Other Solvents
Filtered Search Results
2,5-Dimethylbenzenesulfonyl chloride, 98%, Thermo Scientific™
CAS: 19040-62-1 Molecular Formula: C8H9ClO2S Molecular Weight (g/mol): 204.668 MDL Number: MFCD00024875 InChI Key: FZVZUIBYLZZOEW-UHFFFAOYSA-N Synonym: p-xylene-2-sulfonyl chloride,benzenesulfonyl chloride, 2,5-dimethyl,2,5-dimethylbenzene-1-sulfonyl chloride,2,5-dimethylphenylsulfonyl chloride,2,5-dimethyl-benzenesulfonyl chloride,benzenesulfonylchloride, 2,5-dimethyl,2,5-dimethylphenyl chlorosulfone,acmc-209etq,xylenesulfonylchloride,ksc178m0f PubChem CID: 87910 IUPAC Name: 2,5-dimethylbenzenesulfonyl chloride SMILES: CC1=CC(=C(C=C1)C)S(=O)(=O)Cl
| PubChem CID | 87910 |
|---|---|
| CAS | 19040-62-1 |
| Molecular Weight (g/mol) | 204.668 |
| MDL Number | MFCD00024875 |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)Cl |
| Synonym | p-xylene-2-sulfonyl chloride,benzenesulfonyl chloride, 2,5-dimethyl,2,5-dimethylbenzene-1-sulfonyl chloride,2,5-dimethylphenylsulfonyl chloride,2,5-dimethyl-benzenesulfonyl chloride,benzenesulfonylchloride, 2,5-dimethyl,2,5-dimethylphenyl chlorosulfone,acmc-209etq,xylenesulfonylchloride,ksc178m0f |
| IUPAC Name | 2,5-dimethylbenzenesulfonyl chloride |
| InChI Key | FZVZUIBYLZZOEW-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO2S |
3,5-Dimethylanisole, 99%
CAS: 874-63-5 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.194 MDL Number: MFCD00008398 InChI Key: JCHJBEZBHANKGA-UHFFFAOYSA-N Synonym: 3,5-dimethylanisole,5-methoxy-m-xylene,benzene, 1-methoxy-3,5-dimethyl,1-methoxy-3,5-dimethyl-benzene,3,5-dimethylanisol,3,5-dimethylanizole,acmc-1bkxt,anisole, 3,5-dimethyl,ksc494e7h,5-methoxy-1,3-dimethylbenzene PubChem CID: 70126 IUPAC Name: 1-methoxy-3,5-dimethylbenzene SMILES: CC1=CC(=CC(=C1)OC)C
| PubChem CID | 70126 |
|---|---|
| CAS | 874-63-5 |
| Molecular Weight (g/mol) | 136.194 |
| MDL Number | MFCD00008398 |
| SMILES | CC1=CC(=CC(=C1)OC)C |
| Synonym | 3,5-dimethylanisole,5-methoxy-m-xylene,benzene, 1-methoxy-3,5-dimethyl,1-methoxy-3,5-dimethyl-benzene,3,5-dimethylanisol,3,5-dimethylanizole,acmc-1bkxt,anisole, 3,5-dimethyl,ksc494e7h,5-methoxy-1,3-dimethylbenzene |
| IUPAC Name | 1-methoxy-3,5-dimethylbenzene |
| InChI Key | JCHJBEZBHANKGA-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
Deuterium chloride 20% soln. in D2O, deuteration. deg. min. 99.5%, for NMR, MagniSolv™, MilliporeSigma™
CAS: 7705-07-9 Molecular Formula: Cl3Ti Molecular Weight (g/mol): 154.22 MDL Number: MFCD00011266 InChI Key: YONPGGFAJWQGJC-UHFFFAOYSA-K IUPAC Name: titanium(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Ti+3]
| CAS | 7705-07-9 |
|---|---|
| Molecular Weight (g/mol) | 154.22 |
