Other Solvents
eMolecules 62356-27-8 | 2-Bromo-6-chlorotoluene | Oakwood Chemical | MFCD00061121 | 205.480 | C7H6BrCl | 99.000 | Cc1c(Cl)cccc1Br | 25g | 537676577
2-Bromo-6-chlorotoluene | Oakwood Chemical | 62356-27-8 | MFCD00061121 | 205.480 | C7H6BrCl | 99.000 | Cc1c(Cl)cccc1Br | 25g | 537676577
eMolecules 1189919-21-8 | 2-(2-CHLOROPHENYL)-2-THIOMORPHOLINO-OXIDE ETHANAMINE HCL | AstaTech | MFCD11040484 | 309.250 | C12H18Cl2N2OS | 95.000 | Cl.NCC(N1CCS(=O)CC1)c1ccccc1Cl | 1g | 112531627
2-(2-CHLOROPHENYL)-2-THIOMORPHOLINO-OXIDE ETHANAMINE HCL | AstaTech | 1189919-21-8 | MFCD11040484 | 309.250 | C12H18Cl2N2OS | 95.000 | Cl.NCC(N1CCS(=O)CC1)c1ccccc1Cl | 1g | 112531627
eMolecules 27139-97-5 | 2-Bromo-4-chlorotoluene | AA Blocks LLC | MFCD00060650 | 205.480 | C7H6BrCl | 0.000 | Cc1ccc(Cl)cc1Br | 500g | 713329688
2-Bromo-4-chlorotoluene | AA Blocks LLC | 27139-97-5 | MFCD00060650 | 205.480 | C7H6BrCl | 0.000 | Cc1ccc(Cl)cc1Br | 500g | 713329688
eMolecules 108-90-7 | Chlorobenzene ACS grade | Oakwood Chemical | MFCD00000530 | 112.560 | C6H5Cl | 99.000 | Clc1ccccc1 | 20kg | 712847464
Chlorobenzene ACS grade | Oakwood Chemical | 108-90-7 | MFCD00000530 | 112.560 | C6H5Cl | 99.000 | Clc1ccccc1 | 20kg | 712847464
eMolecules 13278-67-6 | 4-(4-Methylphenyl)-3-thiosemicarbazide | Oakwood Chemical | MFCD00041302 | 181.260 | C8H11N3S | 0.000 | Cc1ccc(NC(=S)NN)cc1 | 1g | 537676223
4-(4-Methylphenyl)-3-thiosemicarbazide | Oakwood Chemical | 13278-67-6 | MFCD00041302 | 181.260 | C8H11N3S | 0.000 | Cc1ccc(NC(=S)NN)cc1 | 1g | 537676223
Cambridge Isotope Laboratories 1 2 4 5-Tetrachlorobenzene (D2 98%) 5 g
1 2 4 5-Tetrachlorobenzene (D2 98%) 5 g
Cambridge Isotope Laboratories 1 2 4-Trichlorobenzene (D3 98%) 0 1 g
1 2 4-Trichlorobenzene (D3 98%) 0 1 g
eMolecules 108-90-7 | Chlorobenzene | Oakwood Chemical | MFCD00000530 | 112.560 | C6H5Cl | 99.000 | Clc1ccccc1 | 1kg | 537692586
Chlorobenzene | Oakwood Chemical | 108-90-7 | MFCD00000530 | 112.560 | C6H5Cl | 99.000 | Clc1ccccc1 | 1kg | 537692586
Chemscene ChemScene | 3-Amino-5-chlorobenzonitrile | 5G | CS-W021837 | 0.96 | 53312-78-0| MFCD06797224 | 152.58
ChemScene | 3-Amino-5-chlorobenzonitrile | 5G | CS-W021837 | 0.96 | 53312-78-0| MFCD06797224 | 152.58
Apexbio Technology LLC N,N-Dimethylacetamide 127-19-5 200ml
N N-Dimethylacetamide (127-19-5) is an organic solvent and FDA-approved pharmaceutical excipient It modulates cellular signaling pathways to exert anti-inflammatory activity N N-Dimethylacetamide demonstrates this activity principally through inhibition of inflammation-related signaling Based on these pharmacological properties N N-Dimethylacetamide holds research potential in studies of high-fat diet-induced metabolic disturbances and neuroinflammatory processes associated with neurodegenerative disorders such as Alzheimer s disease
eMolecules 4637-24-5 | N,N-Dimethylformamide dimethylacetal | Oakwood Chemicals | MFCD00008482 | 119.164 | C5H13NO2 | 96.000 | COC(OC)N(C)C | 100g | 480104239
N,N-Dimethylformamide dimethylacetal | Oakwood Chemicals | 4637-24-5 | MFCD00008482 | 119.164 | C5H13NO2 | 96.000 | COC(OC)N(C)C | 100g | 480104239
Medchemexpress LLC N,N-dimethylformamide dimethylacetal | 4637-24-5 | MFCD: 00008482 | 99.6% | 119.16 | C5H13NO2 | 1000g
1 1-Dimethoxy-N N-dimethylmethanamine (N-Dimethoxymethyl-N N-dimethylamine) is a biological molecule
Selleck Chemical LLC DMF (Dimethyl Fumarate) S2586-1g
DMF (Dimethyl Fumarate) is the methyl ester of fumaric acid used to treat people with relapsing forms of multiple sclerosis Dimethyl fumarate is a nuclear factor (erythroid-derived)-like 2 (Nrf2) pathway activator and induces upregulation of antioxidant gene expression