Chemicals
Filtered Search Results
Cesium chloride, ultrapure, 99.9% (metals basis)
CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.36 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]
| PubChem CID | 24293 |
|---|---|
| CAS | 7647-17-8 |
| Molecular Weight (g/mol) | 168.36 |
| ChEBI | CHEBI:63039 |
| MDL Number | MFCD00010955 |
| SMILES | [Cl-].[Cs+] |
| Synonym | cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride |
| IUPAC Name | cesium;chloride |
| InChI Key | AIYUHDOJVYHVIT-UHFFFAOYSA-M |
| Molecular Formula | ClCs |
Di-n-butyl ether, 99+%, extra pure
CAS: 142-96-1 Molecular Formula: C8H18O Molecular Weight (g/mol): 130.23 MDL Number: MFCD00009461 InChI Key: DURPTKYDGMDSBL-UHFFFAOYSA-N Synonym: di-n-butyl ether,butyl ether,dibutyl ether,butane, 1,1'-oxybis,n-butyl ether,dibutyl oxide,butyl oxide,ether butylique,1,1'-oxybis butane,di-n-butylether PubChem CID: 8909 IUPAC Name: 1-butoxybutane SMILES: CCCCOCCCC
| PubChem CID | 8909 |
|---|---|
| CAS | 142-96-1 |
| Molecular Weight (g/mol) | 130.23 |
| MDL Number | MFCD00009461 |
| SMILES | CCCCOCCCC |
| Synonym | di-n-butyl ether,butyl ether,dibutyl ether,butane, 1,1'-oxybis,n-butyl ether,dibutyl oxide,butyl oxide,ether butylique,1,1'-oxybis butane,di-n-butylether |
| IUPAC Name | 1-butoxybutane |
| InChI Key | DURPTKYDGMDSBL-UHFFFAOYSA-N |
| Molecular Formula | C8H18O |
Sodium dicyanamide, 96%
CAS: 1934-75-4 Molecular Formula: C2N3Na Molecular Weight (g/mol): 89.03 MDL Number: MFCD00003535 InChI Key: IXBPPZBJIFNGJJ-UHFFFAOYSA-N Synonym: sodium dicyanamide,sodium dicyanoazanide,sodium dicyanoamide,unii-i9c96i1mre,cyanamide, cyano-, sodium salt,cyanamide,cyano-,sodium salt,i9c96i1mre,cyanamide, n-cyano-, sodium salt 1:1,dicyanamide, sodium salt,nadca PubChem CID: 4350929 IUPAC Name: sodium;dicyanoazanide SMILES: [Na+].N#C[N-]C#N
| PubChem CID | 4350929 |
|---|---|
| CAS | 1934-75-4 |
| Molecular Weight (g/mol) | 89.03 |
| MDL Number | MFCD00003535 |
| SMILES | [Na+].N#C[N-]C#N |
| Synonym | sodium dicyanamide,sodium dicyanoazanide,sodium dicyanoamide,unii-i9c96i1mre,cyanamide, cyano-, sodium salt,cyanamide,cyano-,sodium salt,i9c96i1mre,cyanamide, n-cyano-, sodium salt 1:1,dicyanamide, sodium salt,nadca |
| IUPAC Name | sodium;dicyanoazanide |
| InChI Key | IXBPPZBJIFNGJJ-UHFFFAOYSA-N |
| Molecular Formula | C2N3Na |
1,3-Diphenylpropane, 98%
CAS: 1081-75-0 Molecular Formula: C15H16 Molecular Weight (g/mol): 196.29 MDL Number: MFCD00043574 InChI Key: VEAFKIYNHVBNIP-UHFFFAOYSA-N Synonym: 1,3-diphenylpropane,3-phenylpropyl benzene,dibenzylmethane,propane, 1,3-diphenyl,unii-x3diq9w9po,3-phenyl-propyl-benzene,x3diq9w9po,benzene, 1,1'-1,3-propanediyl bis,propane, 1,3-diphenyl-8ci,benzene, 1,1'-1,3-propanediyl bis-9ci PubChem CID: 14125 ChEBI: CHEBI:34060 IUPAC Name: 3-phenylpropylbenzene SMILES: C(CC1=CC=CC=C1)CC1=CC=CC=C1
| PubChem CID | 14125 |
|---|---|
| CAS | 1081-75-0 |
| Molecular Weight (g/mol) | 196.29 |
| ChEBI | CHEBI:34060 |
| MDL Number | MFCD00043574 |
| SMILES | C(CC1=CC=CC=C1)CC1=CC=CC=C1 |
| Synonym | 1,3-diphenylpropane,3-phenylpropyl benzene,dibenzylmethane,propane, 1,3-diphenyl,unii-x3diq9w9po,3-phenyl-propyl-benzene,x3diq9w9po,benzene, 1,1'-1,3-propanediyl bis,propane, 1,3-diphenyl-8ci,benzene, 1,1'-1,3-propanediyl bis-9ci |
| IUPAC Name | 3-phenylpropylbenzene |
| InChI Key | VEAFKIYNHVBNIP-UHFFFAOYSA-N |
| Molecular Formula | C15H16 |
