Citric Acid
eMolecules 1730-91-2 | ChemScene | (S)-2-Methylbutanoic acid | 250mg | 572195006 | CS-0120626 | MFCD00063166 | 102.133 | C5H10O2
Ambeed | 2-(24-Dihydroxybenzoyl)benzoic acid | 100mg | 600831423 | A155090 | 2513-33-9 | MFCD00433869 | 258.229 | C14H10O5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aqua Solutions Citric Acid Anhydrous, Laboratory Grade (50LB)
Citric Acid Anhydrous, Laboratory Grade (50LB)
eMolecules 2415226-90-1 | Medchem Express | Lignoceric acid-d9 | 1mg | 784543824 | HY-121883SS5 | 377.701 | C24H48O2
Ambeed | 246-Tris(4-methoxyphenyl)pyrylium tetrafluoroborate | 50mg | 599355287 | A973789 | 580-34-7 | MFCD00160229 | 486.270 | C26H23BF4O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 204514-22-7 | Ambeed | 1-(((tert-Butoxycarbonyl)amino)methyl)cyclopentanecarboxylic acid | 100mg | 632809515 | A445615 | MFCD09264201 | 243.303 | C12H21NO4
Medchem Express | TCS-OX2-29 | 5mg | 446255494 | HY-100452 | 372523-75-6 | MFCD26142103 | 397.519 | C23H31N3O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 474923-47-2 | 18:1 Dodecanyl PE | Broadpharm978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473637.JPG-250.jpg)
eMolecules 474923-47-2 | 18:1 Dodecanyl PE | Broadpharm978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531
18:1 Dodecanyl PE | Broadpharm | 474923-47-2978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531
eMolecules 76-04-0 | Ambeed | Chlorodifluoroacetic acid | 5g | 552753748 | A724594 | MFCD00004176 | 130.47 | C2HClF2O2
Ambeed | Chlorodifluoroacetic acid | 5g | 552753748 | A724594 | 76-04-0 | MFCD00004176 | 130.470 | C2HClF2O2
C(O)=O | 5g | 672838586](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502429743.PNG-250.jpg)
eMolecules 192725-50-1 | (S)-3-Methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid | Ambeed | MFCD06797211 | 200.238 | C9H16N2O3 | 97.000 | CC(C)[C@H](N1CCCNC1=O)C(O)=O | 5g | 672838586
(S)-3-Methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid | Ambeed | 192725-50-1 | MFCD06797211 | 200.238 | C9H16N2O3 | 97.000 | CC(C)[C@H](N1CCCNC1=O)C(O)=O | 5g | 672838586
eMolecules 923-42-2 | ChemScene | Butane-124-tricarboxylic acid | 1g | 591908440 | CS-W019093 | MFCD00152304 | 190.151 | C7H10O6
ChemScene | Butane-124-tricarboxylic acid | 1g | 591908440 | CS-W019093 | 923-42-2 | MFCD00152304 | 190.151 | C7H10O6
C(F)(F)F)C(O)=O | 0.1g | 768982862](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478918.JPG-250.jpg)
eMolecules 864463-32-1 | (S)-3-METHYL-2-(4-(TRIFLUOROMETHYL)BENZYL)BUTANOIC ACID | AstaTech260.256 | C13H15F3O2 | 95.000 | CC(C)[C@H](Cc1ccc(cc1)C(F)(F)F)C(O)=O | 0.1g | 768982862
(S)-3-METHYL-2-(4-(TRIFLUOROMETHYL)BENZYL)BUTANOIC ACID | AstaTech | 864463-32-1260.256 | C13H15F3O2 | 95.000 | CC(C)[C@H](Cc1ccc(cc1)C(F)(F)F)C(O)=O | 0.1g | 768982862
Crescent Chemical Co Inc CITRIC ACID-H2O ANALYTICAL GRD
Citric acid-H2O analytical grade Buffer Substance. Size - 500G Storage Conditions - +15 °C TO +30 °C Catalog Number - 38640.01 CAS 5949-29-1
![eMolecules 956965-37-0 | (R)-4-(3-(1H-Indol-3-yl)-2-(2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-2H-benzofuro[3,2-g]chromen-3-yl)acetamido)propanamido)butanoic acid | Synthonix583.641 | C33H33N3O7 | 95.000 | Cc1c(CC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCCC(O)=O)c(=O)oc2cc3oc4CCCCc4c3cc12 | 50mg | 78455...](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478290.JPG-250.jpg)
eMolecules 956965-37-0 | (R)-4-(3-(1H-Indol-3-yl)-2-(2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-2H-benzofuro[3,2-g]chromen-3-yl)acetamido)propanamido)butanoic acid | Synthonix583.641 | C33H33N3O7 | 95.000 | Cc1c(CC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCCC(O)=O)c(=O)oc2cc3oc4CCCCc4c3cc12 | 50mg | 78455...
(R)-4-(3-(1H-Indol-3-yl)-2-(2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-2H-benzofuro[3,2-g]chromen-3-yl)acetamido)propanamido)butanoic acid | Synthonix | 956965-37-0583.641 | C33H33N3O7 | 95.000 | Cc1c(CC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCCC(O)=O)c(=O)oc2cc3oc4CCCCc4c3cc12 | 50mg | 784553701
eMolecules 2360221-58-3 | 4-Benzyloxycarbonylamino-4-pyridin-2-yl-butyric acid | J&W PharmLab LLC314.341 | C17H18N2O4 | 96.000 | OC(=O)CCC(NC(=O)OCc1ccccc1)c1ccccn1 | 1g | 761737023
4-Benzyloxycarbonylamino-4-pyridin-2-yl-butyric acid | J&W PharmLab LLC | 2360221-58-3314.341 | C17H18N2O4 | 96.000 | OC(=O)CCC(NC(=O)OCc1ccccc1)c1ccccn1 | 1g | 761737023
Sigma Aldrich Fine Chemicals Biosciences Citric acid monohydrate BioXtra, >=99.5% | 5949-29-1 | MFCD00149972 | 1KG
Citric acid monohydrate BioXtra, >=99.5% | Purity: >=99.5% | Mol Wt: 210.14 | 5949-29-1 | MFCD00149972 | 1KG
Electron Microscopy Sciences Citric Acid, Anhydrous Reagent A.C.S. 500 GR
(Piperazine-N,N-bis (2-ethanesulfonic acid,) 1.5 Sodium)
CAS #77-92-9 C₆H₈O₇ F.W. 192.13
Assay: Min. 99.5%