Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Methyl 2-methoxy-5-nitrobenzoate, 98%
CAS: 34841-11-7 Molecular Formula: C9H9NO5 Molecular Weight (g/mol): 211.173 MDL Number: MFCD00673023 InChI Key: DOBFJVVTBNTGCW-UHFFFAOYSA-N Synonym: 2-methoxy-5-nitrobenzoic acid methyl ester,methyl2-methoxy-5-nitrobenzoate,methyl-2-methoxy-5-nitrobenzoate,5-nitro-o-anisic acid methyl ester,pubchem14052,acmc-1adrt,methyl 5-nitro-o-anisate,asischem d13383,rarechem al bf 0877,timtec-bb sbb014757 PubChem CID: 7020925 IUPAC Name: methyl 2-methoxy-5-nitrobenzoate SMILES: COC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)OC
| PubChem CID | 7020925 |
|---|---|
| CAS | 34841-11-7 |
| Molecular Weight (g/mol) | 211.173 |
| MDL Number | MFCD00673023 |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)OC |
| Synonym | 2-methoxy-5-nitrobenzoic acid methyl ester,methyl2-methoxy-5-nitrobenzoate,methyl-2-methoxy-5-nitrobenzoate,5-nitro-o-anisic acid methyl ester,pubchem14052,acmc-1adrt,methyl 5-nitro-o-anisate,asischem d13383,rarechem al bf 0877,timtec-bb sbb014757 |
| IUPAC Name | methyl 2-methoxy-5-nitrobenzoate |
| InChI Key | DOBFJVVTBNTGCW-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO5 |
4-Amino-3-nitrobenzoic acid, 98%, Thermo Scientific™
CAS: 1588-83-6 Molecular Formula: C7H6N2O4 Molecular Weight (g/mol): 182.14 MDL Number: MFCD00017009 InChI Key: ZZNAYFWAXZJITH-UHFFFAOYSA-N Synonym: 4-amino-3-nitrobenzoic acid,3-nitro-4-aminobenzoic acid,benzoic acid, 4-amino-3-nitro,4-carboxy-2-nitroaniline,3-nitro-4-aminobenozic acid,4-amino-3-nitro-benzoic acid,4-amino-3-nitrobenzoicacid,pubchem4982,rarechem al bo 0261,2-nitro-4-carboxyaniline PubChem CID: 74115 SMILES: C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N
| PubChem CID | 74115 |
|---|---|
| CAS | 1588-83-6 |
| Molecular Weight (g/mol) | 182.14 |
| MDL Number | MFCD00017009 |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N |
| Synonym | 4-amino-3-nitrobenzoic acid,3-nitro-4-aminobenzoic acid,benzoic acid, 4-amino-3-nitro,4-carboxy-2-nitroaniline,3-nitro-4-aminobenozic acid,4-amino-3-nitro-benzoic acid,4-amino-3-nitrobenzoicacid,pubchem4982,rarechem al bo 0261,2-nitro-4-carboxyaniline |
| InChI Key | ZZNAYFWAXZJITH-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2O4 |
2-Chloro-3-nitrobenzoic acid, 98%
CAS: 3970-35-2 Molecular Formula: C7H4ClNO4 Molecular Weight (g/mol): 201.562 MDL Number: MFCD00007069 InChI Key: JRQDVRIQJJPHEQ-UHFFFAOYSA-N Synonym: 2-chloro-3-nitrobenzoic acid,2-chloro-3-nitro-benzoic acid,2-chloro-3-nitrobenzoicacid,benzoic acid, 2-chloro-3-nitro,2-chloro-3-carboxynitrobenzene,nitrochlorbenzoesaure,pubchem2100,acmc-1ctvl,2-chloro-3-nitrobenzic acid,2-chloro-3-nitrobezoic acid PubChem CID: 19870 SMILES: C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C(=O)O
| PubChem CID | 19870 |
|---|---|
| CAS | 3970-35-2 |
| Molecular Weight (g/mol) | 201.562 |
| MDL Number | MFCD00007069 |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C(=O)O |
