Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Allyl Chloride 98.0+%, TCI America™
CAS: 107-05-1 Molecular Formula: C3H5Cl Molecular Weight (g/mol): 76.523 MDL Number: MFCD00000984 InChI Key: OSDWBNJEKMUWAV-UHFFFAOYSA-N Synonym: allyl chloride,3-chloro-1-propene,1-propene, 3-chloro,3-chloropropylene,3-chloropropene,chlorallylene,allylchlorid,2-propenyl chloride,1-chloro-2-propene,allylchloride PubChem CID: 7850 ChEBI: CHEBI:82379 IUPAC Name: 3-chloroprop-1-ene SMILES: C=CCCl
| PubChem CID | 7850 |
|---|---|
| CAS | 107-05-1 |
| Molecular Weight (g/mol) | 76.523 |
| ChEBI | CHEBI:82379 |
| MDL Number | MFCD00000984 |
| SMILES | C=CCCl |
| Synonym | allyl chloride,3-chloro-1-propene,1-propene, 3-chloro,3-chloropropylene,3-chloropropene,chlorallylene,allylchlorid,2-propenyl chloride,1-chloro-2-propene,allylchloride |
| IUPAC Name | 3-chloroprop-1-ene |
| InChI Key | OSDWBNJEKMUWAV-UHFFFAOYSA-N |
| Molecular Formula | C3H5Cl |
Salbutamol hemisulfate, 98+%
CAS: 51022-70-9 Molecular Formula: C13H23NO7S Molecular Weight (g/mol): 337.387 MDL Number: MFCD00055200 InChI Key: OVICLFZZVQVVFT-UHFFFAOYSA-N Synonym: salbutamol sulfate,albuterol sulfate,ventolin,ventorlin,4-2-tert-butylamino-1-hydroxyethyl-2-hydroxymethyl phenol sulfate,asthavent,albuterol sulfate 1:x,salbutamol; sulfuric acid,asmaven sulfate,2-tert-butylamino-1-4-hydroxy-3-hydroxymethylphenyl ethanol hemisulfate PubChem CID: 9884233 IUPAC Name: 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;sulfuric acid SMILES: CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O.OS(=O)(=O)O
| PubChem CID | 9884233 |
|---|---|
| CAS | 51022-70-9 |
| Molecular Weight (g/mol) | 337.387 |
| MDL Number | MFCD00055200 |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O.OS(=O)(=O)O |
| Synonym | salbutamol sulfate,albuterol sulfate,ventolin,ventorlin,4-2-tert-butylamino-1-hydroxyethyl-2-hydroxymethyl phenol sulfate,asthavent,albuterol sulfate 1:x,salbutamol; sulfuric acid,asmaven sulfate,2-tert-butylamino-1-4-hydroxy-3-hydroxymethylphenyl ethanol hemisulfate |
| IUPAC Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;sulfuric acid |
| InChI Key | OVICLFZZVQVVFT-UHFFFAOYSA-N |
| Molecular Formula | C13H23NO7S |
2-Furoic acid, 98%
CAS: 88-14-2 MDL Number: MFCD00003238 InChI Key: SMNDYUVBFMFKNZ-UHFFFAOYSA-N Synonym: 2-furoic acid,2-furancarboxylic acid,pyromucic acid,2-carboxyfuran,furoic acid,furancarboxylic acid,alpha-furoic acid,alpha-furancarboxylic acid,2-furanoic acid,kyselina 2-furoova PubChem CID: 6919 ChEBI: CHEBI:30845 IUPAC Name: furan-2-carboxylic acid SMILES: C1=COC(=C1)C(=O)O
| PubChem CID | 6919 |
|---|---|
| CAS | 88-14-2 |
| ChEBI | CHEBI:30845 |
| MDL Number | MFCD00003238 |
| SMILES | C1=COC(=C1)C(=O)O |
| Synonym | 2-furoic acid,2-furancarboxylic acid,pyromucic acid,2-carboxyfuran,furoic acid,furancarboxylic acid,alpha-furoic acid,alpha-furancarboxylic acid,2-furanoic acid,kyselina 2-furoova |
