Piperidines
eMolecules 161609-80-9 | 4-Hydrazinocarbonyl-piperidine-1-carboxylic acid benzyl ester | Combi-Blocks | MFCD06795951 | 277.324 | C14H19N3O3 | 96.000 | NNC(=O)C1CCN(CC1)C(=O)OCc1ccccc1 | 1g | 457921227
4-Hydrazinocarbonyl-piperidine-1-carboxylic acid benzyl ester | Combi-Blocks | 161609-80-9 | MFCD06795951 | 277.324 | C14H19N3O3 | 96.000 | NNC(=O)C1CCN(CC1)C(=O)OCc1ccccc1 | 1g | 457921227
eMolecules 137076-22-3 | N-Boc-4-piperidinecarboxaldehyde | Oakwood Chemical | MFCD02179019 | 213.277 | C11H19NO3 | 97.000 | CC(C)(C)OC(=O)N1CCC(CC1)C=O | 100g | 596114214
N-Boc-4-piperidinecarboxaldehyde | Oakwood Chemical | 137076-22-3 | MFCD02179019 | 213.277 | C11H19NO3 | 97.000 | CC(C)(C)OC(=O)N1CCC(CC1)C=O | 100g | 596114214
Accela Chembio Inc 1-boc-piperidine-4-carboxylic Acid | 25g | 84358-13-4 | MFCD00076999 | 98% | Shelf Life: 2340 Days | Light Sensitive
1-boc-piperidine-4-carboxylic Acid | 25g | 84358-13-4 | MFCD00076999 | 98% | Shelf Life: 2340 Days | Light Sensitive
C1 | 5g | 112530651](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000163087.jpg-250.jpg)
eMolecules 188111-79-7 | (R)-3-AMINO-1-N-BOC-PIPERIDINE | AstaTech | MFCD03094717 | 200.282 | C10H20N2O2 | 95.000 | CC(C)(C)OC(=O)N1CCC[C@@H](N)C1 | 5g | 112530651
(R)-3-AMINO-1-N-BOC-PIPERIDINE | AstaTech | 188111-79-7 | MFCD03094717 | 200.282 | C10H20N2O2 | 95.000 | CC(C)(C)OC(=O)N1CCC[C@@H](N)C1 | 5g | 112530651
C1 | 5g | 537672358](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000224657.jpg-250.jpg)
eMolecules 625471-18-3 | (S)-3-Amino-1-N-BOC-piperidine | Oakwood Chemical | MFCD03094718 | 200.282 | C10H20N2O2 | 97.000 | CC(C)(C)OC(=O)N1CCC[C@H](N)C1 | 5g | 537672358
(S)-3-Amino-1-N-BOC-piperidine | Oakwood Chemical | 625471-18-3 | MFCD03094718 | 200.282 | C10H20N2O2 | 97.000 | CC(C)(C)OC(=O)N1CCC[C@H](N)C1 | 5g | 537672358
eMolecules 473838-66-3 | 3,3-DIMETHYL-4-OXO-PIPERIDINE-1-CARBOXYLIC ACID BENZYL ESTER | AstaTech | MFCD11044473 | 261.321 | C15H19NO3 | 95.000 | CC1(C)CN(CCC1=O)C(=O)OCc1ccccc1 | 1g | 268491748
3,3-DIMETHYL-4-OXO-PIPERIDINE-1-CARBOXYLIC ACID BENZYL ESTER | AstaTech | 473838-66-3 | MFCD11044473 | 261.321 | C15H19NO3 | 95.000 | CC1(C)CN(CCC1=O)C(=O)OCc1ccccc1 | 1g | 268491748
Apexbio Technology LLC BMS-790052 dihydrochloride 1009119-65-6 5mg
BMS-790052 dihydrochloride (CAS 1009119-65-6) is a small-molecule inhibitor targeting hepatitis C virus (HCV) nonstructural protein 5A (NS5A) a zinc-binding protein essential for viral RNA replication It is designed to suppress viral replication by specifically interacting with NS5A BMS-790052 dihydrochloride exerts its biological activity primarily through NS5A inhibition In cell-based replicon assays using genotypes 1a 1b and hybrid genotype 5a BMS-790052 dihydrochloride demonstrates potent inhibitory activity with EC50 values ranging from approximately 9 to 50 pM for genotypes 1a and 1b and from 3 to 7 pM for genotype 5a hybrid replicons Based on these pharmacological properties BMS-790052 dihydrochloride holds research potential in antiviral studies targeting diverse HCV genotypes
