Carboxylic acids and derivatives
![eMolecules 1083246-73-4 | [1-(Benzyloxycarbonylamino-methyl)-cyclohexyl]-acetic acid | J&W PharmLab LLC | MFCD18264502 | 305.374 | C17H23NO4 | 96.000 | OC(=O)CC1(CNC(=O)OCc2ccccc2)CCCCC1 | 500mg | 718378451](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502479530.JPG-250.jpg)
eMolecules 1083246-73-4 | [1-(Benzyloxycarbonylamino-methyl)-cyclohexyl]-acetic acid | J&W PharmLab LLC | MFCD18264502 | 305.374 | C17H23NO4 | 96.000 | OC(=O)CC1(CNC(=O)OCc2ccccc2)CCCCC1 | 500mg | 718378451
[1-(Benzyloxycarbonylamino-methyl)-cyclohexyl]-acetic acid | J&W PharmLab LLC | 1083246-73-4 | MFCD18264502 | 305.374 | C17H23NO4 | 96.000 | OC(=O)CC1(CNC(=O)OCc2ccccc2)CCCCC1 | 500mg | 718378451
eMolecules 4971-55-5 | 3-Chlorotetronic acid | Oakwood Chemical | MFCD00134273 | 134.520 | C4H3ClO3 | 98.000 | ClC1C(=O)COC1=O | 1g | 537709997
3-Chlorotetronic acid | Oakwood Chemical | 4971-55-5 | MFCD00134273 | 134.520 | C4H3ClO3 | 98.000 | ClC1C(=O)COC1=O | 1g | 537709997
eMolecules 794564-07-1 | 4-(Benzyloxy)phenethyl dodecanoate | Ambeed | MFCD30489056 | 410.598 | C27H38O3 | 99.000 | CCCCCCCCCCCC(=O)OCCc1ccc(OCc2ccccc2)cc1 | 5g | 686659989
4-(Benzyloxy)phenethyl dodecanoate | Ambeed | 794564-07-1 | MFCD30489056 | 410.598 | C27H38O3 | 99.000 | CCCCCCCCCCCC(=O)OCCc1ccc(OCc2ccccc2)cc1 | 5g | 686659989
Selleck Chemical LLC 3-methylthiopropionate
3-(Methylthio)propionic acid (3-methylthiopropionate 4-Thiapentanoic acid 3-Methylsulfanylpropionic acid) is a thia fatty acid acid consisting of propionic acid with a methylthio substituent at the 3-position and an intermediate in mammalian methionine metabolism in vitro
Sigma Aldrich Fine Chemicals Biosciences Levulinic acid natural, 99%, FG | 123-76-2 | MFCD00002796 | 10KG
Levulinic acid natural, 99%, FG | Purity: 99% | Mol Wt: 116.12 | 123-76-2 | MFCD00002796 | 10KG
eMolecules 13518-40-6 | Ambeed | (S)-tert-Butyl 2-amino-3-methylbutanoate hydrochloride | 5g | 490522419 | A171504 | MFCD00034863 | 209.71 | C9H20ClNO2
Methyl oxetane-3-carboxylate | Ambeed | 1638760-80-1 | MFCD22566365 | 116.116 | C5H8O3 | 95.000 | COC(=O)C1COC1 | 1g | 570568108
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 587850-67-7 | 4-AMINO-N-(2-PHENYLETHYL)BENZENESULFONAMIDE | AstaTech | MFCD03716650 | 276.350 | C14H16N2O2S | 95.000 | Nc1ccc(cc1)S(=O)(=O)NCCc1ccccc1 | 1g | 290667929
4-AMINO-N-(2-PHENYLETHYL)BENZENESULFONAMIDE | AstaTech | 587850-67-7 | MFCD03716650 | 276.350 | C14H16N2O2S | 95.000 | Nc1ccc(cc1)S(=O)(=O)NCCc1ccccc1 | 1g | 290667929
Sigma Aldrich Fine Chemicals Biosciences Benzyl acetate >=99%, FCC, FG | 140-11-4 | MFCD00008712 |
Benzyl acetate >=99%, FCC, FG | Purity: >=99% | Mol Wt: 150.17 | 140-11-4 | MFCD00008712 |
eMolecules 6099-04-3 | 3-(3-Methoxyphenyl)acrylic acid | MFCD00004386 | 5g
Ambeed | 3-(3-Methoxyphenyl)acrylic acid | 5g | 525086697 | A170167 | 6099-04-3 | MFCD00004386 | 178.187 | C10H10O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 130309-46-5 | 4-tert-Butoxycarbonylamino-cyclohexanecarboxylic acid | J & W PharmLab LLC | MFCD03453262 | 243.303 | C12H21NO4 | 96.000 | CC(C)(C)OC(=O)NC1CCC(CC1)C(O)=O | 1g | 525334931
4-tert-Butoxycarbonylamino-cyclohexanecarboxylic acid | J & W PharmLab LLC | 130309-46-5 | MFCD03453262 | 243.303 | C12H21NO4 | 96.000 | CC(C)(C)OC(=O)NC1CCC(CC1)C(O)=O | 1g | 525334931
eMolecules 25118-23-4 | Ambeed | Ethyl hept-6-enoate | 250mg | 642079690 | A1158117 | MFCD00671845 | 156.225 | C9H16O2
Ambeed | 2-Fluoropropionicacid | 1g | 600851710 | A693841 | 6087-13-4 | MFCD06247714 | 92.069 | C3H5FO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>