| IUPAC Name | furan-2-carboxylic acid |
| InChI Key | SMNDYUVBFMFKNZ-UHFFFAOYSA-N |
2-Fluoro-1-methylpyridinium p-Toluenesulfonate 98.0+%, TCI America™
CAS: 58086-67-2 Molecular Formula: C13H14FNO3S Molecular Weight (g/mol): 283.317 MDL Number: MFCD00011983 InChI Key: HQWDKLAIDBOLFE-UHFFFAOYSA-M Synonym: 2-fluoro-1-methylpyridinium p-toluenesulfonate,2-fluoro-1-methylpyridin-1-ium 4-methylbenzenesulfonate,2-fluoro-1-methylpyridinium,mukaiyama's reagent,2-fluoro-1-methylpyridinium 4-toluenesulfonate,2-fluoro-1-methylpyridinium p-toluenesulphonate,2-fluoro-n-methylpyridinium toluene-4-sulfonate,2-fluoro-1-methylpyridin-1-ium tosylate,2-fluoro-n-methylpyridiniumtoluene-4-sulphonate,2-fluoro-1-methyl-pyridin-1-ium; 4-methylbenzenesulfonate PubChem CID: 171631 IUPAC Name: 2-fluoro-1-methylpyridin-1-ium;4-methylbenzenesulfonate SMILES: CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CC=CC=C1F
| PubChem CID | 171631 |
|---|---|
| CAS | 58086-67-2 |
| Molecular Weight (g/mol) | 283.317 |
| MDL Number | MFCD00011983 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CC=CC=C1F |
| Synonym | 2-fluoro-1-methylpyridinium p-toluenesulfonate,2-fluoro-1-methylpyridin-1-ium 4-methylbenzenesulfonate,2-fluoro-1-methylpyridinium,mukaiyama's reagent,2-fluoro-1-methylpyridinium 4-toluenesulfonate,2-fluoro-1-methylpyridinium p-toluenesulphonate,2-fluoro-n-methylpyridinium toluene-4-sulfonate,2-fluoro-1-methylpyridin-1-ium tosylate,2-fluoro-n-methylpyridiniumtoluene-4-sulphonate,2-fluoro-1-methyl-pyridin-1-ium; 4-methylbenzenesulfonate |
| IUPAC Name | 2-fluoro-1-methylpyridin-1-ium;4-methylbenzenesulfonate |
| InChI Key | HQWDKLAIDBOLFE-UHFFFAOYSA-M |
| Molecular Formula | C13H14FNO3S |
5-(N-2,3-Dihydroxypropylacetimido)-2,4,6-triiodo-N,N'-bis-(2,3-dihydroxypropyl)isophthalamide, MP Biomedicals™
CAS: 66108-95-0 Molecular Formula: C19H26I3N3O9 Molecular Weight (g/mol): 821.14 MDL Number: MFCD00077732 InChI Key: NTHXOOBQLCIOLC-UHFFFAOYNA-N Synonym: Nycodenz,Histodenz™
| CAS | 66108-95-0 |
|---|---|
| Molecular Weight (g/mol) | 821.14 |
| MDL Number | MFCD00077732 |
| Synonym | Nycodenz,Histodenz™ |
| InChI Key | NTHXOOBQLCIOLC-UHFFFAOYNA-N |
| Molecular Formula | C19H26I3N3O9 |
Diethyl methylmalonate, 99%
CAS: 609-08-5 Molecular Formula: C8H14O4 Molecular Weight (g/mol): 174.2 MDL Number: MFCD00009162 InChI Key: UPQZOUHVTJNGFK-UHFFFAOYSA-N Synonym: diethyl methylmalonate,methylmalonic acid diethyl ester,diethyl 2-methylmalonate,propanedioic acid, methyl-, diethyl ester,1,3-diethyl 2-methylpropanedioate,diethylmethylmalonate,ethyl methylmalonate,diethyl methylpropanedioate,malonic acid, methyl-, diethyl ester,2-methylmalonic acid diethyl PubChem CID: 11857 IUPAC Name: diethyl 2-methylpropanedioate SMILES: CCOC(=O)C(C)C(=O)OCC
| PubChem CID | 11857 |
|---|---|
| CAS | 609-08-5 |
| Molecular Weight (g/mol) | 174.2 |
| MDL Number | MFCD00009162 |
| SMILES | CCOC(=O)C(C)C(=O)OCC |
| Synonym | diethyl methylmalonate,methylmalonic acid diethyl ester,diethyl 2-methylmalonate,propanedioic acid, methyl-, diethyl ester,1,3-diethyl 2-methylpropanedioate,diethylmethylmalonate,ethyl methylmalonate,diethyl methylpropanedioate,malonic acid, methyl-, diethyl ester,2-methylmalonic acid diethyl |
| IUPAC Name | diethyl 2-methylpropanedioate |
| InChI Key | UPQZOUHVTJNGFK-UHFFFAOYSA-N |
| Molecular Formula | C8H14O4 |
DL-2-Aminobutyric acid, 99%
CAS: 2835-81-6 Molecular Formula: C4H9NO2 Molecular Weight (g/mol): 103.12 InChI Key: QWCKQJZIFLGMSD-UHFFFAOYSA-N Synonym: dl-2-aminobutyric acid,2-aminobutyric acid,alpha-aminobutyric acid,butanoic acid, 2-amino,butyrine,dl-2-amino-n-butyric acid,h-dl-abu-oh,aaba,dl-alpha-amino-n-butyric acid,alpha-amino-n-butyric acid PubChem CID: 6657 ChEBI: CHEBI:35621 IUPAC Name: 2-aminobutanoic acid SMILES: CCC(C(=O)O)N
| PubChem CID | 6657 |
|---|---|
| CAS | 2835-81-6 |
| Molecular Weight (g/mol) | 103.12 |
| ChEBI | CHEBI:35621 |
| SMILES | CCC(C(=O)O)N |
| Synonym | dl-2-aminobutyric acid,2-aminobutyric acid,alpha-aminobutyric acid,butanoic acid, 2-amino,butyrine,dl-2-amino-n-butyric acid,h-dl-abu-oh,aaba,dl-alpha-amino-n-butyric acid,alpha-amino-n-butyric acid |
| IUPAC Name | 2-aminobutanoic acid |
| InChI Key | QWCKQJZIFLGMSD-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO2 |
4-Nitrophenyl phosphate disodium salt hexahydrate, 5mg tablets, Thermo Scientific Chemicals
CAS: 4264-83-9 Molecular Formula: C6H4NNa2O6P Molecular Weight (g/mol): 263.05 MDL Number: MFCD00007319 InChI Key: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC Name: disodium;(4-nitrophenyl) phosphate SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
| PubChem CID | 77949 |
|---|---|
| CAS | 4264-83-9 |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| IUPAC Name | disodium;(4-nitrophenyl) phosphate |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Molecular Formula | C6H4NNa2O6P |
o-Toluenesulfonyl chloride, 80%
CAS: 133-59-5 Molecular Formula: C7H7ClO2S Molecular Weight (g/mol): 190.641 MDL Number: MFCD00024874 InChI Key: HDECRAPHCDXMIJ-UHFFFAOYSA-N Synonym: o-toluenesulfonyl chloride,2-methylbenzene-1-sulfonyl chloride,toluenesulfonyl chloride,benzenesulfonyl chloride, 2-methyl,2-toluenesulfonyl chloride,toluene-2-sulphonyl chloride,o-tolylsulfonyl chloride,o-tosyl chloride,unii-341l82e3wg,2-methyl-benzenesulfonyl chloride PubChem CID: 8623 IUPAC Name: 2-methylbenzenesulfonyl chloride SMILES: CC1=CC=CC=C1S(=O)(=O)Cl
| PubChem CID | 8623 |
|---|---|
| CAS | 133-59-5 |
| Molecular Weight (g/mol) | 190.641 |
| MDL Number | MFCD00024874 |
| SMILES | CC1=CC=CC=C1S(=O)(=O)Cl |
| Synonym | o-toluenesulfonyl chloride,2-methylbenzene-1-sulfonyl chloride,toluenesulfonyl chloride,benzenesulfonyl chloride, 2-methyl,2-toluenesulfonyl chloride,toluene-2-sulphonyl chloride,o-tolylsulfonyl chloride,o-tosyl chloride,unii-341l82e3wg,2-methyl-benzenesulfonyl chloride |
