Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Sodium propionate, 99%
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.061 MDL Number: MFCD00002759 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M Synonym: sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar PubChem CID: 2723816 IUPAC Name: sodium;propanoate SMILES: CCC(=O)[O-].[Na+]
| PubChem CID | 2723816 |
|---|---|
| CAS | 137-40-6 |
| Molecular Weight (g/mol) | 96.061 |
| MDL Number | MFCD00002759 |
| SMILES | CCC(=O)[O-].[Na+] |
| Synonym | sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar |
| IUPAC Name | sodium;propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |
Thymine, 99%
CAS: 65-71-4 Molecular Formula: C5H6N2O2 Molecular Weight (g/mol): 126.11 MDL Number: MFCD00006026 InChI Key: RWQNBRDOKXIBIV-UHFFFAOYSA-N Synonym: thymine,5-methyluracil,thymin,2,4-dihydroxy-5-methylpyrimidine,thymine anhydrate,2,4 1h,3h-pyrimidinedione, 5-methyl,5-methylpyrimidine-2,4 1h,3h-dione,5-methyl-2,4 1h,3h-pyrimidinedione,thymin purine base,5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione PubChem CID: 1135 ChEBI: CHEBI:17821 IUPAC Name: 5-methyl-1H-pyrimidine-2,4-dione SMILES: CC1=CNC(=O)NC1=O
| PubChem CID | 1135 |
|---|---|
| CAS | 65-71-4 |
| Molecular Weight (g/mol) | 126.11 |
| ChEBI | CHEBI:17821 |
| MDL Number | MFCD00006026 |
| SMILES | CC1=CNC(=O)NC1=O |
| Synonym | thymine,5-methyluracil,thymin,2,4-dihydroxy-5-methylpyrimidine,thymine anhydrate,2,4 1h,3h-pyrimidinedione, 5-methyl,5-methylpyrimidine-2,4 1h,3h-dione,5-methyl-2,4 1h,3h-pyrimidinedione,thymin purine base,5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione |
| InChI Key | RWQNBRDOKXIBIV-UHFFFAOYSA-N |
| Molecular Formula | C5H6N2O2 |
Benzaldehyde dimethyl acetal, 98%
CAS: 1125-88-8 MDL Number: MFCD00008491 InChI Key: HEVMDQBCAHEHDY-UHFFFAOYSA-N Synonym: benzaldehyde dimethyl acetal,dimethoxymethyl benzene,alpha,alpha-dimethoxytoluene,dimethoxyphenylmethane,benzene, dimethoxymethyl,benzaldehydedimethylacetal,dimethoxymethyl-benzene,benzaldehyde, dimethyl acetal,benzaldehyde dimethylacetal,unii-w6t83k35ca PubChem CID: 62375 IUPAC Name: dimethoxymethylbenzene SMILES: COC(C1=CC=CC=C1)OC
| PubChem CID | 62375 |
|---|---|
| CAS | 1125-88-8 |
| MDL Number | MFCD00008491 |
| SMILES | COC(C1=CC=CC=C1)OC |
| Synonym | benzaldehyde dimethyl acetal,dimethoxymethyl benzene,alpha,alpha-dimethoxytoluene,dimethoxyphenylmethane,benzene, dimethoxymethyl,benzaldehydedimethylacetal,dimethoxymethyl-benzene,benzaldehyde, dimethyl acetal,benzaldehyde dimethylacetal,unii-w6t83k35ca |
| IUPAC Name | dimethoxymethylbenzene |
| InChI Key | HEVMDQBCAHEHDY-UHFFFAOYSA-N |
Isopropenylmagnesium bromide, 0.5M solution in THF, AcroSeal™
