Chemicals
Filtered Search Results
Hydrochloric acid, 37%, for analysis, (max. 0.000001% Hg)
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: chlorane SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | chlorane |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
| Boiling Point | 84.0°C to 86.0°C |
|---|---|
| Water | 0.005% max. |
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Dry over Molecular Sieve |
| Density | 0.8670g/mL |
| Percent Purity | 99.5% |
| CAS | 110-71-4 |
| Health Hazard 3 | GHS P Statement Obtain special instructions before use. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. Wear protective gloves/protective clothing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN: Wash with plenty of soap and water. |
| Health Hazard 2 | GHS H Statement Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. Causes skin irritation. May form explosive peroxides. |
| Solubility Information | Solubility in water: miscible. Other solubilities: solulbe in hydrocarbon solvents, soluble in ethanol, ethyl ether, acetone, carbon, tetrachloride, benzene, dichloroethane |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Formula Weight | 90.12 |
| Specific Gravity | 0.867 |
| Melting Point | -69.0°C |
Tin(IV) iodide, 95%
CAS: 7790-47-8 Molecular Formula: H4I4Sn Molecular Weight (g/mol): 630.36 MDL Number: MFCD00036272 InChI Key: ZBCVLXKKLMNLGV-UHFFFAOYSA-N Synonym: stannic iodide,stannane, tetraiodo,tin iv iodide,tetraiodotin,tin tetraiodide,tin iodide,unii-8h688bw69x,tin iv iodide 1:4,tin-iv-iodide PubChem CID: 24631 IUPAC Name: tetraiodostannane SMILES: [Sn].I.I.I.I
| PubChem CID | 24631 |
|---|---|
| CAS | 7790-47-8 |
| Molecular Weight (g/mol) | 630.36 |
| MDL Number | MFCD00036272 |
| SMILES | [Sn].I.I.I.I |
| Synonym | stannic iodide,stannane, tetraiodo,tin iv iodide,tetraiodotin,tin tetraiodide,tin iodide,unii-8h688bw69x,tin iv iodide 1:4,tin-iv-iodide |
| IUPAC Name | tetraiodostannane |
| InChI Key | ZBCVLXKKLMNLGV-UHFFFAOYSA-N |
| Molecular Formula | H4I4Sn |
Molybdenum hexacarbonyl, 98%
CAS: 13939-06-5 Molecular Formula: C6O6Mo Molecular Weight (g/mol): 264 MDL Number: MFCD00003466 InChI Key: KMKBZNSIJQWHJA-UHFFFAOYSA-N Synonym: molybdenumhexacarbonyl,carbon monooxide-molybdenum 6:1,hexakis carbon monoxide molybdenum,hexacarbonylmolybdenu,hexakis methanidylidyneoxidanium molybdenum,hexacarbonylmolybdenum, may contain up to cr 5g PubChem CID: 2724068 ChEBI: CHEBI:30508 IUPAC Name: carbon monoxide;molybdenum SMILES: [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo]
| PubChem CID | 2724068 |
|---|---|
| CAS | 13939-06-5 |
| Molecular Weight (g/mol) | 264 |
| ChEBI | CHEBI:30508 |
| MDL Number | MFCD00003466 |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo] |
| Synonym | molybdenumhexacarbonyl,carbon monooxide-molybdenum 6:1,hexakis carbon monoxide molybdenum,hexacarbonylmolybdenu,hexakis methanidylidyneoxidanium molybdenum,hexacarbonylmolybdenum, may contain up to cr 5g |
| IUPAC Name | carbon monoxide;molybdenum |
| InChI Key | KMKBZNSIJQWHJA-UHFFFAOYSA-N |
| Molecular Formula | C6O6Mo |
