Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Phenylphosphonic acid, 98%
CAS: 1571-33-1 Molecular Formula: C6H7O3P Molecular Weight (g/mol): 158.09 MDL Number: MFCD00002136 InChI Key: QLZHNIAADXEJJP-UHFFFAOYSA-N Synonym: benzenephosphonic acid,phosphonic acid, phenyl,phenyl-phosphonic acid,phosphonic acid, p-phenyl,phenyl phosphonic acid,unii-byd76t2868,sv7,pubchem21303,phosphonic acid,phenyl,wln: qpqo&r PubChem CID: 15295 IUPAC Name: phenylphosphonic acid SMILES: OP(O)(=O)C1=CC=CC=C1
| PubChem CID | 15295 |
|---|---|
| CAS | 1571-33-1 |
| Molecular Weight (g/mol) | 158.09 |
| MDL Number | MFCD00002136 |
| SMILES | OP(O)(=O)C1=CC=CC=C1 |
| Synonym | benzenephosphonic acid,phosphonic acid, phenyl,phenyl-phosphonic acid,phosphonic acid, p-phenyl,phenyl phosphonic acid,unii-byd76t2868,sv7,pubchem21303,phosphonic acid,phenyl,wln: qpqo&r |
| IUPAC Name | phenylphosphonic acid |
| InChI Key | QLZHNIAADXEJJP-UHFFFAOYSA-N |
| Molecular Formula | C6H7O3P |
Graphite foil, 0.13mm (0.005in) thick, 99.8% (metals basis), Thermo Scientific Chemicals
CAS: 7782-42-5 Molecular Formula: C Molecular Weight (g/mol): 12.01 MDL Number: MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7782-42-5 |
| Molecular Weight (g/mol) | 12.01 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 MFCD00144065 MFCD00146977 MFCD00211867 MFCD06411993 MFCD07370731 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
Poly(3-octylthiophene-2,5-diyl), regioregular, low metals, Thermo Scientific Chemicals
CAS: 104934-51-2 Molecular Formula: (C12H18S)n Molecular Weight (g/mol): 241.44 MDL Number: MFCD00241412 InChI Key: RXIQSINDOTYIGV-UHFFFAOYSA-N Synonym: poly 3-octylthiophene-2,5-diyl , regiorandom, low metals,poly 3-octylthiophene-2,5-diyl , regioregular, low metals PubChem CID: 121233643 IUPAC Name: azane;2,5-dimethyl-3-octylthiophene SMILES: CCCCCCCCC1=C(-*)SC(-*)=C1
| PubChem CID | 121233643 |
|---|---|
| CAS | 104934-51-2 |
| Molecular Weight (g/mol) | 241.44 |
| MDL Number | MFCD00241412 |
| SMILES | CCCCCCCCC1=C(-*)SC(-*)=C1 |
| Synonym | poly 3-octylthiophene-2,5-diyl , regiorandom, low metals,poly 3-octylthiophene-2,5-diyl , regioregular, low metals |
| IUPAC Name | azane;2,5-dimethyl-3-octylthiophene |
| InChI Key | RXIQSINDOTYIGV-UHFFFAOYSA-N |
| Molecular Formula | (C12H18S)n |
(7-Azabenzotriazol-1-yloxy)tripyrrolidinophosphonium hexafluorophosphate, 98%
CAS: 156311-83-0 Molecular Formula: C17H27F6N7OP2 Molecular Weight (g/mol): 521.39 MDL Number: MFCD03703417 InChI Key: CBZAHNDHLWAZQC-UHFFFAOYSA-N Synonym: pyaop,3h-1,2,3 triazolo 4,5-b pyridin-3-yl oxy tri pyrrolidin-1-yl phosphonium hexafluorophosphate v,7-azabenzotriazol-1-yloxy tripyrrolidinophosphonium hexafluorophosphate,3-hydroxy-3h-1,2,3-triazolo 4,5-b pyridinato-o tri-1-pyrrolidinylphosphonium hexafluorophosphate,pyaop reagent,7-azabenzotriazol-1-yloxy tripyrrolidino-phosphonium hexafluorophosphate,7-azabenzotriazol-1-yloxy-tris-pyrrolidino phosphonium hexafluorophosphate,pubchem12746,ksc491e1h PubChem CID: 11038641 IUPAC Name: tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium;hexafluorophosphate SMILES: F[P-](F)(F)(F)(F)F.C1CCN(C1)[P+](ON1N=NC2=CC=CN=C12)(N1CCCC1)N1CCCC1
