Other Solvents
Filtered Search Results
N,N-Dimethylacetamide, HPLC Grade, 99.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 127-19-5 Molecular Weight (g/mol): 87.12
| CAS | 127-19-5 |
|---|---|
| Molecular Weight (g/mol) | 87.12 |
Ethylene Glycol, Purified, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 107-21-1 Molecular Weight (g/mol): 62.07
| CAS | 107-21-1 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
tert-Butyl MethyleEther, 99%, Extra Dry, AcroSeal™, Thermo Scientific Chemicals
CAS: 1634-04-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00008812 InChI Key: BZLVMXJERCGZMT-UHFFFAOYSA-N Synonym: tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane PubChem CID: 15413 ChEBI: CHEBI:27642 IUPAC Name: 2-methoxy-2-methylpropane SMILES: CC(C)(C)OC
| PubChem CID | 15413 |
|---|---|
| CAS | 1634-04-4 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:27642 |
| MDL Number | MFCD00008812 |
| SMILES | CC(C)(C)OC |
| Synonym | tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane |
| IUPAC Name | 2-methoxy-2-methylpropane |
| InChI Key | BZLVMXJERCGZMT-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
3,4-Dimethylphenylboronic acid, 97%, May contain varying amounts of anhydride, Thermo Scientific™
CAS: 55499-43-9 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009694 InChI Key: KDVZJKOYSOFXRV-UHFFFAOYSA-N Synonym: 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid PubChem CID: 2734348 IUPAC Name: (3,4-dimethylphenyl)boronic acid SMILES: CC1=CC=C(C=C1C)B(O)O
| PubChem CID | 2734348 |
|---|---|
| CAS | 55499-43-9 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009694 |
| SMILES | CC1=CC=C(C=C1C)B(O)O |
| Synonym | 3,4-dimethylphenyl boronic acid,3,4-dimethylbenzeneboronic acid,3,4-dimethylphenyl boranediol,3,4-dimethylphenylboronicacid,4-borono-o-xylene,boronic acid, 3,4-dimethylphenyl,pubchem1832,acmc-209lna,3.4-dimethylbenzeneboronic acid,3,4-dimethyl phenylboronic acid |
| IUPAC Name | (3,4-dimethylphenyl)boronic acid |
| InChI Key | KDVZJKOYSOFXRV-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
N,N-Dimethylacetamide, 99.9+%, OmniSolv™, MilliporeSigma™
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
trans-4-(4-Chlorophenyl)cyclohexane-1-carboxylic acid, 98%
CAS: 49708-81-8 Molecular Formula: C13H15ClO2 Molecular Weight (g/mol): 238.711 MDL Number: MFCD06797626 InChI Key: NXXDIEYTMQYWJU-UHFFFAOYSA-N Synonym: 4-4-chlorophenyl cyclohexanecarboxylic acid,trans-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4-chlorophenyl cyclohexane-1-carboxylic acid,e-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4'-chlorophenyl cyclohexancarboxylic acid,cis-4-4-chlorophenyl cyclohexanecarboxylic acid,atovaquone related compound 1,cyclohexanecarboxylic acid, 4-4-chlorophenyl-, trans,1r,4r-4-4-chlorophenyl cyclohexane-1-carboxylic acid,cyclohexanecarboxylic acid, 4-4-chlorophenyl PubChem CID: 2735792 IUPAC Name: 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid SMILES: C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O
| PubChem CID | 2735792 |
|---|---|
| CAS | 49708-81-8 |
| Molecular Weight (g/mol) | 238.711 |
| MDL Number | MFCD06797626 |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O |
| Synonym | 4-4-chlorophenyl cyclohexanecarboxylic acid,trans-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4-chlorophenyl cyclohexane-1-carboxylic acid,e-4-4-chlorophenyl cyclohexanecarboxylic acid,4-4'-chlorophenyl cyclohexancarboxylic acid,cis-4-4-chlorophenyl cyclohexanecarboxylic acid,atovaquone related compound 1,cyclohexanecarboxylic acid, 4-4-chlorophenyl-, trans,1r,4r-4-4-chlorophenyl cyclohexane-1-carboxylic acid,cyclohexanecarboxylic acid, 4-4-chlorophenyl |
| IUPAC Name | 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChI Key | NXXDIEYTMQYWJU-UHFFFAOYSA-N |
| Molecular Formula | C13H15ClO2 |
2,6-Dimethylbenzoic acid, 99%
CAS: 632-46-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002483 InChI Key: HCBHQDKBSKYGCK-UHFFFAOYSA-N Synonym: benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid PubChem CID: 12439 ChEBI: CHEBI:64827 IUPAC Name: 2,6-dimethylbenzoic acid SMILES: CC1=C(C(=CC=C1)C)C(=O)O
| PubChem CID | 12439 |
|---|---|
| CAS | 632-46-2 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64827 |
| MDL Number | MFCD00002483 |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid |
| IUPAC Name | 2,6-dimethylbenzoic acid |
| InChI Key | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Cyclohexane-d12, for NMR, 99.5 atom % D, Thermo Scientific™
