Other Solvents
Filtered Search Results
Carbon disulfide, low benzene, 99.9%
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 MDL Number: MFCD00011321 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| MDL Number | MFCD00011321 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
2-Butanone, ACS, 99+%
CAS: 78-93-3 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00011648 InChI Key: ZWEHNKRNPOVVGH-UHFFFAOYSA-N Synonym: 2-butanone,methyl ethyl ketone,butanone,ethyl methyl ketone,methylethyl ketone,meetco,methyl acetone,methylethylketone,3-butanone,ethylmethylketon PubChem CID: 6569 ChEBI: CHEBI:28398 IUPAC Name: butan-2-one SMILES: CCC(C)=O
| PubChem CID | 6569 |
|---|---|
| CAS | 78-93-3 |
| Molecular Weight (g/mol) | 72.11 |
| ChEBI | CHEBI:28398 |
| MDL Number | MFCD00011648 |
| SMILES | CCC(C)=O |
| Synonym | 2-butanone,methyl ethyl ketone,butanone,ethyl methyl ketone,methylethyl ketone,meetco,methyl acetone,methylethylketone,3-butanone,ethylmethylketon |
| IUPAC Name | butan-2-one |
| InChI Key | ZWEHNKRNPOVVGH-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
Dimethyl sulfoxide-D6 deuteration degree min 99.8% for NMR spectroscopy MagniSolv™, MilliporeSigma™
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: Hexadeuterodimethyl sulfoxide,DMSO deuterated IUPAC Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| CAS | 2206-27-1 |
|---|---|
| Molecular Weight (g/mol) | 84.17 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | Hexadeuterodimethyl sulfoxide,DMSO deuterated |
| IUPAC Name | (²H₃)methanesulfinyl(²H₃)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
N,N-Dimethylformamide, 99.8%, Extra Dry, AcroSeal™
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
1,4-Dioxane, 99.5%, Extra Dry over Molecular Sieve, stabilized, AcroSeal™
CAS: 123-91-1 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00006571 InChI Key: RYHBNJHYFVUHQT-UHFFFAOYSA-N Synonym: dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin PubChem CID: 31275 ChEBI: CHEBI:47032 IUPAC Name: 1,4-dioxane SMILES: C1COCCO1
| PubChem CID | 31275 |
|---|---|
| CAS | 123-91-1 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:47032 |
| MDL Number | MFCD00006571 |
| SMILES | C1COCCO1 |
| Synonym | dioxane,p-dioxane,1,4-diethylene dioxide,diethylene ether,dioxan,1,4-dioxacyclohexane,diethylene dioxide,dioxanne,di ethylene oxide,tetrahydro-p-dioxin |
| IUPAC Name | 1,4-dioxane |
| InChI Key | RYHBNJHYFVUHQT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Diethyl ether, anhydrous, ACS, 99% min, stab. with BHT
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
tert-Butyl methyl ether, 99%, pure
CAS: 1634-04-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00008812 InChI Key: BZLVMXJERCGZMT-UHFFFAOYSA-N Synonym: tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane PubChem CID: 15413 ChEBI: CHEBI:27642 IUPAC Name: 2-methoxy-2-methylpropane SMILES: CC(C)(C)OC
| PubChem CID | 15413 |
|---|---|
| CAS | 1634-04-4 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:27642 |
| MDL Number | MFCD00008812 |
| SMILES | CC(C)(C)OC |
| Synonym | tert-butyl methyl ether,methyl tert-butyl ether,mtbe,methyl t-butyl ether,t-butyl methyl ether,methyl tertiary-butyl ether,propane, 2-methoxy-2-methyl,methyl-tert-butyl ether,methyl-t-butyl ether,2-methyl-2-methoxypropane |
| IUPAC Name | 2-methoxy-2-methylpropane |
| InChI Key | BZLVMXJERCGZMT-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Chloroform-d, for NMR, 99.6+ atom % D
CAS: 865-49-6 Molecular Formula: CHCl3 Molecular Weight (g/mol): 120.375 MDL Number: MFCD00000827 InChI Key: HEDRZPFGACZZDS-MICDWDOJSA-N Synonym: chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero PubChem CID: 71583 ChEBI: CHEBI:85365 IUPAC Name: trichloro(deuterio)methane SMILES: C(Cl)(Cl)Cl