| PubChem CID | 11038641 |
|---|---|
| CAS | 156311-83-0 |
| Molecular Weight (g/mol) | 521.39 |
| MDL Number | MFCD03703417 |
| SMILES | F[P-](F)(F)(F)(F)F.C1CCN(C1)[P+](ON1N=NC2=CC=CN=C12)(N1CCCC1)N1CCCC1 |
| Synonym | pyaop,3h-1,2,3 triazolo 4,5-b pyridin-3-yl oxy tri pyrrolidin-1-yl phosphonium hexafluorophosphate v,7-azabenzotriazol-1-yloxy tripyrrolidinophosphonium hexafluorophosphate,3-hydroxy-3h-1,2,3-triazolo 4,5-b pyridinato-o tri-1-pyrrolidinylphosphonium hexafluorophosphate,pyaop reagent,7-azabenzotriazol-1-yloxy tripyrrolidino-phosphonium hexafluorophosphate,7-azabenzotriazol-1-yloxy-tris-pyrrolidino phosphonium hexafluorophosphate,pubchem12746,ksc491e1h |
| IUPAC Name | tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium;hexafluorophosphate |
| InChI Key | CBZAHNDHLWAZQC-UHFFFAOYSA-N |
| Molecular Formula | C17H27F6N7OP2 |
Linezolid, 98%
CAS: 165800-03-3 Molecular Formula: C16H20FN3O4 Molecular Weight (g/mol): 337.35 InChI Key: TYZROVQLWOKYKF-ZDUSSCGKSA-N Synonym: linezolid,zyvox,zyvoxid,s-n-3-3-fluoro-4-morpholinophenyl-2-oxooxazolidin-5-yl methyl acetamide,zyvoxam,linezolide,linezlid,zyvoxa,linezolid usan:inn,unii-isq9i6j12j PubChem CID: 441401 ChEBI: CHEBI:63607 IUPAC Name: N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide SMILES: CC(=O)NCC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F
| PubChem CID | 441401 |
|---|---|
| CAS | 165800-03-3 |
| Molecular Weight (g/mol) | 337.35 |
| ChEBI | CHEBI:63607 |
| SMILES | CC(=O)NCC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F |
| Synonym | linezolid,zyvox,zyvoxid,s-n-3-3-fluoro-4-morpholinophenyl-2-oxooxazolidin-5-yl methyl acetamide,zyvoxam,linezolide,linezlid,zyvoxa,linezolid usan:inn,unii-isq9i6j12j |
| IUPAC Name | N-[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| InChI Key | TYZROVQLWOKYKF-ZDUSSCGKSA-N |
| Molecular Formula | C16H20FN3O4 |
Thermo Scientific Chemicals Betamethasone valerate
CAS: 2152-44-5 Molecular Formula: C27H37FO6 Molecular Weight (g/mol): 476.59 InChI Key: SNHRLVCMMWUAJD-SUYDQAKGSA-N IUPAC Name: (1R,2S,3aS,3bS,9aS,9bR,10S,11aS)-9b-fluoro-10-hydroxy-1-(2-hydroxyacetyl)-2,9a,11a-trimethyl-7-oxo-1H,2H,3H,3aH,3bH,4H,5H,7H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl pentanoate SMILES: CCCCC(=O)O[C@@]1([C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C(=O)CO
| CAS | 2152-44-5 |
|---|---|
| Molecular Weight (g/mol) | 476.59 |
| SMILES | CCCCC(=O)O[C@@]1([C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C(=O)CO |
| IUPAC Name | (1R,2S,3aS,3bS,9aS,9bR,10S,11aS)-9b-fluoro-10-hydroxy-1-(2-hydroxyacetyl)-2,9a,11a-trimethyl-7-oxo-1H,2H,3H,3aH,3bH,4H,5H,7H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl pentanoate |
| InChI Key | SNHRLVCMMWUAJD-SUYDQAKGSA-N |
| Molecular Formula | C27H37FO6 |
n-Propyl decanoate, 98%