Indium foil, 0.25mm (0.01in) thick, 99.99% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |
| CAS | 1303-96-4 |
|---|---|
| Molecular Formula | B4Na2O7.10H2O |
m-Xylene, 99+%, extra pure
CAS: 108-38-3 Molecular Formula: C8H10 Molecular Weight (g/mol): 106.17 MDL Number: MFCD00008536 InChI Key: IVSZLXZYQVIEFR-UHFFFAOYSA-N Synonym: m-xylene,1,3-dimethylbenzene,m-xylol,m-dimethylbenzene,meta-xylene,m-methyltoluene,3-xylene,benzene, 1,3-dimethyl,1,3-dimethylbenzol,santosol 150 PubChem CID: 7929 ChEBI: CHEBI:28488 IUPAC Name: 1,3-xylene SMILES: CC1=CC(C)=CC=C1
| PubChem CID | 7929 |
|---|---|
| CAS | 108-38-3 |
| Molecular Weight (g/mol) | 106.17 |
| ChEBI | CHEBI:28488 |
| MDL Number | MFCD00008536 |
| SMILES | CC1=CC(C)=CC=C1 |
| Synonym | m-xylene,1,3-dimethylbenzene,m-xylol,m-dimethylbenzene,meta-xylene,m-methyltoluene,3-xylene,benzene, 1,3-dimethyl,1,3-dimethylbenzol,santosol 150 |
| IUPAC Name | 1,3-xylene |
| InChI Key | IVSZLXZYQVIEFR-UHFFFAOYSA-N |
| Molecular Formula | C8H10 |
Ammonium Chloride, ACS Grade, ≥ 99.5%, LabChem™
CAS: 12125-02-9 Molecular Formula: ClH4N Molecular Weight (g/mol): 53.49 MDL Number: MFCD00011420 InChI Key: NLXLAEXVIDQMFP-UHFFFAOYSA-N Synonym: ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid PubChem CID: 25517 ChEBI: CHEBI:31206 IUPAC Name: amine hydrochloride SMILES: N.Cl
| PubChem CID | 25517 |
|---|---|
| CAS | 12125-02-9 |
| Molecular Weight (g/mol) | 53.49 |
| ChEBI | CHEBI:31206 |
| MDL Number | MFCD00011420 |
| SMILES | N.Cl |
| Synonym | ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid |
| IUPAC Name | amine hydrochloride |
| InChI Key | NLXLAEXVIDQMFP-UHFFFAOYSA-N |
| Molecular Formula | ClH4N |
Azulene, 99%
CAS: 275-51-4 Molecular Formula: C10H8 Molecular Weight (g/mol): 128.174 MDL Number: MFCD00003810 InChI Key: CUFNKYGDVFVPHO-UHFFFAOYSA-N Synonym: cyclopentacycloheptene,azunamic,bicyclo 5.3.0 decapentaene,azulen,unii-82r6m9mglp,bicyclo 5.3.0-1,3,5,7,9-decapentaene,bicyclo 5.3.0-deca-2,4,6,8,10-pentaene,82r6m9mglp,azulekeep PubChem CID: 9231 ChEBI: CHEBI:31249 IUPAC Name: azulene SMILES: C1=CC=C2C=CC=C2C=C1
| PubChem CID | 9231 |
|---|---|
| CAS | 275-51-4 |
| Molecular Weight (g/mol) | 128.174 |
| ChEBI | CHEBI:31249 |
| MDL Number | MFCD00003810 |
| SMILES | C1=CC=C2C=CC=C2C=C1 |
| Synonym | cyclopentacycloheptene,azunamic,bicyclo 5.3.0 decapentaene,azulen,unii-82r6m9mglp,bicyclo 5.3.0-1,3,5,7,9-decapentaene,bicyclo 5.3.0-deca-2,4,6,8,10-pentaene,82r6m9mglp,azulekeep |
| IUPAC Name | azulene |
| InChI Key | CUFNKYGDVFVPHO-UHFFFAOYSA-N |
| Molecular Formula | C10H8 |
2,2-Bis(hydroxymethyl)propionic acid, 98%
CAS: 4767-03-7 Molecular Formula: C5H10O4 Molecular Weight (g/mol): 134.13 InChI Key: PTBDIHRZYDMNKB-UHFFFAOYSA-N
| CAS | 4767-03-7 |
|---|---|
| Molecular Weight (g/mol) | 134.13 |
| InChI Key | PTBDIHRZYDMNKB-UHFFFAOYSA-N |
| Molecular Formula | C5H10O4 |
Hydroxylamine-O-sulfonic acid, 97%
CAS: 2950-43-8 Molecular Formula: H3NO4S Molecular Weight (g/mol): 113.09 MDL Number: MFCD00011604 InChI Key: DQPBABKTKYNPMH-UHFFFAOYSA-N Synonym: hydroxylamine-o-sulfonic acid,aminooxy sulfonic acid,sulfoperamidic acid,hydroxylamine-o-sulphonic acid,permonosulfamic acid,amidoperoxymonosulfuric acid,aminooxysulfonic acid,amidosulfonic peracid,haos,sulfamic acid n-oxide PubChem CID: 76284 IUPAC Name: amino hydrogen sulfate SMILES: NOS(O)(=O)=O