| MDL Number | MFCD00011266 |
| SMILES | [Cl-].[Cl-].[Cl-].[Ti+3] |
| IUPAC Name | titanium(3+) trichloride |
| InChI Key | YONPGGFAJWQGJC-UHFFFAOYSA-K |
| Molecular Formula | Cl3Ti |
Dichloromethane-d{2}, 99.9% (Isotopic)
CAS: 1665-00-5 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 86.939 MDL Number: MFCD00000882 InChI Key: YMWUJEATGCHHMB-DICFDUPASA-N Synonym: dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d PubChem CID: 160586 IUPAC Name: dichloro(dideuterio)methane SMILES: C(Cl)Cl
| PubChem CID | 160586 |
|---|---|
| CAS | 1665-00-5 |
| Molecular Weight (g/mol) | 86.939 |
| MDL Number | MFCD00000882 |
| SMILES | C(Cl)Cl |
| Synonym | dichloromethane-d2,methylene chloride-d2,dichloro 2h2 methane,methane-d2, dichloro,cd2cl2,deuterated dichloromethane,dichloro dideuterio methane,dideuteromethylene chloride,dichloromethane-d2, 99.9 atom % d,dichloromethane-d', 99.96 atom % d |
| IUPAC Name | dichloro(dideuterio)methane |
| InChI Key | YMWUJEATGCHHMB-DICFDUPASA-N |
| Molecular Formula | CH2Cl2 |
4-Chlorophenyl isocyanate, 98%
CAS: 104-12-1 Molecular Formula: C7H4ClNO Molecular Weight (g/mol): 153.565 MDL Number: MFCD00002024 InChI Key: ADAKRBAJFHTIEW-UHFFFAOYSA-N Synonym: 4-chlorophenyl isocyanate,p-chlorophenyl isocyanate,benzene, 1-chloro-4-isocyanato,pcpi,4-chloroisocyanatobenzene,para-chlorophenyl isocyanate,p-chlorfenylisokyanat,4-chlorophenylisocyanate,isocyanic acid, p-chlorophenyl ester,1-chloro-4-isocyanato-benzene PubChem CID: 7693 IUPAC Name: 1-chloro-4-isocyanatobenzene SMILES: C1=CC(=CC=C1N=C=O)Cl
| PubChem CID | 7693 |
|---|---|
| CAS | 104-12-1 |
| Molecular Weight (g/mol) | 153.565 |
| MDL Number | MFCD00002024 |
| SMILES | C1=CC(=CC=C1N=C=O)Cl |
| Synonym | 4-chlorophenyl isocyanate,p-chlorophenyl isocyanate,benzene, 1-chloro-4-isocyanato,pcpi,4-chloroisocyanatobenzene,para-chlorophenyl isocyanate,p-chlorfenylisokyanat,4-chlorophenylisocyanate,isocyanic acid, p-chlorophenyl ester,1-chloro-4-isocyanato-benzene |
| IUPAC Name | 1-chloro-4-isocyanatobenzene |
| InChI Key | ADAKRBAJFHTIEW-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO |
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| ChEBI | CHEBI:16227 |
3-Bromochlorobenzene, 99%
CAS: 108-37-2 Molecular Formula: C6H4BrCl Molecular Weight (g/mol): 191.45 MDL Number: MFCD00000568 InChI Key: JRGGUPZKKTVKOV-UHFFFAOYSA-N Synonym: 3-bromochlorobenzene,m-bromochlorobenzene,3-chlorobromobenzene,benzene, 1-bromo-3-chloro,m-chlorobromobenzene,1-chloro-3-bromobenzene,3-chlorophenyl bromide,m-chlorophenyl bromide,m-bromophenyl chloride,3-bromo-1-chlorobenzene PubChem CID: 7928 IUPAC Name: 1-bromo-3-chlorobenzene SMILES: ClC1=CC=CC(Br)=C1
| PubChem CID | 7928 |
