Chemicals
Filtered Search Results
Chromium(III) chloride hexahydrate, 98%
CAS: 10060-12-5 Molecular Formula: Cl3CrH12O6 Molecular Weight (g/mol): 266.44 MDL Number: MFCD00149660 InChI Key: LJAOOBNHPFKCDR-UHFFFAOYSA-K Synonym: chromium iii chloride hexahydrate,chromic chloride hexahydrate,hexaaquachromium chloride,chromium trichloride hexahydrate,trichlorochromium hexahydrate,chromium chloride hexahydrate,hexaaquachromium iii chloride,chrom iii-chlorid,chromium 3+ chloride hexahydrate,chlorid chromity hexahydrat czech PubChem CID: 104957 ChEBI: CHEBI:53442 IUPAC Name: chromium(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3]
| PubChem CID | 104957 |
|---|---|
| CAS | 10060-12-5 |
| Molecular Weight (g/mol) | 266.44 |
| ChEBI | CHEBI:53442 |
| MDL Number | MFCD00149660 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] |
| Synonym | chromium iii chloride hexahydrate,chromic chloride hexahydrate,hexaaquachromium chloride,chromium trichloride hexahydrate,trichlorochromium hexahydrate,chromium chloride hexahydrate,hexaaquachromium iii chloride,chrom iii-chlorid,chromium 3+ chloride hexahydrate,chlorid chromity hexahydrat czech |
| IUPAC Name | chromium(3+) hexahydrate trichloride |
| InChI Key | LJAOOBNHPFKCDR-UHFFFAOYSA-K |
| Molecular Formula | Cl3CrH12O6 |
Diethyl ether, ≥99%, for HPLC, stabilized with Ethanol
Greener Choice
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Potassium chromate, 99.5%, for analysis
CAS: 7789-00-6 Molecular Formula: CrK2O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00011368 InChI Key: XMXNVYPJWBTAHN-UHFFFAOYSA-N Synonym: potassium chromate,bipotassium chromate,potassium chromate vi,dipotassium monochromate,dipotassium chromate,tarapacaite,chromate of potash,chromate of potass,neutral potassium chromate,caswell no. 687 PubChem CID: 24597 ChEBI: CHEBI:75249 IUPAC Name: dipotassium;dioxido(dioxo)chromium SMILES: [K+].[K+].[O-][Cr]([O-])(=O)=O
| PubChem CID | 24597 |
|---|---|
| CAS | 7789-00-6 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:75249 |
| MDL Number | MFCD00011368 |
| SMILES | [K+].[K+].[O-][Cr]([O-])(=O)=O |
| Synonym | potassium chromate,bipotassium chromate,potassium chromate vi,dipotassium monochromate,dipotassium chromate,tarapacaite,chromate of potash,chromate of potass,neutral potassium chromate,caswell no. 687 |
| IUPAC Name | dipotassium;dioxido(dioxo)chromium |
| InChI Key | XMXNVYPJWBTAHN-UHFFFAOYSA-N |
| Molecular Formula | CrK2O4 |
Decaborane, 98%, Thermo Scientific Chemicals
CAS: 17702-41-9 Molecular Formula: B10H14 Molecular Weight (g/mol): 122.22 MDL Number: MFCD00011314 InChI Key: KGUZAUWGHAIUGS-UHFFFAOYSA-N Synonym: decaborane,decaboron tetradecahydride PubChem CID: 6328162 IUPAC Name: decaborane SMILES: [B][B][B][B][B][B][B][B][B][B]
| PubChem CID | 6328162 |
|---|---|
| CAS | 17702-41-9 |
| Molecular Weight (g/mol) | 122.22 |
| MDL Number | MFCD00011314 |
| SMILES | [B][B][B][B][B][B][B][B][B][B] |
| Synonym | decaborane,decaboron tetradecahydride |
| IUPAC Name | decaborane |
| InChI Key | KGUZAUWGHAIUGS-UHFFFAOYSA-N |
| Molecular Formula | B10H14 |
Lithium tetraborate, 99% (metals basis)
CAS: 12007-60-2 Molecular Formula: B4Li2O7 Molecular Weight (g/mol): 169.11 MDL Number: MFCD00011083 InChI Key: RDZCISUGRQUANA-UHFFFAOYSA-N IUPAC Name: dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) SMILES: [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| CAS | 12007-60-2 |
|---|---|
| Molecular Weight (g/mol) | 169.11 |
| MDL Number | MFCD00011083 |
| SMILES | [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| IUPAC Name | dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) |
| InChI Key | RDZCISUGRQUANA-UHFFFAOYSA-N |
| Molecular Formula | B4Li2O7 |
Trifluoromethanesulfonic acid, 99%, extra pure
CAS: 1493-13-6 Molecular Formula: CHF3O3S Molecular Weight (g/mol): 150.07 MDL Number: MFCD00007514 InChI Key: ITMCEJHCFYSIIV-UHFFFAOYSA-N Synonym: triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate PubChem CID: 62406 ChEBI: CHEBI:48511 SMILES: OS(=O)(=O)C(F)(F)F
| PubChem CID | 62406 |
|---|---|
| CAS | 1493-13-6 |
| Molecular Weight (g/mol) | 150.07 |
| ChEBI | CHEBI:48511 |
| MDL Number | MFCD00007514 |
| SMILES | OS(=O)(=O)C(F)(F)F |
| Synonym | triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate |
| InChI Key | ITMCEJHCFYSIIV-UHFFFAOYSA-N |
| Molecular Formula | CHF3O3S |
Butyl Alcohol ACS, MilliporeSigma™
CAS: 71-36-3 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 InChI Key: LRHPLDYGYMQRHN-UHFFFAOYSA-N Synonym: 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane PubChem CID: 263 ChEBI: CHEBI:28885 IUPAC Name: butan-1-ol SMILES: CCCCO
| PubChem CID | 263 |
|---|---|
| CAS | 71-36-3 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:28885 |
| SMILES | CCCCO |
| Synonym | 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane |
| IUPAC Name | butan-1-ol |
| InChI Key | LRHPLDYGYMQRHN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
| Boiling Point | 65.0°C |
|---|---|
| Linear Formula | BF3 |
| Molecular Weight (g/mol) | 67.81 |
| Chemical Name or Material | Boron trifluoride |
| SMILES | FB(F)F |
| InChI Key | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Density | 0.8700g/mL |
| PubChem CID | 11062313 |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| MDL Number | MFCD00011316 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Packaging | AcroSeal™ Glass bottle |
| Solubility Information | Solubility in water: may decompose |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| IUPAC Name | trifluoroborane |
| Molecular Formula | BF3 |
| EINECS Number | 206-766-4 |
| Formula Weight | 67.81 |
| Specific Gravity | 0.87 |
| Melting Point | -98.0°C |
Thioglycolic Acid 98.0+%, TCI America™
CAS: 68-11-1 Molecular Formula: C2H4O2S Molecular Weight (g/mol): 92.112 MDL Number: MFCD00004876 InChI Key: CWERGRDVMFNCDR-UHFFFAOYSA-N Synonym: mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio PubChem CID: 1133 ChEBI: CHEBI:30065 IUPAC Name: 2-sulfanylacetic acid SMILES: C(C(=O)O)S
| PubChem CID | 1133 |
|---|---|
| CAS | 68-11-1 |
| Molecular Weight (g/mol) | 92.112 |
| ChEBI | CHEBI:30065 |
| MDL Number | MFCD00004876 |
| SMILES | C(C(=O)O)S |
| Synonym | mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio |
| IUPAC Name | 2-sulfanylacetic acid |
| InChI Key | CWERGRDVMFNCDR-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2S |
p-Toluenesulfonic Acid Monohydrate 98.0+%, TCI America™
CAS: 6192-52-5 Molecular Formula: C7H10O4S Molecular Weight (g/mol): 190.213 MDL Number: MFCD00064387 InChI Key: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC Name: 4-methylbenzenesulfonic acid;hydrate SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O
| PubChem CID | 521998 |
|---|---|
| CAS | 6192-52-5 |
| Molecular Weight (g/mol) | 190.213 |
| MDL Number | MFCD00064387 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.O |
| Synonym | p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate |
| IUPAC Name | 4-methylbenzenesulfonic acid;hydrate |
| InChI Key | KJIFKLIQANRMOU-UHFFFAOYSA-N |
| Molecular Formula | C7H10O4S |
Manganese pieces, irregular, 99.9% (metals basis)
CAS: 7439-96-5 Molecular Formula: Mn Molecular Weight (g/mol): 54.94 MDL Number: MFCD00011111 InChI Key: PWHULOQIROXLJO-UHFFFAOYSA-N Synonym: colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds PubChem CID: 23930 ChEBI: CHEBI:35154 IUPAC Name: manganese SMILES: [Mn]
| PubChem CID | 23930 |
|---|---|
| CAS | 7439-96-5 |
| Molecular Weight (g/mol) | 54.94 |
| ChEBI | CHEBI:35154 |
| MDL Number | MFCD00011111 |
