CID: 6595 ChEBI: CHEBI:51759 IUPAC Name: 2-methylprop-2-enamide SMILES: CC(=C)C(=O)N
| PubChem CID | 6595 |
|---|---|
| CAS | 79-39-0 |
| Molecular Weight (g/mol) | 85.106 |
| ChEBI | CHEBI:51759 |
| MDL Number | MFCD00008018 |
| SMILES | CC(=C)C(=O)N |
| Synonym | methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide |
| IUPAC Name | 2-methylprop-2-enamide |
| InChI Key | FQPSGWSUVKBHSU-UHFFFAOYSA-N |
| Molecular Formula | C4H7NO |
Thermo Scientific Chemicals (-)-Epigallocatechin gallate, 95%
CAS: 989-51-5 Molecular Formula: C22H18O11 Molecular Weight (g/mol): 458.37 InChI Key: WMBWREPUVVBILR-WIYYLYMNSA-N Synonym: =--epigallocatechin gallate,egcg,epigallocatechin gallate,epigallocatechin 3-gallate,tea catechin,epigallocatechin-3-gallate,=--epigallocatechin-3-o-gallate,teavigo,=--epigallocatechol gallate,epigallocatechin-3-monogallate PubChem CID: 65064 ChEBI: CHEBI:4806 IUPAC Name: [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate SMILES: C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O
| PubChem CID | 65064 |
|---|---|
| CAS | 989-51-5 |
| Molecular Weight (g/mol) | 458.37 |
| ChEBI | CHEBI:4806 |
| SMILES | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| Synonym | =--epigallocatechin gallate,egcg,epigallocatechin gallate,epigallocatechin 3-gallate,tea catechin,epigallocatechin-3-gallate,=--epigallocatechin-3-o-gallate,teavigo,=--epigallocatechol gallate,epigallocatechin-3-monogallate |
| IUPAC Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| InChI Key | WMBWREPUVVBILR-WIYYLYMNSA-N |
| Molecular Formula | C22H18O11 |
Vinyl acetate, 99+%, stabilized
CAS: 108-05-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 InChI Key: XTXRWKRVRITETP-UHFFFAOYSA-N Synonym: vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer PubChem CID: 7904 ChEBI: CHEBI:46916 IUPAC Name: ethenyl acetate SMILES: CC(=O)OC=C
| PubChem CID | 7904 |
|---|---|
| CAS | 108-05-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:46916 |
| SMILES | CC(=O)OC=C |
| Synonym | vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer |
| IUPAC Name | ethenyl acetate |
| InChI Key | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
3-Mercaptopropionic acid, 99%
CAS: 107-96-0 Molecular Formula: C3H6O2S Molecular Weight (g/mol): 106.139 MDL Number: MFCD00004897 InChI Key: DKIDEFUBRARXTE-UHFFFAOYSA-N Synonym: 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid PubChem CID: 6514 ChEBI: CHEBI:44111 IUPAC Name: 3-sulfanylpropanoic acid SMILES: C(CS)C(=O)O
| PubChem CID | 6514 |
|---|---|
| CAS | 107-96-0 |
| Molecular Weight (g/mol) | 106.139 |
| ChEBI | CHEBI:44111 |
| MDL Number | MFCD00004897 |
| SMILES | C(CS)C(=O)O |
| Synonym | 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid |
| IUPAC Name | 3-sulfanylpropanoic acid |
| InChI Key | DKIDEFUBRARXTE-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2S |
Aminoguanidine bicarbonate, 98.5%
CAS: 2582-30-1 Molecular Formula: CH6N4·H2CO3 Molecular Weight (g/mol): 136.11 InChI Key: OTXHZHQQWQTQMW-UHFFFAOYSA-N Synonym: aminoguanidine bicarbonate,aminoguanidine hydrogen carbonate,aminoguanidinium bicarbonate,aminoguanidine hydrocarbonate,aminoguanidine carbonate 1:1,aminoguanidium hydrogen carbonate,n1-aminoguanidine carbonate 1:1,aminoguanidine hydrogencarbonate,aminoguanidinebicarbonate,hydrazinecarboximidamide carbonate PubChem CID: 164944 IUPAC Name: 2-aminoguanidine;carbonic acid SMILES: C(=NN)(N)N.C(=O)(O)O
| PubChem CID | 164944 |
|---|---|
| CAS | 2582-30-1 |
| Molecular Weight (g/mol) | 136.11 |
| SMILES | C(=NN)(N)N.C(=O)(O)O |
| Synonym | aminoguanidine bicarbonate,aminoguanidine hydrogen carbonate,aminoguanidinium bicarbonate,aminoguanidine hydrocarbonate,aminoguanidine carbonate 1:1,aminoguanidium hydrogen carbonate,n1-aminoguanidine carbonate 1:1,aminoguanidine hydrogencarbonate,aminoguanidinebicarbonate,hydrazinecarboximidamide carbonate |
| IUPAC Name | 2-aminoguanidine;carbonic acid |
| InChI Key | OTXHZHQQWQTQMW-UHFFFAOYSA-N |
| Molecular Formula | CH6N4·H2CO3 |
Thermo Scientific Chemicals N,N'-Methylenebisacrylamide, 99+%
CAS: 110-26-9 Molecular Formula: C7H10N2O2 Molecular Weight (g/mol): 154.169 MDL Number: MFCD00008625 InChI Key: ZIUHHBKFKCYYJD-UHFFFAOYSA-N Synonym: n,n'-methylenebisacrylamide,n,n'-methylenediacrylamide,n,n'-methylene-bis-acrylamide,methylenebisacrylamide,methylenediacrylamide,2-propenamide, n,n'-methylenebis,bis-acrylamide,n,n'-methylenebis acrylamide,n,n'-methylidenebisacrylamide,bisacrylamide PubChem CID: 8041 IUPAC Name: N-[(prop-2-enoylamino)methyl]prop-2-enamide SMILES: C=CC(=O)NCNC(=O)C=C
| PubChem CID | 8041 |
|---|---|
| CAS | 110-26-9 |
| Molecular Weight (g/mol) | 154.169 |
| MDL Number | MFCD00008625 |
| SMILES | C=CC(=O)NCNC(=O)C=C |
| Synonym | n,n'-methylenebisacrylamide,n,n'-methylenediacrylamide,n,n'-methylene-bis-acrylamide,methylenebisacrylamide,methylenediacrylamide,2-propenamide, n,n'-methylenebis,bis-acrylamide,n,n'-methylenebis acrylamide,n,n'-methylidenebisacrylamide,bisacrylamide |
| IUPAC Name | N-[(prop-2-enoylamino)methyl]prop-2-enamide |
| InChI Key | ZIUHHBKFKCYYJD-UHFFFAOYSA-N |
| Molecular Formula | C7H10N2O2 |
Thermo Scientific Chemicals Diethylenetriaminepentaacetic acid, pentasodium salt, tech., 40% aqueous solution
CAS: 140-01-2 | C14H18N3Na5O10 | 503.26 g/mol
| Linear Formula | NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Density | 1.2900g/mL |
| PubChem CID | 8779 |
| Name Note | 40% Aqueous Solution |
| Percent Purity | 39 to 41% |
| pH | 11.0 to 12.0 (1% aq. soln.) |
| Formula Weight | 503.26 |
| Melting Point | -40°C |
| Boiling Point | 106°C |
| Physical Form | Solution |
| Chemical Name or Material | Diethylenetriaminepentaacetic acid, pentasodium salt |
| Grade | Technical |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| MDL Number | MFCD00051016 |
| Health Hazard 2 | GHS H Statement Causes serious eye irritation. |
| Solubility Information | Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Packaging | Glass bottle |
| Flash Point | >100°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Refractive Index | 1.4185 to 1.4205 |
| Synonym | pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| IUPAC Name | pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate |
| Beilstein | 04, III, 1190 |
| Molecular Formula | C14H18N3Na5O10 |
| EINECS Number | 205-391-3 |
| Specific Gravity | 1.29 |
Cyanoacetic acid, 97%
CAS: 372-09-8 Molecular Formula: C3H3NO2 Molecular Weight (g/mol): 85.062 MDL Number: MFCD00002677 InChI Key: MLIREBYILWEBDM-UHFFFAOYSA-N Synonym: cyanoacetic acid,acetic acid, cyano,malonic mononitrile,acide cyanacetique,cyanessigsaeure,monocyanoacetic acid,malonic acid mononitrile,usaf kf-17,cyanoethanoic acid,kyselina kyanoctova PubChem CID: 9740 ChEBI: CHEBI:51889 IUPAC Name: 2-cyanoacetic acid SMILES: C(C#N)C(=O)O
| PubChem CID | 9740 |
|---|---|
| CAS | 372-09-8 |
| Molecular Weight (g/mol) | 85.062 |
| ChEBI | CHEBI:51889 |
| MDL Number | MFCD00002677 |
| SMILES | C(C#N)C(=O)O |
| Synonym | cyanoacetic acid,acetic acid, cyano,malonic mononitrile,acide cyanacetique,cyanessigsaeure,monocyanoacetic acid,malonic acid mononitrile,usaf kf-17,cyanoethanoic acid,kyselina kyanoctova |
| IUPAC Name | 2-cyanoacetic acid |
| InChI Key | MLIREBYILWEBDM-UHFFFAOYSA-N |
| Molecular Formula | C3H3NO2 |
Dibutylboron trifluoromethanesulfonate, 1M sol. in dichloromethane
CAS: 60669-69-4 | C9H18BF3O3S | 274.11 g/mol
| Linear Formula | CF3SO3B[(CH2)3CH3]2 |
|---|---|
| Molecular Weight (g/mol) | 274.11 |
| Color | Orange to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Dibutylboron trifluoromethanesulfonate |
| SMILES | CCCCB(CCCC)OS(=O)(=O)C(F)(F)F |
| InChI Key | FAVAVMFXAKZTMV-UHFFFAOYSA-N |
| Density | 1.2710g/mL |
| Assay Percent Range | 98% |
| PubChem CID | 2724243 |
