Boronic acid derivatives
Aobchem 4-Bromo-3-nitrophenylboronic acid pinacol ester | 97% | CAS 2121514-39-2 | C12H15BBrNO4 | 1g
4-Bromo-3-nitrophenylboronic acid pinacol ester | 97% | CAS 2121514-39-2 | C12H15BBrNO4 | 1g
Aobchem 2-Bromo-5-fluorophenylboronic acid pinacol ester | 97% | CAS 2121513-85-5 | C12H15BBrFO2 | 500mg
2-Bromo-5-fluorophenylboronic acid pinacol ester | 97% | CAS 2121513-85-5 | C12H15BBrFO2 | 500mg
eMolecules 214360-73-3 | 4-Aminophenylboronic acid pinacol ester | Key Organics/BIONET | MFCD02093721 | 219.090 | C12H18BNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 1g | 600883265
4-Aminophenylboronic acid pinacol ester | Key Organics/BIONET | 214360-73-3 | MFCD02093721 | 219.090 | C12H18BNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1 | 1g | 600883265
Accela Chembio Inc 2-methoxybenzeneboronic Acid | 25g | 5720-06-9 | MFCD00236047 | 97+% | Shelf Life: 1620 Days | Light Sensitive/n2/+4
2-methoxybenzeneboronic Acid | 25g | 5720-06-9 | MFCD00236047 | 97+% | Shelf Life: 1620 Days | Light Sensitive/n2/+4
eMolecules 397843-61-7 | 4-(Phenoxymethyl)phenylboronic acid | Combi-Blocks | MFCD09966155 | 228.050 | C13H13BO3 | 97.000 | OB(O)c1ccc(COc2ccccc2)cc1 | 1g | 205383172
4-(Phenoxymethyl)phenylboronic acid | Combi-Blocks | 397843-61-7 | MFCD09966155 | 228.050 | C13H13BO3 | 97.000 | OB(O)c1ccc(COc2ccccc2)cc1 | 1g | 205383172
eMolecules 14047-29-1 | 4-Carboxyphenylboronic acid | Key Organics/BIONET | MFCD00151801 | 165.940 | C7H7BO4 | 90.000 | OB(O)c1ccc(cc1)C(O)=O | 5mg | 564101493
4-Carboxyphenylboronic acid | Key Organics/BIONET | 14047-29-1 | MFCD00151801 | 165.940 | C7H7BO4 | 90.000 | OB(O)c1ccc(cc1)C(O)=O | 5mg | 564101493
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | Synthonix - Stock | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 25g | 525912884
4-Cyanophenylboronic acid | Synthonix - Stock | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 25g | 525912884
eMolecules 4151-80-8 | 4,4'-Biphenyldiboronic acid | Combi-Blocks | MFCD00151795 | 241.840 | C12H12B2O4 | 97.000 | OB(O)c1ccc(cc1)-c1ccc(cc1)B(O)O | 25g | 290685114
4,4'-Biphenyldiboronic acid | Combi-Blocks | 4151-80-8 | MFCD00151795 | 241.840 | C12H12B2O4 | 97.000 | OB(O)c1ccc(cc1)-c1ccc(cc1)B(O)O | 25g | 290685114
Frontier Specialty Chemicals 25G 4-(1-NAPHTHYL)PHENYL BORON
4-(1-naphthyl)phenyl boronic acid; CAS: 870774-25-7; 25g
Medchemexpress LLC Boronic acid, B-(3-aminophenyl)- | 30418-59-8 | MFCD00007755 | 99.9% | 136.94 g/mol | C6H8BNO2 | 10 G
3-Aminophenylboronic acid is an organoboron reagent and building block used in organic synthesis and biochemical research. It is supplied as a solid of high purity and is commonly used to functionalize nanomaterials, such as copper nanoclusters, enabling rapid, selective detection of glycoproteins.
- Chemical formula: C6H8BNO2.
- Molecular weight: 136.94 g/mol.
- CAS number: 30418-59-8.
- Purity: 99.87%.
- Physical form: solid.
- Applications include biochemical assays and organic synthesis.
- Available in research pack sizes including 10 g.
Aobchem 4-Bromo-2-ethylphenylboronic acid pinacol ester | ≥97% | CAS 1674364-30-7 | C14H20BBrO2 | 500mg
4-Bromo-2-ethylphenylboronic acid pinacol ester | ≥97% | CAS 1674364-30-7 | C14H20BBrO2 | 500mg
Aobchem 3-Bromo-2-ethoxyphenylboronic acid | ≥95% | CAS 352525-81-6 | C8H10BBrO3 | 250mg
3-Bromo-2-ethoxyphenylboronic acid | ≥95% | CAS 352525-81-6 | C8H10BBrO3 | 250mg
Aobchem 2 4-Dichloro-5-fluorophenylboronic acid | ≥97% | CAS 1417914-09-0 | C6H4BCl2FO2 | 1g
2 4-Dichloro-5-fluorophenylboronic acid | ≥97% | CAS 1417914-09-0 | C6H4BCl2FO2 | 1g