CAS: 1735-17-7 Molecular Formula: C6H12 Molecular Weight (g/mol): 96.24 MDL Number: 00044212 InChI Key: XDTMQSROBMDMFD-LBTWDOQPSA-N IUPAC Name: (²H₁₂)cyclohexane SMILES: [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H]
| CAS | 1735-17-7 |
|---|---|
| Molecular Weight (g/mol) | 96.24 |
| MDL Number | 00044212 |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| IUPAC Name | (²H₁₂)cyclohexane |
| InChI Key | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| Molecular Formula | C6H12 |
Pyridine, for HPLC
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
1-Chloro-3,5-dimethoxybenzene, 98%
CAS: 7051-16-3 Molecular Formula: C8H9ClO2 Molecular Weight (g/mol): 172.608 MDL Number: MFCD00008382 InChI Key: WQHNWJBSROXROL-UHFFFAOYSA-N Synonym: 5-chloro-1,3-dimethoxybenzene,3,5-dimethoxychlorobenzene,benzene, 1-chloro-3,5-dimethoxy,5-chlororesorcinol dimethyl ether,1,3-dimethoxy-5-chlorobenzene,pubchem3042,benzene,5-dimethoxy,acmc-209oev,wln: gr co1 eo1,3,5-dimethoxyphenyl chloride PubChem CID: 81502 IUPAC Name: 1-chloro-3,5-dimethoxybenzene SMILES: COC1=CC(=CC(=C1)Cl)OC
| PubChem CID | 81502 |
|---|---|
| CAS | 7051-16-3 |
| Molecular Weight (g/mol) | 172.608 |
| MDL Number | MFCD00008382 |
| SMILES | COC1=CC(=CC(=C1)Cl)OC |
| Synonym | 5-chloro-1,3-dimethoxybenzene,3,5-dimethoxychlorobenzene,benzene, 1-chloro-3,5-dimethoxy,5-chlororesorcinol dimethyl ether,1,3-dimethoxy-5-chlorobenzene,pubchem3042,benzene,5-dimethoxy,acmc-209oev,wln: gr co1 eo1,3,5-dimethoxyphenyl chloride |
| IUPAC Name | 1-chloro-3,5-dimethoxybenzene |
| InChI Key | WQHNWJBSROXROL-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO2 |
3-Chlorophenylboronic acid, 97%
CAS: 63503-60-6 Molecular Formula: C6H6BClO2 Molecular Weight (g/mol): 156.37 MDL Number: MFCD00161354 InChI Key: SDEAGACSNFSZCU-UHFFFAOYSA-N Synonym: 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 PubChem CID: 2734323 IUPAC Name: (3-chlorophenyl)boronic acid SMILES: OB(O)C1=CC(Cl)=CC=C1
| PubChem CID | 2734323 |
|---|---|
| CAS | 63503-60-6 |
| Molecular Weight (g/mol) | 156.37 |
| MDL Number | MFCD00161354 |
| SMILES | OB(O)C1=CC(Cl)=CC=C1 |
| Synonym | 3-chlorophenyl boronic acid,3-chlorobenzeneboronic acid,3-chlorophenyl boranediol,3-chlorophenylbornic acid,3-chloro benzene boronic acid,m-chlorophenylboronic acid,3-chloro-phenyl-boronic acid,boronic acid, 3-chlorophenyl,pubchem1785 |
| IUPAC Name | (3-chlorophenyl)boronic acid |
| InChI Key | SDEAGACSNFSZCU-UHFFFAOYSA-N |
| Molecular Formula | C6H6BClO2 |
2-Amino-5-chlorobenzonitrile, 97%
CAS: 5922-60-1 Molecular Formula: C7H5ClN2 Molecular Weight (g/mol): 152.58 MDL Number: MFCD00017106 InChI Key: QYRDWARBHMCOAG-UHFFFAOYSA-N Synonym: 5-chloroanthranilonitrile,benzonitrile, 2-amino-5-chloro,anthranilonitrile, 5-chloro,2-amino-5-chloro-benzonitrile,4-chloro-2-cyanoaniline,unii-gy0x0082qb,2-amino-5-chloro benzonitrile,amino 2-5-chloro-benzonitrile,2-amino-5-chlorobenzenecarbonitrile,acbn PubChem CID: 80019 IUPAC Name: 2-amino-5-chlorobenzonitrile SMILES: NC1=CC=C(Cl)C=C1C#N
| PubChem CID | 80019 |
|---|---|
| CAS | 5922-60-1 |
| Molecular Weight (g/mol) | 152.58 |
| MDL Number | MFCD00017106 |
| SMILES | NC1=CC=C(Cl)C=C1C#N |
| Synonym | 5-chloroanthranilonitrile,benzonitrile, 2-amino-5-chloro,anthranilonitrile, 5-chloro,2-amino-5-chloro-benzonitrile,4-chloro-2-cyanoaniline,unii-gy0x0082qb,2-amino-5-chloro benzonitrile,amino 2-5-chloro-benzonitrile,2-amino-5-chlorobenzenecarbonitrile,acbn |
| IUPAC Name | 2-amino-5-chlorobenzonitrile |
| InChI Key | QYRDWARBHMCOAG-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClN2 |
Ethylene glycol, 99% min., MP Biomedicals™
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.068 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.068 |
| ChEBI | CHEBI:30742 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
Tetramethylsilane, for the calibration of NMR spectra for NMR spectroscopy, MagniSolv™, MilliporeSigma™
CAS: 75-76-3 Molecular Formula: C4H12Si Molecular Weight (g/mol): 88.23 MDL Number: MFCD00008274 InChI Key: CZDYPVPMEAXLPK-UHFFFAOYSA-N Synonym: silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 PubChem CID: 6396 ChEBI: CHEBI:85361 IUPAC Name: tetramethylsilane SMILES: C[Si](C)(C)C
| PubChem CID | 6396 |
|---|---|
| CAS | 75-76-3 |
| Molecular Weight (g/mol) | 88.23 |
| ChEBI | CHEBI:85361 |
| MDL Number | MFCD00008274 |
| SMILES | C[Si](C)(C)C |
| Synonym | silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 |
| IUPAC Name | tetramethylsilane |
| InChI Key | CZDYPVPMEAXLPK-UHFFFAOYSA-N |
| Molecular Formula | C4H12Si |