Organooxygen compounds
eMolecules 18992-80-8 | 3'-Dimethylaminoacetophenone | Combi-Blocks | MFCD00059343 | 163.220 | C10H13NO | 95.000 | CN(C)c1cccc(c1)C(C)=O | 5g | 267198716
3'-Dimethylaminoacetophenone | Combi-Blocks | 18992-80-8 | MFCD00059343 | 163.220 | C10H13NO | 95.000 | CN(C)c1cccc(c1)C(C)=O | 5g | 267198716
eMolecules 403-42-9 | 4'-Fluoroacetophenone | Combi-Blocks | MFCD00000354 | 138.141 | C8H7FO | 98.000 | CC(=O)c1ccc(F)cc1 | 5g | 303332007
4'-Fluoroacetophenone | Combi-Blocks | 403-42-9 | MFCD00000354 | 138.141 | C8H7FO | 98.000 | CC(=O)c1ccc(F)cc1 | 5g | 303332007
eMolecules 25016-10-8 | 1,5-Dimethyl-1h-pyrazole-3-carbaldehyde | Combi-Blocks | MFCD04967221 | 124.143 | C6H8N2O | 98.000 | Cc1cc(C=O)nn1C | 1g | 303333900
1,5-Dimethyl-1h-pyrazole-3-carbaldehyde | Combi-Blocks | 25016-10-8 | MFCD04967221 | 124.143 | C6H8N2O | 98.000 | Cc1cc(C=O)nn1C | 1g | 303333900
Sigma Aldrich Fine Chemicals Biosciences gycerol BioReagent suitab500ML
Glycerol is odourless colorless viscous in nature and exists as a sweet tasting liquid. It can be derived naturally as well as from petrochemical feedstock. Glycerol has a wide variety of applications and is one of the most valuable and versatile chemical substances in nature. It can be used as an emollient solvent sweetening agent in pharmaceutical formulations cosmetics foodstuffs and toiletries. It is very stable and can be easily stored under normal temperature also it is non-irritating and has no adverse impact to the environment.
eMolecules 902837-55-2 | Ethyl 6-chloro-3-pyridylglyoxylate | Combi-Blocks | MFCD07781188 | 213.620 | C9H8ClNO3 | 97.000 | CCOC(=O)C(=O)c1ccc(Cl)nc1 | 250mg | 232334865
Ethyl 6-chloro-3-pyridylglyoxylate | Combi-Blocks | 902837-55-2 | MFCD07781188 | 213.620 | C9H8ClNO3 | 97.000 | CCOC(=O)C(=O)c1ccc(Cl)nc1 | 250mg | 232334865