| IUPAC Name | 2-methylbenzenesulfonyl chloride |
| InChI Key | HDECRAPHCDXMIJ-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO2S |
Pyrene, 98%
CAS: 129-00-0 Molecular Formula: C16H10 Molecular Weight (g/mol): 202.256 MDL Number: MFCD00004136 InChI Key: BBEAQIROQSPTKN-UHFFFAOYSA-N Synonym: benzo def phenanthrene,pyren,beta-pyrene,.beta.-pyrene,pyren german,unii-9e0t7wfw93,ccris 1256,pyrene def phenanthrene,coal tar pitch volatiles:pyrene PubChem CID: 31423 ChEBI: CHEBI:39106 IUPAC Name: pyrene SMILES: C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2
| PubChem CID | 31423 |
|---|---|
| CAS | 129-00-0 |
| Molecular Weight (g/mol) | 202.256 |
| ChEBI | CHEBI:39106 |
| MDL Number | MFCD00004136 |
| SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
| Synonym | benzo def phenanthrene,pyren,beta-pyrene,.beta.-pyrene,pyren german,unii-9e0t7wfw93,ccris 1256,pyrene def phenanthrene,coal tar pitch volatiles:pyrene |
| IUPAC Name | pyrene |
| InChI Key | BBEAQIROQSPTKN-UHFFFAOYSA-N |
| Molecular Formula | C16H10 |
Pyridinium bromide perbromide, 90+%, technical
CAS: 39416-48-3 Molecular Formula: C5H6Br3N Molecular Weight (g/mol): 319.83 MDL Number: MFCD00013223 Synonym: Pyridine hydrobromide, compound with bromine
| CAS | 39416-48-3 |
|---|---|
| Molecular Weight (g/mol) | 319.83 |
| MDL Number | MFCD00013223 |
| Synonym | Pyridine hydrobromide, compound with bromine |
| Molecular Formula | C5H6Br3N |
1,8-Bis(dimethylamino)naphthalene, 98+%
CAS: 20734-58-1 Molecular Formula: C14H18N2 Molecular Weight (g/mol): 214.312 MDL Number: MFCD00003920 InChI Key: GJFNRSDCSTVPCJ-UHFFFAOYSA-N Synonym: 1,8-bis dimethylamino naphthalene,n1,n1,n8,n8-tetramethylnaphthalene-1,8-diamine,proton sponge,1,8-bis dimethylamino naphtalene,n,n,n',n'-tetramethyl-1,8-naphthalenediamine,proton-sponge,1,8-naphthalenediamine, n,n,n',n'-tetramethyl,unii-6s79d2p9h8,1,8-bis-dimethylamino naphthalene,n,n,n',n'-tetramethylnaphthalene-1,8-diamine PubChem CID: 88675 IUPAC Name: 1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine SMILES: CN(C)C1=CC=CC2=C1C(=CC=C2)N(C)C
| PubChem CID | 88675 |
|---|---|
| CAS | 20734-58-1 |
| Molecular Weight (g/mol) | 214.312 |
| MDL Number | MFCD00003920 |
| SMILES | CN(C)C1=CC=CC2=C1C(=CC=C2)N(C)C |
| Synonym | 1,8-bis dimethylamino naphthalene,n1,n1,n8,n8-tetramethylnaphthalene-1,8-diamine,proton sponge,1,8-bis dimethylamino naphtalene,n,n,n',n'-tetramethyl-1,8-naphthalenediamine,proton-sponge,1,8-naphthalenediamine, n,n,n',n'-tetramethyl,unii-6s79d2p9h8,1,8-bis-dimethylamino naphthalene,n,n,n',n'-tetramethylnaphthalene-1,8-diamine |
| IUPAC Name | 1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine |
| InChI Key | GJFNRSDCSTVPCJ-UHFFFAOYSA-N |
| Molecular Formula | C14H18N2 |
1,4-Dithioerythritol, 98+%
CAS: 6892-68-8 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 MDL Number: MFCD00063750 InChI Key: VHJLVAABSRFDPM-ZXZARUISSA-N Synonym: dithioerythritol,1,4-dithioerythritol,dte,2r,3s-1,4-dimercaptobutane-2,3-diol,erythro-1,4-dimercapto-2,3-butanediol,2,3-butanediol, 1,4-dimercapto-, 2r,3s-rel,1,4-dithioerythritol dte,2r*,3s*-1,4-dimercapto-2,3-butanediol,erythro-2,3-dihydroxy-1,4-butanedithiol,2r,3s-1,4-disulfanylbutane-2,3-diol PubChem CID: 439352 ChEBI: CHEBI:17456 SMILES: O[C@@H](CS)[C@H](O)CS
| PubChem CID | 439352 |
|---|---|
| CAS | 6892-68-8 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:17456 |
| MDL Number | MFCD00063750 |
| SMILES | O[C@@H](CS)[C@H](O)CS |
| Synonym | dithioerythritol,1,4-dithioerythritol,dte,2r,3s-1,4-dimercaptobutane-2,3-diol,erythro-1,4-dimercapto-2,3-butanediol,2,3-butanediol, 1,4-dimercapto-, 2r,3s-rel,1,4-dithioerythritol dte,2r*,3s*-1,4-dimercapto-2,3-butanediol,erythro-2,3-dihydroxy-1,4-butanedithiol,2r,3s-1,4-disulfanylbutane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-ZXZARUISSA-N |
| Molecular Formula | C4H10O2S2 |
Polyethylene, low density, ∣<400 micron
CAS: 9002-88-4 Molecular Formula: (C2H4)n Molecular Weight (g/mol): 28.05 MDL Number: MFCD00084423 InChI Key: VGGSQFUCUMXWEO-UHFFFAOYSA-N Synonym: ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore PubChem CID: 6325 ChEBI: CHEBI:18153 IUPAC Name: ethene SMILES: *-CC-*
| PubChem CID | 6325 |
|---|---|
| CAS | 9002-88-4 |
| Molecular Weight (g/mol) | 28.05 |
| ChEBI | CHEBI:18153 |
| MDL Number | MFCD00084423 |
| SMILES | *-CC-* |
| Synonym | ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore |
| IUPAC Name | ethene |
| InChI Key | VGGSQFUCUMXWEO-UHFFFAOYSA-N |
| Molecular Formula | (C2H4)n |
2-[3,4-(Methylenedioxy)phenyl]ethylamine, 95%
CAS: 1484-85-1 Molecular Formula: C9H11NO2 Molecular Weight (g/mol): 165.192 MDL Number: MFCD00060509 InChI Key: RRIRDPSOCUCGBV-UHFFFAOYSA-N Synonym: homopiperonylamine,3,4-methylenedioxyphenethylamine,methylenedioxyphenethylamine,1,3-benzodioxole-5-ethanamine,2-1,3-benzodioxol-5-yl ethanamine,2-benzo d 1,3 dioxol-5-yl ethanamine,methylenedioxyphenylethylamine,benzo-1,3-dioxole-5-ethylamine,3,4-methylenedioxyphenyl ethylamine,phenethylamine, 3,4-methylenedioxy PubChem CID: 73874 IUPAC Name: 2-(1,3-benzodioxol-5-yl)ethanamine SMILES: C1OC2=C(O1)C=C(C=C2)CCN
| PubChem CID | 73874 |
|---|---|
| CAS | 1484-85-1 |
| Molecular Weight (g/mol) | 165.192 |
| MDL Number | MFCD00060509 |
| SMILES | C1OC2=C(O1)C=C(C=C2)CCN |
| Synonym | homopiperonylamine,3,4-methylenedioxyphenethylamine,methylenedioxyphenethylamine,1,3-benzodioxole-5-ethanamine,2-1,3-benzodioxol-5-yl ethanamine,2-benzo d 1,3 dioxol-5-yl ethanamine,methylenedioxyphenylethylamine,benzo-1,3-dioxole-5-ethylamine,3,4-methylenedioxyphenyl ethylamine,phenethylamine, 3,4-methylenedioxy |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)ethanamine |
| InChI Key | RRIRDPSOCUCGBV-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO2 |