CAS: 13291-18-4 Molecular Formula: C3H5BrMg Molecular Weight (g/mol): 145.28 MDL Number: MFCD00192240 InChI Key: LFTYALBVGVNGLI-UHFFFAOYSA-M Synonym: isopropenylmagnesium bromide,isopropenylmagnesium bromide solution,isopropenyl magnesium bromide,bromo prop-1-en-2-yl magnesium,magnesium, bromo 1-methylethenyl,bromo isopropenyl magnesium,1-methylethenylmagnesium bromide,2-propen-2-ylmagnesium bromide,prop-1-en-2-ylmagnesium bromide,lftyalbvgvngli-uhfffaoysa-m,grignard reagent PubChem CID: 4187787 IUPAC Name: magnesium;prop-1-ene;bromide SMILES: CC(=C)[Mg]Br
| PubChem CID | 4187787 |
|---|---|
| CAS | 13291-18-4 |
| Molecular Weight (g/mol) | 145.28 |
| MDL Number | MFCD00192240 |
| SMILES | CC(=C)[Mg]Br |
| Synonym | isopropenylmagnesium bromide,isopropenylmagnesium bromide solution,isopropenyl magnesium bromide,bromo prop-1-en-2-yl magnesium,magnesium, bromo 1-methylethenyl,bromo isopropenyl magnesium,1-methylethenylmagnesium bromide,2-propen-2-ylmagnesium bromide,prop-1-en-2-ylmagnesium bromide,lftyalbvgvngli-uhfffaoysa-m,grignard reagent |
| IUPAC Name | magnesium;prop-1-ene;bromide |
| InChI Key | LFTYALBVGVNGLI-UHFFFAOYSA-M |
| Molecular Formula | C3H5BrMg |
Methyl 2-iodobenzoate, 98%
CAS: 610-97-9 Molecular Formula: C8H7IO2 Molecular Weight (g/mol): 262.046 MDL Number: MFCD00016351 InChI Key: BXXLTVBTDZXPTN-UHFFFAOYSA-N Synonym: 2-iodobenzoic acid methyl ester,methyl o-iodobenzoate,methyl-2-iodobenzoate,benzoic acid, 2-iodo-, methyl ester,2-iodo-benzoic acid methyl ester,methyl2-iodobenzoate,benzoic acid, o-iodo-, methyl ester,methyl 2-iodo-benzoate,pubchem10568,acmc-209mp0 PubChem CID: 69132 IUPAC Name: methyl 2-iodobenzoate SMILES: COC(=O)C1=CC=CC=C1I
| PubChem CID | 69132 |
|---|---|
| CAS | 610-97-9 |
| Molecular Weight (g/mol) | 262.046 |
| MDL Number | MFCD00016351 |
| SMILES | COC(=O)C1=CC=CC=C1I |
| Synonym | 2-iodobenzoic acid methyl ester,methyl o-iodobenzoate,methyl-2-iodobenzoate,benzoic acid, 2-iodo-, methyl ester,2-iodo-benzoic acid methyl ester,methyl2-iodobenzoate,benzoic acid, o-iodo-, methyl ester,methyl 2-iodo-benzoate,pubchem10568,acmc-209mp0 |
| IUPAC Name | methyl 2-iodobenzoate |
| InChI Key | BXXLTVBTDZXPTN-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO2 |
Benzotrifluoride, 99%
CAS: 98-08-8 Molecular Formula: C7H5F3 Molecular Weight (g/mol): 146.112 MDL Number: MFCD00000372 InChI Key: GETTZEONDQJALK-UHFFFAOYSA-N Synonym: benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene PubChem CID: 7368 ChEBI: CHEBI:36810 IUPAC Name: trifluoromethylbenzene SMILES: C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 7368 |
|---|---|
| CAS | 98-08-8 |
| Molecular Weight (g/mol) | 146.112 |
| ChEBI | CHEBI:36810 |
| MDL Number | MFCD00000372 |
| SMILES | C1=CC=C(C=C1)C(F)(F)F |
| Synonym | benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene |
| IUPAC Name | trifluoromethylbenzene |
| InChI Key | GETTZEONDQJALK-UHFFFAOYSA-N |
| Molecular Formula | C7H5F3 |
Tetra-n-butylammonium hydroxide, 55% w/w aq. soln.
CAS: 2052-49-5 Molecular Formula: C16H37NO Molecular Weight (g/mol): 259.48 MDL Number: MFCD00009425 InChI Key: VDZOOKBUILJEDG-UHFFFAOYSA-M Synonym: tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 PubChem CID: 2723671 SMILES: [OH-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2723671 |
|---|---|
| CAS | 2052-49-5 |
| Molecular Weight (g/mol) | 259.48 |
| MDL Number | MFCD00009425 |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO |
L-Glutathione, oxidized
CAS: 27025-41-8 Molecular Formula: C20H32N6O12S2 Molecular Weight (g/mol): 612.63 MDL Number: MFCD00150701 InChI Key: YPZRWBKMTBYPTK-IOKZUGQQNA-N Synonym: oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized PubChem CID: 65359 ChEBI: CHEBI:17858 IUPAC Name: (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid SMILES: N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O
| PubChem CID | 65359 |
|---|---|
| CAS | 27025-41-8 |
| Molecular Weight (g/mol) | 612.63 |
| ChEBI | CHEBI:17858 |
| MDL Number | MFCD00150701 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Synonym | oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| InChI Key | YPZRWBKMTBYPTK-IOKZUGQQNA-N |
| Molecular Formula | C20H32N6O12S2 |
4-Fluorocinnamic acid, 99%
CAS: 459-32-5 Molecular Formula: C9H7FO2 Molecular Weight (g/mol): 166.15 MDL Number: MFCD00004395 InChI Key: ISMMYAZSUSYVQG-ZZXKWVIFSA-N Synonym: 4-fluorocinnamic acid,e-3-4-fluorophenyl acrylic acid,2e-3-4-fluorophenyl prop-2-enoic acid,p-fluorocinnamic acid,3-4-fluorophenyl acrylic acid,e-p-fluorocinnamic acid,trans-4-fluorocinnamic acid,p-fluoro cinnamic acid,3-4-fluorophenyl prop-2-enoic acid,2-propenoic acid, 3-4-fluorophenyl-, 2e PubChem CID: 1530234 IUPAC Name: (E)-3-(4-fluorophenyl)prop-2-enoic acid SMILES: C1=CC(=CC=C1C=CC(=O)O)F
| PubChem CID | 1530234 |
|---|---|
| CAS | 459-32-5 |
| Molecular Weight (g/mol) | 166.15 |
| MDL Number | MFCD00004395 |
| SMILES | C1=CC(=CC=C1C=CC(=O)O)F |
| Synonym | 4-fluorocinnamic acid,e-3-4-fluorophenyl acrylic acid,2e-3-4-fluorophenyl prop-2-enoic acid,p-fluorocinnamic acid,3-4-fluorophenyl acrylic acid,e-p-fluorocinnamic acid,trans-4-fluorocinnamic acid,p-fluoro cinnamic acid,3-4-fluorophenyl prop-2-enoic acid,2-propenoic acid, 3-4-fluorophenyl-, 2e |
| IUPAC Name | (E)-3-(4-fluorophenyl)prop-2-enoic acid |
| InChI Key | ISMMYAZSUSYVQG-ZZXKWVIFSA-N |
| Molecular Formula | C9H7FO2 |
Perfluorotributylamine, Mass Spec Std, Thermo Scientific Chemicals
CAS: 311-89-7 Molecular Formula: C12F27N Molecular Weight (g/mol): 671.096 MDL Number: MFCD00000436 InChI Key: RVZRBWKZFJCCIB-UHFFFAOYSA-N Synonym: perfluorotributylamine,tris perfluorobutyl amine,tri perfluorobutyl amine,tris nonafluorobutyl amine,heptacosafluorotributylamine,fluorinert,fluosol 43,perfluorotri-n-butylamine,fluorocarbon fc 43,tri nonafluorobutyl amine PubChem CID: 9397 ChEBI: CHEBI:38854 IUPAC Name: 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)butan-1-amine SMILES: C(C(C(F)(F)F)(F)F)(C(N(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
| PubChem CID | 9397 |
|---|---|
| CAS | 311-89-7 |
| Molecular Weight (g/mol) | 671.096 |
| ChEBI | CHEBI:38854 |
| MDL Number | MFCD00000436 |
| SMILES | C(C(C(F)(F)F)(F)F)(C(N(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Synonym | perfluorotributylamine,tris perfluorobutyl amine,tri perfluorobutyl amine,tris nonafluorobutyl amine,heptacosafluorotributylamine,fluorinert,fluosol 43,perfluorotri-n-butylamine,fluorocarbon fc 43,tri nonafluorobutyl amine |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)butan-1-amine |
| InChI Key | RVZRBWKZFJCCIB-UHFFFAOYSA-N |
| Molecular Formula | C12F27N |
3-Ethylpyridine, 98%
CAS: 536-78-7 Molecular Formula: C7H9N Molecular Weight (g/mol): 107.156 MDL Number: MFCD00006413 InChI Key: MFEIKQPHQINPRI-UHFFFAOYSA-N Synonym: pyridine, 3-ethyl,3-ethyl pyridine,beta-lutidine,beta-ethylpyridine,3-ethyl-pyridine,5-ethylpyridine,unii-a25i3ez88v,lutidine, beta,3ethylpyridine,fema no. 3394 PubChem CID: 10823 IUPAC Name: 3-ethylpyridine SMILES: CCC1=CN=CC=C1
| PubChem CID | 10823 |
|---|---|
| CAS | 536-78-7 |
| Molecular Weight (g/mol) | 107.156 |
| MDL Number | MFCD00006413 |
| SMILES | CCC1=CN=CC=C1 |
| Synonym | pyridine, 3-ethyl,3-ethyl pyridine,beta-lutidine,beta-ethylpyridine,3-ethyl-pyridine,5-ethylpyridine,unii-a25i3ez88v,lutidine, beta,3ethylpyridine,fema no. 3394 |
| IUPAC Name | 3-ethylpyridine |
| InChI Key | MFEIKQPHQINPRI-UHFFFAOYSA-N |
| Molecular Formula | C7H9N |
Dibutylboron trifluoromethanesulfonate, 1M sol. in dichloromethane
CAS: 60669-69-4 | C9H18BF3O3S | 274.11 g/mol
| Linear Formula | CF3SO3B[(CH2)3CH3]2 |
|---|---|
| Molecular Weight (g/mol) | 274.11 |
| Color | Orange to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Dibutylboron trifluoromethanesulfonate |
| SMILES | CCCCB(CCCC)OS(=O)(=O)C(F)(F)F |
| InChI Key | FAVAVMFXAKZTMV-UHFFFAOYSA-N |
| Density | 1.2710g/mL |
| Assay Percent Range | 98% |
| PubChem CID | 2724243 |
| Fieser | 07,91; 09,140; 16,109 |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse |
| MDL Number | MFCD00009669 |
| Health Hazard 2 | GHS H Statement Flammable liquid and vapour. Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. |
| Solubility Information | Solubility in water: reacts. |
| Packaging | Glass Bottle |
| Flash Point | 27°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | dibutylboron trifluoromethanesulfonate,dibutylboryl trifluoromethanesulfonate solution,nbu2botf,bu2botf,dibutylboron triflate,n-bu 2botf,dibutylboryl trifluoromethanesulfonate,dibutylboron triflate solution,trifluoromethylsulfonyloxy dibutylborane,dibutyl trifluoromethyl sulfonyl oxy borane |
| IUPAC Name | dibutylboranyl trifluoromethanesulfonate |
| Molecular Formula | C9H18BF3O3S |
| Formula Weight | 274.11 |
| Specific Gravity | 1.271 |
Fullerene C60, 99.9%
CAS: 99685-96-8 Molecular Formula: C60 Molecular Weight (g/mol): 720.66 MDL Number: MFCD00151408 InChI Key: XMWRBQBLMFGWIX-UHFFFAOYSA-N Synonym: fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih PubChem CID: 123591 ChEBI: CHEBI:33128 IUPAC Name: (C\{60}-I\{h})[5,6]fullerene SMILES: C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41
| PubChem CID | 123591 |
|---|---|
| CAS | 99685-96-8 |
| Molecular Weight (g/mol) | 720.66 |
| ChEBI | CHEBI:33128 |
| MDL Number | MFCD00151408 |
| SMILES | C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41 |
| Synonym | fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih |
| IUPAC Name | (C\{60}-I\{h})[5,6]fullerene |
| InChI Key | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
| Molecular Formula | C60 |
Bathocuproin, 98%
CAS: 4733-39-5 Molecular Formula: C26H20N2 Molecular Weight (g/mol): 360.46 MDL Number: MFCD00004972 InChI Key: STTGYIUESPWXOW-UHFFFAOYSA-N Synonym: bathocuproine,bathocuproin,1,10-phenanthroline, 2,9-dimethyl-4,7-diphenyl,unii-9thp2v94fx,9thp2v94fx,2,9-dimethyl-4,7-diphenylpyridino 3,2-h quinoline,pubchem19657,bathocuproin 1g,bidd:gt0563 PubChem CID: 65149 IUPAC Name: 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline SMILES: CC1=CC(C2=CC=CC=C2)=C2C=CC3=C(C=C(C)N=C3C2=N1)C1=CC=CC=C1
| PubChem CID | 65149 |
|---|---|
| CAS | 4733-39-5 |
| Molecular Weight (g/mol) | 360.46 |
| MDL Number | MFCD00004972 |
| SMILES | CC1=CC(C2=CC=CC=C2)=C2C=CC3=C(C=C(C)N=C3C2=N1)C1=CC=CC=C1 |
| Synonym | bathocuproine,bathocuproin,1,10-phenanthroline, 2,9-dimethyl-4,7-diphenyl,unii-9thp2v94fx,9thp2v94fx,2,9-dimethyl-4,7-diphenylpyridino 3,2-h quinoline,pubchem19657,bathocuproin 1g,bidd:gt0563 |
| IUPAC Name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| InChI Key | STTGYIUESPWXOW-UHFFFAOYSA-N |
| Molecular Formula | C26H20N2 |
Sulfamethoxazole, 98%
CAS: 723-46-6 Molecular Formula: C10H11N3O3S Molecular Weight (g/mol): 253.276 MDL Number: MFCD00010546 InChI Key: JLKIGFTWXXRPMT-UHFFFAOYSA-N Synonym: sulfamethoxazole,sulphamethoxazole,sulfisomezole,gantanol,sulfamethoxazol,metoxal,sulfamethylisoxazole,simsinomin,radonil,sinomin PubChem CID: 5329 ChEBI: CHEBI:9332 IUPAC Name: 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide SMILES: CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N
| PubChem CID | 5329 |
|---|---|
| CAS | 723-46-6 |
| Molecular Weight (g/mol) | 253.276 |
| ChEBI | CHEBI:9332 |
| MDL Number | MFCD00010546 |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Synonym | sulfamethoxazole,sulphamethoxazole,sulfisomezole,gantanol,sulfamethoxazol,metoxal,sulfamethylisoxazole,simsinomin,radonil,sinomin |
| IUPAC Name | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| InChI Key | JLKIGFTWXXRPMT-UHFFFAOYSA-N |
| Molecular Formula | C10H11N3O3S |