Benzene and substituted derivatives
Filtered Search Results
eMolecules 220000-88-4 | AstaTech | 4-(4-(TRIFLUOROMETHYL)PHENYL)PYRIDINE | 0.25g | 718058080 | D82750 | 95 | MFCD08235161 | 223.198 | C12H8F3N
Medchem Express | Aucubin | 10mg | 446275252 | HY-N0664 | 479-98-1 | MFCD00136026 | 346.332 | C15H22O9
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
alpha-Bromo-p-toluic acid, 97%
CAS: 6232-88-8 Molecular Formula: C8H7BrO2 Molecular Weight (g/mol): 215.05 MDL Number: MFCD00002567 InChI Key: CQQSQBRPAJSTFB-UHFFFAOYSA-N Synonym: 4-bromomethyl benzoic acid,alpha-bromo-p-toluic acid,benzoic acid, 4-bromomethyl,p-bromomethyl benzoic acid,4-carboxybenzyl bromide,4-bromomethyl-benzoic acid,a-bromo-p-toluic acid,p-carboxybenzyl bromide,p-bromomethylbenzoic acid PubChem CID: 22599 IUPAC Name: 4-(bromomethyl)benzoic acid SMILES: C1=CC(=CC=C1CBr)C(=O)O
| PubChem CID | 22599 |
|---|---|
| CAS | 6232-88-8 |
| Molecular Weight (g/mol) | 215.05 |
| MDL Number | MFCD00002567 |
| SMILES | C1=CC(=CC=C1CBr)C(=O)O |
| Synonym | 4-bromomethyl benzoic acid,alpha-bromo-p-toluic acid,benzoic acid, 4-bromomethyl,p-bromomethyl benzoic acid,4-carboxybenzyl bromide,4-bromomethyl-benzoic acid,a-bromo-p-toluic acid,p-carboxybenzyl bromide,p-bromomethylbenzoic acid |
| IUPAC Name | 4-(bromomethyl)benzoic acid |
| InChI Key | CQQSQBRPAJSTFB-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO2 |
4-Chlorobenzaldehyde 97.0+%, TCI America™
CAS: 104-88-1 Molecular Formula: C7H5ClO Molecular Weight (g/mol): 140.566 MDL Number: MFCD00003379 InChI Key: AVPYQKSLYISFPO-UHFFFAOYSA-N Synonym: p-chlorobenzaldehyde,benzaldehyde, 4-chloro,benzaldehyde, p-chloro,p-chlorobenzenecarboxaldehyde,4-chloro-benzaldehyde,4-chlorobenzenaldehyde,4-chloro benzaldehyde,ccris 857,para-chlorobenzaldehyde,unii-e67727up9z PubChem CID: 7726 ChEBI: CHEBI:28105 IUPAC Name: 4-chlorobenzaldehyde SMILES: C1=CC(=CC=C1C=O)Cl
| PubChem CID | 7726 |
|---|---|
| CAS | 104-88-1 |
| Molecular Weight (g/mol) | 140.566 |
| ChEBI | CHEBI:28105 |
| MDL Number | MFCD00003379 |
| SMILES | C1=CC(=CC=C1C=O)Cl |
| Synonym | p-chlorobenzaldehyde,benzaldehyde, 4-chloro,benzaldehyde, p-chloro,p-chlorobenzenecarboxaldehyde,4-chloro-benzaldehyde,4-chlorobenzenaldehyde,4-chloro benzaldehyde,ccris 857,para-chlorobenzaldehyde,unii-e67727up9z |
| IUPAC Name | 4-chlorobenzaldehyde |
| InChI Key | AVPYQKSLYISFPO-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO |
4-Isobutylbenzoic Acid 99.0+%, TCI America™
CAS: 38861-88-0 Molecular Formula: C11H14O2 Molecular Weight (g/mol): 178.23 MDL Number: MFCD00191658 InChI Key: VUBBCFWWSKOHTH-UHFFFAOYSA-N PubChem CID: 38111 IUPAC Name: 4-(2-methylpropyl)benzoic acid SMILES: CC(C)CC1=CC=C(C=C1)C(O)=O
| PubChem CID | 38111 |
|---|---|
| CAS | 38861-88-0 |
| Molecular Weight (g/mol) | 178.23 |
| MDL Number | MFCD00191658 |
| SMILES | CC(C)CC1=CC=C(C=C1)C(O)=O |
| IUPAC Name | 4-(2-methylpropyl)benzoic acid |