| Synonym | 2-chloro-3-nitrobenzoic acid,2-chloro-3-nitro-benzoic acid,2-chloro-3-nitrobenzoicacid,benzoic acid, 2-chloro-3-nitro,2-chloro-3-carboxynitrobenzene,nitrochlorbenzoesaure,pubchem2100,acmc-1ctvl,2-chloro-3-nitrobenzic acid,2-chloro-3-nitrobezoic acid |
| InChI Key | JRQDVRIQJJPHEQ-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO4 |
3-Amino-5-nitrobenzoic acid, 98%
CAS: 618-84-8 Molecular Formula: C7H6N2O4 Molecular Weight (g/mol): 182.135 MDL Number: MFCD00017025 InChI Key: ZNVHAQRPXAQKRU-UHFFFAOYSA-N Synonym: 3-amino-5-nitrobenzoic acid,3-amino-5-nitro-benzoic acid,benzoic acid, 3-amino-5-nitro,3-amino-5-nitrobenzoicacid,5-amino-3-nitrobenzoic acid,acmc-20ana2,3-nitro-5-aminobenzoic acid,5-nitro-3-aminobenzoic acid,benzoic acid,3-amino-5-nitro,3-amino-5-nitrobenzoic acid 1g PubChem CID: 239342 SMILES: C1=C(C=C(C=C1N)[N+](=O)[O-])C(=O)O
| PubChem CID | 239342 |
|---|---|
| CAS | 618-84-8 |
| Molecular Weight (g/mol) | 182.135 |
| MDL Number | MFCD00017025 |
| SMILES | C1=C(C=C(C=C1N)[N+](=O)[O-])C(=O)O |
| Synonym | 3-amino-5-nitrobenzoic acid,3-amino-5-nitro-benzoic acid,benzoic acid, 3-amino-5-nitro,3-amino-5-nitrobenzoicacid,5-amino-3-nitrobenzoic acid,acmc-20ana2,3-nitro-5-aminobenzoic acid,5-nitro-3-aminobenzoic acid,benzoic acid,3-amino-5-nitro,3-amino-5-nitrobenzoic acid 1g |
| InChI Key | ZNVHAQRPXAQKRU-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2O4 |
Methyl 2-chloro-4-nitrobenzoate, 98%, Thermo Scientific™
CAS: 13324-11-3 Molecular Formula: C8H6ClNO4 Molecular Weight (g/mol): 215.59 MDL Number: MFCD00017013 InChI Key: PICNSXCJRMYANX-UHFFFAOYSA-N Synonym: 2-chloro-4-nitrobenzoic acid methyl ester,methyl2-chloro-4-nitrobenzoate,4-nitro-2-chlorobenzoic acid methyl ester,2-chloro-4-nitro-benzoic acid methyl ester,benzoic acid, 2-chloro-4-nitro-, methyl ester,maybridge1_005088,acmc-1c12v,methyl-2-chloro-4-nitrobenzoate,methyl-4-nitro-2-chlorobenzoate,2-chloro-4-nitrobenzoic acid methylester PubChem CID: 83343 IUPAC Name: methyl 2-chloro-4-nitrobenzoate SMILES: COC(=O)C1=CC=C(C=C1Cl)[N+]([O-])=O
| PubChem CID | 83343 |
|---|---|
| CAS | 13324-11-3 |
| Molecular Weight (g/mol) | 215.59 |
| MDL Number | MFCD00017013 |
| SMILES | COC(=O)C1=CC=C(C=C1Cl)[N+]([O-])=O |
| Synonym | 2-chloro-4-nitrobenzoic acid methyl ester,methyl2-chloro-4-nitrobenzoate,4-nitro-2-chlorobenzoic acid methyl ester,2-chloro-4-nitro-benzoic acid methyl ester,benzoic acid, 2-chloro-4-nitro-, methyl ester,maybridge1_005088,acmc-1c12v,methyl-2-chloro-4-nitrobenzoate,methyl-4-nitro-2-chlorobenzoate,2-chloro-4-nitrobenzoic acid methylester |
| IUPAC Name | methyl 2-chloro-4-nitrobenzoate |
| InChI Key | PICNSXCJRMYANX-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClNO4 |
3-Nitrosalicylic acid, 98%
