Other Solvents
Filtered Search Results
Xylenes, 96%, pure, mixed isomers with ethylbenzene
CAS: 1330-20-7 Molecular Formula: C8H10 MDL Number: MFCD00077264 Synonym: Dimethylbenzene
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
| Synonym | Dimethylbenzene |
| Molecular Formula | C8H10 |
4-Chloro-2,6-dimethylaniline, 96%
CAS: 24596-18-7 Molecular Formula: C8H10ClN Molecular Weight (g/mol): 155.625 MDL Number: MFCD01076576 InChI Key: JCLZLZKUISPXDC-UHFFFAOYSA-N Synonym: 4-chloro-2,6-dimethyl-phenylamine,4-chloro-2,6-dimethylbenzenamine,2,6-dimethyl-4-chloroaniline,intermediates-zcf02661,acmc-20a53k,4-chlor-2,6-dimethylanilin,pharmabridge p-1739,4-chloro-2,6-dimethyl-aniline,4-chloro-2,6-xylidine,4-chloro-2,6-dimethylphenylamine PubChem CID: 5073362 IUPAC Name: 4-chloro-2,6-dimethylaniline SMILES: CC1=CC(=CC(=C1N)C)Cl
| PubChem CID | 5073362 |
|---|---|
| CAS | 24596-18-7 |
| Molecular Weight (g/mol) | 155.625 |
| MDL Number | MFCD01076576 |
| SMILES | CC1=CC(=CC(=C1N)C)Cl |
| Synonym | 4-chloro-2,6-dimethyl-phenylamine,4-chloro-2,6-dimethylbenzenamine,2,6-dimethyl-4-chloroaniline,intermediates-zcf02661,acmc-20a53k,4-chlor-2,6-dimethylanilin,pharmabridge p-1739,4-chloro-2,6-dimethyl-aniline,4-chloro-2,6-xylidine,4-chloro-2,6-dimethylphenylamine |
| IUPAC Name | 4-chloro-2,6-dimethylaniline |
| InChI Key | JCLZLZKUISPXDC-UHFFFAOYSA-N |
| Molecular Formula | C8H10ClN |
2,4-Dimethylbenzoic acid, 97%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
M-Xylene, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
2,4-Dimethylbenzoic acid, 98%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,4-Dimethylphenyl isocyanate, 98+%
CAS: 51163-29-2 Molecular Formula: C9H9NO Molecular Weight (g/mol): 147.177 MDL Number: MFCD00013853 InChI Key: QUOBVYPFBJUOAJ-UHFFFAOYSA-N Synonym: 2,4-dimethylphenyl isocyanate,2,4-dimethylphenylisocyanate,benzene, 1-isocyanato-2,4-dimethyl,2,4-dimethylbenzenisocyanate,acmc-20aoc8,1-isocyanato-2,4-dimethyl-benzene PubChem CID: 5207585 IUPAC Name: 1-isocyanato-2,4-dimethylbenzene SMILES: CC1=CC(=C(C=C1)N=C=O)C
| PubChem CID | 5207585 |
|---|---|
| CAS | 51163-29-2 |
| Molecular Weight (g/mol) | 147.177 |
| MDL Number | MFCD00013853 |
| SMILES | CC1=CC(=C(C=C1)N=C=O)C |
| Synonym | 2,4-dimethylphenyl isocyanate,2,4-dimethylphenylisocyanate,benzene, 1-isocyanato-2,4-dimethyl,2,4-dimethylbenzenisocyanate,acmc-20aoc8,1-isocyanato-2,4-dimethyl-benzene |
| IUPAC Name | 1-isocyanato-2,4-dimethylbenzene |
| InChI Key | QUOBVYPFBJUOAJ-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO |
2,6-Dimethylbenzoic acid, 99%
CAS: 632-46-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002483 InChI Key: HCBHQDKBSKYGCK-UHFFFAOYSA-N Synonym: benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid PubChem CID: 12439 ChEBI: CHEBI:64827 IUPAC Name: 2,6-dimethylbenzoic acid SMILES: CC1=C(C(=CC=C1)C)C(=O)O
| PubChem CID | 12439 |
|---|---|
| CAS | 632-46-2 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64827 |
