Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
Citric acid, 99%, pure, anhydrous
CAS: 77-92-9 Molecular Formula: C6H8O7 Molecular Weight (g/mol): 192.12 MDL Number: MFCD00011669 InChI Key: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonym: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy PubChem CID: 311 ChEBI: CHEBI:30769 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
| PubChem CID | 311 |
|---|---|
| CAS | 77-92-9 |
| Molecular Weight (g/mol) | 192.12 |
| ChEBI | CHEBI:30769 |
| MDL Number | MFCD00011669 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Synonym | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Molecular Formula | C6H8O7 |
Chlorosulfonic acid, 97%
CAS: 7790-94-5 InChI Key: XTHPWXDJESJLNJ-UHFFFAOYSA-N Synonym: chlorosulfonic acid,chlorosulfuric acid,sulfuric chlorohydrin,chlorosulphuric acid,chlorosulphonic acid,monochlorosulfuric acid,unii-2o9axl1tj4,sulfonic acid, monochloride,chloridosulfuric acid,hsdb 909 PubChem CID: 24638 IUPAC Name: sulfurochloridic acid SMILES: OS(=O)(=O)Cl
| PubChem CID | 24638 |
|---|---|
| CAS | 7790-94-5 |
| SMILES | OS(=O)(=O)Cl |
| Synonym | chlorosulfonic acid,chlorosulfuric acid,sulfuric chlorohydrin,chlorosulphuric acid,chlorosulphonic acid,monochlorosulfuric acid,unii-2o9axl1tj4,sulfonic acid, monochloride,chloridosulfuric acid,hsdb 909 |
| IUPAC Name | sulfurochloridic acid |
| InChI Key | XTHPWXDJESJLNJ-UHFFFAOYSA-N |
Boric Acid, MP Biomedicals™
CAS: 10043-35-3 Molecular Formula: BH3O3 Molecular Weight (g/mol): 61.83 MDL Number: MFCD00011337 InChI Key: KGBXLFKZBHKPEV-UHFFFAOYSA-N Synonym: orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe PubChem CID: 7628 ChEBI: CHEBI:33118 IUPAC Name: boric acid SMILES: OB(O)O
| PubChem CID | 7628 |
|---|---|
| CAS | 10043-35-3 |
| Molecular Weight (g/mol) | 61.83 |
| ChEBI | CHEBI:33118 |
| MDL Number | MFCD00011337 |
| SMILES | OB(O)O |
| Synonym | orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe |
| IUPAC Name | boric acid |
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Molecular Formula | BH3O3 |
Hydrochloric Acid, 33.33% (w/v), with 0.0005% (w/v) Methyl Orange Indicator, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: Cl2Pd Molecular Weight (g/mol): 177.32 MDL Number: MFCD00003558 InChI Key: PIBWKRNGBLPSSY-UHFFFAOYSA-L Synonym: palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 PubChem CID: 24290 ChEBI: CHEBI:53434 IUPAC Name: palladium(2+) dichloride SMILES: [Cl-].[Cl-].[Pd++]
| PubChem CID | 24290 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 177.32 |
| ChEBI | CHEBI:53434 |
| MDL Number | MFCD00003558 |
| SMILES | [Cl-].[Cl-].[Pd++] |
| Synonym | palladium chloride,palladium ii chloride,palladium dichloride,palladous chloride,pdcl2,palladium 2+ chloride,palladium chloride pdcl2,enplate activator 440 |
| IUPAC Name | palladium(2+) dichloride |
| InChI Key | PIBWKRNGBLPSSY-UHFFFAOYSA-L |
| Molecular Formula | Cl2Pd |
Nitric acid, for analysis, ca. 65% solution in water, Thermo Scientific Chemicals
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Glycolic acid, 70%
CAS: 79-14-1 Molecular Formula: C2H4O3 Molecular Weight (g/mol): 76.051 MDL Number: MFCD00004312 InChI Key: AEMRFAOFKBGASW-UHFFFAOYSA-N Synonym: glycolic acid,hydroxyacetic acid,glycollic acid,hydroxyethanoic acid,acetic acid, hydroxy,glycolate,caswell no. 470,alpha-hydroxyacetic acid,kyselina glykolova,kyselina glykolova czech PubChem CID: 757 ChEBI: CHEBI:17497 IUPAC Name: 2-hydroxyacetic acid SMILES: C(C(=O)O)O
| PubChem CID | 757 |
|---|---|
| CAS | 79-14-1 |
| Molecular Weight (g/mol) | 76.051 |
| ChEBI | CHEBI:17497 |
| MDL Number | MFCD00004312 |
| SMILES | C(C(=O)O)O |
| Synonym | glycolic acid,hydroxyacetic acid,glycollic acid,hydroxyethanoic acid,acetic acid, hydroxy,glycolate,caswell no. 470,alpha-hydroxyacetic acid,kyselina glykolova,kyselina glykolova czech |
| IUPAC Name | 2-hydroxyacetic acid |
| InChI Key | AEMRFAOFKBGASW-UHFFFAOYSA-N |
| Molecular Formula | C2H4O3 |
L(+)-Tartaric acid, disodium salt, dihydrate, 99+%, ACS reagent
CAS: 6106-24-7 Molecular Formula: C4H8Na2O8 Molecular Weight (g/mol): 230.08 MDL Number: MFCD00150035 InChI Key: FGJLAJMGHXGFDE-UDMGOBQRNA-L Synonym: unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi PubChem CID: 131855972 SMILES: O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O
| PubChem CID | 131855972 |
|---|---|
| CAS | 6106-24-7 |
| Molecular Weight (g/mol) | 230.08 |
| MDL Number | MFCD00150035 |
| SMILES | O.O.[Na+].[Na+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| Synonym | unii-dia7c37aow,disodium tartrate dihydrate,disodium l-+-tartrate dihydrate,dia7c37aow,disodium +-tartrate dihydrate,sodium l-+-tartrate dihydrate,butanedioic acid, 2,3-dihydroxy-2r,3r-, disodium salt, dihydrate,disodium tartarate dihydrate,sodium tartrate nf,sodium tartrate dihydrate mi |
| InChI Key | FGJLAJMGHXGFDE-UDMGOBQRNA-L |
| Molecular Formula | C4H8Na2O8 |
Periodic acid, for analysis
CAS: 10450-60-9 Molecular Formula: H5IO6 Molecular Weight (g/mol): 227.94 MDL Number: MFCD00011344 InChI Key: TWLXDPFBEPBAQB-UHFFFAOYSA-N Synonym: orthoperiodic acid,periodic acid,tetrahydroxyiodous acid,acid, periodic,paraperiodic acid,pentahydroxy-l5-iodane oxide,unii-ak1d44l87g,pentahydroxidooxidoiodine,hexaoxoiodic 5-acid,periodic acid, cryst PubChem CID: 25289 ChEBI: CHEBI:29150 IUPAC Name: pentahydroxy(oxo)-$l^{7}-iodane SMILES: O[I](O)(O)(O)(O)=O
| PubChem CID | 25289 |
|---|---|
| CAS | 10450-60-9 |
| Molecular Weight (g/mol) | 227.94 |
| ChEBI | CHEBI:29150 |
| MDL Number | MFCD00011344 |
| SMILES | O[I](O)(O)(O)(O)=O |
| Synonym | orthoperiodic acid,periodic acid,tetrahydroxyiodous acid,acid, periodic,paraperiodic acid,pentahydroxy-l5-iodane oxide,unii-ak1d44l87g,pentahydroxidooxidoiodine,hexaoxoiodic 5-acid,periodic acid, cryst |
| IUPAC Name | pentahydroxy(oxo)-$l^{7}-iodane |
| InChI Key | TWLXDPFBEPBAQB-UHFFFAOYSA-N |
| Molecular Formula | H5IO6 |
Nitric acid, 1.0N Standardized Solution
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Sulfuric acid, 0.2N Standardized Solution
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| CAS | 7664-93-9 |
|---|---|
| Molecular Weight (g/mol) | 98.07 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Acetic acid, 25%, solution in water
CAS: 64-19-7 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 64-19-7 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Sulfuric acid, 72% w/w aq. soln.
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
| Linear Formula | H3[P(Mo3O10)4] |
|---|---|
| Molecular Weight (g/mol) | 1825.40 |
| Color | Green to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Phosphomolybdic acid |
| SMILES | [O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].OP(O)(O)=O |
| Merck Index | 13, 7428 |
| InChI Key | FEFSFHGZSNHJEL-UHFFFAOYSA-N |
| Density | 0.9400 g/mL |
| Name Note | 20 wt% solution in ethanol |
| Percent Purity | 19 to 21% |
| CAS | 64-17-5 |
| Health Hazard 3 | GHS P Statement: IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00149913 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. Highly flammable liquid and vapor. |
| Flash Point | 5°C |
| Packaging | Plastic Bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Molybdophosphoric acid |
| IUPAC Name | phosphoric acid dodecamolybdenum hexatriacontaoxidandiide |
| Molecular Formula | H3Mo12O40P |
| Formula Weight | 1825.25 |
| Specific Gravity | 94% |
Perchloric acid, ACS, 69.0-72.0%, redistilled
CAS: 7601-90-3 Molecular Formula: ClHO4 Molecular Weight (g/mol): 100.45 MDL Number: MFCD00011325 InChI Key: VLTRZXGMWDSKGL-UHFFFAOYSA-N Synonym: unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 PubChem CID: 24247 ChEBI: CHEBI:29221 IUPAC Name: perchloric acid SMILES: O[Cl](=O)(=O)=O
| PubChem CID | 24247 |
|---|---|
| CAS | 7601-90-3 |
| Molecular Weight (g/mol) | 100.45 |
| ChEBI | CHEBI:29221 |
| MDL Number | MFCD00011325 |
| SMILES | O[Cl](=O)(=O)=O |
| Synonym | unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 |
| IUPAC Name | perchloric acid |
| InChI Key | VLTRZXGMWDSKGL-UHFFFAOYSA-N |
| Molecular Formula | ClHO4 |
Phosphorous acid, 98%, extra pure
CAS: 13598-36-2 Molecular Formula: H3O3P MDL Number: MFCD00137258 Synonym: Orthophosphorous acid
| CAS | 13598-36-2 |
|---|---|
| MDL Number | MFCD00137258 |
| Synonym | Orthophosphorous acid |
| Molecular Formula | H3O3P |