Protein Modification Reagents
(=O)OCCNC(=O)OCCNC(=O)CI)OC(=O)CCCCCCCCCCCCCCCCC | 100mg | 649282255](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502475556.JPG-250.jpg)
eMolecules DSPE-PEG-IA, MW 2,000 | Broadpharm |1003.091 | C46H88IN2O11P | 0.000 | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(=O)OCCNC(=O)OCCNC(=O)CI)OC(=O)CCCCCCCCCCCCCCCCC | 100mg | 649282255
DSPE-PEG-IA, MW 2,000 | Broadpharm |1003.091 | C46H88IN2O11P | 0.000 | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(=O)OCCNC(=O)OCCNC(=O)CI)OC(=O)CCCCCCCCCCCCCCCCC | 100mg | 649282255
![eMolecules 1374658-86-2 | Biotin-PEG3-(CH2)3-NH2 TFA salt | Broadpharm | MFCD28053681 | 446.610 | C20H38N4O5S | 98.000 | NCCCOCCOCCOCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12 | 1g | 309209153](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502202743.JPG-250.jpg)
eMolecules 1374658-86-2 | Biotin-PEG3-(CH2)3-NH2 TFA salt | Broadpharm | MFCD28053681 | 446.610 | C20H38N4O5S | 98.000 | NCCCOCCOCCOCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12 | 1g | 309209153
Biotin-PEG3-(CH2)3-NH2 TFA salt | Broadpharm | 1374658-86-2 | MFCD28053681 | 446.610 | C20H38N4O5S | 98.000 | NCCCOCCOCCOCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12 | 1g | 309209153
Chemscene ChemScene | Azido-PEG5-amine | 1G | CS-0114401 | 0.97 | 516493-93-9| MFCD16619318 | 306.36
ChemScene | Azido-PEG5-amine | 1G | CS-0114401 | 0.97 | 516493-93-9| MFCD16619318 | 306.36
eMolecules 2204246-03-5 | Pomalidomide-PEG3-NH-Boc | Broadpharm548.593 | C26H36N4O9 | 0.000 | CC(C)(C)OC(=O)NCCOCCOCCOCCNc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12 | 500mg | 533795541
Pomalidomide-PEG3-NH-Boc | Broadpharm | 2204246-03-5548.593 | C26H36N4O9 | 0.000 | CC(C)(C)OC(=O)NCCOCCOCCOCCNc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12 | 500mg | 533795541
Medchemexpress LLC Tos-PEG4-acid | 1453117-42-4 | 97.2% | 50 MG
Tos-PEG4-acid is a PEG-based PROTAC linker used in the synthesis of PROTACs. This compound facilitates the degradation of target proteins by exploiting the intracellular ubiquitin-proteasome system.
- Peg-based PROTAC linker
- Utilized in PROTAC synthesis
- Facilitates protein degradation
- Selectively targets proteins via ubiquitin-proteasome system
eMolecules DBCO-PEG8-Maleimide | Broadpharm |850.963 | C44H58N4O13 | 0.000 | O=C(CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)NCCC(=O)N1Cc2ccccc2C#Cc2ccccc12 | 25mg | 686678581
DBCO-PEG8-Maleimide | Broadpharm |850.963 | C44H58N4O13 | 0.000 | O=C(CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)NCCC(=O)N1Cc2ccccc2C#Cc2ccccc12 | 25mg | 686678581
Medchemexpress LLC Propargyl-PEG4-Tos | 875770-32-4 | 99.3% | 5 G
Propargyl-PEG4-Tos is a PEG-based PROTAC linker used in the synthesis of PROTACs and as a cleavable ADC linker in the synthesis of antibody-drug conjugates (ADCs). It also functions as a click chemistry reagent featuring an Alkyne group that can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
- PEG-based PROTAC linker
- Used in the synthesis of PROTACs
- Cleavable ADC linker
- Utilized in the synthesis of antibody-drug conjugates (ADCs)
- Click chemistry reagent
- Features an alkyne group
- Undergoes copper-catalyzed azide-alkyne cycloaddition (CuAAc) with azide-containing molecules
Nanocs DSPE PEG Maleimide, DSPE-PEG-MAL, Specification 3400 Da, 100 mg
DSPE PEG Maleimide is one of Nanocs reactive phospholipid PEG reagents that can react with sulfhydryl (thiol, -SH) groups. DSPE (1,2-Distearoyl-sn-Glycero-3-Phosphoethanolamine) is a saturated 18C phospholipid that is highly hydrophobic. PEG linker (polyethylene glycol), on the other hand, offers good hydrophilicity and water solubility. Maleimide functional DSPE PEG has excellent reactivity towards sulfhydryl/thiol groups derived from various molecules. Reaction between maleimide and thiolproceeds easily at neutral pH. Maleimide PEG DSPE is one of most commonly used reactive phospholipids to conjugate antibodies, peptides or other ligands to the surface of liposome and other lipid PEG nanoparticles. Pegylated phospholipids have longer blood circulation time and higher stability for encapsulated drugs.