CAS: 85-38-1 Molecular Formula: C7H5NO5 Molecular Weight (g/mol): 183.12 InChI Key: WWWFHFGUOIQNJC-UHFFFAOYSA-N Synonym: 3-nitrosalicylic acid,2-hydroxy-3-nitrobenzoic acid,benzoic acid, 2-hydroxy-3-nitro,salicylic acid, 3-nitro,2-hydroxy-3-nitro-benzoic acid,3-nitro-salicylsaure,3-nitrosalicyclic acid,wln: wnr bq cvq,acmc-209q5q PubChem CID: 6807 SMILES: C1=CC(=C(C(=C1)[N+](=O)[O-])O)C(=O)O
| PubChem CID | 6807 |
|---|---|
| CAS | 85-38-1 |
| Molecular Weight (g/mol) | 183.12 |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])O)C(=O)O |
| Synonym | 3-nitrosalicylic acid,2-hydroxy-3-nitrobenzoic acid,benzoic acid, 2-hydroxy-3-nitro,salicylic acid, 3-nitro,2-hydroxy-3-nitro-benzoic acid,3-nitro-salicylsaure,3-nitrosalicyclic acid,wln: wnr bq cvq,acmc-209q5q |
| InChI Key | WWWFHFGUOIQNJC-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO5 |
Methyl 2-hydroxy-3-nitrobenzoate, 98%
CAS: 22621-41-6 Molecular Formula: C8H7NO5 Molecular Weight (g/mol): 197.146 MDL Number: MFCD00272263 InChI Key: NIBVYEHAFBEVFI-UHFFFAOYSA-N Synonym: methyl 2-hydroxy-3-nitrobenzoate,methyl 3-nitrosalicylate,benzoic acid, 2-hydroxy-3-nitro-, methyl ester,2-hydroxy-3-nitrobenzoic acid methyl ester,2-hydroxy-3-nitro-benzoic acid methyl ester,salicylic acid, 3-nitro-, methyl ester,methyl-3-nitrosalicylat,methyl-m-nitrosalicylate,acmc-209fxo,ksc490c4l PubChem CID: 596904 SMILES: COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])O
| PubChem CID | 596904 |
|---|---|
| CAS | 22621-41-6 |
| Molecular Weight (g/mol) | 197.146 |
| MDL Number | MFCD00272263 |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])O |
| Synonym | methyl 2-hydroxy-3-nitrobenzoate,methyl 3-nitrosalicylate,benzoic acid, 2-hydroxy-3-nitro-, methyl ester,2-hydroxy-3-nitrobenzoic acid methyl ester,2-hydroxy-3-nitro-benzoic acid methyl ester,salicylic acid, 3-nitro-, methyl ester,methyl-3-nitrosalicylat,methyl-m-nitrosalicylate,acmc-209fxo,ksc490c4l |
| InChI Key | NIBVYEHAFBEVFI-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO5 |
5-Nitro-2-(3-phenylpropylamino)benzoic acid, 98%
CAS: 107254-86-4 Molecular Formula: C16H16N2O4 Molecular Weight (g/mol): 300.31 MDL Number: MFCD00153851 InChI Key: WBSMIPAMAXNXFS-UHFFFAOYSA-N Synonym: nppb,5-nitro-2-3-phenylpropylamino benzoic acid,unii-3a35o9g3yz,5-nitro-2-3-phenylpropyl amino benzoic acid,benzoic acid,5-nitro-2-3-phenylpropyl amino,benzoic acid, 5-nitro-2-3-phenylpropyl amino,5-nitro-2-3-phenylpropylamino-benzoic acid,5-nitro-2-phenylpropylaminobenzoic acid nppb,5-nitro-2-3-phenylpropylamino benzoic acid nppb,spectrum_001814 PubChem CID: 4549 ChEBI: CHEBI:34457 IUPAC Name: 5-nitro-2-[(3-phenylpropyl)amino]benzoic acid SMILES: OC(=O)C1=CC(=CC=C1NCCCC1=CC=CC=C1)[N+]([O-])=O
| PubChem CID | 4549 |
|---|---|
| CAS | 107254-86-4 |
| Molecular Weight (g/mol) | 300.31 |
| ChEBI | CHEBI:34457 |
| MDL Number | MFCD00153851 |
| SMILES | OC(=O)C1=CC(=CC=C1NCCCC1=CC=CC=C1)[N+]([O-])=O |
| Synonym | nppb,5-nitro-2-3-phenylpropylamino benzoic acid,unii-3a35o9g3yz,5-nitro-2-3-phenylpropyl amino benzoic acid,benzoic acid,5-nitro-2-3-phenylpropyl amino,benzoic acid, 5-nitro-2-3-phenylpropyl amino,5-nitro-2-3-phenylpropylamino-benzoic acid,5-nitro-2-phenylpropylaminobenzoic acid nppb,5-nitro-2-3-phenylpropylamino benzoic acid nppb,spectrum_001814 |
