Organosulfur Compounds
AdipoGen 6-Dimethylaminopurine
Chemical. CAS 938-55-6. Formula C7H9N5. MW 163.18. Synthetic. A puromycin analog that acts as a protein kinase inhibitor. Selectively induces premature mitosis in mammalian cells. Inhibits TNF-alpha upregulation of ICAM-1, lipolysis, and the activation of JNK/SAPK. Inhibits p34cdc2/cyclin B IC50 = 300 µM. Induces apoptosis in S-phase-arrested HeLa cells ~5 mM.
eMolecules 88768-45-0 | (2-Pyrimidylthio)acetic acid | Oakwood Chemical | MFCD00010287 | 170.190 | C6H6N2O2S | 98.000 | OC(=O)CSc1ncccn1 | 5g | 537673966
(2-Pyrimidylthio)acetic acid | Oakwood Chemical | 88768-45-0 | MFCD00010287 | 170.190 | C6H6N2O2S | 98.000 | OC(=O)CSc1ncccn1 | 5g | 537673966
eMolecules 1193-82-4 | (Methylsulfinyl)benzene | Oakwood Chemicals | MFCD00002088 | 140.200 | C7H8OS | 95.000 | CS(=O)c1ccccc1 | 5g | 480156440
(Methylsulfinyl)benzene | Oakwood Chemicals | 1193-82-4 | MFCD00002088 | 140.200 | C7H8OS | 95.000 | CS(=O)c1ccccc1 | 5g | 480156440
eMolecules 505-10-2 | 3-Methylthio-1-propanol | Oakwood Chemical | MFCD00036560 | 106.180 | C4H10OS | 98.000 | CSCCCO | 1g | 537697811
3-Methylthio-1-propanol | Oakwood Chemical | 505-10-2 | MFCD00036560 | 106.180 | C4H10OS | 98.000 | CSCCCO | 1g | 537697811
eMolecules 1256345-90-0 | 6-(Isopropylthio)pyridine-3-boronic acid | Combi-Blocks | MFCD16295060 | 197.060 | C8H12BNO2S | 98.000 | CC(C)Sc1ccc(cn1)B(O)O | 1g | 117524564
6-(Isopropylthio)pyridine-3-boronic acid | Combi-Blocks | 1256345-90-0 | MFCD16295060 | 197.060 | C8H12BNO2S | 98.000 | CC(C)Sc1ccc(cn1)B(O)O | 1g | 117524564
eMolecules 1218790-69-2 | 2-(Isobutylthio)pyridine-5-boronic acid | Combi-Blocks | MFCD15143473 | 211.090 | C9H14BNO2S | 98.000 | CC(C)CSc1ccc(cn1)B(O)O | 1g | 117524531
2-(Isobutylthio)pyridine-5-boronic acid | Combi-Blocks | 1218790-69-2 | MFCD15143473 | 211.090 | C9H14BNO2S | 98.000 | CC(C)CSc1ccc(cn1)B(O)O | 1g | 117524531
eMolecules 148312-55-4 | tert-Butyl thiazolidine-3-carboxylate | MFCD22581582 | 1g
Ambeed | 2-Chloro-3-(4455-tetramethyl-132-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine | 250mg | 716947782 | A277029 | 2068737-11-9 | MFCD16996474 | 307.500 | C12H14BClF3NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1312095-44-5 | (2-(Methylthio)pyrimidin-4-yl)methanamine | MFCD19981683 | 250mg
Ambeed | 2-Methylbenzo[d]isothiazol-3(2H)-one 11-dioxide | 250mg | 525126502 | A211588 | 15448-99-4 | MFCD00059263 | 197.210 | C8H7NO3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules Lipoamide-PEG11-Mal | BroadpharmMFCD21363248 | 884.110 | C39H69N3O15S2 | 95.000 | O=C(CCCCC1CCSS1)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O | 500mg | 247403005
Lipoamide-PEG11-Mal | BroadpharmMFCD21363248 | 884.110 | C39H69N3O15S2 | 95.000 | O=C(CCCCC1CCSS1)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O | 500mg | 247403005
eMolecules 6325-91-3 | 2-Mercapto-5-nitrobenzimidazole | MFCD00804727 | 25g
Combi-Blocks | 2-Mercapto-5-nitrobenzimidazole | 25g | 335354889 | QF-9095 | 95.000 | 6325-91-3 | MFCD00804727 | 195.200 | C7H5N3O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 3698-89-3 | Dodecyl methyl sulfide | Oakwood Chemicals | MFCD00015073 | 216.430 | C13H28S | 98.000 | CCCCCCCCCCCCSC | 1g | 480148191
Dodecyl methyl sulfide | Oakwood Chemicals | 3698-89-3 | MFCD00015073 | 216.430 | C13H28S | 98.000 | CCCCCCCCCCCCSC | 1g | 480148191
![eMolecules 30065-27-1 | (2-Benzimidazolylthio)acetic acid hydrazide | Oakwood Chemical | MFCD00171027 | 222.270 | C9H10N4OS | 0.000 | NNC(=O)CSc1nc2ccccc2[nH]1 | 1g | 537672208](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502149456.JPG-250.jpg)
eMolecules 30065-27-1 | (2-Benzimidazolylthio)acetic acid hydrazide | Oakwood Chemical | MFCD00171027 | 222.270 | C9H10N4OS | 0.000 | NNC(=O)CSc1nc2ccccc2[nH]1 | 1g | 537672208
(2-Benzimidazolylthio)acetic acid hydrazide | Oakwood Chemical | 30065-27-1 | MFCD00171027 | 222.270 | C9H10N4OS | 0.000 | NNC(=O)CSc1nc2ccccc2[nH]1 | 1g | 537672208
eMolecules 349402-18-2 | N-(3-Methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide | AA Blocks LLC | MFCD02229286 | 288.320 | C11H16N2O5S | 0.000 | COCCCNS(=O)(=O)c1ccc(C)c(c1)[N+]([O-])=O | 1g | 913106108
N-(3-Methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide | AA Blocks LLC | 349402-18-2 | MFCD02229286 | 288.320 | C11H16N2O5S | 0.000 | COCCCNS(=O)(=O)c1ccc(C)c(c1)[N+]([O-])=O | 1g | 913106108
eMolecules 62-56-6 | Thiourea | Chem-Impex | MFCD00008067 | 76.120 | CH4N2S | 99.000 | NC(N)=S | 25kg | 342448904
Thiourea | Chem-Impex | 62-56-6 | MFCD00008067 | 76.120 | CH4N2S | 99.000 | NC(N)=S | 25kg | 342448904