|---|---|
| CAS | 108-37-2 |
| Molecular Weight (g/mol) | 191.45 |
| MDL Number | MFCD00000568 |
| SMILES | ClC1=CC=CC(Br)=C1 |
| Synonym | 3-bromochlorobenzene,m-bromochlorobenzene,3-chlorobromobenzene,benzene, 1-bromo-3-chloro,m-chlorobromobenzene,1-chloro-3-bromobenzene,3-chlorophenyl bromide,m-chlorophenyl bromide,m-bromophenyl chloride,3-bromo-1-chlorobenzene |
| IUPAC Name | 1-bromo-3-chlorobenzene |
| InChI Key | JRGGUPZKKTVKOV-UHFFFAOYSA-N |
| Molecular Formula | C6H4BrCl |
Chloroform-d, for NMR, 100.0 atom % D
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
1,2,4-Trichlorobenzene, 99%, pure
CAS: 120-82-1 MDL Number: MFCD00000547 InChI Key: PBKONEOXTCPAFI-UHFFFAOYSA-N Synonym: benzene, 1,2,4-trichloro,unsym-trichlorobenzene,hostetex l-pec,trojchlorobenzen,1,2,4-trichlorbenzol,1,2,4-trichlorobenzol,1,3,4-trichlorobenzene,trichlorobenzene a,1,2,5-trichlorobenzene,as-trichlorobenzene PubChem CID: 13 ChEBI: CHEBI:28222 IUPAC Name: 1,2,4-trichlorobenzene SMILES: C1=CC(=C(C=C1Cl)Cl)Cl
| PubChem CID | 13 |
|---|---|
| CAS | 120-82-1 |
| ChEBI | CHEBI:28222 |
| MDL Number | MFCD00000547 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)Cl |
| Synonym | benzene, 1,2,4-trichloro,unsym-trichlorobenzene,hostetex l-pec,trojchlorobenzen,1,2,4-trichlorbenzol,1,2,4-trichlorobenzol,1,3,4-trichlorobenzene,trichlorobenzene a,1,2,5-trichlorobenzene,as-trichlorobenzene |
| IUPAC Name | 1,2,4-trichlorobenzene |
| InChI Key | PBKONEOXTCPAFI-UHFFFAOYSA-N |
Bis(4-chlorophenyl) disulfide, 98+%
CAS: 1142-19-4 Molecular Formula: C12H8Cl2S2 Molecular Weight (g/mol): 287.216 MDL Number: MFCD00013642 InChI Key: ZIXXRXGPBFMPFD-UHFFFAOYSA-N Synonym: 4,4'-dichlorodiphenyl disulfide,bis 4-chlorophenyl disulfide,disulfide, bis 4-chlorophenyl,ddds,ddds pesticide,disulfide, bis p-chlorophenyl,p-chlorophenyl disulfide,4-chlorophenyl disulfide,bis p-chlorophenyl disulfide,4,4'-dichloro diphenyl disulfide PubChem CID: 14360 IUPAC Name: 1-chloro-4-[(4-chlorophenyl)disulfanyl]benzene SMILES: C1=CC(=CC=C1SSC2=CC=C(C=C2)Cl)Cl
| PubChem CID | 14360 |
|---|---|
| CAS | 1142-19-4 |
| Molecular Weight (g/mol) | 287.216 |
| MDL Number | MFCD00013642 |
| SMILES | C1=CC(=CC=C1SSC2=CC=C(C=C2)Cl)Cl |
| Synonym | 4,4'-dichlorodiphenyl disulfide,bis 4-chlorophenyl disulfide,disulfide, bis 4-chlorophenyl,ddds,ddds pesticide,disulfide, bis p-chlorophenyl,p-chlorophenyl disulfide,4-chlorophenyl disulfide,bis p-chlorophenyl disulfide,4,4'-dichloro diphenyl disulfide |
| IUPAC Name | 1-chloro-4-[(4-chlorophenyl)disulfanyl]benzene |
| InChI Key | ZIXXRXGPBFMPFD-UHFFFAOYSA-N |
| Molecular Formula | C12H8Cl2S2 |
4,5-Dimethyl-o-phenylenediamine, 98%, many contain up to ca 15% water