| MDL Number | MFCD00002483 |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid |
| IUPAC Name | 2,6-dimethylbenzoic acid |
| InChI Key | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2,6-Dimethylbenzeneboronic acid, 97%
CAS: 100379-00-8 Molecular Formula: C8H11BO2 Molecular Weight (g/mol): 149.98 MDL Number: MFCD01009693 InChI Key: ZXDTWWZIHJEZOG-UHFFFAOYSA-N Synonym: 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za PubChem CID: 583322 IUPAC Name: (2,6-dimethylphenyl)boronic acid SMILES: CC1=CC=CC(C)=C1B(O)O
| PubChem CID | 583322 |
|---|---|
| CAS | 100379-00-8 |
| Molecular Weight (g/mol) | 149.98 |
| MDL Number | MFCD01009693 |
| SMILES | CC1=CC=CC(C)=C1B(O)O |
| Synonym | 2,6-dimethylphenyl boronic acid,2,6-dimethylbenzeneboronic acid,2,6-dimethylphenyl boranediol,2,6-dimethylboronic acid,m-xylene-2-boronic acid,2,6-dimethyl-phenylboronic acid,boronic acid, 2,6-dimethylphenyl,2-borono-m-xylene,pubchem16357,acmc-1c3za |
| IUPAC Name | (2,6-dimethylphenyl)boronic acid |
| InChI Key | ZXDTWWZIHJEZOG-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO2 |
2,3-Dimethylbenzoic acid, 98%
CAS: 603-79-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00002479 InChI Key: RIZUCYSQUWMQLX-UHFFFAOYSA-N Synonym: hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 PubChem CID: 11782 ChEBI: CHEBI:64823 IUPAC Name: 2,3-dimethylbenzoic acid SMILES: CC1=CC=CC(=C1C)C(=O)O
| PubChem CID | 11782 |
|---|---|
| CAS | 603-79-2 |
| Molecular Weight (g/mol) | 150.177 |
| ChEBI | CHEBI:64823 |
| MDL Number | MFCD00002479 |
| SMILES | CC1=CC=CC(=C1C)C(=O)O |
| Synonym | hemellitic acid,benzoic acid, 2,3-dimethyl,2,3-dimethylbenzoicacid,2,3-dimethyl benzoic acid,2,3-dimethyl-benzoic acid,unii-7irp8ca267,2,3-dimethylbenzenecarboxylic acid,vic-o-xylylic acid,methyl m-toluic acid,pubchem2549 |
| IUPAC Name | 2,3-dimethylbenzoic acid |
| InChI Key | RIZUCYSQUWMQLX-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
1,4-Dibromo-2,5-dimethylbenzene, 98+%
CAS: 1074-24-4 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.96 MDL Number: MFCD00000091 InChI Key: QENIALCDPFDFHX-UHFFFAOYSA-N Synonym: 2,5-dibromo-p-xylene,benzene, 1,4-dibromo-2,5-dimethyl,p-xylene, 2,5-dibromo,2,5-dibromo-1,4-dimethylbenzene,2,5-dimethyl-1,4-dibromobenzene,2,5-dibromo-4-xylene,2,4-dibromobenzene,p-xylene,5-dibromo,pubchem14829,acmc-1c2tg PubChem CID: 66175 IUPAC Name: 1,4-dibromo-2,5-dimethylbenzene SMILES: CC1=CC(Br)=C(C)C=C1Br
| PubChem CID | 66175 |
|---|---|
| CAS | 1074-24-4 |
| Molecular Weight (g/mol) | 263.96 |
| MDL Number | MFCD00000091 |
| SMILES | CC1=CC(Br)=C(C)C=C1Br |
| Synonym | 2,5-dibromo-p-xylene,benzene, 1,4-dibromo-2,5-dimethyl,p-xylene, 2,5-dibromo,2,5-dibromo-1,4-dimethylbenzene,2,5-dimethyl-1,4-dibromobenzene,2,5-dibromo-4-xylene,2,4-dibromobenzene,p-xylene,5-dibromo,pubchem14829,acmc-1c2tg |
| IUPAC Name | 1,4-dibromo-2,5-dimethylbenzene |
| InChI Key | QENIALCDPFDFHX-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
1,2-Dichloroethane, ACS, 99+%
