Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
4-Nitrobenzylamine hydrochloride, 94%
CAS: 18600-42-5 Molecular Formula: C7H9ClN2O2 Molecular Weight (g/mol): 188.611 MDL Number: MFCD00012863 InChI Key: SMIXZZMSWYOQPW-UHFFFAOYSA-N Synonym: 4-nitrobenzylamine hydrochloride,4-nitrophenyl methanamine hydrochloride,p-nitrobenzylamine hydrochloride,4-nitrobenzylamine hcl,pubchem12455,acmc-209enh,4-nitrobenzylamine hcl salt,ksc493k2b,p-nitrobenzylaminehydrochloride,4-nitrobenzylaminehydrochloride PubChem CID: 11252467 IUPAC Name: (4-nitrophenyl)methanamine;hydrochloride SMILES: C1=CC(=CC=C1CN)[N+](=O)[O-].Cl
| PubChem CID | 11252467 |
|---|---|
| CAS | 18600-42-5 |
| Molecular Weight (g/mol) | 188.611 |
| MDL Number | MFCD00012863 |
| SMILES | C1=CC(=CC=C1CN)[N+](=O)[O-].Cl |
| Synonym | 4-nitrobenzylamine hydrochloride,4-nitrophenyl methanamine hydrochloride,p-nitrobenzylamine hydrochloride,4-nitrobenzylamine hcl,pubchem12455,acmc-209enh,4-nitrobenzylamine hcl salt,ksc493k2b,p-nitrobenzylaminehydrochloride,4-nitrobenzylaminehydrochloride |
| IUPAC Name | (4-nitrophenyl)methanamine;hydrochloride |
| InChI Key | SMIXZZMSWYOQPW-UHFFFAOYSA-N |
| Molecular Formula | C7H9ClN2O2 |
Benzo[b]furan-2-carboxaldehyde, 99%
CAS: 4265-16-1 Molecular Formula: C9H6O2 Molecular Weight (g/mol): 146.145 MDL Number: MFCD00015463 InChI Key: ADDZHRRCUWNSCS-UHFFFAOYSA-N Synonym: benzo b furan-2-carboxaldehyde,2-benzofurancarboxaldehyde,benzofuran-2-carbaldehyde,benzofuran-2-carboxaldehyde,2-formylbenzofuran,2-benzofurancarbaldehyde,coumarilaldehyde,1-benzofuran-2-carboxaldehyde,benzofuran-2-aldehyde,benzo b-2-furfural PubChem CID: 61341 IUPAC Name: 1-benzofuran-2-carbaldehyde SMILES: C1=CC=C2C(=C1)C=C(O2)C=O
| PubChem CID | 61341 |
|---|---|
| CAS | 4265-16-1 |
| Molecular Weight (g/mol) | 146.145 |
| MDL Number | MFCD00015463 |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C=O |
| Synonym | benzo b furan-2-carboxaldehyde,2-benzofurancarboxaldehyde,benzofuran-2-carbaldehyde,benzofuran-2-carboxaldehyde,2-formylbenzofuran,2-benzofurancarbaldehyde,coumarilaldehyde,1-benzofuran-2-carboxaldehyde,benzofuran-2-aldehyde,benzo b-2-furfural |
| IUPAC Name | 1-benzofuran-2-carbaldehyde |
| InChI Key | ADDZHRRCUWNSCS-UHFFFAOYSA-N |
| Molecular Formula | C9H6O2 |
Aminoacetaldehyde dimethyl acetal, 99%
CAS: 22483-09-6 Molecular Formula: C4H11NO2 Molecular Weight (g/mol): 105.137 MDL Number: MFCD00008135 InChI Key: QKWWDTYDYOFRJL-UHFFFAOYSA-N Synonym: aminoacetaldehyde dimethyl acetal,2,2-dimethoxyethylamine,ethanamine, 2,2-dimethoxy,2,2-dimethoxyethan-1-amine,dimethylaminoacetal,amino acetaldehyde dimethyl acetal,1-amino-2,2-dimethoxyethane,2-aminoacetaldehyde dimethyl acetal,acetaldehyde, amino-, dimethyl acetal,acmc-209fwr PubChem CID: 89728 IUPAC Name: 2,2-dimethoxyethanamine SMILES: COC(CN)OC
| PubChem CID | 89728 |
|---|---|
| CAS | 22483-09-6 |
| Molecular Weight (g/mol) | 105.137 |
| MDL Number | MFCD00008135 |
| SMILES | COC(CN)OC |