CAS: 3171-45-7 Molecular Formula: C8H12N2 Molecular Weight (g/mol): 136.20 MDL Number: MFCD00007729 InChI Key: XSZYBMMYQCYIPC-UHFFFAOYSA-N Synonym: 4,5-dimethyl-1,2-phenylenediamine,4,5-diamino-o-xylene,4,5-dimethyl-o-phenylenediamine,1,2-benzenediamine, 4,5-dimethyl,1,2-diamino-4,5-dimethylbenzene,4,5-dimethyl-1,2-benzenediamine,4,5-dimethyl-benzene-1,2-diamine,4,5-dimethyl-ortho-phenylenediamine,4,5-dimethylphenylene-1,2-diamine,4,5-dimethyl-o-phenylenediamine monohydrate PubChem CID: 76635 IUPAC Name: 4,5-dimethylbenzene-1,2-diamine SMILES: CC1=CC(N)=C(N)C=C1C
| PubChem CID | 76635 |
|---|---|
| CAS | 3171-45-7 |
| Molecular Weight (g/mol) | 136.20 |
| MDL Number | MFCD00007729 |
| SMILES | CC1=CC(N)=C(N)C=C1C |
| Synonym | 4,5-dimethyl-1,2-phenylenediamine,4,5-diamino-o-xylene,4,5-dimethyl-o-phenylenediamine,1,2-benzenediamine, 4,5-dimethyl,1,2-diamino-4,5-dimethylbenzene,4,5-dimethyl-1,2-benzenediamine,4,5-dimethyl-benzene-1,2-diamine,4,5-dimethyl-ortho-phenylenediamine,4,5-dimethylphenylene-1,2-diamine,4,5-dimethyl-o-phenylenediamine monohydrate |
| IUPAC Name | 4,5-dimethylbenzene-1,2-diamine |
| InChI Key | XSZYBMMYQCYIPC-UHFFFAOYSA-N |
| Molecular Formula | C8H12N2 |
Ethylene glycol, 99% min., MP Biomedicals™
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.068 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.068 |
| ChEBI | CHEBI:30742 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
EcoLite(+) Scintillation Cocktail, MP Biomedicals
All Purpose, Environmentally Safe, Biodegradable, Non-Toxic, Non-Flammable, Ready-to-Use, For RIA and Receptor Assays, Forms no gel or phasing
| Chemical Name or Material | EcoLite(+)™ Liquid Scintillation Cocktail |
|---|
tert-Butyl Alcohol ACS AR, Macron Fine Chemicals™
CAS: 75-65-0 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 InChI Key: DKGAVHZHDRPRBM-UHFFFAOYSA-N Synonym: tert-butanol,tert-butyl alcohol,2-methyl-2-propanol,t-butanol,t-butyl hydroxide,1,1-dimethylethanol,trimethylcarbinol,trimethyl methanol,2-propanol, 2-methyl,t-butyl alcohol PubChem CID: 6386 ChEBI: CHEBI:45895 IUPAC Name: 2-methylpropan-2-ol SMILES: CC(C)(C)O
| PubChem CID | 6386 |
|---|---|
| CAS | 75-65-0 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:45895 |
| SMILES | CC(C)(C)O |
| Synonym | tert-butanol,tert-butyl alcohol,2-methyl-2-propanol,t-butanol,t-butyl hydroxide,1,1-dimethylethanol,trimethylcarbinol,trimethyl methanol,2-propanol, 2-methyl,t-butyl alcohol |
| IUPAC Name | 2-methylpropan-2-ol |
| InChI Key | DKGAVHZHDRPRBM-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
2,4-Dimethylbenzoic acid, 98%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |