Carbohydrates
![eMolecules 13992-25-1 | 1-Azido-1-deoxy-b-D-glucopyranoside tetraacetate | Chem-Impex373.318 | C14H19N3O9 | 99.000 | CC(=O)OCC1OC(N=[N+]=[N-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O | 1g | 112769746](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502178092.JPG-250.jpg)
eMolecules 13992-25-1 | 1-Azido-1-deoxy-b-D-glucopyranoside tetraacetate | Chem-Impex373.318 | C14H19N3O9 | 99.000 | CC(=O)OCC1OC(N=[N+]=[N-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O | 1g | 112769746
1-Azido-1-deoxy-b-D-glucopyranoside tetraacetate | Chem-Impex | 13992-25-1373.318 | C14H19N3O9 | 99.000 | CC(=O)OCC1OC(N=[N+]=[N-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O | 1g | 112769746
Apexbio Technology LLC Anti-Amyloid-Beta-Ab-Donanemab
Anti-Amyloid Beta Antibody (Donanemab) (CAS No 1931944-80-7) is a monoclonal antibody under investigation in the field of neurodegenerative research specifically for Alzheimer s disease Originating from biotechnology developments its primary mechanism involves targeting amyloid beta plaques which are believed to contribute to Alzheimer s pathology It binds to a specific epitope on deposited amyloid plaques promoting clearance and reducing their accumulation Common in vitro activity has been observed in the nanomolar to low micromolar range Typical applications include use in cell models animal studies and drug screening assays to assess efficacy and mechanistic pathways Experimental concentrations typically depend on the specific research design