| Synonym | aminoacetaldehyde dimethyl acetal,2,2-dimethoxyethylamine,ethanamine, 2,2-dimethoxy,2,2-dimethoxyethan-1-amine,dimethylaminoacetal,amino acetaldehyde dimethyl acetal,1-amino-2,2-dimethoxyethane,2-aminoacetaldehyde dimethyl acetal,acetaldehyde, amino-, dimethyl acetal,acmc-209fwr |
| IUPAC Name | 2,2-dimethoxyethanamine |
| InChI Key | QKWWDTYDYOFRJL-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO2 |
Cyclobutylamine, 98%
CAS: 2516-34-9 Molecular Formula: C4H9N Molecular Weight (g/mol): 71.123 MDL Number: MFCD00001328 InChI Key: KZZKOVLJUKWSKX-UHFFFAOYSA-N Synonym: cyclobutylamine,aminocyclobutane,cyclobutyl amine,cyclobutylamin,cyclobutaneamine,1-amino cyclobutane,pubchem11047,acmc-209ghn,cyclobutylammonium chloride PubChem CID: 75645 IUPAC Name: cyclobutanamine SMILES: C1CC(C1)N
| PubChem CID | 75645 |
|---|---|
| CAS | 2516-34-9 |
| Molecular Weight (g/mol) | 71.123 |
| MDL Number | MFCD00001328 |
| SMILES | C1CC(C1)N |
| Synonym | cyclobutylamine,aminocyclobutane,cyclobutyl amine,cyclobutylamin,cyclobutaneamine,1-amino cyclobutane,pubchem11047,acmc-209ghn,cyclobutylammonium chloride |
| IUPAC Name | cyclobutanamine |
| InChI Key | KZZKOVLJUKWSKX-UHFFFAOYSA-N |
| Molecular Formula | C4H9N |
2-Bromobenzylamine, 98%
CAS: 3959-05-5 Molecular Formula: C7H8BrN Molecular Weight (g/mol): 186.05 MDL Number: MFCD00025572 InChI Key: NOYASZMZIBFFNZ-UHFFFAOYSA-N Synonym: 2-bromobenzylamine,2-bromophenyl methanamine,o-bromobenzylamine,2-bromophenyl methylamine,1-2-bromophenyl methanamine,2-brobenzylamine,2-bromo-benzylamine,pubchem20398,acmc-1ct06,benzenemethanamine, 2-bromo PubChem CID: 334072 IUPAC Name: (2-bromophenyl)methanamine SMILES: C1=CC=C(C(=C1)CN)Br
| PubChem CID | 334072 |
|---|---|
| CAS | 3959-05-5 |
| Molecular Weight (g/mol) | 186.05 |
| MDL Number | MFCD00025572 |
| SMILES | C1=CC=C(C(=C1)CN)Br |
| Synonym | 2-bromobenzylamine,2-bromophenyl methanamine,o-bromobenzylamine,2-bromophenyl methylamine,1-2-bromophenyl methanamine,2-brobenzylamine,2-bromo-benzylamine,pubchem20398,acmc-1ct06,benzenemethanamine, 2-bromo |
| IUPAC Name | (2-bromophenyl)methanamine |
| InChI Key | NOYASZMZIBFFNZ-UHFFFAOYSA-N |
| Molecular Formula | C7H8BrN |
4-Methoxybenzylamine, 98%
CAS: 2393-23-9 Molecular Formula: C8H11NO Molecular Weight (g/mol): 137.18 InChI Key: IDPURXSQCKYKIJ-UHFFFAOYSA-N Synonym: 4-methoxybenzylamine,4-methoxyphenyl methanamine,benzenemethanamine, 4-methoxy,p-methoxybenzylamine,4-methoxy-benzylamine,anisylamine,benzylamine, p-methoxy,4-methoxybenzyl amine,1-4-methoxyphenyl methanamine,4-methoxyphenyl methylamine PubChem CID: 75452 ChEBI: CHEBI:49837 IUPAC Name: (4-methoxyphenyl)methanamine SMILES: COC1=CC=C(C=C1)CN
| PubChem CID | 75452 |
|---|---|
| CAS | 2393-23-9 |
| Molecular Weight (g/mol) | 137.18 |
| ChEBI | CHEBI:49837 |
| SMILES | COC1=CC=C(C=C1)CN |
| Synonym | 4-methoxybenzylamine,4-methoxyphenyl methanamine,benzenemethanamine, 4-methoxy,p-methoxybenzylamine,4-methoxy-benzylamine,anisylamine,benzylamine, p-methoxy,4-methoxybenzyl amine,1-4-methoxyphenyl methanamine,4-methoxyphenyl methylamine |
| IUPAC Name | (4-methoxyphenyl)methanamine |
| InChI Key | IDPURXSQCKYKIJ-UHFFFAOYSA-N |
| Molecular Formula | C8H11NO |
1-Heptanesulfonic acid, sodium salt, 99+%, Ion pair chromatography, anhydrous
CAS: 22767-50-6 Molecular Formula: C7H15NaO3S Molecular Weight (g/mol): 202.25 MDL Number: MFCD00007543 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M Synonym: sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate PubChem CID: 23672332 IUPAC Name: sodium;heptane-1-sulfonate SMILES: CCCCCCCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| Molecular Weight (g/mol) | 202.25 |
| MDL Number | MFCD00007543 |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Synonym | sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate |
| IUPAC Name | sodium;heptane-1-sulfonate |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Molecular Formula | C7H15NaO3S |
Glutathione Reduced, Cell Culture Reagent, ≥98%, MP Biomedicals™
CAS: 70-18-8 Molecular Formula: C10H17N3O6S Molecular Weight (g/mol): 307.321 MDL Number: MFCD00065939 InChI Key: RWSXRVCMGQZWBV-WDSKDSINSA-N Synonym: glutathione,l-glutathione,glutathion,glutathione-sh,glutinal,isethion,tathion,reduced glutathione,deltathione,neuthion PubChem CID: 124886 ChEBI: CHEBI:16856 IUPAC Name: (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid SMILES: C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N
| PubChem CID | 124886 |
|---|---|
| CAS | 70-18-8 |
| Molecular Weight (g/mol) | 307.321 |
| ChEBI | CHEBI:16856 |
| MDL Number | MFCD00065939 |
| SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| Synonym | glutathione,l-glutathione,glutathion,glutathione-sh,glutinal,isethion,tathion,reduced glutathione,deltathione,neuthion |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| InChI Key | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Molecular Formula | C10H17N3O6S |
Phthalimide, 99%
CAS: 85-41-6 Molecular Formula: C8H5NO2 Molecular Weight (g/mol): 147.13 MDL Number: MFCD00005881 InChI Key: XKJCHHZQLQNZHY-UHFFFAOYSA-N Synonym: phthalimide,1h-isoindole-1,3 2h-dione,o-phthalimide,isoindoline-1,3-dione,o-phthalic imide,1,3-isoindolinedione,benzoimide,2-diazoindan-1,3-dione,phenylimide,phthalimid PubChem CID: 6809 ChEBI: CHEBI:38817 IUPAC Name: isoindole-1,3-dione SMILES: O=C1NC(=O)C2=CC=CC=C12
| PubChem CID | 6809 |
|---|---|
| CAS | 85-41-6 |
| Molecular Weight (g/mol) | 147.13 |
| ChEBI | CHEBI:38817 |
| MDL Number | MFCD00005881 |
| SMILES | O=C1NC(=O)C2=CC=CC=C12 |
| Synonym | phthalimide,1h-isoindole-1,3 2h-dione,o-phthalimide,isoindoline-1,3-dione,o-phthalic imide,1,3-isoindolinedione,benzoimide,2-diazoindan-1,3-dione,phenylimide,phthalimid |
| IUPAC Name | isoindole-1,3-dione |
| InChI Key | XKJCHHZQLQNZHY-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO2 |
2-Chloro-3',4'-dihydroxyacetophenone, 97%
CAS: 99-40-1 Molecular Formula: C8H7ClO3 Molecular Weight (g/mol): 186.591 MDL Number: MFCD00002200 InChI Key: LWTJEJCZJFZKEL-UHFFFAOYSA-N Synonym: 2-chloro-3',4'-dihydroxyacetophenone,2-chloro-1-3,4-dihydroxyphenyl ethanone,4-chloroacetyl catechol,3,4-dihydroxyphenacyl chloride,ethanone, 2-chloro-1-3,4-dihydroxyphenyl,unii-fn6949l56q,3',4'-dihydroxy-2-chloroacetophenone,chloromethyl 3,4-dihydroxyphenyl ketone,2-chloro-3,4-dihydroxyacetophenone,.alpha.-chloro-3,4-dihydroxyacetophenone PubChem CID: 66834 ChEBI: CHEBI:51844 IUPAC Name: 2-chloro-1-(3,4-dihydroxyphenyl)ethanone SMILES: C1=CC(=C(C=C1C(=O)CCl)O)O
| PubChem CID | 66834 |
|---|---|
| CAS | 99-40-1 |
| Molecular Weight (g/mol) | 186.591 |
| ChEBI | CHEBI:51844 |
| MDL Number | MFCD00002200 |
| SMILES | C1=CC(=C(C=C1C(=O)CCl)O)O |
| Synonym | 2-chloro-3',4'-dihydroxyacetophenone,2-chloro-1-3,4-dihydroxyphenyl ethanone,4-chloroacetyl catechol,3,4-dihydroxyphenacyl chloride,ethanone, 2-chloro-1-3,4-dihydroxyphenyl,unii-fn6949l56q,3',4'-dihydroxy-2-chloroacetophenone,chloromethyl 3,4-dihydroxyphenyl ketone,2-chloro-3,4-dihydroxyacetophenone,.alpha.-chloro-3,4-dihydroxyacetophenone |
| IUPAC Name | 2-chloro-1-(3,4-dihydroxyphenyl)ethanone |
| InChI Key | LWTJEJCZJFZKEL-UHFFFAOYSA-N |
| Molecular Formula | C8H7ClO3 |
N-Hydroxysulfosuccinimide sodium salt, 95%
CAS: 106627-54-7 Molecular Formula: C4H4NNaO6S Molecular Weight (g/mol): 217.13 InChI Key: RPENMORRBUTCPR-UHFFFAOYSA-M Synonym: n-hydroxysulfosuccinimide sodium salt,sulfo-nhs,sodium 1-hydroxy-2,5-dioxopyrrolidine-3-sulfonate,n-hydroxysulfosuccinimidesodiumsalt,3-pyrrolidinesulfonic acid, 1-hydroxy-2,5-dioxo-, monosodium salt,sodium 1-hydroxy-2,5-dioxo-pyrrolidine-3-sulfonate,n-hydroxusulfosuccinimide sodium,n-hydroxy-2-sodiosulfo succinimide,n-hydroxysulfosuccinimide,sodium salt,n-hydroxusulfosuccinimide sodium salt PubChem CID: 3520574 IUPAC Name: sodium;1-hydroxy-2,5-dioxopyrrolidine-3-sulfonate SMILES: C1C(C(=O)N(C1=O)O)S(=O)(=O)[O-].[Na+]
| PubChem CID | 3520574 |
|---|---|
| CAS | 106627-54-7 |
| Molecular Weight (g/mol) | 217.13 |
| SMILES | C1C(C(=O)N(C1=O)O)S(=O)(=O)[O-].[Na+] |
| Synonym | n-hydroxysulfosuccinimide sodium salt,sulfo-nhs,sodium 1-hydroxy-2,5-dioxopyrrolidine-3-sulfonate,n-hydroxysulfosuccinimidesodiumsalt,3-pyrrolidinesulfonic acid, 1-hydroxy-2,5-dioxo-, monosodium salt,sodium 1-hydroxy-2,5-dioxo-pyrrolidine-3-sulfonate,n-hydroxusulfosuccinimide sodium,n-hydroxy-2-sodiosulfo succinimide,n-hydroxysulfosuccinimide,sodium salt,n-hydroxusulfosuccinimide sodium salt |
| IUPAC Name | sodium;1-hydroxy-2,5-dioxopyrrolidine-3-sulfonate |
| InChI Key | RPENMORRBUTCPR-UHFFFAOYSA-M |
| Molecular Formula | C4H4NNaO6S |
Triethylenetetramine, 60%
CAS: 112-24-3 Molecular Formula: C6H18N4 Molecular Weight (g/mol): 146.24 MDL Number: MFCD00008169 InChI Key: VILCJCGEZXAXTO-UHFFFAOYSA-N Synonym: triethylenetetramine,trientine,trien,teta,tecza,triethylene tetramine,araldite hardener hy 951,1,2-ethanediamine, n,n'-bis 2-aminoethyl,deh 24,araldite hy 951 PubChem CID: 5565 ChEBI: CHEBI:39501 IUPAC Name: N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine SMILES: C(CNCCNCCN)N