| PubChem CID | 76284 |
|---|---|
| CAS | 2950-43-8 |
| Molecular Weight (g/mol) | 113.09 |
| MDL Number | MFCD00011604 |
| SMILES | NOS(O)(=O)=O |
| Synonym | hydroxylamine-o-sulfonic acid,aminooxy sulfonic acid,sulfoperamidic acid,hydroxylamine-o-sulphonic acid,permonosulfamic acid,amidoperoxymonosulfuric acid,aminooxysulfonic acid,amidosulfonic peracid,haos,sulfamic acid n-oxide |
| IUPAC Name | amino hydrogen sulfate |
| InChI Key | DQPBABKTKYNPMH-UHFFFAOYSA-N |
| Molecular Formula | H3NO4S |
Diphenylborinic acid 2-aminoethyl ester, 98%
CAS: 524-95-8 Molecular Formula: C14H16BNO Molecular Weight (g/mol): 225.10 MDL Number: MFCD00014823 InChI Key: BLZVCIGGICSWIG-UHFFFAOYSA-N Synonym: 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl PubChem CID: 1598 SMILES: NCCOB(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 1598 |
|---|---|
| CAS | 524-95-8 |
| Molecular Weight (g/mol) | 225.10 |
| MDL Number | MFCD00014823 |
| SMILES | NCCOB(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl |
| InChI Key | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| Molecular Formula | C14H16BNO |
Citric acid, 99%, pure, anhydrous
CAS: 77-92-9 Molecular Formula: C6H8O7 Molecular Weight (g/mol): 192.12 MDL Number: MFCD00011669 InChI Key: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonym: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy PubChem CID: 311 ChEBI: CHEBI:30769 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
| PubChem CID | 311 |
|---|---|
| CAS | 77-92-9 |
| Molecular Weight (g/mol) | 192.12 |
| ChEBI | CHEBI:30769 |
| MDL Number | MFCD00011669 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Synonym | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Molecular Formula | C6H8O7 |
2-Chloro-3-nitrobenzoic acid, 98%
CAS: 3970-35-2 Molecular Formula: C7H4ClNO4 Molecular Weight (g/mol): 201.57 MDL Number: MFCD00007069 InChI Key: JRQDVRIQJJPHEQ-UHFFFAOYSA-N Synonym: 2-chloro-3-nitrobenzoic acid,2-chloro-3-nitro-benzoic acid,2-chloro-3-nitrobenzoicacid,benzoic acid, 2-chloro-3-nitro,2-chloro-3-carboxynitrobenzene,nitrochlorbenzoesaure,pubchem2100,acmc-1ctvl,2-chloro-3-nitrobenzic acid,2-chloro-3-nitrobezoic acid PubChem CID: 19870 SMILES: C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C(=O)O
| PubChem CID | 19870 |
|---|---|
| CAS | 3970-35-2 |
| Molecular Weight (g/mol) | 201.57 |
| MDL Number | MFCD00007069 |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C(=O)O |
| Synonym | 2-chloro-3-nitrobenzoic acid,2-chloro-3-nitro-benzoic acid,2-chloro-3-nitrobenzoicacid,benzoic acid, 2-chloro-3-nitro,2-chloro-3-carboxynitrobenzene,nitrochlorbenzoesaure,pubchem2100,acmc-1ctvl,2-chloro-3-nitrobenzic acid,2-chloro-3-nitrobezoic acid |
| InChI Key | JRQDVRIQJJPHEQ-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO4 |
Potassium Chloride, ≥99%, MP Biomedicals
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |