Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Hydroquinone, 99.5%
CAS: 123-31-9 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.11 MDL Number: MFCD00002339 InChI Key: QIGBRXMKCJKVMJ-UHFFFAOYSA-N Synonym: hydroquinone,1,4-benzenediol,quinol,1,4-dihydroxybenzene,p-benzenediol,4-hydroxyphenol,p-hydroquinone,p-hydroxyphenol,p-dihydroxybenzene,benzoquinol PubChem CID: 785 ChEBI: CHEBI:17594 IUPAC Name: benzene-1,4-diol SMILES: C1=CC(=CC=C1O)O
| PubChem CID | 785 |
|---|---|
| CAS | 123-31-9 |
| Molecular Weight (g/mol) | 110.11 |
| ChEBI | CHEBI:17594 |
| MDL Number | MFCD00002339 |
| SMILES | C1=CC(=CC=C1O)O |
| Synonym | hydroquinone,1,4-benzenediol,quinol,1,4-dihydroxybenzene,p-benzenediol,4-hydroxyphenol,p-hydroquinone,p-hydroxyphenol,p-dihydroxybenzene,benzoquinol |
| IUPAC Name | benzene-1,4-diol |
| InChI Key | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
N,N-Diethylaniline, 99%
CAS: 91-66-7 Molecular Formula: C10H15N Molecular Weight (g/mol): 149.24 MDL Number: MFCD00009042,MFCD31699978 InChI Key: GGSUCNLOZRCGPQ-UHFFFAOYSA-N Synonym: diethylaniline,n,n-diethylanilin,diethylphenylamine,benzenamine, n,n-diethyl,n,n-diethyl aniline,diaethylanilin,phenyldiethylamine,aniline, n,n-diethyl,n,n-diethylaminobenzene,n-phenyldiethylamine PubChem CID: 7061 IUPAC Name: N,N-diethylaniline SMILES: CCN(CC)C1=CC=CC=C1
| PubChem CID | 7061 |
|---|---|
| CAS | 91-66-7 |
| Molecular Weight (g/mol) | 149.24 |
| MDL Number | MFCD00009042,MFCD31699978 |
| SMILES | CCN(CC)C1=CC=CC=C1 |
| Synonym | diethylaniline,n,n-diethylanilin,diethylphenylamine,benzenamine, n,n-diethyl,n,n-diethyl aniline,diaethylanilin,phenyldiethylamine,aniline, n,n-diethyl,n,n-diethylaminobenzene,n-phenyldiethylamine |
| IUPAC Name | N,N-diethylaniline |
| InChI Key | GGSUCNLOZRCGPQ-UHFFFAOYSA-N |
| Molecular Formula | C10H15N |
3-Hydroxybenzaldehyde, 97%
CAS: 100-83-4 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.123 MDL Number: MFCD00003368 InChI Key: IAVREABSGIHHMO-UHFFFAOYSA-N Synonym: m-formylphenol,m-hydroxybenzaldehyde,3-formylphenol,benzaldehyde, 3-hydroxy,meta-hydroxybenzaldehyde,benzaldehyde, m-hydroxy,3-hydroxy-benzaldehyde,3-hydroxy benzaldehyde,3-hydroxybenzaldehyd,3-hydroxylbenzaldehyde PubChem CID: 101 ChEBI: CHEBI:16207 IUPAC Name: 3-hydroxybenzaldehyde SMILES: C1=CC(=CC(=C1)O)C=O
| PubChem CID | 101 |
|---|---|
| CAS | 100-83-4 |
| Molecular Weight (g/mol) | 122.123 |
| ChEBI | CHEBI:16207 |
| MDL Number | MFCD00003368 |
| SMILES | C1=CC(=CC(=C1)O)C=O |
| Synonym | m-formylphenol,m-hydroxybenzaldehyde,3-formylphenol,benzaldehyde, 3-hydroxy,meta-hydroxybenzaldehyde,benzaldehyde, m-hydroxy,3-hydroxy-benzaldehyde,3-hydroxy benzaldehyde,3-hydroxybenzaldehyd,3-hydroxylbenzaldehyde |
| IUPAC Name | 3-hydroxybenzaldehyde |
| InChI Key | IAVREABSGIHHMO-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2 |
Poly(acrylic acid), 63 wt% solution in water; approx. M.W. 2,000
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
Cellulose powder, microcrystallline, >97%, MP Biomedicals™
CAS: 9004-34-6 Molecular Formula: (C6H10O5)n
| CAS | 9004-34-6 |
|---|---|
| Molecular Formula | (C6H10O5)n |
2,2,2-Trichloroethyl chloroformate, 97%
CAS: 17341-93-4 MDL Number: MFCD00000810 InChI Key: LJCZNYWLQZZIOS-UHFFFAOYSA-N Synonym: 2,2,2-trichloroethyl chloroformate,trichloroethyl chloroformate,2,2,2-trichloroethylchloroformate,carbonochloridic acid, 2,2,2-trichloroethyl ester,2,2,2-trichloroethoxycarbonyl chloride,chloroformic acid 2,2,2-trichloroethyl ester,formic acid, chloro-, 2,2,2-trichloroethyl ester,chloro 2,2,2-trichloroethoxy methanone,beta, beta, beta-trichloroethoxycarbonyl chloride,troc PubChem CID: 87063 IUPAC Name: 2,2,2-trichloroethyl carbonochloridate SMILES: C(C(Cl)(Cl)Cl)OC(=O)Cl
| PubChem CID | 87063 |
|---|---|
| CAS | 17341-93-4 |
| MDL Number | MFCD00000810 |
| SMILES | C(C(Cl)(Cl)Cl)OC(=O)Cl |
| Synonym | 2,2,2-trichloroethyl chloroformate,trichloroethyl chloroformate,2,2,2-trichloroethylchloroformate,carbonochloridic acid, 2,2,2-trichloroethyl ester,2,2,2-trichloroethoxycarbonyl chloride,chloroformic acid 2,2,2-trichloroethyl ester,formic acid, chloro-, 2,2,2-trichloroethyl ester,chloro 2,2,2-trichloroethoxy methanone,beta, beta, beta-trichloroethoxycarbonyl chloride,troc |
| IUPAC Name | 2,2,2-trichloroethyl carbonochloridate |
| InChI Key | LJCZNYWLQZZIOS-UHFFFAOYSA-N |
1,2-Phthalic dicarboxaldehyde, 98+%
CAS: 643-79-8 Molecular Formula: C8H6O2 Molecular Weight (g/mol): 134.13 MDL Number: MFCD00003335 InChI Key: ZWLUXSQADUDCSB-UHFFFAOYSA-N Synonym: o-phthalaldehyde,o-phthaldialdehyde,benzene-1,2-dicarboxaldehyde,1,2-benzenedicarboxaldehyde,phthaldialdehyde,phthalic aldehyde,phthalic dialdehyde,phthalyldicarboxaldehyde,ortho-phthalaldehyde,o-phthaldehyde PubChem CID: 4807 ChEBI: CHEBI:70851 IUPAC Name: phthalaldehyde SMILES: O=CC1=CC=CC=C1C=O
| PubChem CID | 4807 |
|---|---|
| CAS | 643-79-8 |
| Molecular Weight (g/mol) | 134.13 |
| ChEBI | CHEBI:70851 |
| MDL Number | MFCD00003335 |
| SMILES | O=CC1=CC=CC=C1C=O |
| Synonym | o-phthalaldehyde,o-phthaldialdehyde,benzene-1,2-dicarboxaldehyde,1,2-benzenedicarboxaldehyde,phthaldialdehyde,phthalic aldehyde,phthalic dialdehyde,phthalyldicarboxaldehyde,ortho-phthalaldehyde,o-phthaldehyde |
| IUPAC Name | phthalaldehyde |
| InChI Key | ZWLUXSQADUDCSB-UHFFFAOYSA-N |
| Molecular Formula | C8H6O2 |
Hydrazine acetate, 97%
CAS: 7335-65-1 Molecular Formula: C2H8N2O2 Molecular Weight (g/mol): 92.10 MDL Number: MFCD00013141 InChI Key: YFHNDHXQDJQEEE-UHFFFAOYSA-N Synonym: hydrazine acetate,hydrazinium acetate,hydrazine, monoacetate,hydrazine monoacetate,acetic acid; hydrazine,hydrazineacetate,hydrazine, acetate 1:1,acetic acid; diamine,hydrazine mono-acetate,acmc-209bph PubChem CID: 165591 IUPAC Name: acetic acid;hydrazine SMILES: NN.CC(O)=O
| PubChem CID | 165591 |
|---|---|
| CAS | 7335-65-1 |
| Molecular Weight (g/mol) | 92.10 |
| MDL Number | MFCD00013141 |
| SMILES | NN.CC(O)=O |
| Synonym | hydrazine acetate,hydrazinium acetate,hydrazine, monoacetate,hydrazine monoacetate,acetic acid; hydrazine,hydrazineacetate,hydrazine, acetate 1:1,acetic acid; diamine,hydrazine mono-acetate,acmc-209bph |
| IUPAC Name | acetic acid;hydrazine |
| InChI Key | YFHNDHXQDJQEEE-UHFFFAOYSA-N |
| Molecular Formula | C2H8N2O2 |
2,4-Thiazolidinedione, 99%
CAS: 2295-31-0 Molecular Formula: C3H3NO2S Molecular Weight (g/mol): 117.12 MDL Number: MFCD00005478 InChI Key: ZOBPZXTWZATXDG-UHFFFAOYSA-N Synonym: 2,4-thiazolidinedione,thiazolidinedione,thiazolidine-2,4-dione,2,4-dioxothiazolidine,2,4 3h,5h-thiazoledione,usaf ek-5496,thiazolidindione,unii-aa68lxk93c,2,4 thiazolidinedione,thiazolidinedione-2,4 PubChem CID: 5437 ChEBI: CHEBI:50992 IUPAC Name: 1,3-thiazolidine-2,4-dione SMILES: C1C(=O)NC(=O)S1
| PubChem CID | 5437 |
|---|---|
| CAS | 2295-31-0 |
| Molecular Weight (g/mol) | 117.12 |
| ChEBI | CHEBI:50992 |
| MDL Number | MFCD00005478 |
| SMILES | C1C(=O)NC(=O)S1 |
| Synonym | 2,4-thiazolidinedione,thiazolidinedione,thiazolidine-2,4-dione,2,4-dioxothiazolidine,2,4 3h,5h-thiazoledione,usaf ek-5496,thiazolidindione,unii-aa68lxk93c,2,4 thiazolidinedione,thiazolidinedione-2,4 |
| IUPAC Name | 1,3-thiazolidine-2,4-dione |
| InChI Key | ZOBPZXTWZATXDG-UHFFFAOYSA-N |
| Molecular Formula | C3H3NO2S |
Perfluoro(methyldecahydronaphthalene), tech. 85%, mixture of isomers, Thermo Scientific Chemicals
CAS: 51294-16-7 Molecular Formula: C11F20 Molecular Weight (g/mol): 512.09 MDL Number: MFCD00014326 InChI Key: LWRNQOBXRHWPGE-UHFFFAOYNA-N Synonym: perfluoromethyldecalin,perfluoro methyldecalin,flutec pp9,perfluoro 1-methyldecalin,perfluoro-1-methyldecalin,pp 9,perfluoro methyldecalin , tech.,naphthalene, 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluorodecahydro-8-trifluoromethyl,heptadecafluorodecahydro-1-trifluoromethyl naphthalene,1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-trifluoromethyl naphthalene PubChem CID: 39977 IUPAC Name: 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene SMILES: FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F
| PubChem CID | 39977 |
|---|---|
| CAS | 51294-16-7 |
| Molecular Weight (g/mol) | 512.09 |
| MDL Number | MFCD00014326 |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F |
| Synonym | perfluoromethyldecalin,perfluoro methyldecalin,flutec pp9,perfluoro 1-methyldecalin,perfluoro-1-methyldecalin,pp 9,perfluoro methyldecalin , tech.,naphthalene, 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluorodecahydro-8-trifluoromethyl,heptadecafluorodecahydro-1-trifluoromethyl naphthalene,1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-trifluoromethyl naphthalene |
| IUPAC Name | 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene |
| InChI Key | LWRNQOBXRHWPGE-UHFFFAOYNA-N |
| Molecular Formula | C11F20 |
2-Methyl-2,4-pentanediol, 99%
CAS: 107-41-5 Molecular Formula: C6H14O2 Molecular Weight (g/mol): 118.18 MDL Number: MFCD00004547 InChI Key: SVTBMSDMJJWYQN-UHFFFAOYSA-N Synonym: hexylene glycol,2-methyl-2,4-pentanediol,pinakon,2,4-dihydroxy-2-methylpentane,2,4-pentanediol, 2-methyl,diolane,isol,4-methyl-2,4-pentanediol,1,1,3-trimethyltrimethylenediol,2-methyl pentane-2,4-diol PubChem CID: 7870 ChEBI: CHEBI:62995 IUPAC Name: 2-methylpentane-2,4-diol SMILES: CC(CC(C)(C)O)O
| PubChem CID | 7870 |
|---|---|
| CAS | 107-41-5 |
| Molecular Weight (g/mol) | 118.18 |
| ChEBI | CHEBI:62995 |
| MDL Number | MFCD00004547 |
| SMILES | CC(CC(C)(C)O)O |
| Synonym | hexylene glycol,2-methyl-2,4-pentanediol,pinakon,2,4-dihydroxy-2-methylpentane,2,4-pentanediol, 2-methyl,diolane,isol,4-methyl-2,4-pentanediol,1,1,3-trimethyltrimethylenediol,2-methyl pentane-2,4-diol |
| IUPAC Name | 2-methylpentane-2,4-diol |
| InChI Key | SVTBMSDMJJWYQN-UHFFFAOYSA-N |
| Molecular Formula | C6H14O2 |
Borane-tert-butylamine complex, 95%, powder
CAS: 7337-45-3 Molecular Formula: C4H14BN Molecular Weight (g/mol): 86.97 MDL Number: MFCD00075635 InChI Key: GKFJEDWZQZKYHV-UHFFFAOYSA-N Synonym: tert-butylamine borane,borane-tert-butylamine complex,borane tert-butylamine complex,borane-tert-butylaminecomplex,c4h14bn,borane t-butylamine,t-butylamine.borane,tert-butylamineborane,borane tert-butylamine,tert-butylamine-borane PubChem CID: 6364547 IUPAC Name: boron;2-methylpropan-2-amine SMILES: B.CC(C)(C)N
| PubChem CID | 6364547 |
|---|---|
| CAS | 7337-45-3 |
| Molecular Weight (g/mol) | 86.97 |
| MDL Number | MFCD00075635 |
| SMILES | B.CC(C)(C)N |
| Synonym | tert-butylamine borane,borane-tert-butylamine complex,borane tert-butylamine complex,borane-tert-butylaminecomplex,c4h14bn,borane t-butylamine,t-butylamine.borane,tert-butylamineborane,borane tert-butylamine,tert-butylamine-borane |
| IUPAC Name | boron;2-methylpropan-2-amine |
| InChI Key | GKFJEDWZQZKYHV-UHFFFAOYSA-N |
| Molecular Formula | C4H14BN |
Isosorbide mononitrate, 98+%
CAS: 16051-77-7 Molecular Formula: C6H9NO6 Molecular Weight (g/mol): 191.139 MDL Number: MFCD00143462 InChI Key: YWXYYJSYQOXTPL-SLPGGIOYSA-N Synonym: isosorbide mononitrate,isosorbide 5-mononitrate,monosorbitrate,imdur,elantan,monoket,mononit,corangin,ismn,isosorbide 5-nitrate PubChem CID: 27661 ChEBI: CHEBI:6062 IUPAC Name: [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate SMILES: C1C(C2C(O1)C(CO2)O[N+](=O)[O-])O
| PubChem CID | 27661 |
|---|---|
| CAS | 16051-77-7 |
| Molecular Weight (g/mol) | 191.139 |
| ChEBI | CHEBI:6062 |
| MDL Number | MFCD00143462 |
| SMILES | C1C(C2C(O1)C(CO2)O[N+](=O)[O-])O |
| Synonym | isosorbide mononitrate,isosorbide 5-mononitrate,monosorbitrate,imdur,elantan,monoket,mononit,corangin,ismn,isosorbide 5-nitrate |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| InChI Key | YWXYYJSYQOXTPL-SLPGGIOYSA-N |
| Molecular Formula | C6H9NO6 |
n-Hexyllithium, 2.5M (33 wt.%) solution in hexane, AcroSeal™, Thermo Scientific Chemicals
CAS: 21369-64-2 Molecular Formula: C6H13Li Molecular Weight (g/mol): 92.11 MDL Number: MFCD00191446 InChI Key: CETVQRFGPOGIQJ-UHFFFAOYSA-N Synonym: n-hexyllithium,lithium, hexyl,hexyllithium,hexyl lithium,hexyl-lithium,lithium hexane,n-hexyllithiurn,n-hexyllitium,n-hexyl lithium,hexli PubChem CID: 2733163 IUPAC Name: lithium;hexane SMILES: [Li+].CCCCC[CH2-]
| PubChem CID | 2733163 |
|---|---|
| CAS | 21369-64-2 |
| Molecular Weight (g/mol) | 92.11 |
| MDL Number | MFCD00191446 |
| SMILES | [Li+].CCCCC[CH2-] |
| Synonym | n-hexyllithium,lithium, hexyl,hexyllithium,hexyl lithium,hexyl-lithium,lithium hexane,n-hexyllithiurn,n-hexyllitium,n-hexyl lithium,hexli |
| IUPAC Name | lithium;hexane |
| InChI Key | CETVQRFGPOGIQJ-UHFFFAOYSA-N |
| Molecular Formula | C6H13Li |
beta-Carotene 97.0+%, TCI America™
CAS: 7235-40-7 Molecular Formula: C40H56 Molecular Weight (g/mol): 536.89 MDL Number: MFCD00001556 InChI Key: OENHQHLEOONYIE-JLTXGRSLSA-N Synonym: beta-carotene,beta carotene,betacarotene,beta,beta-carotene,provitamin a,solatene,carotaben,provatene,all-trans-beta-carotene,serlabo PubChem CID: 5280489 ChEBI: CHEBI:17579 IUPAC Name: 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-1-ene SMILES: C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C
| PubChem CID | 5280489 |
|---|---|
| CAS | 7235-40-7 |
| Molecular Weight (g/mol) | 536.89 |
| ChEBI | CHEBI:17579 |
| MDL Number | MFCD00001556 |
| SMILES | C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C |
| Synonym | beta-carotene,beta carotene,betacarotene,beta,beta-carotene,provitamin a,solatene,carotaben,provatene,all-trans-beta-carotene,serlabo |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-1-ene |
| InChI Key | OENHQHLEOONYIE-JLTXGRSLSA-N |
| Molecular Formula | C40H56 |