eMolecules 1023595-06-3 | 4-IMIDAZOL-1-YL-PIPERIDINE HCL | AstaTech | MFCD12024510 | 187.670 | C8H14ClN3 | 97.000 | Cl.C1CC(CCN1)n1ccnc1 | 0.25g | 350770918
4-IMIDAZOL-1-YL-PIPERIDINE HCL | AstaTech | 1023595-06-3 | MFCD12024510 | 187.670 | C8H14ClN3 | 97.000 | Cl.C1CC(CCN1)n1ccnc1 | 0.25g | 350770918
eMolecules 1550371-22-6 | Medchem Express | BMS-P5 (free base) | 5mg | 569407403 | HY-137655A | 472.593 | C27H32N6O2
ChemScene | Methyl 3-amino-3-(4-isopropylphenyl)propanoate hydrochloride | 100mg | 761228895 | CS-0616513 | 2156615-71-1 | MFCD30749444 | 257.760 | C13H20ClNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 166438-83-1 | (1-(4-Nitrophenyl)piperidin-3-yl)methanol | MFCD11039478 | 1g
Ambeed | Ethyl acetyl-L-tryptophanate | 1g | 491651597 | A265487 | 2382-80-1 | 274.320 | C15H18N2O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1803560-89-5 | 4-Trifluoromethyl-piperidin-4-ylamine dihydrochloride | J & W PharmLab LLC | MFCD28118365 | 241.080 | C6H13Cl2F3N2 | 96.000 | Cl.Cl.NC1(CCNCC1)C(F)(F)F | 1g | 415670843
4-Trifluoromethyl-piperidin-4-ylamine dihydrochloride | J & W PharmLab LLC | 1803560-89-5 | MFCD28118365 | 241.080 | C6H13Cl2F3N2 | 96.000 | Cl.Cl.NC1(CCNCC1)C(F)(F)F | 1g | 415670843
eMolecules 18650-39-0 | Methyl (S)-piperidine-2-carboxylate hydrochloride | MFCD00672366 | 1g
Pharmablock | 2-methyl-6-nitro-13-benzothiazole | 25mg | 784547222 | PBT8575 | 2941-63-1 | MFCD00160096 | 194.210 | C8H6N2O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 7462-86-4 | Piperidine-4-carboxylic acid methyl ester hydrochloride | Oakwood Chemical | MFCD02667641 | 179.640 | C7H14ClNO2 | 97.000 | Cl.COC(=O)C1CCNCC1 | 1g | 537684650
Piperidine-4-carboxylic acid methyl ester hydrochloride | Oakwood Chemical | 7462-86-4 | MFCD02667641 | 179.640 | C7H14ClNO2 | 97.000 | Cl.COC(=O)C1CCNCC1 | 1g | 537684650
eMolecules 303144-44-7 | 1-Pyrimidin-2-yl-piperidine-4-carboxylic acid | Combi-Blocks | MFCD00664474 | 207.233 | C10H13N3O2 | 96.000 | OC(=O)C1CCN(CC1)c1ncccn1 | 1g | 232306746
1-Pyrimidin-2-yl-piperidine-4-carboxylic acid | Combi-Blocks | 303144-44-7 | MFCD00664474 | 207.233 | C10H13N3O2 | 96.000 | OC(=O)C1CCN(CC1)c1ncccn1 | 1g | 232306746
eMolecules 694443-80-6 | 4'-(4-bromobenzyloxy)acetophenone | Oakwood Chemicals | MFCD03999373 | 305.171 | C15H13BrO2 | 99.000 | CC(=O)c1ccc(OCc2ccc(Br)cc2)cc1 | 1g | 480117934
4'-(4-bromobenzyloxy)acetophenone | Oakwood Chemicals | 694443-80-6 | MFCD03999373 | 305.171 | C15H13BrO2 | 99.000 | CC(=O)c1ccc(OCc2ccc(Br)cc2)cc1 | 1g | 480117934