Inorganic Salts
Filtered Search Results
Sodium tellurate(VI) hydrate, Te 45% min
CAS: 10101-83-4 Molecular Formula: Na2O4Te Molecular Weight (g/mol): 237.58 MDL Number: MFCD00014242 InChI Key: XERQTZLDFHNZIC-UHFFFAOYSA-L Synonym: sodium tellurate,unii-7kar02f0r0,natriumtellurat,2na.o4te,disodium tellurate,telluric acid h2teo4 , sodium salt 1:2,telluric acid h2teo4 ,disodium salt, dihydrate 8ci,9ci PubChem CID: 13652393 SMILES: [Na+].[Na+].[O-][Te]([O-])(=O)=O
| PubChem CID | 13652393 |
|---|---|
| CAS | 10101-83-4 |
| Molecular Weight (g/mol) | 237.58 |
| MDL Number | MFCD00014242 |
| SMILES | [Na+].[Na+].[O-][Te]([O-])(=O)=O |
| Synonym | sodium tellurate,unii-7kar02f0r0,natriumtellurat,2na.o4te,disodium tellurate,telluric acid h2teo4 , sodium salt 1:2,telluric acid h2teo4 ,disodium salt, dihydrate 8ci,9ci |
| InChI Key | XERQTZLDFHNZIC-UHFFFAOYSA-L |
| Molecular Formula | Na2O4Te |
| CAS | 13569-80-7 |
|---|---|
| MDL Number | MFCD00016071 |
Antimony(III) sulfide, 98%
CAS: 1345-04-6 Molecular Formula: S3Sb2 Molecular Weight (g/mol): 339.70 MDL Number: MFCD00011217 InChI Key: NVWBARWTDVQPJD-UHFFFAOYSA-N Synonym: Antimony trisulfide IUPAC Name: diantimony(3+) trisulfanediide SMILES: [S--].[S--].[S--].[Sb+3].[Sb+3]
| CAS | 1345-04-6 |
|---|---|
| Molecular Weight (g/mol) | 339.70 |
| MDL Number | MFCD00011217 |
| SMILES | [S--].[S--].[S--].[Sb+3].[Sb+3] |
| Synonym | Antimony trisulfide |
| IUPAC Name | diantimony(3+) trisulfanediide |
| InChI Key | NVWBARWTDVQPJD-UHFFFAOYSA-N |
| Molecular Formula | S3Sb2 |
Copper(II) acetate monohydrate, ACS reagent
CAS: 6046-93-1 Molecular Formula: C4H8CuO5 Molecular Weight (g/mol): 199.65 MDL Number: MFCD00149570 InChI Key: NWFNSTOSIVLCJA-UHFFFAOYSA-L Synonym: copper ii acetate monohydrate,cupric acetate monohydrate,copper diacetate monohydrate,copper acetate monohydrate,copper 2+ acetate, monohydrate,acetic acid, copper 2+ salt, monohydrate,verdigris,copper acetate hydrate,diacetoxycopper hydrate,copper acetate, hydrate PubChem CID: 165397 IUPAC Name: copper;diacetate;hydrate SMILES: O.[Cu++].CC([O-])=O.CC([O-])=O
| PubChem CID | 165397 |
|---|---|
| CAS | 6046-93-1 |
| Molecular Weight (g/mol) | 199.65 |
| MDL Number | MFCD00149570 |
| SMILES | O.[Cu++].CC([O-])=O.CC([O-])=O |
| Synonym | copper ii acetate monohydrate,cupric acetate monohydrate,copper diacetate monohydrate,copper acetate monohydrate,copper 2+ acetate, monohydrate,acetic acid, copper 2+ salt, monohydrate,verdigris,copper acetate hydrate,diacetoxycopper hydrate,copper acetate, hydrate |
| IUPAC Name | copper;diacetate;hydrate |
| InChI Key | NWFNSTOSIVLCJA-UHFFFAOYSA-L |
| Molecular Formula | C4H8CuO5 |
Thermo Scientific Chemicals Lithium chloride, 99%, for molecular biology
CAS: 7447-41-8 Molecular Formula: ClLi Molecular Weight (g/mol): 42.39 MDL Number: MFCD00011078 InChI Key: KWGKDLIKAYFUFQ-UHFFFAOYSA-M Synonym: lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride PubChem CID: 433294 ChEBI: CHEBI:48607 IUPAC Name: lithium;chloride SMILES: [Li+].[Cl-]
| PubChem CID | 433294 |
|---|---|
| CAS | 7447-41-8 |
| Molecular Weight (g/mol) | 42.39 |
| ChEBI | CHEBI:48607 |
| MDL Number | MFCD00011078 |
| SMILES | [Li+].[Cl-] |
| Synonym | lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride |
| IUPAC Name | lithium;chloride |
| InChI Key | KWGKDLIKAYFUFQ-UHFFFAOYSA-M |
| Molecular Formula | ClLi |
tert-Butyldimethylchlorosilane, 50% w/w in toluene, Thermo Scientific Chemicals
CAS: 18162-48-6 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.721 MDL Number: MFCD00000501 InChI Key: BCNZYOJHNLTNEZ-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride PubChem CID: 28928 ChEBI: CHEBI:85071 IUPAC Name: tert-butyl-chloro-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)Cl
| PubChem CID | 28928 |
|---|---|
| CAS | 18162-48-6 |
| Molecular Weight (g/mol) | 150.721 |
| ChEBI | CHEBI:85071 |
| MDL Number | MFCD00000501 |
| SMILES | CC(C)(C)[Si](C)(C)Cl |
| Synonym | tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride |
| IUPAC Name | tert-butyl-chloro-dimethylsilane |
| InChI Key | BCNZYOJHNLTNEZ-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
Chlorotri-n-butylsilane, 97%
CAS: 995-45-9 Molecular Formula: C12H27ClSi Molecular Weight (g/mol): 234.883 MDL Number: MFCD00000509 InChI Key: JSQJUDVTRRCSRU-UHFFFAOYSA-N Synonym: silane, tributylchloro,chlorotributylsilane,chlorotri-n-butylsilane,tributyl chloro silane,tri-n-butylchlorosilane,tributylsilyl chloride,tributylchloro-silan,chloro-tri-n-butylsilane PubChem CID: 70448 IUPAC Name: tributyl(chloro)silane SMILES: CCCC[Si](CCCC)(CCCC)Cl
| PubChem CID | 70448 |
|---|---|
| CAS | 995-45-9 |
| Molecular Weight (g/mol) | 234.883 |
| MDL Number | MFCD00000509 |
| SMILES | CCCC[Si](CCCC)(CCCC)Cl |
| Synonym | silane, tributylchloro,chlorotributylsilane,chlorotri-n-butylsilane,tributyl chloro silane,tri-n-butylchlorosilane,tributylsilyl chloride,tributylchloro-silan,chloro-tri-n-butylsilane |
| IUPAC Name | tributyl(chloro)silane |
| InChI Key | JSQJUDVTRRCSRU-UHFFFAOYSA-N |
| Molecular Formula | C12H27ClSi |
1H,1H,2H,2H-Perfluorodecyltriethoxysilane, 97%, Thermo Scientific™
CAS: 101947-16-4 Molecular Formula: C16H19F17O3Si Molecular Weight (g/mol): 610.38 MDL Number: MFCD00042334 InChI Key: MLXDKRSDUJLNAB-UHFFFAOYSA-N Synonym: 1h,1h,2h,2h-perfluorodecyltriethoxysilane,triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl silane,heptadecafluoro-1,1,2,2-tetrahydrodecyl triethoxysilane,perfluorooctylethyl triethoxysilane,r-3-hydroxy-1-benyzl-pyrrolidine,triethoxy-1h,1h,2h,2h-perfluorodecylsilane,triethoxy-1h,1h,2h,2h-heptadecafluorodecylsilane,1h,1h,2h,2h-perfluorodec-1-yl tris ethoxy silan,1h,1h,2h,2h-perfluorodecyltriethoxysilane 1g PubChem CID: 145374 IUPAC Name: triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane SMILES: CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC
| PubChem CID | 145374 |
|---|---|
| CAS | 101947-16-4 |
| Molecular Weight (g/mol) | 610.38 |
| MDL Number | MFCD00042334 |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| Synonym | 1h,1h,2h,2h-perfluorodecyltriethoxysilane,triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl silane,heptadecafluoro-1,1,2,2-tetrahydrodecyl triethoxysilane,perfluorooctylethyl triethoxysilane,r-3-hydroxy-1-benyzl-pyrrolidine,triethoxy-1h,1h,2h,2h-perfluorodecylsilane,triethoxy-1h,1h,2h,2h-heptadecafluorodecylsilane,1h,1h,2h,2h-perfluorodec-1-yl tris ethoxy silan,1h,1h,2h,2h-perfluorodecyltriethoxysilane 1g |
| IUPAC Name | triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane |
| InChI Key | MLXDKRSDUJLNAB-UHFFFAOYSA-N |
| Molecular Formula | C16H19F17O3Si |
Barium Carbonate, Powder, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 513-77-9 Molecular Formula: CBaO3 Molecular Weight (g/mol): 197.34 MDL Number: MFCD00003448 InChI Key: AYJRCSIUFZENHW-UHFFFAOYSA-L Synonym: barium carbonate,carbonic acid, barium salt 1:1,barium carbonate 1:1,barium monocarbonate,carbonic acid, barium salt,pigment white 10,caswell no. 069,witherite,ci pigment white 10,bw-p PubChem CID: 10563 SMILES: [Ba++].[O-]C([O-])=O
| PubChem CID | 10563 |
|---|---|
| CAS | 513-77-9 |
| Molecular Weight (g/mol) | 197.34 |
| MDL Number | MFCD00003448 |
| SMILES | [Ba++].[O-]C([O-])=O |
| Synonym | barium carbonate,carbonic acid, barium salt 1:1,barium carbonate 1:1,barium monocarbonate,carbonic acid, barium salt,pigment white 10,caswell no. 069,witherite,ci pigment white 10,bw-p |
| InChI Key | AYJRCSIUFZENHW-UHFFFAOYSA-L |
| Molecular Formula | CBaO3 |
2-(Chloromethoxy)ethyltrimethylsilane, tech. 90%, stab. with 0.1% N,N-Diisopropylethylamine
CAS: 76513-69-4 Molecular Formula: C6H15ClOSi Molecular Weight (g/mol): 166.72 MDL Number: MFCD00009919 InChI Key: BPXKZEMBEZGUAH-UHFFFAOYSA-N Synonym: 2-trimethylsilyl ethoxymethyl chloride,2-chloromethoxy ethyl trimethylsilane,sem-chloride,2-trimethylsilyl ethoxymethylchloride,sem-cl,2-chloromethyl 2-trimethylsilyl ethyl ether,semcl,2-chloromethoxy ethyl-trimethylsilane,2-trimethysilyl-ethoxymethyl chloride PubChem CID: 2724271 IUPAC Name: 2-(chloromethoxy)ethyl-trimethylsilane SMILES: C[Si](C)(C)CCOCCl
| PubChem CID | 2724271 |
|---|---|
| CAS | 76513-69-4 |
| Molecular Weight (g/mol) | 166.72 |
| MDL Number | MFCD00009919 |
| SMILES | C[Si](C)(C)CCOCCl |
| Synonym | 2-trimethylsilyl ethoxymethyl chloride,2-chloromethoxy ethyl trimethylsilane,sem-chloride,2-trimethylsilyl ethoxymethylchloride,sem-cl,2-chloromethyl 2-trimethylsilyl ethyl ether,semcl,2-chloromethoxy ethyl-trimethylsilane,2-trimethysilyl-ethoxymethyl chloride |
| IUPAC Name | 2-(chloromethoxy)ethyl-trimethylsilane |
| InChI Key | BPXKZEMBEZGUAH-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClOSi |
Sodium bis(trimethylsilyl)amide, 1M soln. in THF
CAS: 1070-89-9 Molecular Formula: C6H18NNaSi2 Molecular Weight (g/mol): 183.377 MDL Number: MFCD00009835 InChI Key: WRIKHQLVHPKCJU-UHFFFAOYSA-N Synonym: sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt PubChem CID: 2724254 IUPAC Name: sodium;bis(trimethylsilyl)azanide SMILES: C[Si](C)(C)[N-][Si](C)(C)C.[Na+]
| PubChem CID | 2724254 |
|---|---|
| CAS | 1070-89-9 |
| Molecular Weight (g/mol) | 183.377 |
| MDL Number | MFCD00009835 |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| Synonym | sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt |
| IUPAC Name | sodium;bis(trimethylsilyl)azanide |
| InChI Key | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| Molecular Formula | C6H18NNaSi2 |
1-Bromo-3-(tert-butyldimethylsiloxy)benzene, 98+%, Thermo Scientific Chemicals
CAS: 65423-56-5 Molecular Formula: C12H19BrOSi Molecular Weight (g/mol): 287.272 MDL Number: MFCD01318106 InChI Key: BFRHMVJJJGUHDI-UHFFFAOYSA-N Synonym: 3-bromophenoxy tert-butyl dimethylsilane,3-bromophenyl tert-butyldimethylsilyl ether,1-bromo-3-tert-butyldimethylsiloxy benzene,silane, 3-bromophenoxy 1,1-dimethylethyl dimethyl,acmc-1b3kt,3-t-butyldimethylsilyloxybromobenzene,3-t-butyldimethylsilyloxy bromobenzene,3-bromophenoxy-tert-butyldimethylsilane,3-tert-butyldimethylsiloxy bromobenzene PubChem CID: 11254705 IUPAC Name: (3-bromophenoxy)-tert-butyl-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)OC1=CC(=CC=C1)Br
| PubChem CID | 11254705 |
|---|---|
| CAS | 65423-56-5 |
| Molecular Weight (g/mol) | 287.272 |
| MDL Number | MFCD01318106 |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC(=CC=C1)Br |
| Synonym | 3-bromophenoxy tert-butyl dimethylsilane,3-bromophenyl tert-butyldimethylsilyl ether,1-bromo-3-tert-butyldimethylsiloxy benzene,silane, 3-bromophenoxy 1,1-dimethylethyl dimethyl,acmc-1b3kt,3-t-butyldimethylsilyloxybromobenzene,3-t-butyldimethylsilyloxy bromobenzene,3-bromophenoxy-tert-butyldimethylsilane,3-tert-butyldimethylsiloxy bromobenzene |
| IUPAC Name | (3-bromophenoxy)-tert-butyl-dimethylsilane |
| InChI Key | BFRHMVJJJGUHDI-UHFFFAOYSA-N |
| Molecular Formula | C12H19BrOSi |
Sodium dihydrogen phosphate monohydrate, Puratronic™, 99.998% (metals basis)
CAS: 10049-21-5 Molecular Formula: H5NaO5P Molecular Weight (g/mol): 139.00 MDL Number: MFCD00149208 InChI Key: BBMHARZCALWXSL-UHFFFAOYSA-N Synonym: sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 PubChem CID: 516949 IUPAC Name: sodium;dihydrogen phosphate;hydrate SMILES: O.[Na+].OP(O)(O)=O
| PubChem CID | 516949 |
|---|---|
| CAS | 10049-21-5 |
| Molecular Weight (g/mol) | 139.00 |
| MDL Number | MFCD00149208 |
| SMILES | O.[Na+].OP(O)(O)=O |
| Synonym | sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 |
| IUPAC Name | sodium;dihydrogen phosphate;hydrate |
| InChI Key | BBMHARZCALWXSL-UHFFFAOYSA-N |
| Molecular Formula | H5NaO5P |
MilliporeSigma™ Sodium Acetate, Anhydrous, OmniPur™, Calbiochem™,
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 IUPAC Name: sodium acetate SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| IUPAC Name | sodium acetate |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
(2-Bromoethoxy)-tert-butyldimethylsilane, 98%, stab. with sodium carbonate, Thermo Scientific Chemicals
CAS: 86864-60-0 Molecular Formula: C8H19BrOSi Molecular Weight (g/mol): 239.228 MDL Number: MFCD00209550 InChI Key: JBKINHFZTVLNEM-UHFFFAOYSA-N Synonym: 2-bromoethoxy-tert-butyldimethylsilane,2-bromoethoxy tert-butyl dimethylsilane,2-bromoethoxy-t-butyl dimethylsilane,2-t-butyldimethylsiloxy ethylbromide,2-bromoethoxy-t-butyldimethylsilane,2-bromo-ethoxy-tert-butyl-dimethyl-silane,silane, 2-bromoethoxy 1,1-dimethylethyl dimethyl,brch2ch2otbs PubChem CID: 3608067 IUPAC Name: 2-bromoethoxy-tert-butyl-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)OCCBr
| PubChem CID | 3608067 |
|---|---|
| CAS | 86864-60-0 |
| Molecular Weight (g/mol) | 239.228 |
| MDL Number | MFCD00209550 |
| SMILES | CC(C)(C)[Si](C)(C)OCCBr |
| Synonym | 2-bromoethoxy-tert-butyldimethylsilane,2-bromoethoxy tert-butyl dimethylsilane,2-bromoethoxy-t-butyl dimethylsilane,2-t-butyldimethylsiloxy ethylbromide,2-bromoethoxy-t-butyldimethylsilane,2-bromo-ethoxy-tert-butyl-dimethyl-silane,silane, 2-bromoethoxy 1,1-dimethylethyl dimethyl,brch2ch2otbs |
| IUPAC Name | 2-bromoethoxy-tert-butyl-dimethylsilane |
| InChI Key | JBKINHFZTVLNEM-UHFFFAOYSA-N |
| Molecular Formula | C8H19BrOSi |