| InChI Key | VUBBCFWWSKOHTH-UHFFFAOYSA-N |
| Molecular Formula | C11H14O2 |
2,2',4,4'-Tetramethylbenzophenone 96.0+%, TCI America™
CAS: 3478-88-4 Molecular Formula: C17H18O Molecular Weight (g/mol): 238.33 MDL Number: MFCD00060094 InChI Key: KFNQSAKXSGGDAA-UHFFFAOYSA-N PubChem CID: 12274022 IUPAC Name: bis(2,4-dimethylphenyl)methanone SMILES: CC1=CC(C)=C(C=C1)C(=O)C1=C(C)C=C(C)C=C1
| PubChem CID | 12274022 |
|---|---|
| CAS | 3478-88-4 |
| Molecular Weight (g/mol) | 238.33 |
| MDL Number | MFCD00060094 |
| SMILES | CC1=CC(C)=C(C=C1)C(=O)C1=C(C)C=C(C)C=C1 |
| IUPAC Name | bis(2,4-dimethylphenyl)methanone |
| InChI Key | KFNQSAKXSGGDAA-UHFFFAOYSA-N |
| Molecular Formula | C17H18O |
3,5-Difluorobenzaldehyde 98.0+%, TCI America™
CAS: 32085-88-4 Molecular Formula: C7H4F2O Molecular Weight (g/mol): 142.105 MDL Number: MFCD00010329 InChI Key: ASOFZHSTJHGQDT-UHFFFAOYSA-N Synonym: benzaldehyde, 3,5-difluoro,3,5-difluoro-benzaldehyde,pubchem1414,3,5difluorobenzaldehyde,acmc-1aewe,3,5-diflourobenzaldehyde,3-5-difluorobenzaldehyde,3, 5-difluorobenzaldehyde,ksc224o7p,3,5-difluorophenyl methanone PubChem CID: 588160 IUPAC Name: 3,5-difluorobenzaldehyde SMILES: C1=C(C=C(C=C1F)F)C=O
| PubChem CID | 588160 |
|---|---|
| CAS | 32085-88-4 |
| Molecular Weight (g/mol) | 142.105 |
| MDL Number | MFCD00010329 |
| SMILES | C1=C(C=C(C=C1F)F)C=O |
| Synonym | benzaldehyde, 3,5-difluoro,3,5-difluoro-benzaldehyde,pubchem1414,3,5difluorobenzaldehyde,acmc-1aewe,3,5-diflourobenzaldehyde,3-5-difluorobenzaldehyde,3, 5-difluorobenzaldehyde,ksc224o7p,3,5-difluorophenyl methanone |
| IUPAC Name | 3,5-difluorobenzaldehyde |
| InChI Key | ASOFZHSTJHGQDT-UHFFFAOYSA-N |
| Molecular Formula | C7H4F2O |
4-Ethoxybenzyltriphenylphosphonium Bromide 98.0+%, TCI America™
CAS: 82105-88-2 Molecular Formula: C27H26BrOP Molecular Weight (g/mol): 477.38 MDL Number: MFCD00011834 InChI Key: MZBKKJRCQNVENM-UHFFFAOYSA-M Synonym: 4-ethoxybenzyltriphenylphosphonium bromide,4-ethoxybenzyl triphenylphosphonium bromide,4-ethoxyphenyl methyl triphenylphosphanium bromide,acmc-209pn2,4-ethoxybenzyltriphenylphosphoniumbromide,p-ethoxybenzyltriphenylphosphonium bromide,4-ethoxybenzyl triphenylphosphoniumbromide,4-ethoxybenzyl triphenyl phosphonium bromide,4-ethoxyphenyl methyl-triphenylphosphanium bromide,4-ethoxyphenyl methyl triphenyl phosphanium bromide PubChem CID: 2724470 IUPAC Name: [(4-ethoxyphenyl)methyl]triphenylphosphanium bromide SMILES: [Br-].CCOC1=CC=C(C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1
| PubChem CID | 2724470 |
|---|---|
| CAS | 82105-88-2 |
| Molecular Weight (g/mol) | 477.38 |
| MDL Number | MFCD00011834 |
| SMILES | [Br-].CCOC1=CC=C(C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 |
