Chemicals
Filtered Search Results
Trimethylsilyl isocyanate, 94%
CAS: 1118-02-1 Molecular Formula: C4H9NOSi Molecular Weight (g/mol): 115.21 MDL Number: MFCD00001993 InChI Key: NIZHERJWXFHGGU-UHFFFAOYSA-N Synonym: trimethylsilyl isocyanate,silane, isocyanatotrimethyl,trimethylsilylisocyanate,isocyanato trimethyl silane,trimethylisocyanatosilane,tmsisocyanate,tms isocyanate,tms-isocyanate,tms isocynate PubChem CID: 70696 IUPAC Name: isocyanato(trimethyl)silane SMILES: C[Si](C)(C)N=C=O
| PubChem CID | 70696 |
|---|---|
| CAS | 1118-02-1 |
| Molecular Weight (g/mol) | 115.21 |
| MDL Number | MFCD00001993 |
| SMILES | C[Si](C)(C)N=C=O |
| Synonym | trimethylsilyl isocyanate,silane, isocyanatotrimethyl,trimethylsilylisocyanate,isocyanato trimethyl silane,trimethylisocyanatosilane,tmsisocyanate,tms isocyanate,tms-isocyanate,tms isocynate |
| IUPAC Name | isocyanato(trimethyl)silane |
| InChI Key | NIZHERJWXFHGGU-UHFFFAOYSA-N |
| Molecular Formula | C4H9NOSi |
Sodium phosphate dibasic dihydrate, specified accord. to the requir. of USP, Ph.Eur.
CAS: 10028-24-7 Molecular Formula: H5Na2O6P Molecular Weight (g/mol): 177.99 MDL Number: MFCD00149182 InChI Key: KDQPSPMLNJTZAL-UHFFFAOYSA-L IUPAC Name: disodium dihydrate hydrogen phosphate SMILES: O.O.[Na+].[Na+].OP([O-])([O-])=O
| CAS | 10028-24-7 |
|---|---|
| Molecular Weight (g/mol) | 177.99 |
| MDL Number | MFCD00149182 |
| SMILES | O.O.[Na+].[Na+].OP([O-])([O-])=O |
| IUPAC Name | disodium dihydrate hydrogen phosphate |
| InChI Key | KDQPSPMLNJTZAL-UHFFFAOYSA-L |
| Molecular Formula | H5Na2O6P |
| Form | Powder |
|---|---|
| Health Hazard 3 | P201-P202-P260-P264b-P270-P272-P280g-P281-P302+P352-P308+P313-P333+P313-P363-P501c |
| MDL Number | MFCD00148499 |
| Health Hazard 2 | GHS H Statement H372-H351-H319-H317-H335 Causes damage to organs through prolonged or repeated exposure. Suspected of causing cancer. Causes serious eye irritation. May cause an allergic skin reaction. May cause respiratory irritation. |
| Color | Gray |
| Solubility Information | Insoluble in water. |
| Health Hazard 1 | H317-H350-H372 |
| Chemical Name or Material | Stainless Steel powder, Type 316-L |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Mesh Size | −100 Mesh |
| Avg. Mol. Wt. or Mol. Wt. Range | Fe:Cr:Ni:Mo; 67.5:17:13:2.5 wt% |
Bupivacaine
CAS: 38396-39-3 Molecular Formula: C18H28N2O Molecular Weight (g/mol): 288.44 MDL Number: MFCD00243007,MFCD00941462 InChI Key: LEBVLXFERQHONN-UHFFFAOYNA-N Synonym: bupivacaine,1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide,dl-bupivacaine,marcaine,bupivacaina,carbostesin,bupivacainum,sensorcaine,anekain,+--bupivacaine PubChem CID: 2474 ChEBI: CHEBI:77431 IUPAC Name: 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide SMILES: CCCCN1CCCCC1C(=O)NC1=C(C)C=CC=C1C
| PubChem CID | 2474 |
|---|---|
| CAS | 38396-39-3 |
| Molecular Weight (g/mol) | 288.44 |
| ChEBI | CHEBI:77431 |
| MDL Number | MFCD00243007,MFCD00941462 |
| SMILES | CCCCN1CCCCC1C(=O)NC1=C(C)C=CC=C1C |
| Synonym | bupivacaine,1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide,dl-bupivacaine,marcaine,bupivacaina,carbostesin,bupivacainum,sensorcaine,anekain,+--bupivacaine |
| IUPAC Name | 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
