Chemicals
Filtered Search Results
Ferric Chloride Hexahydrate, >97%, (ACS Reagent Grade), MP Biomedicals
CAS: 10025-77-1 Molecular Formula: Cl3FeH12O6 Molecular Weight (g/mol): 270.29 MDL Number: MFCD00149712 InChI Key: NQXWGWZJXJUMQB-UHFFFAOYSA-K IUPAC Name: iron(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 10025-77-1 |
|---|---|
| Molecular Weight (g/mol) | 270.29 |
| MDL Number | MFCD00149712 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3] |
| IUPAC Name | iron(3+) hexahydrate trichloride |
| InChI Key | NQXWGWZJXJUMQB-UHFFFAOYSA-K |
| Molecular Formula | Cl3FeH12O6 |
Isopropyl methanesulfonate, 99%
CAS: 926-06-7 Molecular Formula: C4H10O3S Molecular Weight (g/mol): 138.19 MDL Number: MFCD00047802 InChI Key: SWWHCQCMVCPLEQ-UHFFFAOYSA-N Synonym: isopropyl methanesulfonate,isopropyl mesylate,isopropylmethanesulfonate,methanesulfonic acid, 1-methylethyl ester,isopropyl methane sulphonate,2-propyl methanesulphonate,isopropyl methane sulfonate,methanesulfonic acid, isopropyl ester,isopropyl methanesulphonate,unii-t0k2txy26b PubChem CID: 13551 IUPAC Name: propan-2-yl methanesulfonate SMILES: CC(C)OS(=O)(=O)C
| PubChem CID | 13551 |
|---|---|
| CAS | 926-06-7 |
| Molecular Weight (g/mol) | 138.19 |
| MDL Number | MFCD00047802 |
| SMILES | CC(C)OS(=O)(=O)C |
| Synonym | isopropyl methanesulfonate,isopropyl mesylate,isopropylmethanesulfonate,methanesulfonic acid, 1-methylethyl ester,isopropyl methane sulphonate,2-propyl methanesulphonate,isopropyl methane sulfonate,methanesulfonic acid, isopropyl ester,isopropyl methanesulphonate,unii-t0k2txy26b |
| IUPAC Name | propan-2-yl methanesulfonate |
| InChI Key | SWWHCQCMVCPLEQ-UHFFFAOYSA-N |
| Molecular Formula | C4H10O3S |
Nitric Acid, 10% (v/v), Ricca Chemical
CAS: 7732-18-5 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Calcium sulfate, 99%, pure, anhydrous
CAS: 7778-18-9 Molecular Formula: CaO4S Molecular Weight (g/mol): 136.13 MDL Number: MFCD00010912 InChI Key: OSGAYBCDTDRGGQ-UHFFFAOYSA-L Synonym: calcium sulfate,drierite,gypsum,sulfuric acid, calcium salt 1:1,karstenite,calcium sulphate,anhydrous gypsum,plaster of paris,anhydrous calcium sulfate,calcium sulfate, anhydrous PubChem CID: 24497 ChEBI: CHEBI:31346 IUPAC Name: calcium;sulfate SMILES: [Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24497 |
|---|---|
| CAS | 7778-18-9 |
| Molecular Weight (g/mol) | 136.13 |
| ChEBI | CHEBI:31346 |
| MDL Number | MFCD00010912 |
| SMILES | [Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate,drierite,gypsum,sulfuric acid, calcium salt 1:1,karstenite,calcium sulphate,anhydrous gypsum,plaster of paris,anhydrous calcium sulfate,calcium sulfate, anhydrous |
| IUPAC Name | calcium;sulfate |
| InChI Key | OSGAYBCDTDRGGQ-UHFFFAOYSA-L |
| Molecular Formula | CaO4S |
Tetrahydrofuran, 99+%, extra pure, stabilized with BHT
CAS: 109-99-9 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00005356 InChI Key: WYURNTSHIVDZCO-UHFFFAOYSA-N Synonym: tetrahydrofuran,furan, tetrahydro,butylene oxide,furanidine,hydrofuran,tetramethylene oxide,oxacyclopentane,1,4-epoxybutane,tetrahydrofuranne,tetraidrofurano PubChem CID: 8028 ChEBI: CHEBI:26911 IUPAC Name: oxolane SMILES: C1CCOC1
| PubChem CID | 8028 |
|---|---|
| CAS | 109-99-9 |
| Molecular Weight (g/mol) | 72.11 |
| ChEBI | CHEBI:26911 |
| MDL Number | MFCD00005356 |
| SMILES | C1CCOC1 |