| SMILES | [Mn] |
| Synonym | colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds |
| IUPAC Name | manganese |
| InChI Key | PWHULOQIROXLJO-UHFFFAOYSA-N |
| Molecular Formula | Mn |
Aluminum oxide, 99%
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 IUPAC Name: dialuminium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| IUPAC Name | dialuminium(3+) trioxidandiide |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Potassium fluoride, ACS, 99% min, Thermo Scientific Chemicals
CAS: 7789-23-3 Molecular Formula: FK Molecular Weight (g/mol): 58.10 MDL Number: MFCD00011398 InChI Key: NROKBHXJSPEDAR-UHFFFAOYSA-M Synonym: potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 PubChem CID: 522689 ChEBI: CHEBI:66872 SMILES: [F-].[K+]
| PubChem CID | 522689 |
|---|---|
| CAS | 7789-23-3 |
| Molecular Weight (g/mol) | 58.10 |
| ChEBI | CHEBI:66872 |
| MDL Number | MFCD00011398 |
| SMILES | [F-].[K+] |
| Synonym | potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 |
| InChI Key | NROKBHXJSPEDAR-UHFFFAOYSA-M |
| Molecular Formula | FK |
4-Amino-3-hydrazino-5-mercapto-1,2,4-triazole, 99+%, Thermo Scientific Chemicals
CAS: 1750-12-5 Molecular Formula: C2H6N6S Molecular Weight (g/mol): 146.172 MDL Number: MFCD00003098 InChI Key: RDIMQHBOTMWMJA-UHFFFAOYSA-N Synonym: 4-amino-3-hydrazino-5-mercapto-1,2,4-triazole,purpald,4-amino-3-hydrazino-1,2,4-triazol-5-thiol,1,2,4-triazolidin-3-one, 4-amino-5-thioxo-, hydrazone,purpald r,4-amino-5-hydrazino-1,2,4-triazole-3-thiol,1,2,4-triazolidin-3-one, 4-amino-5-thioxo-, 3-hydrazone,4-amino-5-hydrazinyl-4h-1,2,4-triazole-3-thiol,3h-1,2,4-triazole-3-thione, 4-amino-5-hydrazinyl-2,4-dihydro,4-amino-5-hydrazinyl-1,2,4-triazole-3-thiol PubChem CID: 2723946 IUPAC Name: 4-amino-3-hydrazinyl-1H-1,2,4-triazole-5-thione SMILES: C1(=S)NN=C(N1N)NN
| PubChem CID | 2723946 |
|---|---|
| CAS | 1750-12-5 |
| Molecular Weight (g/mol) | 146.172 |
| MDL Number | MFCD00003098 |
| SMILES | C1(=S)NN=C(N1N)NN |
| Synonym | 4-amino-3-hydrazino-5-mercapto-1,2,4-triazole,purpald,4-amino-3-hydrazino-1,2,4-triazol-5-thiol,1,2,4-triazolidin-3-one, 4-amino-5-thioxo-, hydrazone,purpald r,4-amino-5-hydrazino-1,2,4-triazole-3-thiol,1,2,4-triazolidin-3-one, 4-amino-5-thioxo-, 3-hydrazone,4-amino-5-hydrazinyl-4h-1,2,4-triazole-3-thiol,3h-1,2,4-triazole-3-thione, 4-amino-5-hydrazinyl-2,4-dihydro,4-amino-5-hydrazinyl-1,2,4-triazole-3-thiol |
| IUPAC Name | 4-amino-3-hydrazinyl-1H-1,2,4-triazole-5-thione |
| InChI Key | RDIMQHBOTMWMJA-UHFFFAOYSA-N |
| Molecular Formula | C2H6N6S |
L(-)-Carnitine hydrochloride, 98%
CAS: 6645-46-1 Molecular Formula: C7H16ClNO3 Molecular Weight (g/mol): 197.66 MDL Number: MFCD00066100 InChI Key: JXXCENBLGFBQJM-FYZOBXCZSA-N Synonym: r-3-carboxy-2-hydroxy-n,n,n-trimethylpropan-1-aminium chloride,l-carnitine hcl,unii-j3y5e6iks3,l-carnitine hydrochloride,levocarnitine chloride,j3y5e6iks3,r-carnitine hydrochloride,carnitine l-form hydrochloride,+--carnitine chloride,l-3-carboxy-2-hydroxypropyl trimethylammonium chloride PubChem CID: 656657 IUPAC Name: [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium;chloride SMILES: [Cl-].C[N+](C)(C)C[C@H](O)CC(O)=O
| PubChem CID | 656657 |
|---|---|
| CAS | 6645-46-1 |
| Molecular Weight (g/mol) | 197.66 |
| MDL Number | MFCD00066100 |
| SMILES | [Cl-].C[N+](C)(C)C[C@H](O)CC(O)=O |
| Synonym | r-3-carboxy-2-hydroxy-n,n,n-trimethylpropan-1-aminium chloride,l-carnitine hcl,unii-j3y5e6iks3,l-carnitine hydrochloride,levocarnitine chloride,j3y5e6iks3,r-carnitine hydrochloride,carnitine l-form hydrochloride,+--carnitine chloride,l-3-carboxy-2-hydroxypropyl trimethylammonium chloride |
| IUPAC Name | [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium;chloride |
| InChI Key | JXXCENBLGFBQJM-FYZOBXCZSA-N |
| Molecular Formula | C7H16ClNO3 |