| InChI Key | LEBVLXFERQHONN-UHFFFAOYNA-N |
| Molecular Formula | C18H28N2O |
2,3-Pentanedione, 97%
CAS: 600-14-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009313 InChI Key: TZMFJUDUGYTVRY-UHFFFAOYSA-N Synonym: 2,3-pentanedione,acetylpropionyl,acetyl propionyl,2,3-pentadione,acetylpropionyl van,unii-k4wbe45scm,acetyl propionyl natural,2,3-pentane-dione,pentan-2,3-dione,ethyl methyl diketone PubChem CID: 11747 ChEBI: CHEBI:52774 IUPAC Name: pentane-2,3-dione SMILES: CCC(=O)C(C)=O
| PubChem CID | 11747 |
|---|---|
| CAS | 600-14-6 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:52774 |
| MDL Number | MFCD00009313 |
| SMILES | CCC(=O)C(C)=O |
| Synonym | 2,3-pentanedione,acetylpropionyl,acetyl propionyl,2,3-pentadione,acetylpropionyl van,unii-k4wbe45scm,acetyl propionyl natural,2,3-pentane-dione,pentan-2,3-dione,ethyl methyl diketone |
| IUPAC Name | pentane-2,3-dione |
| InChI Key | TZMFJUDUGYTVRY-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Iron(II) sulfide, 99.9%, (trace metal basis), -100 mesh
CAS: 1317-37-9 Molecular Formula: FeS Molecular Weight (g/mol): 87.91 MDL Number: MFCD00011013 InChI Key: GNVXPFBEZCSHQZ-UHFFFAOYSA-N Synonym: ferrous sulfide,iron ii sulfide,iron sulfide,troilite,iron sulfuret,iron sulphide,iron monosulfide,iron protosulfide,ferrous monosulfide PubChem CID: 14828 IUPAC Name: λ²-iron(2+) sulfanediide SMILES: [S--].[Fe++]
| PubChem CID | 14828 |
|---|---|
| CAS | 1317-37-9 |
| Molecular Weight (g/mol) | 87.91 |
| MDL Number | MFCD00011013 |
| SMILES | [S--].[Fe++] |
| Synonym | ferrous sulfide,iron ii sulfide,iron sulfide,troilite,iron sulfuret,iron sulphide,iron monosulfide,iron protosulfide,ferrous monosulfide |
| IUPAC Name | λ²-iron(2+) sulfanediide |
| InChI Key | GNVXPFBEZCSHQZ-UHFFFAOYSA-N |
| Molecular Formula | FeS |
Lithium sulfate monohydrate, ACS, 99.0% min
CAS: 10102-25-7 Molecular Formula: H2Li2O5S Molecular Weight (g/mol): 127.95 MDL Number: MFCD00149766 InChI Key: RKGLUDFWIKNKMX-UHFFFAOYSA-L Synonym: lithium sulfate monohydrate,dilithium 1+ ion hydrate sulfate,dilithium sulfate hydrate,sufuric acid, dilithium slat, monohydrate,lithiumsulfatemonohydrate,dilithotab hydrate sulfate,lithium sulphate monohydrate,lithium sulfate, acs,ksc181s7n PubChem CID: 165815 SMILES: [Li+].[Li+].O.[O-]S([O-])(=O)=O
| PubChem CID | 165815 |
|---|---|
| CAS | 10102-25-7 |
| Molecular Weight (g/mol) | 127.95 |
| MDL Number | MFCD00149766 |
| SMILES | [Li+].[Li+].O.[O-]S([O-])(=O)=O |
| Synonym | lithium sulfate monohydrate,dilithium 1+ ion hydrate sulfate,dilithium sulfate hydrate,sufuric acid, dilithium slat, monohydrate,lithiumsulfatemonohydrate,dilithotab hydrate sulfate,lithium sulphate monohydrate,lithium sulfate, acs,ksc181s7n |
| InChI Key | RKGLUDFWIKNKMX-UHFFFAOYSA-L |
| Molecular Formula | H2Li2O5S |
Zirconium(IV) oxide, yttria stabilized, 99% (metals basis excluding Hf), Hf 4% max, Thermo Scientific Chemicals
CAS: 1314-23-4 Molecular Formula: O2Zr Molecular Weight (g/mol): 123.22 MDL Number: MFCD00011310 MFCD01868884 InChI Key: MCMNRKCIXSYSNV-UHFFFAOYSA-N Synonym: zirconia,zirconium oxide,zirconium oxide zro2,rhuligel,zirconium iv oxide,zirconium white,zirconic anhydride,pigment white 12,zirox zt 35,pcs filler PubChem CID: 62395 IUPAC Name: dioxozirconium SMILES: O=[Zr]=O
