Organonitrogen Compounds
Medchemexpress LLC (2R,2'R)-4,4'-Disulfanediylbis(2-aminobutanoic acid) | 6027-15-2 | 98.0% | C8H16N2O4S2 | 5 G
(2R,2'R)-4,4'-Disulfanediylbis(2-aminobutanoic acid) is a cysteine derivative. Amino acids and amino acid derivatives, such as this product, have been used commercially as ergogenic supplements. They are known to influence the secretion of anabolic hormones, supply fuel during exercise, improve mental performance during stress-related tasks, and prevent exercise-induced muscle damage, thus recognized as beneficial ergogenic dietary substances.
- Cysteine derivative
- Influences secretion of anabolic hormones
- Supplies fuel during exercise
- Improves mental performance during stress-related tasks
- Prevents exercise-induced muscle damage
eMolecules 182076-49-9 | (R)-1-N-Benzyl-prolinol | MFCD03790915 | 1g
Ambeed | (2-(2-Propoxyethoxy)phenyl)boronic acid | 250mg | 572901263 | A111429 | 279262-53-2 | MFCD18434429 | 224.060 | C11H17BO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 66493-39-8 | 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid | Synthonix | MFCD00037428 | 237.255 | C12H15NO4 | 95.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C(O)=O | 1g | 831794875](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159501.jpg-250.jpg)
eMolecules 66493-39-8 | 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid | Synthonix | MFCD00037428 | 237.255 | C12H15NO4 | 95.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C(O)=O | 1g | 831794875
4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid | Synthonix | 66493-39-8 | MFCD00037428 | 237.255 | C12H15NO4 | 95.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C(O)=O | 1g | 831794875
![eMolecules 925240-97-7 | (S)-a-[Fmoc-(methyl)amino]cyclohexaneacetic acid | Advanced ChemBlocks - In Stock393.483 | C24H27NO4 | 95.000 | CN([C@@H](C1CCCCC1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 412261534](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000225400.jpg-250.jpg)
eMolecules 925240-97-7 | (S)-a-[Fmoc-(methyl)amino]cyclohexaneacetic acid | Advanced ChemBlocks - In Stock393.483 | C24H27NO4 | 95.000 | CN([C@@H](C1CCCCC1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 412261534
(S)-a-[Fmoc-(methyl)amino]cyclohexaneacetic acid | Advanced ChemBlocks - In Stock | 925240-97-7393.483 | C24H27NO4 | 95.000 | CN([C@@H](C1CCCCC1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 412261534
Medchemexpress LLC (1S,2R)-2-Amino-1,2-diphenylethanol | 23364-44-5 | 100.0% | C14H15NO | 10 G
(1S,2R)-2-Amino-1,2-diphenylethanol is a biochemical reagent suitable for various life science-related research applications as a biological material or organic compound. It also acts as a potent and selective inhibitor of Histone deacetylase-3.
- Functions as a biochemical reagent
- Can be used as a biological material or organic compound
- Potent and selective inhibitor of Histone deacetylase-3
- Appears as a white to off-white solid
- High purity of 99.96%
- Molecular weight of 213.28
- Soluble in DMSO
Medchemexpress LLC Methyl 2-amino-2-cyclopropylacetate hydrochloride | 535936-86-8 | 165.62 | 250 MG
Methyl 2-amino-2-cyclopropylacetate hydrochloride is a derivative of Glycine. Amino acids and their derivatives are used commercially as ergogenic supplements.
- They impact the secretion of anabolic hormones.
- They provide fuel during exercise.
- They improve mental performance during stress-related tasks.
- They help prevent exercise-induced muscle damage.
- Recognized for their benefits as ergogenic dietary substances.
eMolecules 1250998-21-0 | 2-methylpropan-2-yl 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-5-carboxylate | Abosyn Chemicals Inc. | MFCD17017290 | 302.172 | C11H16BrN3O2 | 0.000 | CC(C)(C)OC(=O)N1CCn2nc(Br)cc2C1 | 10g | 812069014
2-methylpropan-2-yl 2-bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-5-carboxylate | Abosyn Chemicals Inc. | 1250998-21-0 | MFCD17017290 | 302.172 | C11H16BrN3O2 | 0.000 | CC(C)(C)OC(=O)N1CCn2nc(Br)cc2C1 | 10g | 812069014
![eMolecules 66493-39-8 | 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid | Synthonix | MFCD00037428 | 237.255 | C12H15NO4 | 95.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C(O)=O | 10g | 831794877](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000160112.jpg-250.jpg)
eMolecules 66493-39-8 | 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid | Synthonix | MFCD00037428 | 237.255 | C12H15NO4 | 95.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C(O)=O | 10g | 831794877
4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid | Synthonix | 66493-39-8 | MFCD00037428 | 237.255 | C12H15NO4 | 95.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C(O)=O | 10g | 831794877
![eMolecules 925240-97-7 | (S)-a-[Fmoc-(methyl)amino]cyclohexaneacetic acid | Acrotein ChemBio Inc.393.483 | C24H27NO4 | 97.000 | CN([C@@H](C1CCCCC1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 487536665](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000166047.jpg-250.jpg)
eMolecules 925240-97-7 | (S)-a-[Fmoc-(methyl)amino]cyclohexaneacetic acid | Acrotein ChemBio Inc.393.483 | C24H27NO4 | 97.000 | CN([C@@H](C1CCCCC1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 487536665
(S)-a-[Fmoc-(methyl)amino]cyclohexaneacetic acid | Acrotein ChemBio Inc. | 925240-97-7393.483 | C24H27NO4 | 97.000 | CN([C@@H](C1CCCCC1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 487536665
eMolecules 111-57-9 | Medchem Express | Stearoylethanolamide | 5mg | 482204047 | HY-113015 | MFCD00045971 | 327.553 | C20H41NO2
ChemScene | 7-Bromo-28-dimethylquinolin-4-ol | 100mg | 712788654 | CS-0435880 | 1189106-80-6 | MFCD12675041 | 252.111 | C11H10BrNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool