Benzophenones
eMolecules 438049-36-6 | 2,6-Difluoro-4-hydroxybenzyl alcohol | MFCD11040173 | 1g
ChemScene | 2-Chloro-n-(diphenylmethyl)propanamide | 100mg | 654783245 | CS-0221142 | 94500-97-7 | MFCD05263186 | 273.760 | C16H16ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1013-88-3 | Benzophenone imine | Combi-Blocks | MFCD00001760 | 181.238 | C13H11N | 95.000 | N=C(c1ccccc1)c1ccccc1 | 1kg | 267162599
Benzophenone imine | Combi-Blocks | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 95.000 | N=C(c1ccccc1)c1ccccc1 | 1kg | 267162599
eMolecules 918523-99-6 | 2,5-Difluoro-4-hydroxybenzaldehyde | MFCD04112521 | 1g
Ambeed | 2,5-Difluoro-4-hydroxybenzaldehyde | 1g | 572825126 | A715304 | 918523-99-6 | MFCD04112521 | 158.104 | C7H4F2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1013-88-3 | Benzophenone imine | Chem-Impex | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 1kg | 254750104
Benzophenone imine | Chem-Impex | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 1kg | 254750104
eMolecules 1147-43-9 | 2-Aminobenzophenone-2'-carboxylic acid | Oakwood Chemical | MFCD00007715 | 241.246 | C14H11NO3 | 98.000 | Nc1ccccc1C(=O)c1ccccc1C(O)=O | 1g | 537710528
2-Aminobenzophenone-2'-carboxylic acid | Oakwood Chemical | 1147-43-9 | MFCD00007715 | 241.246 | C14H11NO3 | 98.000 | Nc1ccccc1C(=O)c1ccccc1C(O)=O | 1g | 537710528
American Radiolabeled Chemicals Inc BENZOPHENONE 2 3H 250UC
Benzophenone-2-ring-3H 250uCi in ethanol, 1 mCi/ml, 10-20 Ci/mmol, M.W. 246.2, Shipped in Dry Ice, Exclusive
eMolecules 579-18-0 | 3-Benzoylbenzoic acid | Combi-Blocks, Inc. | MFCD00002518 | 226.231 | C14H10O3 | 98.000 | OC(=O)c1cccc(c1)C(=O)c1ccccc1 | 5g | 569295495
3-Benzoylbenzoic acid | Combi-Blocks, Inc. | 579-18-0 | MFCD00002518 | 226.231 | C14H10O3 | 98.000 | OC(=O)c1cccc(c1)C(=O)c1ccccc1 | 5g | 569295495
Matrix Scientific 2-HYDROXYBENZOPHENONE-5G
2-Hydroxybenzophenone, 99%; 5g,C13H10O2, MFCD00002216, mw 198.22, [117-99-7]
![eMolecules 6628-37-1 | 2-HYDROXY-4-METHOXYBENZOPHENONE-5-SULFONIC ACID SODIUM SALT | AstaTech332.300 | C14H13NaO6S | 95.000 | [NaH].COc1cc(O)c(cc1S(O)(=O)=O)C(=O)c1ccccc1 | 5g | 599121292](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502199382.JPG-250.jpg)
eMolecules 6628-37-1 | 2-HYDROXY-4-METHOXYBENZOPHENONE-5-SULFONIC ACID SODIUM SALT | AstaTech332.300 | C14H13NaO6S | 95.000 | [NaH].COc1cc(O)c(cc1S(O)(=O)=O)C(=O)c1ccccc1 | 5g | 599121292
2-HYDROXY-4-METHOXYBENZOPHENONE-5-SULFONIC ACID SODIUM SALT | AstaTech | 6628-37-1332.300 | C14H13NaO6S | 95.000 | [NaH].COc1cc(O)c(cc1S(O)(=O)=O)C(=O)c1ccccc1 | 5g | 599121292
eMolecules 1013-88-3 | Benzophenone imine | Chem-Impex | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 100g | 112766097
Benzophenone imine | Chem-Impex | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 100g | 112766097
Enzo Life Sciences AH-6809 (5 mg). CAS: 33458-93-4
Selective prostaglandin E2 receptor (EP1) antagonist. Useful at concentrations up to 10 µM, at which point it starts to block PGD2 and TXA2 receptors. Purity: ≥98% (TLC). Solubility: Soluble in DMSO. Long Term Storage: Ambient.
Medchemexpress LLC HY-10418 5mg Medchemexpress, AH 6809 CAS:33458-93-4 Purity:>98%
Medchemexpress, HY-10418 5mg AH 6809 CAS:33458-93-4 Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Sigma Aldrich Fine Chemicals Biosciences 2-Hydroxybenzophenone 99% | 117-99-7 | MFCD00002216 | 25G
2-Hydroxybenzophenone 99% | Purity: 99% | Mol Wt: 198.22 | 117-99-7 | MFCD00002216 | 25G