CAS: 30673-60-0 Molecular Formula: C13H26O2 Molecular Weight (g/mol): 214.349 MDL Number: MFCD00056329 InChI Key: OVFMRFMJVFDSAA-UHFFFAOYSA-N Synonym: n-propyl decanoate,decanoic acid, propyl ester,propyl caprate,capric acid propyl ester,unii-s0he9grs1w,decanoic acid, propylester,s0he9grs1w,propyl caprate natural,propyl caprate decanoate,n-propyldecanoate PubChem CID: 121739 ChEBI: CHEBI:86973 IUPAC Name: propyl decanoate SMILES: CCCCCCCCCC(=O)OCCC
| PubChem CID | 121739 |
|---|---|
| CAS | 30673-60-0 |
| Molecular Weight (g/mol) | 214.349 |
| ChEBI | CHEBI:86973 |
| MDL Number | MFCD00056329 |
| SMILES | CCCCCCCCCC(=O)OCCC |
| Synonym | n-propyl decanoate,decanoic acid, propyl ester,propyl caprate,capric acid propyl ester,unii-s0he9grs1w,decanoic acid, propylester,s0he9grs1w,propyl caprate natural,propyl caprate decanoate,n-propyldecanoate |
| IUPAC Name | propyl decanoate |
| InChI Key | OVFMRFMJVFDSAA-UHFFFAOYSA-N |
| Molecular Formula | C13H26O2 |
Gossypol, 98+%
CAS: 303-45-7 Molecular Formula: C30H30O8 Molecular Weight (g/mol): 518.56 MDL Number: MFCD00017352 InChI Key: QBKSWRVVCFFDOT-UHFFFAOYSA-N Synonym: gossypol,--gossypol,+-gossypol,pogosin,tash 1,racemic-gossypol,r---gossypol,r-gossypol,+--gossypol,+/--gossypol PubChem CID: 3503 ChEBI: CHEBI:28584 SMILES: CC(C)C1=C(O)C(O)=C(C=O)C2=C(O)C(=C(C)C=C12)C1=C(O)C2=C(C=O)C(O)=C(O)C(C(C)C)=C2C=C1C
| PubChem CID | 3503 |
|---|---|
| CAS | 303-45-7 |
| Molecular Weight (g/mol) | 518.56 |
| ChEBI | CHEBI:28584 |
| MDL Number | MFCD00017352 |
| SMILES | CC(C)C1=C(O)C(O)=C(C=O)C2=C(O)C(=C(C)C=C12)C1=C(O)C2=C(C=O)C(O)=C(O)C(C(C)C)=C2C=C1C |
| Synonym | gossypol,--gossypol,+-gossypol,pogosin,tash 1,racemic-gossypol,r---gossypol,r-gossypol,+--gossypol,+/--gossypol |
| InChI Key | QBKSWRVVCFFDOT-UHFFFAOYSA-N |
| Molecular Formula | C30H30O8 |
4-Nitrobenzaldehyde, 99%
CAS: 555-16-8 Molecular Formula: C7H5NO3 Molecular Weight (g/mol): 151.12 MDL Number: MFCD00007346 InChI Key: BXRFQSNOROATLV-UHFFFAOYSA-N Synonym: p-nitrobenzaldehyde,benzaldehyde, 4-nitro,p-formylnitrobenzene,benzaldehyde, p-nitro,4-nitrobenzaldehydde,4-nitro-benzaldehyde,4-formylnitrobenzene,p-nitro benzaldehyde,4-nitro benzaldehyde,ccris 1675 PubChem CID: 541 ChEBI: CHEBI:66926 IUPAC Name: 4-nitrobenzaldehyde SMILES: [O-][N+](=O)C1=CC=C(C=O)C=C1
| PubChem CID | 541 |
|---|---|
| CAS | 555-16-8 |
| Molecular Weight (g/mol) | 151.12 |
| ChEBI | CHEBI:66926 |
| MDL Number | MFCD00007346 |
| SMILES | [O-][N+](=O)C1=CC=C(C=O)C=C1 |
| Synonym | p-nitrobenzaldehyde,benzaldehyde, 4-nitro,p-formylnitrobenzene,benzaldehyde, p-nitro,4-nitrobenzaldehydde,4-nitro-benzaldehyde,4-formylnitrobenzene,p-nitro benzaldehyde,4-nitro benzaldehyde,ccris 1675 |
| IUPAC Name | 4-nitrobenzaldehyde |
| InChI Key | BXRFQSNOROATLV-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO3 |
1-Methyl-1-cyclohexene, 97%, stabilized
CAS: 591-49-1 InChI Key: CTMHWPIWNRWQEG-UHFFFAOYSA-N Synonym: 1-methyl-1-cyclohexene,cyclohexene, 1-methyl,1-methylcyclohex-1-ene,cyclohexene, methyl,methylcyclohexene,.alpha.-methylcyclohexene,1-methyl-cyclohexene,methyl-1-cyclohexene,2,3,4,5-tetrahydrotoluene,unii-te4p8q2044 PubChem CID: 11574 IUPAC Name: 1-methylcyclohexene SMILES: CC1=CCCCC1
| PubChem CID | 11574 |
|---|---|
| CAS | 591-49-1 |
| SMILES | CC1=CCCCC1 |
| Synonym | 1-methyl-1-cyclohexene,cyclohexene, 1-methyl,1-methylcyclohex-1-ene,cyclohexene, methyl,methylcyclohexene,.alpha.-methylcyclohexene,1-methyl-cyclohexene,methyl-1-cyclohexene,2,3,4,5-tetrahydrotoluene,unii-te4p8q2044 |
| IUPAC Name | 1-methylcyclohexene |
| InChI Key | CTMHWPIWNRWQEG-UHFFFAOYSA-N |
Caffeine Citrate, MP Biomedicals™
CAS: 69-22-7 Molecular Formula: C14H18N4O9 Molecular Weight (g/mol): 386.32 MDL Number: MFCD00044986 InChI Key: RCQXSQPPHJPGOF-UHFFFAOYSA-N Synonym: Citrated caffeine,Caffeine,Citrated,Caffeina citrate PubChem CID: 6241 IUPAC Name: 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione; 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CN1C=NC2=C1C(=O)N(C)C(=O)N2C
| PubChem CID | 6241 |
|---|---|
| CAS | 69-22-7 |
| Molecular Weight (g/mol) | 386.32 |
| MDL Number | MFCD00044986 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| Synonym | Citrated caffeine,Caffeine,Citrated,Caffeina citrate |
| IUPAC Name | 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione; 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | RCQXSQPPHJPGOF-UHFFFAOYSA-N |
| Molecular Formula | C14H18N4O9 |
Diethyl dicarbonate, 97%
CAS: 1609-47-8 Molecular Formula: C6H10O5 Molecular Weight (g/mol): 162.14 MDL Number: MFCD00009106 InChI Key: FFYPMLJYZAEMQB-UHFFFAOYSA-N Synonym: diethyl pyrocarbonate,diethyl dicarbonate,depc,diethyl oxydiformate,baycovin,diethylpyrocarbonate,ethyl pyrocarbonate,dicarbonic acid, diethyl ester,dicarbonic acid diethyl ester,diethyl pyrocarbonic acid PubChem CID: 3051 ChEBI: CHEBI:59051 IUPAC Name: ethoxycarbonyl ethyl carbonate SMILES: CCOC(=O)OC(=O)OCC
| PubChem CID | 3051 |
|---|---|
| CAS | 1609-47-8 |
| Molecular Weight (g/mol) | 162.14 |
| ChEBI | CHEBI:59051 |
| MDL Number | MFCD00009106 |
| SMILES | CCOC(=O)OC(=O)OCC |
| Synonym | diethyl pyrocarbonate,diethyl dicarbonate,depc,diethyl oxydiformate,baycovin,diethylpyrocarbonate,ethyl pyrocarbonate,dicarbonic acid, diethyl ester,dicarbonic acid diethyl ester,diethyl pyrocarbonic acid |
| IUPAC Name | ethoxycarbonyl ethyl carbonate |
| InChI Key | FFYPMLJYZAEMQB-UHFFFAOYSA-N |
| Molecular Formula | C6H10O5 |
Sulbactam, 98%
CAS: 68373-14-8 Molecular Formula: C8H11NO5S Molecular Weight (g/mol): 233.24 MDL Number: MFCD00867005 InChI Key: FKENQMMABCRJMK-RITPCOANSA-N Synonym: sulbactam,sulbactam acid,penicillanic acid sulfone,sulbactamum,betamaze,2s,5r-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylic acid 4,4-dioxide,penicillanic acid 1,1-dioxide,unii-s4tf6i2330,penicillanic acid dioxide,chembl403 PubChem CID: 130313 ChEBI: CHEBI:9321 IUPAC Name: (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ⁶-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid SMILES: CC1(C)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O
| PubChem CID | 130313 |
|---|---|
| CAS | 68373-14-8 |
| Molecular Weight (g/mol) | 233.24 |
| ChEBI | CHEBI:9321 |
| MDL Number | MFCD00867005 |
| SMILES | CC1(C)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O |
| Synonym | sulbactam,sulbactam acid,penicillanic acid sulfone,sulbactamum,betamaze,2s,5r-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylic acid 4,4-dioxide,penicillanic acid 1,1-dioxide,unii-s4tf6i2330,penicillanic acid dioxide,chembl403 |
| IUPAC Name | (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ⁶-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI Key | FKENQMMABCRJMK-RITPCOANSA-N |
| Molecular Formula | C8H11NO5S |
Thermo Scientific Chemicals Nitro Blue Tetrazolium Chloride, 90%
CAS: 298-83-9 Molecular Formula: C40H30Cl2N10O6 Molecular Weight (g/mol): 817.65 InChI Key: FSVCQIDHPKZJSO-UHFFFAOYSA-L Synonym: nitrotetrazolium blue chloride,nitro bt,nitro blue tetrazolium,nbt,nitro blue tetrazolium chloride,p-nitrotetrazolium blue,nitrotetrazolium blue,nitroblue tetrazolium chloride,p-nitro blue tetrazolium chloride,nitro tetrazolium bt PubChem CID: 9281 ChEBI: CHEBI:9505 IUPAC Name: 2-[2-methoxy-4-[3-methoxy-4-[3-(4-nitrophenyl)-5-phenyltetrazol-2-ium-2-yl]phenyl]phenyl]-3-(4-nitrophenyl)-5-phenyltetrazol-2-ium;dichloride SMILES: COC1=C(C=CC(=C1)C2=CC(=C(C=C2)[N+]3=NC(=NN3C4=CC=C(C=C4)[N+](=O)[O-])C5=CC=CC=C5)OC)[N+]6=NC(=NN6C7=CC=C(C=C7)[N+](=O)[O-])C8=CC=CC=C8.[Cl-].[Cl-]
| PubChem CID | 9281 |
|---|---|
| CAS | 298-83-9 |
| Molecular Weight (g/mol) | 817.65 |
| ChEBI | CHEBI:9505 |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)[N+]3=NC(=NN3C4=CC=C(C=C4)[N+](=O)[O-])C5=CC=CC=C5)OC)[N+]6=NC(=NN6C7=CC=C(C=C7)[N+](=O)[O-])C8=CC=CC=C8.[Cl-].[Cl-] |
| Synonym | nitrotetrazolium blue chloride,nitro bt,nitro blue tetrazolium,nbt,nitro blue tetrazolium chloride,p-nitrotetrazolium blue,nitrotetrazolium blue,nitroblue tetrazolium chloride,p-nitro blue tetrazolium chloride,nitro tetrazolium bt |
| IUPAC Name | 2-[2-methoxy-4-[3-methoxy-4-[3-(4-nitrophenyl)-5-phenyltetrazol-2-ium-2-yl]phenyl]phenyl]-3-(4-nitrophenyl)-5-phenyltetrazol-2-ium;dichloride |
| InChI Key | FSVCQIDHPKZJSO-UHFFFAOYSA-L |
| Molecular Formula | C40H30Cl2N10O6 |
Cacodylic acid sodium salt trihydrate 98+%
CAS: 6131-99-3 Molecular Formula: C2H12AsNaO5 Molecular Weight (g/mol): 214.024 MDL Number: MFCD00149079 InChI Key: RLGWPHBPRCROJO-UHFFFAOYSA-M Synonym: sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate PubChem CID: 23679059 IUPAC Name: sodium;dimethylarsinate;trihydrate SMILES: C[As](=O)(C)[O-].O.O.O.[Na+]
| PubChem CID | 23679059 |
|---|---|
| CAS | 6131-99-3 |
| Molecular Weight (g/mol) | 214.024 |
| MDL Number | MFCD00149079 |
| SMILES | C[As](=O)(C)[O-].O.O.O.[Na+] |
| Synonym | sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate |
| IUPAC Name | sodium;dimethylarsinate;trihydrate |
| InChI Key | RLGWPHBPRCROJO-UHFFFAOYSA-M |
| Molecular Formula | C2H12AsNaO5 |