Mercury(II) sulfate, ACS, 98.0% min
CAS: 7783-35-9 Molecular Formula: HgO4S Molecular Weight (g/mol): 296.65 MDL Number: MFCD00011047 InChI Key: DOBUSJIVSSJEDA-UHFFFAOYSA-L Synonym: mercury ii sulfate,mercuric sulfate,mercury sulphate,mercury bisulfate,mercury disulfate,mercury persulfate,mercuric sulphate,mercury sulfate hgso4,unii-j4l3ppg58i,mercuric bisulphate PubChem CID: 24544 IUPAC Name: mercury(2+);sulfate SMILES: [Hg++].[O-]S([O-])(=O)=O
| PubChem CID | 24544 |
|---|---|
| CAS | 7783-35-9 |
| Molecular Weight (g/mol) | 296.65 |
| MDL Number | MFCD00011047 |
| SMILES | [Hg++].[O-]S([O-])(=O)=O |
| Synonym | mercury ii sulfate,mercuric sulfate,mercury sulphate,mercury bisulfate,mercury disulfate,mercury persulfate,mercuric sulphate,mercury sulfate hgso4,unii-j4l3ppg58i,mercuric bisulphate |
| IUPAC Name | mercury(2+);sulfate |
| InChI Key | DOBUSJIVSSJEDA-UHFFFAOYSA-L |
| Molecular Formula | HgO4S |
Glassy carbon rod, 5mm (0.2in) dia, type 1
Widely practiced as an electrode material in electrochemistry, as considerably as for high temperature crucibles and as a part of some prosthetic devices. Glassy carbon electrode (GCE) in aqueous solutions is considered to be an inert electrode for hydronium ion reduction. | CAS: 7440-44-0
| CAS | 7440-44-0 |
|---|---|
| MDL Number | MFCD00133992 |
| Solubility Information | Insoluble in almost all the solvents. |
| Packaging | Tube |
| Chemical Name or Material | Glassy carbon rod |
| TSCA | Yes |
| RTECS Number | FF5250100 |
| Recommended Storage | Ambient temperatures |
| EINECS Number | 231-153-3 |
1-Cyano-4-(dimethylamino)pyridinium tetrafluoroborate, 98%
CAS: 59016-56-7 Molecular Formula: C8H10BF4N3 Molecular Weight (g/mol): 234.99 MDL Number: MFCD00011998 InChI Key: MBLVMDCQDCVKNE-UHFFFAOYSA-N Synonym: cdap,1-cyano-4-dimethylamino pyridinium tetrafluoroborate,1-cyano-4-dimethylamino pyridin-1-ium tetrafluoroborate,unii-p4w72066jt,1-cyano-4-dimethylamino-pyridinium tetrafluoroborate,pubchem17735,acmc-209m9a,n-cyano-4-dimethylaminopyridinium tetrafluoroborate,1-cyano-4-dimethylaminopyridinium tetra-fluoroborate,n-cyano-4-dimethylamino-pyridinium tetrafluoroborate PubChem CID: 9881151 IUPAC Name: 4-(dimethylamino)pyridin-1-ium-1-carbonitrile;tetrafluoroborate SMILES: F[B-](F)(F)F.CN(C)C1=CC=[N+](C=C1)C#N
| PubChem CID | 9881151 |
|---|---|
| CAS | 59016-56-7 |
| Molecular Weight (g/mol) | 234.99 |
| MDL Number | MFCD00011998 |
| SMILES | F[B-](F)(F)F.CN(C)C1=CC=[N+](C=C1)C#N |
| Synonym | cdap,1-cyano-4-dimethylamino pyridinium tetrafluoroborate,1-cyano-4-dimethylamino pyridin-1-ium tetrafluoroborate,unii-p4w72066jt,1-cyano-4-dimethylamino-pyridinium tetrafluoroborate,pubchem17735,acmc-209m9a,n-cyano-4-dimethylaminopyridinium tetrafluoroborate,1-cyano-4-dimethylaminopyridinium tetra-fluoroborate,n-cyano-4-dimethylamino-pyridinium tetrafluoroborate |
| IUPAC Name | 4-(dimethylamino)pyridin-1-ium-1-carbonitrile;tetrafluoroborate |
| InChI Key | MBLVMDCQDCVKNE-UHFFFAOYSA-N |
| Molecular Formula | C8H10BF4N3 |
Ethanol, denatured, Spectrophotometric Grade, 90%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 64-17-5 Molecular Formula: C2H6O Molecular Weight (g/mol): 46.069 MDL Number: MFCD00003568 InChI Key: LFQSCWFLJHTTHZ-UHFFFAOYSA-N Synonym: ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol PubChem CID: 702 ChEBI: CHEBI:16236 IUPAC Name: ethanol SMILES: CCO
| PubChem CID | 702 |
|---|---|
| CAS | 64-17-5 |
| Molecular Weight (g/mol) | 46.069 |
| ChEBI | CHEBI:16236 |
| MDL Number | MFCD00003568 |
| SMILES | CCO |
| Synonym | ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol |
| IUPAC Name | ethanol |
| InChI Key | LFQSCWFLJHTTHZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O |
Cyclobutanol, 99+%
CAS: 2919-23-5 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00001318 InChI Key: KTHXBEHDVMTNOH-UHFFFAOYSA-N Synonym: cyclobutyl alcohol,cyclobutyl hydroxide,hydroxycyclobutane,acmc-1cgim,cyclobutanol,cyclobutanol 1g,ksc206s6t,kthxbehdvmtnoh-uhfffaoysa PubChem CID: 76218 IUPAC Name: cyclobutanol SMILES: OC1CCC1
| PubChem CID | 76218 |
|---|---|
| CAS | 2919-23-5 |
| Molecular Weight (g/mol) | 72.11 |
| MDL Number | MFCD00001318 |
| SMILES | OC1CCC1 |
| Synonym | cyclobutyl alcohol,cyclobutyl hydroxide,hydroxycyclobutane,acmc-1cgim,cyclobutanol,cyclobutanol 1g,ksc206s6t,kthxbehdvmtnoh-uhfffaoysa |
| IUPAC Name | cyclobutanol |
| InChI Key | KTHXBEHDVMTNOH-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
1,3-Dihydroxynaphthalene, 99+%
CAS: 132-86-5 Molecular Formula: C10H8O2 Molecular Weight (g/mol): 160.17 InChI Key: XOOMNEFVDUTJPP-UHFFFAOYSA-N Synonym: 1,3-naphthalenediol,1,3-dihydroxynaphthalene,naphthoresorcinol,naphthoresoucinol,3-hydroxybenzocyclohexadien-1-one,naphthoresorcin,ccris 7896,unii-5x457yew8y,acmc-1bvwb,naphthalenediol-1,3 PubChem CID: 8601 IUPAC Name: naphthalene-1,3-diol SMILES: C1=CC=C2C(=C1)C=C(C=C2O)O
| PubChem CID | 8601 |
|---|---|
| CAS | 132-86-5 |
| Molecular Weight (g/mol) | 160.17 |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2O)O |
| Synonym | 1,3-naphthalenediol,1,3-dihydroxynaphthalene,naphthoresorcinol,naphthoresoucinol,3-hydroxybenzocyclohexadien-1-one,naphthoresorcin,ccris 7896,unii-5x457yew8y,acmc-1bvwb,naphthalenediol-1,3 |
| IUPAC Name | naphthalene-1,3-diol |
| InChI Key | XOOMNEFVDUTJPP-UHFFFAOYSA-N |
| Molecular Formula | C10H8O2 |
Benzyltriphenylphosphonium chloride, 99%
CAS: 1100-88-5 Molecular Formula: C25H22ClP Molecular Weight (g/mol): 388.87 MDL Number: MFCD00011913 InChI Key: USFRYJRPHFMVBZ-UHFFFAOYSA-M Synonym: benzyltriphenylphosphonium chloride,triphenylbenzylphosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride,benzyltriphenylphosphanium chloride,benzyl triphenylphosphonium chloride,benzyl-triphenyl-phosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride 1:1,triphenylbenzylphosphine, chloride,benzyl triphenyl phosphoniumchlorid PubChem CID: 70671 IUPAC Name: benzyl(triphenyl)phosphanium;chloride SMILES: [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 70671 |
|---|---|
| CAS | 1100-88-5 |
| Molecular Weight (g/mol) | 388.87 |
| MDL Number | MFCD00011913 |
| SMILES | [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | benzyltriphenylphosphonium chloride,triphenylbenzylphosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride,benzyltriphenylphosphanium chloride,benzyl triphenylphosphonium chloride,benzyl-triphenyl-phosphonium chloride,phosphonium, triphenyl phenylmethyl-, chloride 1:1,triphenylbenzylphosphine, chloride,benzyl triphenyl phosphoniumchlorid |
| IUPAC Name | benzyl(triphenyl)phosphanium;chloride |
| InChI Key | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
| Molecular Formula | C25H22ClP |
Nickel wire, 0.5mm (0.02in) dia, annealed, 99.98% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
