Oxanes
![eMolecules 1219925-75-3 | ChemScene | 6-(3-Chloropropoxy)-2-(4-(3-chloropropoxy)phenyl)benzo[d]oxazole | 100mg | 726025441 | CS-0530143 | 380.27 | C19H19Cl2NO3](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502470872.JPG-250.jpg)
eMolecules 1219925-75-3 | ChemScene | 6-(3-Chloropropoxy)-2-(4-(3-chloropropoxy)phenyl)benzo[d]oxazole | 100mg | 726025441 | CS-0530143 | 380.27 | C19H19Cl2NO3
Medchem Express | Rivastigmine carbamate impurity | 25mg | 705860717 | HY-133776 | 1346242-31-6 | MFCD26390683 | 224.216 | C10H12N2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Chem-Impex International, Inc. Tetrahydro-4H-pyran-4-one | 29943-42-8 | MFCD00006581 | 100G
Tetrahydro-4H-pyran-4-one, 29943-42-8, MFCD00006581, 100G
eMolecules 214470-68-5 | ChemScene | 4-Chloro-7-(3-chloropropoxy)-6-methoxy-3-quinolinecarbonitrile | 1g | 582640914 | CS-0001124 | MFCD09833974 | 311.16 | C14H12Cl2N2O2
Ambeed | Methyl 5-chloro-2-cyanobenzoate | 1g | 525034683 | A130502 | 439117-38-1 | MFCD08234733 | 195.600 | C9H6ClNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 13224-94-7 | 3-O-Methyl-a-D-glucopyranose | Chem-Impex | MFCD00066653 | 194.183 | C7H14O6 | 99.000 | COC1C(O)C(O)OC(CO)C1O | 1g | 112768892
3-O-Methyl-a-D-glucopyranose | Chem-Impex | 13224-94-7 | MFCD00066653 | 194.183 | C7H14O6 | 99.000 | COC1C(O)C(O)OC(CO)C1O | 1g | 112768892
eMolecules 33532-46-6 | Oxane-2,4-dione | Advanced ChemBlocks | MFCD24445216 | 114.100 | C5H6O3 | 95.000 | O=C1CCOC(=O)C1 | 250mg | 307157725
Oxane-2,4-dione | Advanced ChemBlocks | 33532-46-6 | MFCD24445216 | 114.100 | C5H6O3 | 95.000 | O=C1CCOC(=O)C1 | 250mg | 307157725
Sigma Aldrich Fine Chemicals Biosciences 1,5-Anhydro-D-sorbitol crystalline | 154-58-5 | MFCD00067386 | 100MG
1,5-Anhydro-D-sorbitol crystalline | Mol Wt: 164.16 | 154-58-5 | MFCD00067386 | 100MG
eMolecules 2096341-24-9 | 3-(Tetrahydropyran-4-yloxy)-5-trifluoromethylphenylboronic acid, pinacol ester | Combi-Blocks | MFCD18434454 | 372.190 | C18H24BF3O4 | 96.000 | CC1(C)OB(OC1(C)C)c1cc(OC2CCOCC2)cc(c1)C(F)(F)F | 1g | 117546100
3-(Tetrahydropyran-4-yloxy)-5-trifluoromethylphenylboronic acid, pinacol ester | Combi-Blocks | 2096341-24-9 | MFCD18434454 | 372.190 | C18H24BF3O4 | 96.000 | CC1(C)OB(OC1(C)C)c1cc(OC2CCOCC2)cc(c1)C(F)(F)F | 1g | 117546100
eMolecules 211814-15-2 | N-Ethyltetrahydro-2H-pyran-4-amine | MFCD06658446 | 1g
Medchem Express | Transketolase-IN-4 | 5mg | 788478542 | HY-153090 | 419547-73-2 | MFCD01455660 | 335.790 | C19H14ClN3O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1256358-78-7 | 4-(Tetrahydropyran-4-yloxymethy)phenylboronic acid | Combi-Blocks | MFCD16198632 | 236.070 | C12H17BO4 | 96.000 | OB(O)c1ccc(COC2CCOCC2)cc1 | 1g | 117529709
4-(Tetrahydropyran-4-yloxymethy)phenylboronic acid | Combi-Blocks | 1256358-78-7 | MFCD16198632 | 236.070 | C12H17BO4 | 96.000 | OB(O)c1ccc(COC2CCOCC2)cc1 | 1g | 117529709
eMolecules 1245724-46-2 | (S)-Tetrahydro-2H-pyran-3-amine hydrochloride | MFCD09056862 | 1g
Ambeed | 2-Fluoro-3-methylpyridin-4-amine | 100mg | 570578404 | A518405 | 1393532-84-7 | MFCD22546940 | 126.134 | C6H7FN2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Advanced Chemblocks Inc 4-(Hydroxyethyl)tetrahydropyran; 1G; 97%
Chemical Name: 4-(Hydroxyethyl)tetrahydropyran CAS: 4677-18-3 MW: 130.19 MDL Number: MFCD00129068 Category: tetrahydro-2H-pyran Synonym: 4-(Hydroxyethyl)tetrahydropyran
eMolecules 885269-69-2 | (4-Amino-tetrahydro-pyran-4-ylmethyl)-carbamic acid tert-butyl ester | J&W PharmLab LLC | MFCD08234567 | 230.308 | C11H22N2O3 | 96.000 | CC(C)(C)OC(=O)NCC1(N)CCOCC1 | 1g | 600881721
(4-Amino-tetrahydro-pyran-4-ylmethyl)-carbamic acid tert-butyl ester | J&W PharmLab LLC | 885269-69-2 | MFCD08234567 | 230.308 | C11H22N2O3 | 96.000 | CC(C)(C)OC(=O)NCC1(N)CCOCC1 | 1g | 600881721
eMolecules 1287777-05-2 | 3-(Tetrahydropyran-2-yloxy)phenylboronic acid | Combi-Blocks | MFCD03425971 | 222.050 | C11H15BO4 | 96.000 | OB(O)c1cccc(OC2CCCCO2)c1 | 1g | 517033568
3-(Tetrahydropyran-2-yloxy)phenylboronic acid | Combi-Blocks | 1287777-05-2 | MFCD03425971 | 222.050 | C11H15BO4 | 96.000 | OB(O)c1cccc(OC2CCCCO2)c1 | 1g | 517033568
Chemscene ChemScene | Tetrahydro-4H-pyran-4-one | 100G | CS-D0601 | 0.98 | 29943-42-8| MFCD00006581 | 100.12
ChemScene | Tetrahydro-4H-pyran-4-one | 100G | CS-D0601 | 0.98 | 29943-42-8| MFCD00006581 | 100.12
Chemscene ChemScene | 2-(Tetrahydro-2H-pyran-2-yl)acetic acid | 1G | CS-0069618 | 0.97 | 13103-40-7| MFCD03990565 | 144.17
ChemScene | 2-(Tetrahydro-2H-pyran-2-yl)acetic acid | 1G | CS-0069618 | 0.97 | 13103-40-7| MFCD03990565 | 144.17