| Synonym | 4-ethoxybenzyltriphenylphosphonium bromide,4-ethoxybenzyl triphenylphosphonium bromide,4-ethoxyphenyl methyl triphenylphosphanium bromide,acmc-209pn2,4-ethoxybenzyltriphenylphosphoniumbromide,p-ethoxybenzyltriphenylphosphonium bromide,4-ethoxybenzyl triphenylphosphoniumbromide,4-ethoxybenzyl triphenyl phosphonium bromide,4-ethoxyphenyl methyl-triphenylphosphanium bromide,4-ethoxyphenyl methyl triphenyl phosphanium bromide |
| IUPAC Name | [(4-ethoxyphenyl)methyl]triphenylphosphanium bromide |
| InChI Key | MZBKKJRCQNVENM-UHFFFAOYSA-M |
| Molecular Formula | C27H26BrOP |
Benzyltrimethylammonium Tetrachloroiodate 95.0+%, TCI America™
CAS: 121309-88-4 Molecular Formula: C10H16Cl4IN Molecular Weight (g/mol): 418.949 MDL Number: MFCD00191607 InChI Key: IBXYFQYYVRYALP-UHFFFAOYSA-N PubChem CID: 11122622 SMILES: C[N+](C)(C)CC1=CC=CC=C1.Cl[I-](Cl)(Cl)Cl
| PubChem CID | 11122622 |
|---|---|
| CAS | 121309-88-4 |
| Molecular Weight (g/mol) | 418.949 |
| MDL Number | MFCD00191607 |
| SMILES | C[N+](C)(C)CC1=CC=CC=C1.Cl[I-](Cl)(Cl)Cl |
| InChI Key | IBXYFQYYVRYALP-UHFFFAOYSA-N |
| Molecular Formula | C10H16Cl4IN |
4-Bromophenylhydrazine Hydrochloride 98.0+%, TCI America™
CAS: 622-88-8 Molecular Formula: C6H8BrClN2 Molecular Weight (g/mol): 223.498 MDL Number: MFCD00012941 InChI Key: RGGOWBBBHWTTRE-UHFFFAOYSA-N Synonym: 4-bromophenylhydrazine hydrochloride,4-bromophenyl hydrazine hydrochloride,4-bromophenylhydrazine hcl,4-bromo phenyl hydrazine hydrochloride,p-bromophenylhydrazine monohydrochloride,hydrazine, 4-bromophenyl-, monohydrochloride,1-4-bromophenyl hydrazine hydrochloride,4-bromophenylhydrazinehydrochloride,p-bromophenylhydrazine hydrochloride PubChem CID: 12157 IUPAC Name: (4-bromophenyl)hydrazine;hydrochloride SMILES: C1=CC(=CC=C1NN)Br.Cl
| PubChem CID | 12157 |
|---|---|
| CAS | 622-88-8 |
| Molecular Weight (g/mol) | 223.498 |
| MDL Number | MFCD00012941 |
| SMILES | C1=CC(=CC=C1NN)Br.Cl |
| Synonym | 4-bromophenylhydrazine hydrochloride,4-bromophenyl hydrazine hydrochloride,4-bromophenylhydrazine hcl,4-bromo phenyl hydrazine hydrochloride,p-bromophenylhydrazine monohydrochloride,hydrazine, 4-bromophenyl-, monohydrochloride,1-4-bromophenyl hydrazine hydrochloride,4-bromophenylhydrazinehydrochloride,p-bromophenylhydrazine hydrochloride |
| IUPAC Name | (4-bromophenyl)hydrazine;hydrochloride |
| InChI Key | RGGOWBBBHWTTRE-UHFFFAOYSA-N |
| Molecular Formula | C6H8BrClN2 |
1-(4-Chlorobenzyl)piperazine 98.0+%, TCI America™
CAS: 23145-88-2 Molecular Formula: C11H15ClN2 Molecular Weight (g/mol): 210.705 MDL Number: MFCD00040791 InChI Key: GSJXJZOWHSTWOX-UHFFFAOYSA-N Synonym: 1-4-chlorobenzyl piperazine,1-4-chlorophenyl methyl piperazine,4-chlorobenzylpiperazine,1-4-chlorobenzyl-piperazine,1-4-chloro-benzyl-piperazine,1-4-chloro benzyl piperazine,n-4-chlorobenzyl piperazine,4-chlorophenyl methyl piperazine,norhomochlorcyclizine,chlorobenzylpiperazin PubChem CID: 134826 IUPAC Name: 1-[(4-chlorophenyl)methyl]piperazine SMILES: C1CN(CCN1)CC2=CC=C(C=C2)Cl
| PubChem CID | 134826 |
|---|---|
| CAS | 23145-88-2 |
| Molecular Weight (g/mol) | 210.705 |
| MDL Number | MFCD00040791 |