| Synonym | tetrahydrofuran,furan, tetrahydro,butylene oxide,furanidine,hydrofuran,tetramethylene oxide,oxacyclopentane,1,4-epoxybutane,tetrahydrofuranne,tetraidrofurano |
| IUPAC Name | oxolane |
| InChI Key | WYURNTSHIVDZCO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
Calcium carbonate, 99.5% (metals basis)
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 IUPAC Name: calcium;carbonate SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| IUPAC Name | calcium;carbonate |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Spermidine, 99%
CAS: 124-20-9 Molecular Formula: C7H19N3 Molecular Weight (g/mol): 145.25 MDL Number: MFCD00008229 InChI Key: ATHGHQPFGPMSJY-UHFFFAOYSA-N Synonym: spermidine,1,5,10-triazadecane,4-azaoctamethylenediamine,spermidin,4-azaoctane-1,8-diamine,n1-3-aminopropyl butane-1,4-diamine,1,4-butanediamine, n-3-aminopropyl,n-3-aminopropyl butane-1,4-diamine,n-3-aminopropyl-1,4-butane-diamine,1,4-diaminobutane, n-3-aminopropyl PubChem CID: 1102 ChEBI: CHEBI:16610 SMILES: NCCCCNCCCN
| PubChem CID | 1102 |
|---|---|
| CAS | 124-20-9 |
| Molecular Weight (g/mol) | 145.25 |
| ChEBI | CHEBI:16610 |
| MDL Number | MFCD00008229 |
| SMILES | NCCCCNCCCN |
| Synonym | spermidine,1,5,10-triazadecane,4-azaoctamethylenediamine,spermidin,4-azaoctane-1,8-diamine,n1-3-aminopropyl butane-1,4-diamine,1,4-butanediamine, n-3-aminopropyl,n-3-aminopropyl butane-1,4-diamine,n-3-aminopropyl-1,4-butane-diamine,1,4-diaminobutane, n-3-aminopropyl |
| InChI Key | ATHGHQPFGPMSJY-UHFFFAOYSA-N |
| Molecular Formula | C7H19N3 |
Sodium nitroferricyanide dihydrate, 99+%
CAS: 13755-38-9 Molecular Formula: C5H4FeN6Na2O3 Molecular Weight (g/mol): 297.95 MDL Number: MFCD00149192 InChI Key: JFPDVRGGFBUORC-UHFFFAOYSA-N Synonym: nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o PubChem CID: 11953895 SMILES: O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+]
| PubChem CID | 11953895 |
|---|---|
| CAS | 13755-38-9 |
| Molecular Weight (g/mol) | 297.95 |
| MDL Number | MFCD00149192 |
| SMILES | O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+] |
| Synonym | nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o |
| InChI Key | JFPDVRGGFBUORC-UHFFFAOYSA-N |
| Molecular Formula | C5H4FeN6Na2O3 |
Benzonitrile, 99%, pure
CAS: 100-47-0 MDL Number: MFCD00001770 InChI Key: JFDZBHWFFUWGJE-UHFFFAOYSA-N Synonym: phenyl cyanide,cyanobenzene,benzenenitrile,benzoic acid nitrile,benzene, cyano,benzenecarbonitrile,phenylcyanide,fenylkyanid,fenylkyanid czech,benzonitril PubChem CID: 7505 ChEBI: CHEBI:27991 IUPAC Name: benzonitrile SMILES: C1=CC=C(C=C1)C#N
| PubChem CID | 7505 |
|---|---|
| CAS | 100-47-0 |
| ChEBI | CHEBI:27991 |
| MDL Number | MFCD00001770 |
| SMILES | C1=CC=C(C=C1)C#N |
| Synonym | phenyl cyanide,cyanobenzene,benzenenitrile,benzoic acid nitrile,benzene, cyano,benzenecarbonitrile,phenylcyanide,fenylkyanid,fenylkyanid czech,benzonitril |
| IUPAC Name | benzonitrile |
| InChI Key | JFDZBHWFFUWGJE-UHFFFAOYSA-N |
Ammonium thiocyanate, ACS, 97.5% min
CAS: 1762-95-4 Molecular Formula: CH4N2S Molecular Weight (g/mol): 76.117 MDL Number: MFCD00011428 InChI Key: SOIFLUNRINLCBN-UHFFFAOYSA-N Synonym: ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt PubChem CID: 15666 IUPAC Name: azanium;thiocyanate SMILES: C(#N)[S-].[NH4+]
| PubChem CID | 15666 |
|---|---|
| CAS | 1762-95-4 |
| Molecular Weight (g/mol) | 76.117 |
| MDL Number | MFCD00011428 |
| SMILES | C(#N)[S-].[NH4+] |
| Synonym | ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt |
| IUPAC Name | azanium;thiocyanate |
| InChI Key | SOIFLUNRINLCBN-UHFFFAOYSA-N |
| Molecular Formula | CH4N2S |
Methanol, 99.9%, for analysis
CAS: 67-56-1 Molecular Formula: CH4O Molecular Weight (g/mol): 32.04 MDL Number: MFCD00004595 InChI Key: OKKJLVBELUTLKV-UHFFFAOYSA-N Synonym: methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit PubChem CID: 887 ChEBI: CHEBI:17790 IUPAC Name: methanol SMILES: CO
| PubChem CID | 887 |
|---|---|
| CAS | 67-56-1 |
| Molecular Weight (g/mol) | 32.04 |
| ChEBI | CHEBI:17790 |
| MDL Number | MFCD00004595 |
| SMILES | CO |
| Synonym | methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit |
| IUPAC Name | methanol |
| InChI Key | OKKJLVBELUTLKV-UHFFFAOYSA-N |
| Molecular Formula | CH4O |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Boiling Point | 65.0°C |
|---|---|
| Linear Formula | ((CH3)3Si)2NLi |
| Molecular Weight (g/mol) | 167.33 |
| Chemical Name or Material | Lithium bis(trimethylsilyl)amide |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Density | 0.9000g/mL |
| PubChem CID | 2733832 |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Solubility Information | Solubility in water: reacts. |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| Molecular Formula | C6H18LiNSi2 |
| EINECS Number | 223-725-6 |
| Formula Weight | 167.33 |
| Specific Gravity | 0.9 |
Magnesium sulfate heptahydrate, 98+%, ACS reagent
CAS: 10034-99-8 Molecular Formula: H14MgO11S Molecular Weight (g/mol): 246.47 MDL Number: MFCD00149785 InChI Key: WRUGWIBCXHJTDG-UHFFFAOYSA-L Synonym: magnesium sulfate heptahydrate,mgso4.7h2o,magnesium sulfate 1:1 heptahydrate,magnesium sulphate heptahydrate,unii-sk47b8698t,magnesium sulfate usan:jan,sulfuric acid magnesium salt 1:1 , heptahydrate,magnesium sulfate heptahydrate mgso4.7h2o,sulfuric acid, magnesium salt 1:1 , heptahydrate,magnesium ii , sulfate, heptahydrate PubChem CID: 24843 ChEBI: CHEBI:31795 IUPAC Name: magnesium;sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24843 |
|---|---|
| CAS | 10034-99-8 |
| Molecular Weight (g/mol) | 246.47 |
| ChEBI | CHEBI:31795 |
| MDL Number | MFCD00149785 |
| SMILES | O.O.O.O.O.O.O.[Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate heptahydrate,mgso4.7h2o,magnesium sulfate 1:1 heptahydrate,magnesium sulphate heptahydrate,unii-sk47b8698t,magnesium sulfate usan:jan,sulfuric acid magnesium salt 1:1 , heptahydrate,magnesium sulfate heptahydrate mgso4.7h2o,sulfuric acid, magnesium salt 1:1 , heptahydrate,magnesium ii , sulfate, heptahydrate |
| IUPAC Name | magnesium;sulfate;heptahydrate |
| InChI Key | WRUGWIBCXHJTDG-UHFFFAOYSA-L |
| Molecular Formula | H14MgO11S |
2-Mercaptoethanol Cell Culture MP Biomedicals
CAS: 60-24-2 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00004890 InChI Key: DGVVWUTYPXICAM-UHFFFAOYSA-N Synonym: 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan PubChem CID: 1567 ChEBI: CHEBI:41218 IUPAC Name: 2-sulfanylethan-1-ol SMILES: OCCS
| PubChem CID | 1567 |
|---|---|
| CAS | 60-24-2 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:41218 |
| MDL Number | MFCD00004890 |
| SMILES | OCCS |
| Synonym | 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan |
| IUPAC Name | 2-sulfanylethan-1-ol |
| InChI Key | DGVVWUTYPXICAM-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
Reagent Grade Water Tested to USP Purified Water, Corning™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More