| PubChem CID | 62395 |
|---|---|
| CAS | 1314-23-4 |
| Molecular Weight (g/mol) | 123.22 |
| MDL Number | MFCD00011310 MFCD01868884 |
| SMILES | O=[Zr]=O |
| Synonym | zirconia,zirconium oxide,zirconium oxide zro2,rhuligel,zirconium iv oxide,zirconium white,zirconic anhydride,pigment white 12,zirox zt 35,pcs filler |
| IUPAC Name | dioxozirconium |
| InChI Key | MCMNRKCIXSYSNV-UHFFFAOYSA-N |
| Molecular Formula | O2Zr |
Cerium(IV) oxide, nanopowder, 99.5% min (REO)
CAS: 1306-38-3 Molecular Formula: CeO2 Molecular Weight (g/mol): 172.114 MDL Number: MFCD00010933 InChI Key: CETPSERCERDGAM-UHFFFAOYSA-N Synonym: ceric oxide,cerium dioxide,cerium iv oxide,ceria,cerium oxide,ceric dioxide,cerium 4+ oxide,needlal,nidoral,opaline PubChem CID: 73963 ChEBI: CHEBI:79089 IUPAC Name: dioxocerium SMILES: O=[Ce]=O
| PubChem CID | 73963 |
|---|---|
| CAS | 1306-38-3 |
| Molecular Weight (g/mol) | 172.114 |
| ChEBI | CHEBI:79089 |
| MDL Number | MFCD00010933 |
| SMILES | O=[Ce]=O |
| Synonym | ceric oxide,cerium dioxide,cerium iv oxide,ceria,cerium oxide,ceric dioxide,cerium 4+ oxide,needlal,nidoral,opaline |
| IUPAC Name | dioxocerium |
| InChI Key | CETPSERCERDGAM-UHFFFAOYSA-N |
| Molecular Formula | CeO2 |
Zirconium(IV) oxide, yttria stabilized, 99.95% (metals basis excluding Hf), Thermo Scientific Chemicals
CAS: 1314-23-4 Molecular Formula: O2Zr Molecular Weight (g/mol): 123.22 MDL Number: MFCD00011310 MFCD01868884 InChI Key: MCMNRKCIXSYSNV-UHFFFAOYSA-N Synonym: zirconia,zirconium oxide,zirconium oxide zro2,rhuligel,zirconium iv oxide,zirconium white,zirconic anhydride,pigment white 12,zirox zt 35,pcs filler PubChem CID: 62395 IUPAC Name: dioxozirconium SMILES: O=[Zr]=O
| PubChem CID | 62395 |
|---|---|
| CAS | 1314-23-4 |
| Molecular Weight (g/mol) | 123.22 |
| MDL Number | MFCD00011310 MFCD01868884 |
| SMILES | O=[Zr]=O |
| Synonym | zirconia,zirconium oxide,zirconium oxide zro2,rhuligel,zirconium iv oxide,zirconium white,zirconic anhydride,pigment white 12,zirox zt 35,pcs filler |
| IUPAC Name | dioxozirconium |
| InChI Key | MCMNRKCIXSYSNV-UHFFFAOYSA-N |
| Molecular Formula | O2Zr |
Cadmium sulfide, 98%
CAS: 1306-23-6 Molecular Formula: CdS Molecular Weight (g/mol): 144.47 MDL Number: MFCD00010922 InChI Key: FRLJSGOEGLARCA-UHFFFAOYSA-N Synonym: cadmium sulfide,cadmium sulphide,capsebon,orange cadmium,cadmopur yellow,jaune brilliant,aurora yellow,cadmium orange,cadmium yellow,ferro yellow PubChem CID: 14783 ChEBI: CHEBI:50833 SMILES: [S--].[Cd++]
| PubChem CID | 14783 |
|---|---|
| CAS | 1306-23-6 |
| Molecular Weight (g/mol) | 144.47 |
| ChEBI | CHEBI:50833 |
| MDL Number | MFCD00010922 |
| SMILES | [S--].[Cd++] |
| Synonym | cadmium sulfide,cadmium sulphide,capsebon,orange cadmium,cadmopur yellow,jaune brilliant,aurora yellow,cadmium orange,cadmium yellow,ferro yellow |
| InChI Key | FRLJSGOEGLARCA-UHFFFAOYSA-N |
| Molecular Formula | CdS |
Tetrachlorobis(tetrahydrofuran)zirconium(IV), Thermo Scientific Chemicals
CAS: 21959-01-3 Molecular Formula: C8H16Cl4O2Zr Molecular Weight (g/mol): 377.238 MDL Number: MFCD00145367 InChI Key: VDJJKYYENYIHFF-UHFFFAOYSA-J Synonym: tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 PubChem CID: 2734040 IUPAC Name: oxolane;tetrachlorozirconium SMILES: C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl
| PubChem CID | 2734040 |
|---|---|
| CAS | 21959-01-3 |
| Molecular Weight (g/mol) | 377.238 |
| MDL Number | MFCD00145367 |
| SMILES | C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl |
| Synonym | tetrachlorobis tetrahydrofuran zirconium,zrcl4 thf 2,oxolane; tetrachlorozirconium,tetrachlorobis tetrahydrofurane zirconium,zirconium tetrachloride tetrahydrofuran complex,zirconium iv chloride tetrahydrofuran complex,bis tetrahydrofuran ; zirconium iv chloride,zirconium iv chloride tetrahydrofuran complex 1:2 |
| IUPAC Name | oxolane;tetrachlorozirconium |
| InChI Key | VDJJKYYENYIHFF-UHFFFAOYSA-J |
| Molecular Formula | C8H16Cl4O2Zr |
Magnesium chloride, ultra dry, 99.99% (metals basis)
CAS: 7786-30-3 Molecular Formula: Cl2Mg Molecular Weight (g/mol): 95.21 MDL Number: MFCD00011106 InChI Key: TWRXJAOTZQYOKJ-UHFFFAOYSA-L Synonym: magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride PubChem CID: 5360315 ChEBI: CHEBI:6636 SMILES: [Mg++].[Cl-].[Cl-]
| PubChem CID | 5360315 |
|---|---|
| CAS | 7786-30-3 |
| Molecular Weight (g/mol) | 95.21 |
| ChEBI | CHEBI:6636 |
| MDL Number | MFCD00011106 |
| SMILES | [Mg++].[Cl-].[Cl-] |
| Synonym | magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride |
| InChI Key | TWRXJAOTZQYOKJ-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mg |
Europium pieces, dendritic, 99.9% (REO)
CAS: 7440-53-1 Molecular Formula: Eu Molecular Weight (g/mol): 151.96 MDL Number: MFCD00010992 InChI Key: OGPBJKLSAFTDLK-UHFFFAOYSA-N Synonym: europio,atom,ingot,acmc-1bj8v,europium, chip, in mineral oil,foil, 1.0mm 0.04in thick,foil, 0.1mm 0.004in thick,foil, 0.25mm 0.01in thick,rod, 9.52 mm 0.375in dia,ingot reo , packed in mineral oil PubChem CID: 23981 ChEBI: CHEBI:32999 IUPAC Name: europium SMILES: [Eu]
| PubChem CID | 23981 |
|---|---|
| CAS | 7440-53-1 |
| Molecular Weight (g/mol) | 151.96 |
| ChEBI | CHEBI:32999 |
| MDL Number | MFCD00010992 |
| SMILES | [Eu] |
| Synonym | europio,atom,ingot,acmc-1bj8v,europium, chip, in mineral oil,foil, 1.0mm 0.04in thick,foil, 0.1mm 0.004in thick,foil, 0.25mm 0.01in thick,rod, 9.52 mm 0.375in dia,ingot reo , packed in mineral oil |
| IUPAC Name | europium |
| InChI Key | OGPBJKLSAFTDLK-UHFFFAOYSA-N |
| Molecular Formula | Eu |
Manganese(II) fluoride, 99%
CAS: 7782-64-1 Molecular Formula: F2Mn Molecular Weight (g/mol): 92.935 MDL Number: MFCD00016222 InChI Key: CTNMMTCXUUFYAP-UHFFFAOYSA-L Synonym: manganese ii fluoride,manganese fluoride mnf2,manganese fluorure french,manganese fluorure,mnf2,manganese fluoride di,manganese ii fluoride, anhydrous trace metals basis PubChem CID: 24528 IUPAC Name: difluoromanganese SMILES: F[Mn]F
| PubChem CID | 24528 |
|---|---|
| CAS | 7782-64-1 |
| Molecular Weight (g/mol) | 92.935 |
| MDL Number | MFCD00016222 |
| SMILES | F[Mn]F |
| Synonym | manganese ii fluoride,manganese fluoride mnf2,manganese fluorure french,manganese fluorure,mnf2,manganese fluoride di,manganese ii fluoride, anhydrous trace metals basis |
| IUPAC Name | difluoromanganese |
| InChI Key | CTNMMTCXUUFYAP-UHFFFAOYSA-L |
| Molecular Formula | F2Mn |