Boronic acid derivatives
Medchemexpress LLC 3-aminophenylboronic acid | 30418-59-8 | MFCD00007755 | 99.9% | 136.94 g/mol | C6H8BNO2 | 25 G
3-Aminophenylboronic acid is an organoboron reagent used as a building block in organic synthesis and biochemical research. It participates in cross-coupling reactions and enables boronic-acid-based functionalization of materials, for example in nanoparticle conjugation and glycoprotein sensing. Supplied as a high-purity solid, it is suitable for analytical and preparative laboratory work.
- High purity suitable for research.
- Useful in Suzuki-Miyaura and other cross-coupling reactions.
- Reacts with diols for reversible covalent binding to saccharides.
- Enables functionalization of nanomaterials and sensors.
- Available in multiple pack sizes for lab-scale and bulk use.
eMolecules 883231-25-2 | (2-((tert-Butoxycarbonyl)amino)pyrimidin-5-yl)boronic acid | Synthonix - Stock | MFCD16251533 | 239.040 | C9H14BN3O4 | 95.000 | CC(C)(C)OC(=O)Nc1ncc(cn1)B(O)O | 5g | 459660942
(2-((tert-Butoxycarbonyl)amino)pyrimidin-5-yl)boronic acid | Synthonix - Stock | 883231-25-2 | MFCD16251533 | 239.040 | C9H14BN3O4 | 95.000 | CC(C)(C)OC(=O)Nc1ncc(cn1)B(O)O | 5g | 459660942
eMolecules 819058-34-9 | (4-AMINO-3-FLUOROPHENYL)BORONIC ACID PINACOL ESTER | AstaTech | MFCD09033884 | 237.080 | C12H17BFNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)c(F)c1 | 5g | 233630498
(4-AMINO-3-FLUOROPHENYL)BORONIC ACID PINACOL ESTER | AstaTech | 819058-34-9 | MFCD09033884 | 237.080 | C12H17BFNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)c(F)c1 | 5g | 233630498
eMolecules 72824-04-5 | Allylboronic acid, pinacol cyclic ester | Synthonix - Stock | MFCD00013347 | 168.040 | C9H17BO2 | 95.000 | CC1(C)OB(CC=C)OC1(C)C | 5g | 459632954
Allylboronic acid, pinacol cyclic ester | Synthonix - Stock | 72824-04-5 | MFCD00013347 | 168.040 | C9H17BO2 | 95.000 | CC1(C)OB(CC=C)OC1(C)C | 5g | 459632954
Chemscene ChemScene | 2-Ethoxyphenylboronic acid | 25G | CS-W016068 | 0.98 | 213211-69-9| MFCD00674027 | 165.99
ChemScene | 2-Ethoxyphenylboronic acid | 25G | CS-W016068 | 0.98 | 213211-69-9| MFCD00674027 | 165.99
![eMolecules 1531-77-7 | Dibenzo[b,e]thiepin-11(6h)-one | MFCD02093738 | 25g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502184267.JPG-250.jpg)
eMolecules 1531-77-7 | Dibenzo[b,e]thiepin-11(6h)-one | MFCD02093738 | 25g
Fmoc-9-Anc-OH | Ambeed | 212688-52-3 | MFCD00273465 | 395.499 | C24H29NO4 | 97.000 | OC(=O)CCCCCCCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 660584387
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
=O | 1g | 117545572](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190549.JPG-250.jpg)
eMolecules 1218791-28-6 | 2-Cyano-5-nitrophenylboronic acid, pinacol ester | Combi-Blocks | MFCD12546472 | 274.080 | C13H15BN2O4 | 97.000 | CC1(C)OB(OC1(C)C)c1cc(ccc1C#N)[N+]([O-])=O | 1g | 117545572
2-Cyano-5-nitrophenylboronic acid, pinacol ester | Combi-Blocks | 1218791-28-6 | MFCD12546472 | 274.080 | C13H15BN2O4 | 97.000 | CC1(C)OB(OC1(C)C)c1cc(ccc1C#N)[N+]([O-])=O | 1g | 117545572
eMolecules 950511-17-8 | m-Benzenediboronic acid pinacol ester, 1,8-diaminonaphthalene, protected | Combi-Blocks | MFCD17018842 | 370.070 | C22H24B2N2O2 | 95.000 | CC1(C)OB(OC1(C)C)c1cccc(c1)B1Nc2cccc3cccc(N1)c23 | 1g | 482933567
m-Benzenediboronic acid pinacol ester, 1,8-diaminonaphthalene, protected | Combi-Blocks | 950511-17-8 | MFCD17018842 | 370.070 | C22H24B2N2O2 | 95.000 | CC1(C)OB(OC1(C)C)c1cccc(c1)B1Nc2cccc3cccc(N1)c23 | 1g | 482933567
eMolecules 1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanone | 1450657-28-9 | MFCD28359366 | 1g
Synthonix - Stock | 1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanone | 1g | 495878161 | E67192 | | 1450657-28-9 | MFCD28359366 | 272.320 | C12H16O5S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1072945-92-6 | 1-p-Tolylpyrazole-4-boronic acid | Combi-Blocks | MFCD09972102 | 202.020 | C10H11BN2O2 | 98.000 | Cc1ccc(cc1)-n1cc(cn1)B(O)O | 1g | 117523684
1-p-Tolylpyrazole-4-boronic acid | Combi-Blocks | 1072945-92-6 | MFCD09972102 | 202.020 | C10H11BN2O2 | 98.000 | Cc1ccc(cc1)-n1cc(cn1)B(O)O | 1g | 117523684
eMolecules 725251-81-0 | 3-Methoxy-5-methylphenylboronic acid | Combi-Blocks | MFCD09952026 | 165.980 | C8H11BO3 | 98.000 | COc1cc(C)cc(c1)B(O)O | 1g | 117524062
3-Methoxy-5-methylphenylboronic acid | Combi-Blocks | 725251-81-0 | MFCD09952026 | 165.980 | C8H11BO3 | 98.000 | COc1cc(C)cc(c1)B(O)O | 1g | 117524062
eMolecules 167105-03-5 | (8-Bromonaphthalen-1-yl)boronic acid | MFCD11656280 | 1g
Ambeed | 22-Dimethyl-1-(4-methyl-7-(4455-tetramethyl-132-dioxaborolan-2-yl)-1H-indol-1-yl)propan-1-one | 1g | 714082726 | A1390021 | 2390149-06-9 | 341.260 | C20H28BNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 51851-79-7 | Diisopropyl allylboronate | Combi-Blocks | MFCD15072157 | 170.060 | C9H19BO2 | 95.000 | CC(C)OB(CC=C)OC(C)C | 1g | 267203938
Diisopropyl allylboronate | Combi-Blocks | 51851-79-7 | MFCD15072157 | 170.060 | C9H19BO2 | 95.000 | CC(C)OB(CC=C)OC(C)C | 1g | 267203938
Chem-Impex International, Inc. 3-Methoxyphenylboronic acid | MFCD00161359 | 25G
3-Methoxyphenylboronic acid, MFCD00161359, 25G
eMolecules 28075-50-5 | 1-Cyclohexenyl trifluoromethanesulfonate | Combi-Blocks, Inc. | MFCD06411281 | 230.200 | C7H9F3O3S | 97.000 | FC(F)(F)S(=O)(=O)OC1=CCCCC1 | 25g | 603131917
1-Cyclohexenyl trifluoromethanesulfonate | Combi-Blocks, Inc. | 28075-50-5 | MFCD06411281 | 230.200 | C7H9F3O3S | 97.000 | FC(F)(F)S(=O)(=O)OC1=CCCCC1 | 25g | 603131917