| PubChem CID | 5565 |
|---|---|
| CAS | 112-24-3 |
| Molecular Weight (g/mol) | 146.24 |
| ChEBI | CHEBI:39501 |
| MDL Number | MFCD00008169 |
| SMILES | C(CNCCNCCN)N |
| Synonym | triethylenetetramine,trientine,trien,teta,tecza,triethylene tetramine,araldite hardener hy 951,1,2-ethanediamine, n,n'-bis 2-aminoethyl,deh 24,araldite hy 951 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine |
| InChI Key | VILCJCGEZXAXTO-UHFFFAOYSA-N |
| Molecular Formula | C6H18N4 |
Potassium oxalate hydrate, 99%
CAS: 6487-48-5 Molecular Formula: C2H2K2O5 Molecular Weight (g/mol): 184.23 MDL Number: MFCD00150033 InChI Key: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC Name: dipotassium;oxalate;hydrate SMILES: O.[K+].[K+].[O-]C(=O)C([O-])=O
| PubChem CID | 2724193 |
|---|---|
| CAS | 6487-48-5 |
| Molecular Weight (g/mol) | 184.23 |
| MDL Number | MFCD00150033 |
| SMILES | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| IUPAC Name | dipotassium;oxalate;hydrate |
| InChI Key | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molecular Formula | C2H2K2O5 |
2-Hydroxyisobutyric Acid 98.0+%, TCI America™
CAS: 594-61-6 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.11 MDL Number: MFCD00004459 InChI Key: BWLBGMIXKSTLSX-UHFFFAOYSA-N Synonym: 2-hydroxyisobutyric acid,2-methyllactic acid,acetonic acid,2-hydroxy-2-methylpropionic acid,alpha-hydroxyisobutyric acid,hydroxydimethylacetic acid,acetonate,propanoic acid, 2-hydroxy-2-methyl,alpha-hydroxyisobutanoic acid,2-hydroxyisobutyricacid PubChem CID: 11671 ChEBI: CHEBI:50129 IUPAC Name: 2-hydroxy-2-methylpropanoic acid SMILES: CC(C)(O)C(O)=O
| PubChem CID | 11671 |
|---|---|
| CAS | 594-61-6 |
| Molecular Weight (g/mol) | 104.11 |
| ChEBI | CHEBI:50129 |
| MDL Number | MFCD00004459 |
| SMILES | CC(C)(O)C(O)=O |
| Synonym | 2-hydroxyisobutyric acid,2-methyllactic acid,acetonic acid,2-hydroxy-2-methylpropionic acid,alpha-hydroxyisobutyric acid,hydroxydimethylacetic acid,acetonate,propanoic acid, 2-hydroxy-2-methyl,alpha-hydroxyisobutanoic acid,2-hydroxyisobutyricacid |
| IUPAC Name | 2-hydroxy-2-methylpropanoic acid |
| InChI Key | BWLBGMIXKSTLSX-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3 |
n-Nonane, 99%
CAS: 111-84-2 Molecular Formula: C9H20 Molecular Weight (g/mol): 128.259 MDL Number: MFCD00009574 InChI Key: BKIMMITUMNQMOS-UHFFFAOYSA-N Synonym: n-nonane,shellsol 140,nonyl hydride,nonan,heptane, ethyl,unii-t9w3vh6g10,ccris 6081,hsdb 107,dsstox_cid_5796,nonane, analytical standard PubChem CID: 8141 ChEBI: CHEBI:32892 IUPAC Name: nonane SMILES: CCCCCCCCC
| PubChem CID | 8141 |
|---|---|
| CAS | 111-84-2 |
| Molecular Weight (g/mol) | 128.259 |
| ChEBI | CHEBI:32892 |
| MDL Number | MFCD00009574 |
| SMILES | CCCCCCCCC |
| Synonym | n-nonane,shellsol 140,nonyl hydride,nonan,heptane, ethyl,unii-t9w3vh6g10,ccris 6081,hsdb 107,dsstox_cid_5796,nonane, analytical standard |
| IUPAC Name | nonane |
| InChI Key | BKIMMITUMNQMOS-UHFFFAOYSA-N |
| Molecular Formula | C9H20 |