CAS: 107-06-2 Molecular Formula: C2H4Cl2 Molecular Weight (g/mol): 98.95 MDL Number: MFCD00000963 InChI Key: WSLDOOZREJYCGB-UHFFFAOYSA-N Synonym: ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion PubChem CID: 11 ChEBI: CHEBI:27789 IUPAC Name: 1,2-dichloroethane SMILES: ClCCCl
| PubChem CID | 11 |
|---|---|
| CAS | 107-06-2 |
| Molecular Weight (g/mol) | 98.95 |
| ChEBI | CHEBI:27789 |
| MDL Number | MFCD00000963 |
| SMILES | ClCCCl |
| Synonym | ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion |
| IUPAC Name | 1,2-dichloroethane |
| InChI Key | WSLDOOZREJYCGB-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl2 |
Xylenes, contains ethylbenzene, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 1330-20-7 Molecular Formula: C6H4(CH3)2
| CAS | 1330-20-7 |
|---|---|
| Molecular Formula | C6H4(CH3)2 |
Xylenes, extra pure, mixture of isomers
CAS: 1330-20-7 Molecular Formula: C8H10 Synonym: Dimethylbenzene
| CAS | 1330-20-7 |
|---|---|
| Synonym | Dimethylbenzene |
| Molecular Formula | C8H10 |
4,5-Dibromo-o-xylene, 97%
CAS: 24932-48-7 Molecular Formula: C8H8Br2 Molecular Weight (g/mol): 263.96 MDL Number: MFCD00082743 InChI Key: BCIDDURGCAHERU-UHFFFAOYSA-N Synonym: 4,5-dibromo-o-xylene,benzene, 1,2-dibromo-4,5-dimethyl,acmc-209gfu,benzene,1,2-dibromo-4,5-dimethyl,1,2-bis bromanyl-4,5-dimethyl-benzene,1,2-dibromo-4,5-dimethylbenzene,1,2-dibromo-4,5-dimethyl-benzene PubChem CID: 34347 IUPAC Name: 1,2-dibromo-4,5-dimethylbenzene SMILES: CC1=CC(Br)=C(Br)C=C1C
| PubChem CID | 34347 |
|---|---|
| CAS | 24932-48-7 |
| Molecular Weight (g/mol) | 263.96 |
| MDL Number | MFCD00082743 |
| SMILES | CC1=CC(Br)=C(Br)C=C1C |
| Synonym | 4,5-dibromo-o-xylene,benzene, 1,2-dibromo-4,5-dimethyl,acmc-209gfu,benzene,1,2-dibromo-4,5-dimethyl,1,2-bis bromanyl-4,5-dimethyl-benzene,1,2-dibromo-4,5-dimethylbenzene,1,2-dibromo-4,5-dimethyl-benzene |
| IUPAC Name | 1,2-dibromo-4,5-dimethylbenzene |
| InChI Key | BCIDDURGCAHERU-UHFFFAOYSA-N |
| Molecular Formula | C8H8Br2 |
2-Chloro-N-(2,3-dimethylphenyl)benzamide, 97%
CAS: 196617-88-6 Molecular Formula: C15H14ClNO Molecular Weight (g/mol): 259.733 MDL Number: MFCD00018254 InChI Key: OUAGJVUPQKYHDU-UHFFFAOYSA-N Synonym: 2-chloro-n-2,3-dimethylphenyl benzamide,cambridge id 5328590,2-chloro-2',3'-benzoxylidide,2-chloro-n-2,3-dimethyl-phenyl-benzamide,n-2,3-dimethylphenyl 2-chlorophenyl carboxamide PubChem CID: 295079 IUPAC Name: 2-chloro-N-(2,3-dimethylphenyl)benzamide SMILES: CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2Cl)C
| PubChem CID | 295079 |
|---|---|
| CAS | 196617-88-6 |
| Molecular Weight (g/mol) | 259.733 |
| MDL Number | MFCD00018254 |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2Cl)C |
| Synonym | 2-chloro-n-2,3-dimethylphenyl benzamide,cambridge id 5328590,2-chloro-2',3'-benzoxylidide,2-chloro-n-2,3-dimethyl-phenyl-benzamide,n-2,3-dimethylphenyl 2-chlorophenyl carboxamide |
| IUPAC Name | 2-chloro-N-(2,3-dimethylphenyl)benzamide |
| InChI Key | OUAGJVUPQKYHDU-UHFFFAOYSA-N |
| Molecular Formula | C15H14ClNO |