Phenylcarbamic acid esters
eMolecules 1818294-42-6 | Amino-PEG10-Boc | Ambeed | MFCD26127812 | 585.732 | C27H55NO12 | 95.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN | 100mg | 599120008
Amino-PEG10-Boc | Ambeed | 1818294-42-6 | MFCD26127812 | 585.732 | C27H55NO12 | 95.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN | 100mg | 599120008
eMolecules 1818294-42-6 | Amino-PEG10-Boc | Ambeed | MFCD26127812 | 585.732 | C27H55NO12 | 95.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN | 250mg | 599120009
Amino-PEG10-Boc | Ambeed | 1818294-42-6 | MFCD26127812 | 585.732 | C27H55NO12 | 95.000 | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN | 250mg | 599120009
Medchemexpress LLC Bromo-PEG2-C2-Boc | 1381861-91-1 | 97.0% | C11H21BrO4 | 250 MG
Bromo-PEG2-C2-Boc is a PEG-based PROTAC linker used in the synthesis of PROTACs. It is for research use only and exploits the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
- PEG-based PROTAC linker
- Used in the synthesis of PROTACs
- Exploits intracellular ubiquitin-proteasome system
- Selectively degrades target proteins
Selleck Chemical LLC N-Methylsarcosine
N-Methylsarcosine (N N-Dimethylglycine (Dimethylamino)acetic acid) is a natural N-methylated glycine that is used in the development of glycine-based ionic liquids and emulsifiers
![eMolecules 53292-89-0 | trans-4-(Boc-amino)cyclohexanecarboxylic acid | Accela ChemBio (ASD) | MFCD01862293 | 243.303 | C12H21NO4 | 98.000 | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](CC1)C(O)=O | 5g | 444750847](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000472118.jpg-250.jpg)
eMolecules 53292-89-0 | trans-4-(Boc-amino)cyclohexanecarboxylic acid | Accela ChemBio (ASD) | MFCD01862293 | 243.303 | C12H21NO4 | 98.000 | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](CC1)C(O)=O | 5g | 444750847
trans-4-(Boc-amino)cyclohexanecarboxylic acid | Accela ChemBio (ASD) | 53292-89-0 | MFCD01862293 | 243.303 | C12H21NO4 | 98.000 | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](CC1)C(O)=O | 5g | 444750847
Medchemexpress LLC Boc-aminoxy-PEG4-acid | 2062663-68-5 | 98.0% | C16H31NO9 | 25 MG
Boc-aminoxy-PEG4-acid is a PEG-based PROTAC linker. It can be used in the synthesis of PROTACs, which are compounds containing two different ligands connected by a linker. One ligand is for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
- Functions as a PEG-based PROTAC linker
- Useful in the synthesis of PROTAC compounds
- Facilitates targeted protein degradation via the ubiquitin-proteasome system
- Connects ligands for E3 ubiquitin ligase and target proteins
Medchemexpress LLC Carbamic acid, N-[2-hydroxy-1,1-bis(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester | 146651-71-0 | ≥97.0% | C9H19NO5 | 25 G
N-Boc-Tris is a protective reagent that utilizes the Boc protecting group to protect amino groups, preventing unnecessary side reactions. It is widely used in various fields such as organic synthesis and pharmaceutical research and development. This product appears as a white to off-white solid.
- Functions as a protective reagent
- Utilizes the Boc protecting group
- Protects amino groups in reactions
- Prevents unwanted side reactions
- Applicable in organic synthesis
- Applicable in pharmaceutical research and development
Medchemexpress LLC N-Boc-N-bis(C2-PEG1-azide) | 2100306-79-2 | 25 MG
N-Boc-N-bis(C2-PEG1-azide) | 2100306-79-2 | 25 MG
![eMolecules 53292-89-0 | Trans-4-Boc-cyclohexanecarboxylic acid | Synthonix - Stock | MFCD01862293 | 243.303 | C12H21NO4 | 97.000 | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](CC1)C(O)=O | 50g | 414011417](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000472655.jpg-250.jpg)
eMolecules 53292-89-0 | Trans-4-Boc-cyclohexanecarboxylic acid | Synthonix - Stock | MFCD01862293 | 243.303 | C12H21NO4 | 97.000 | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](CC1)C(O)=O | 50g | 414011417
Trans-4-Boc-cyclohexanecarboxylic acid | Synthonix - Stock | 53292-89-0 | MFCD01862293 | 243.303 | C12H21NO4 | 97.000 | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](CC1)C(O)=O | 50g | 414011417
eMolecules 1363380-83-9 | 1-(BOC-AMINO)-3,3-DIFLUOROCYCLOBUTANECARBOXYLIC ACID | AstaTech | MFCD22415254 | 251.230 | C10H15F2NO4 | 95.000 | CC(C)(C)OC(=O)NC1(CC(F)(F)C1)C(O)=O | 0.1g | 875343080
1-(BOC-AMINO)-3,3-DIFLUOROCYCLOBUTANECARBOXYLIC ACID | AstaTech | 1363380-83-9 | MFCD22415254 | 251.230 | C10H15F2NO4 | 95.000 | CC(C)(C)OC(=O)NC1(CC(F)(F)C1)C(O)=O | 0.1g | 875343080
eMolecules 111721-74-5 | 2-Bromo-5-iodoaniline | ChemScene | MFCD16038675 | 297.921 | C6H5BrIN | 97.000 | Nc1cc(I)ccc1Br | 5g | 717420087
2-Bromo-5-iodoaniline | ChemScene | 111721-74-5 | MFCD16038675 | 297.921 | C6H5BrIN | 97.000 | Nc1cc(I)ccc1Br | 5g | 717420087
eMolecules 14047-29-1 | 4-Carboxybenzeneboronic acid | Oakwood Chemicals | MFCD00151801 | 165.940 | C7H7BO4 | 98.000 | OB(O)c1ccc(cc1)C(O)=O | 1g | 480110039
4-Carboxybenzeneboronic acid | Oakwood Chemicals | 14047-29-1 | MFCD00151801 | 165.940 | C7H7BO4 | 98.000 | OB(O)c1ccc(cc1)C(O)=O | 1g | 480110039
=O)Cc1cccc(Cl)c1 | 1g | 117552657](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000471626.jpg-250.jpg)
eMolecules 270596-39-9 | Boc-(S)-3-amino-4-(3-chloro-phenyl)-butyric acid | Combi-Blocks | MFCD01860999 | 313.780 | C15H20ClNO4 | 97.000 | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1cccc(Cl)c1 | 1g | 117552657
Boc-(S)-3-amino-4-(3-chloro-phenyl)-butyric acid | Combi-Blocks | 270596-39-9 | MFCD01860999 | 313.780 | C15H20ClNO4 | 97.000 | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1cccc(Cl)c1 | 1g | 117552657
Medchemexpress LLC HSP60 Mouse N-His 50ug
The HSP60 protein together with Hsp10 contributes to the import and assembly of mitochondrial proteins It ensures correct folding and prevents incorrect folding under stressful conditions HSP60 Protein Mouse (N-His) is the recombinant mouse-derived HSP60 expressed by E coli with N-10 His labeled tag The total length of HSP60 Protein Mouse (N-His) is 572 a a