| Boiling Point | 69.0°C |
|---|---|
| Water | 0.01% max. |
| Viscosity | 0.31 mPa.s (20°C) |
| Linear Formula | CH3(CH2)4CH3 |
| Physical Form | Liquid |
| Chemical Name or Material | Hexanes |
| Grade | Analytical |
| Acidity | 0.0002 meq/g max. |
| Residue after Evaporation | 0.0005% max. |
| Density | 0.6590g/mL |
| CAS | 110-54-3 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF exposed or concerned: Get medical advice/attention. |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. May be fatal if swallowed and enters airways. Causes skin irritation. May cause drowsiness or dizziness. Suspected of damaging fertility. May cause damage to organs through prolonged or repeated exposure. Toxic to aquatic life with long lasting effects. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in alcohol, acetone, ether and chloroform |
| Flash Point | −22°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3748 to 1.3810 |
| Synonym | Hex |
| Molecular Formula | C6H14 |
| Formula Weight | 86.18 |
| Specific Gravity | 0.659 |
| Melting Point | -95.0°C |
Methyltriphenylphosphonium Bromide, 98%
CAS: 1779-49-3 Molecular Formula: C19H18BrP Molecular Weight (g/mol): 357.23 MDL Number: MFCD00011804 InChI Key: LSEFCHWGJNHZNT-UHFFFAOYSA-M Synonym: methyltriphenylphosphonium bromide,methyltriphenylphosphanium bromide,triphenylmethylphosphonium bromide,methyl triphenylphosphonium bromide,methyl triphenyl phosphonium bromide,phosphonium, methyltriphenyl-, bromide,methyltriphenylphosphoniumbromide,methyl-triphenyl-phosphonium bromide PubChem CID: 74505 IUPAC Name: methyl(triphenyl)phosphanium;bromide SMILES: [Br-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 74505 |
|---|---|
| CAS | 1779-49-3 |
| Molecular Weight (g/mol) | 357.23 |
| MDL Number | MFCD00011804 |
| SMILES | [Br-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | methyltriphenylphosphonium bromide,methyltriphenylphosphanium bromide,triphenylmethylphosphonium bromide,methyl triphenylphosphonium bromide,methyl triphenyl phosphonium bromide,phosphonium, methyltriphenyl-, bromide,methyltriphenylphosphoniumbromide,methyl-triphenyl-phosphonium bromide |
| IUPAC Name | methyl(triphenyl)phosphanium;bromide |
| InChI Key | LSEFCHWGJNHZNT-UHFFFAOYSA-M |
| Molecular Formula | C19H18BrP |
Di-2-ethylhexylamine, 99%
CAS: 106-20-7 Molecular Formula: C16H35N Molecular Weight (g/mol): 241.46 MDL Number: MFCD00009489 InChI Key: SAIKULLUBZKPDA-UHFFFAOYSA-N Synonym: bis 2-ethylhexyl amine,di 2-ethylhexyl amine,diisooctylamine,1-hexanamine, 2-ethyl-n-2-ethylhexyl,bis-2-ethylhexylamine,2,2'-diethyldihexylamine,2,2'-diethylhexylamine,di-2-ethylhexyl amine,dihexylamine, 2,2'-diethyl,ccris 4619 PubChem CID: 7791 IUPAC Name: 2-ethyl-N-(2-ethylhexyl)hexan-1-amine SMILES: CCCCC(CC)CNCC(CC)CCCC
| PubChem CID | 7791 |
|---|---|
| CAS | 106-20-7 |
| Molecular Weight (g/mol) | 241.46 |
| MDL Number | MFCD00009489 |
| SMILES | CCCCC(CC)CNCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl amine,di 2-ethylhexyl amine,diisooctylamine,1-hexanamine, 2-ethyl-n-2-ethylhexyl,bis-2-ethylhexylamine,2,2'-diethyldihexylamine,2,2'-diethylhexylamine,di-2-ethylhexyl amine,dihexylamine, 2,2'-diethyl,ccris 4619 |
| IUPAC Name | 2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
| InChI Key | SAIKULLUBZKPDA-UHFFFAOYSA-N |
| Molecular Formula | C16H35N |