| Fieser | 07,91; 09,140; 16,109 |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse |
| MDL Number | MFCD00009669 |
| Health Hazard 2 | GHS H Statement Flammable liquid and vapour. Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. |
| Solubility Information | Solubility in water: reacts. |
| Packaging | Glass Bottle |
| Flash Point | 27°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | dibutylboron trifluoromethanesulfonate,dibutylboryl trifluoromethanesulfonate solution,nbu2botf,bu2botf,dibutylboron triflate,n-bu 2botf,dibutylboryl trifluoromethanesulfonate,dibutylboron triflate solution,trifluoromethylsulfonyloxy dibutylborane,dibutyl trifluoromethyl sulfonyl oxy borane |
| IUPAC Name | dibutylboranyl trifluoromethanesulfonate |
| Molecular Formula | C9H18BF3O3S |
| Formula Weight | 274.11 |
| Specific Gravity | 1.271 |
Sodium 1-heptanesulfonate, 99% (dry wt.), water <2%
CAS: 22767-50-6 Molecular Formula: C7H15NaO3S Molecular Weight (g/mol): 202.244 MDL Number: MFCD00007543 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M Synonym: sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate PubChem CID: 23672332 IUPAC Name: sodium;heptane-1-sulfonate SMILES: CCCCCCCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| Molecular Weight (g/mol) | 202.244 |
| MDL Number | MFCD00007543 |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Synonym | sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate |
| IUPAC Name | sodium;heptane-1-sulfonate |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Molecular Formula | C7H15NaO3S |
Phenylboronic acid, 98+%, may contain varying amounts of anhydride
CAS: 98-80-6 Molecular Formula: C6H7BO2 Molecular Weight (g/mol): 121.93 MDL Number: MFCD00002103 InChI Key: HXITXNWTGFUOAU-UHFFFAOYSA-N Synonym: benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 PubChem CID: 66827 ChEBI: CHEBI:44923 IUPAC Name: phenylboronic acid SMILES: OB(O)C1=CC=CC=C1
| PubChem CID | 66827 |
|---|---|
| CAS | 98-80-6 |
| Molecular Weight (g/mol) | 121.93 |
| ChEBI | CHEBI:44923 |
| MDL Number | MFCD00002103 |
| SMILES | OB(O)C1=CC=CC=C1 |
| Synonym | benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 |
| IUPAC Name | phenylboronic acid |
| InChI Key | HXITXNWTGFUOAU-UHFFFAOYSA-N |
| Molecular Formula | C6H7BO2 |
Ethyl cinnamate, 98% trans
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.21 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.21 |
| ChEBI | CHEBI:4895 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
n-Butyl acetate, 99+%
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, dipotassium salt dihydrate, 99%, extra pure
CAS: 25102-12-9 Molecular Formula: C10H14K2N2O8·2H2O Molecular Weight (g/mol): 404.46 MDL Number: MFCD00150036 InChI Key: JFROQFOCFOKDKU-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx PubChem CID: 53486451 IUPAC Name: dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+]
| PubChem CID | 53486451 |
|---|---|
| CAS | 25102-12-9 |
| Molecular Weight (g/mol) | 404.46 |
| MDL Number | MFCD00150036 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+] |
| Synonym | ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx |
| IUPAC Name | dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | JFROQFOCFOKDKU-UHFFFAOYSA-L |
| Molecular Formula | C10H14K2N2O8·2H2O |
Ethyl formate, 98+%, pure
CAS: 109-94-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00003294 InChI Key: WBJINCZRORDGAQ-UHFFFAOYSA-N Synonym: areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat PubChem CID: 8025 ChEBI: CHEBI:52342 IUPAC Name: ethyl formate SMILES: CCOC=O
| PubChem CID | 8025 |
|---|---|
| CAS | 109-94-4 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:52342 |
| MDL Number | MFCD00003294 |
| SMILES | CCOC=O |
| Synonym | areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat |
| IUPAC Name | ethyl formate |
| InChI Key | WBJINCZRORDGAQ-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |