UserName
Choose the brand aligned with your industry so we can best serve your needs.
For researchers, scientists, and technical professionals: Your one-stop shop for the complete range of laboratory, production, and safety products and services.
For healthcare professionals: Your proven destination for comprehensive diagnostic and clinical laboratory products and services.
Pyridine-2-carboximidamide hydrochloride | Oakwood Chemical | 51285-26-8 | MFCD00052271 | 157.600 | C6H8ClN3 | 97.000 | Cl.NC(=N)c1ccccn1 | 1g | 537692932
Diamide | Combi-Blocks | 10465-78-8 | MFCD00008318 | 172.188 | C6H12N4O2 | 98.000 | CN(C)C(=O)\N=N\C(=O)N(C)C | 25g | 228815483
3-((Difluoromethyl)sulfonyl)propan-1-amine hydrochloride | ChemScene | 2490400-70-7209.640 | C4H10ClF2NO2S | 98.000 | Cl.NCCCS(=O)(=O)C(F)F | 100mg | 718356374
Bis(2-diphenylphosphinophenyl)ether | Combi-Blocks | 166330-10-5 | MFCD00233863 | 538.567 | C36H28OP2 | 98.000 | O(c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 | 100g | 257647933
Free PNP: <200ppm
2-((5-Bromopyrimidin-2-yl)oxy)acetic acid | Combi-Blocks | 270912-79-3 | MFCD09753920 | 233.021 | C6H5BrN2O3 | 98.000 | OC(=O)COc1ncc(Br)cn1 | 1g | 415498882
3-(2-Hydroxyethylcarbamoyl)phenylboronic acid | Combi-Blocks | 955422-14-7 | MFCD09878355 | 209.010 | C9H12BNO4 | 97.000 | OCCNC(=O)c1cccc(c1)B(O)O | 1g | 117523698
4-(4-Bromophenethyl)morpholine | Combi-Blocks | 736991-39-2 | MFCD11855960 | 270.170 | C12H16BrNO | 98.000 | Brc1ccc(CCN2CCOCC2)cc1 | 1g | 117542779
Carbamimidic chloride hydrochloride | Ambeed | 29671-92-9 | MFCD00035527 | 114.960 | CH4Cl2N2 | 97.000 | Cl.NC(Cl)=N | 5g | 525106618
2-Methylpropan-2-aminium chloride | Oakwood Chemical | 10017-37-5 | MFCD00042027 | 109.600 | C4H12ClN | 98.000 | Cl.CC(C)(C)N | 5g | 537712187
N-Fmoc-N-methyl-(S)-3-cyclopentylalanine | Acrotein ChemBio Inc. | 2407830-01-5393.483 | C24H27NO4 | 97.000 | CN([C@@H](CC1CCCC1)C(O)=O)C(=O)OCC1c2ccccc2-c2ccccc12 | 0.5g | 625591080
Trimethylamine anhydrous | Oakwood Chemical | 75-50-3 | MFCD00008327 | 59.112 | C3H9N | 99.000 | CN(C)C | 400g | 642185219
N,N'-Diisopropylcarbodiimide | Chem-Impex | 693-13-0 | MFCD00065689 | 126.203 | C7H14N2 | 99.000 | CC(C)N=C=NC(C)C | 500g | 112439039
4-Bromo-2,6-diethylaniline | Oakwood Chemical | 56746-19-1 | MFCD00059266 | 228.133 | C10H14BrN | 97.000 | CCc1cc(Br)cc(CC)c1N | 1g | 537711487
5000841172 O-BENZYLHYDROXYLAMINE HY 100G