| PubChem CID | 71583 |
|---|---|
| CAS | 865-49-6 |
| Molecular Weight (g/mol) | 120.375 |
| ChEBI | CHEBI:85365 |
| MDL Number | MFCD00000827 |
| SMILES | C(Cl)(Cl)Cl |
| Synonym | chloroform-d,deuterochloroform,methane-d, trichloro,2h chloroform,deuterated chloroform,cdcl3,trichloromethane-d,unii-p1nw4885vt,trichloro deuterio methane,chloroform, deutero |
| IUPAC Name | trichloro(deuterio)methane |
| InChI Key | HEDRZPFGACZZDS-MICDWDOJSA-N |
| Molecular Formula | CHCl3 |
| Water | 0.1% max. (K.F.) |
|---|---|
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Density | 0.8670g/mL |
| Name Note | Stabilized with BHT |
| Percent Purity | ≥99% |
| Fieser | 01,267; 02,143; 16,229 |
| Infrared Spectrum | Authentic |
| pH | 6 to 7.5 (1:9) |
| Formula Weight | 90.12 |
| Melting Point | -69.0°C |
| Boiling Point | 84.0°C to 86.0°C |
| Physical Form | Liquid |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Pure |
| Merck Index | 15, 3245 |
| Assay Percent Range | 99+% |
| CAS | 128-37-0 |
| Health Hazard 3 | GHS P Statement: Obtain special instructions before use. IF exposed or concerned: Get medical advice/attention. Keep container tightly closed. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Health Hazard 2 | GHS H Statement: Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. May form explosive peroxides. |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Beilstein | 01, 467 |
| Specific Gravity | 0.867 |
Ethylene glycol, technical
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.068 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.068 |
| ChEBI | CHEBI:30742 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
Dimethyl sulfoxide-d{6}, 99.5% (Isotopic)
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Ethylene glycol, 99.5%, for analysis
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.068 MDL Number: MFCD00002885 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.068 |
| ChEBI | CHEBI:30742 |
| MDL Number | MFCD00002885 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
Cyclohexanone, 99+%, ACS reagent
CAS: 108-94-1 Molecular Formula: C6H10O Molecular Weight (g/mol): 98.145 InChI Key: JHIVVAPYMSGYDF-UHFFFAOYSA-N Synonym: ketohexamethylene,pimelic ketone,sextone,cyclohexyl ketone,nadone,anone,anon,cyclohexanon,hytrol o,hexanon PubChem CID: 7967 ChEBI: CHEBI:17854 IUPAC Name: cyclohexanone SMILES: C1CCC(=O)CC1
| PubChem CID | 7967 |
|---|---|
| CAS | 108-94-1 |
| Molecular Weight (g/mol) | 98.145 |
| ChEBI | CHEBI:17854 |
| SMILES | C1CCC(=O)CC1 |
| Synonym | ketohexamethylene,pimelic ketone,sextone,cyclohexyl ketone,nadone,anone,anon,cyclohexanon,hytrol o,hexanon |
| IUPAC Name | cyclohexanone |
| InChI Key | JHIVVAPYMSGYDF-UHFFFAOYSA-N |
| Molecular Formula | C6H10O |
Pyridine, 99.5%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
Acetonitrile-d3, for NMR, 99.9 atom% D
CAS: 2206-26-0 Molecular Formula: C2H3N Molecular Weight (g/mol): 44.07 MDL Number: MFCD00001881 InChI Key: WEVYAHXRMPXWCK-FIBGUPNXSA-N Synonym: acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g PubChem CID: 123151 IUPAC Name: 2,2,2-trideuterioacetonitrile SMILES: [2H]C([2H])([2H])C#N
| PubChem CID | 123151 |
|---|---|
| CAS | 2206-26-0 |
| Molecular Weight (g/mol) | 44.07 |
| MDL Number | MFCD00001881 |
| SMILES | [2H]C([2H])([2H])C#N |
| Synonym | acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g |
| IUPAC Name | 2,2,2-trideuterioacetonitrile |
| InChI Key | WEVYAHXRMPXWCK-FIBGUPNXSA-N |
| Molecular Formula | C2H3N |