| SMILES | C1CN(CCN1)CC2=CC=C(C=C2)Cl |
| Synonym | 1-4-chlorobenzyl piperazine,1-4-chlorophenyl methyl piperazine,4-chlorobenzylpiperazine,1-4-chlorobenzyl-piperazine,1-4-chloro-benzyl-piperazine,1-4-chloro benzyl piperazine,n-4-chlorobenzyl piperazine,4-chlorophenyl methyl piperazine,norhomochlorcyclizine,chlorobenzylpiperazin |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]piperazine |
| InChI Key | GSJXJZOWHSTWOX-UHFFFAOYSA-N |
| Molecular Formula | C11H15ClN2 |
4-Nitrodiphenyl Ether 98.0+%, TCI America™
CAS: 620-88-2 Molecular Formula: C12H9NO3 Molecular Weight (g/mol): 215.208 MDL Number: MFCD00007320 InChI Key: JDTMUJBWSGNMGR-UHFFFAOYSA-N Synonym: 4-nitrophenyl phenyl ether,4-nitrodiphenyl ether,p-nitrophenyl phenyl ether,benzene, 1-nitro-4-phenoxy,p-nitrodiphenyl ether,ether, 4-nitrophenyl phenyl,4-nitrodifenylether,ether, p-nitrophenyl phenyl,1-nitro-4-phenoxy-benzene,4-nitrobiphenyl ether PubChem CID: 12110 IUPAC Name: 1-nitro-4-phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-]
| PubChem CID | 12110 |
|---|---|
| CAS | 620-88-2 |
| Molecular Weight (g/mol) | 215.208 |
| MDL Number | MFCD00007320 |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
| Synonym | 4-nitrophenyl phenyl ether,4-nitrodiphenyl ether,p-nitrophenyl phenyl ether,benzene, 1-nitro-4-phenoxy,p-nitrodiphenyl ether,ether, 4-nitrophenyl phenyl,4-nitrodifenylether,ether, p-nitrophenyl phenyl,1-nitro-4-phenoxy-benzene,4-nitrobiphenyl ether |
| IUPAC Name | 1-nitro-4-phenoxybenzene |
| InChI Key | JDTMUJBWSGNMGR-UHFFFAOYSA-N |
| Molecular Formula | C12H9NO3 |
4-Chloro-2-nitrobenzoic Acid 98.0+%, TCI America™
CAS: 6280-88-2 Molecular Formula: C7H4ClNO4 Molecular Weight (g/mol): 201.56 MDL Number: MFCD00007214 InChI Key: JAHIPDTWWVYVRV-UHFFFAOYSA-N Synonym: 4-chloro-2-nitrobenzoic acid,2-nitro-4-chlorobenzoic acid,4-chloro-2-nitrobenzoicacid,benzoic acid, 4-chloro-2-nitro,4-chloro-2-nitro-benzoic acid,acmc-1b6vn,ksc353a2d,2-carboxy-5-chloronitrobenzene,benzoicacid, 4-chloro-2-nitro,2-nitro-4-chlorobenzoic acid anion PubChem CID: 80475 IUPAC Name: 4-chloro-2-nitrobenzoic acid SMILES: OC(=O)C1=CC=C(Cl)C=C1[N+]([O-])=O
| PubChem CID | 80475 |
|---|---|
| CAS | 6280-88-2 |
| Molecular Weight (g/mol) | 201.56 |
| MDL Number | MFCD00007214 |
| SMILES | OC(=O)C1=CC=C(Cl)C=C1[N+]([O-])=O |
| Synonym | 4-chloro-2-nitrobenzoic acid,2-nitro-4-chlorobenzoic acid,4-chloro-2-nitrobenzoicacid,benzoic acid, 4-chloro-2-nitro,4-chloro-2-nitro-benzoic acid,acmc-1b6vn,ksc353a2d,2-carboxy-5-chloronitrobenzene,benzoicacid, 4-chloro-2-nitro,2-nitro-4-chlorobenzoic acid anion |
| IUPAC Name | 4-chloro-2-nitrobenzoic acid |
| InChI Key | JAHIPDTWWVYVRV-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO4 |
3-Chloro-4-nitrotoluene 98.0+%, TCI America™
CAS: 38939-88-7 Molecular Formula: C7H6ClNO2 Molecular Weight (g/mol): 171.58 MDL Number: MFCD02683043 InChI Key: KGSQRFPDZCBVBS-UHFFFAOYSA-N Synonym: 3-chloro-4-nitrotoluene,2-chloro-4-methyl-1-nitro-benzene,benzene, 2-chloro-4-methyl-1-nitro,pubchem4534,acmc-1afh8,ksc493s6j PubChem CID: 123478 IUPAC Name: 2-chloro-4-methyl-1-nitrobenzene SMILES: CC1=CC(=C(C=C1)[N+](=O)[O-])Cl
| PubChem CID | 123478 |
|---|---|
| CAS | 38939-88-7 |
| Molecular Weight (g/mol) | 171.58 |
| MDL Number | MFCD02683043 |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])Cl |
| Synonym | 3-chloro-4-nitrotoluene,2-chloro-4-methyl-1-nitro-benzene,benzene, 2-chloro-4-methyl-1-nitro,pubchem4534,acmc-1afh8,ksc493s6j |
| IUPAC Name | 2-chloro-4-methyl-1-nitrobenzene |
| InChI Key | KGSQRFPDZCBVBS-UHFFFAOYSA-N |
| Molecular Formula | C7H6ClNO2 |
1-Bromo-2-(trifluoromethoxy)benzene 98.0+%, TCI America™
CAS: 64115-88-4 Molecular Formula: C7H4BrF3O Molecular Weight (g/mol): 241.01 MDL Number: MFCD00040942 InChI Key: ITYCJCVRPBLODP-UHFFFAOYSA-N Synonym: 1-bromo-2-trifluoromethoxy benzene,2-trifluoromethoxy bromobenzene,2-bromo trifluoromethoxy benzene,o-trifluoromethoxybromobenzene,o-bromo trifluoromethoxy benzene,2-bromo-alpha,alpha,alpha-trifluoroanisole,2-bromophenyl trifluoromethyl ether,trifluoromethoxy bromobenzene,o-bromotrifluoromethoxybenzene,benzene, bromo trifluoromethoxy PubChem CID: 2777266 IUPAC Name: 1-bromo-2-(trifluoromethoxy)benzene SMILES: FC(F)(F)OC1=CC=CC=C1Br
| PubChem CID | 2777266 |
|---|---|
| CAS | 64115-88-4 |
| Molecular Weight (g/mol) | 241.01 |
| MDL Number | MFCD00040942 |
| SMILES | FC(F)(F)OC1=CC=CC=C1Br |
| Synonym | 1-bromo-2-trifluoromethoxy benzene,2-trifluoromethoxy bromobenzene,2-bromo trifluoromethoxy benzene,o-trifluoromethoxybromobenzene,o-bromo trifluoromethoxy benzene,2-bromo-alpha,alpha,alpha-trifluoroanisole,2-bromophenyl trifluoromethyl ether,trifluoromethoxy bromobenzene,o-bromotrifluoromethoxybenzene,benzene, bromo trifluoromethoxy |
| IUPAC Name | 1-bromo-2-(trifluoromethoxy)benzene |
| InChI Key | ITYCJCVRPBLODP-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrF3O |
Hexyl Benzoate 98.0+%, TCI America™
CAS: 6789-88-4 Molecular Formula: C13H18O2 Molecular Weight (g/mol): 206.285 MDL Number: MFCD00051714 InChI Key: UUGLJVMIFJNVFH-UHFFFAOYSA-N Synonym: benzoic acid, hexyl ester,benzoic acid n-hexyl ester,n-hexylbenzoate,n-hexyl benzoate,1-hexyl benzoate,hexylbenzoate,hexylester kyseliny benzoove,benzoic acid hexyl ester,unii-vr3c36ekjr,fema no. 3691 PubChem CID: 23235 IUPAC Name: hexyl benzoate SMILES: CCCCCCOC(=O)C1=CC=CC=C1
| PubChem CID | 23235 |
|---|---|
| CAS | 6789-88-4 |
| Molecular Weight (g/mol) | 206.285 |
| MDL Number | MFCD00051714 |
| SMILES | CCCCCCOC(=O)C1=CC=CC=C1 |
| Synonym | benzoic acid, hexyl ester,benzoic acid n-hexyl ester,n-hexylbenzoate,n-hexyl benzoate,1-hexyl benzoate,hexylbenzoate,hexylester kyseliny benzoove,benzoic acid hexyl ester,unii-vr3c36ekjr,fema no. 3691 |
| IUPAC Name | hexyl benzoate |
| InChI Key | UUGLJVMIFJNVFH-UHFFFAOYSA-N |
| Molecular Formula | C13H18O2 |