| IUPAC Name | 5-nitro-2-[(3-phenylpropyl)amino]benzoic acid |
| InChI Key | WBSMIPAMAXNXFS-UHFFFAOYSA-N |
| Molecular Formula | C16H16N2O4 |
2-Nitrobenzoic acid, 95%
CAS: 552-16-9 Molecular Formula: C7H5NO4 Molecular Weight (g/mol): 167.12 MDL Number: MFCD00007137 InChI Key: SLAMLWHELXOEJZ-UHFFFAOYSA-N Synonym: 2-nitrobenzoic acid,o-nitrobenzoic acid,benzoic acid, 2-nitro,2-nitrobenzoicacid,o-carboxynitrobenzene,benzoic acid, o-nitro,nitrobenzoic acid,2-nitro-benzoic acid,ccris 2334,2-nitro benzoic acid PubChem CID: 11087 ChEBI: CHEBI:25620 SMILES: C1=CC=C(C(=C1)C(=O)O)[N+](=O)[O-]
| PubChem CID | 11087 |
|---|---|
| CAS | 552-16-9 |
| Molecular Weight (g/mol) | 167.12 |
| ChEBI | CHEBI:25620 |
| MDL Number | MFCD00007137 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)[N+](=O)[O-] |
| Synonym | 2-nitrobenzoic acid,o-nitrobenzoic acid,benzoic acid, 2-nitro,2-nitrobenzoicacid,o-carboxynitrobenzene,benzoic acid, o-nitro,nitrobenzoic acid,2-nitro-benzoic acid,ccris 2334,2-nitro benzoic acid |
| InChI Key | SLAMLWHELXOEJZ-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO4 |
2-Chloro-5-nitrobenzoic acid, 98+%
CAS: 2516-96-3 Molecular Formula: C7H4ClNO4 Molecular Weight (g/mol): 201.562 MDL Number: MFCD00007294 InChI Key: QUEKGYQTRJVEQC-UHFFFAOYSA-N Synonym: 2-chloro-5-nitrobenzoic acid,benzoic acid, 2-chloro-5-nitro,6-chloro-3-nitrobenzoic acid,2-chloro-5-nitro-benzoic acid,2-chloro-5-nitrobenzoicacid,mesalamine impurity m,pubchem13682,acmc-1cb0i,2-chloro-5-nitrobenzic acid,5-nitro-2-chlorobenzoic acid PubChem CID: 17287 SMILES: C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl
| PubChem CID | 17287 |
|---|---|
| CAS | 2516-96-3 |
| Molecular Weight (g/mol) | 201.562 |
| MDL Number | MFCD00007294 |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl |
| Synonym | 2-chloro-5-nitrobenzoic acid,benzoic acid, 2-chloro-5-nitro,6-chloro-3-nitrobenzoic acid,2-chloro-5-nitro-benzoic acid,2-chloro-5-nitrobenzoicacid,mesalamine impurity m,pubchem13682,acmc-1cb0i,2-chloro-5-nitrobenzic acid,5-nitro-2-chlorobenzoic acid |
| InChI Key | QUEKGYQTRJVEQC-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO4 |
4-Nitrophthalic acid, 97%
CAS: 610-27-5 Molecular Formula: C8H5NO6 Molecular Weight (g/mol): 211.129 MDL Number: MFCD00007252 InChI Key: SLBQXWXKPNIVSQ-UHFFFAOYSA-N Synonym: 4-nitrophthalic acid,5-nitrophthalic acid,4-nitrobenzene-1,2-dicarboxylic acid,1,2-benzenedicarboxylic acid, 4-nitro,phthalic acid, 4-nitro,4-nitrophthalicacid,p-nitrophthalic acid,4-nitro-phthalic acid,acmc-209mo8 PubChem CID: 69121 SMILES: C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)C(=O)O
| PubChem CID | 69121 |
|---|---|
| CAS | 610-27-5 |
| Molecular Weight (g/mol) | 211.129 |
| MDL Number | MFCD00007252 |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)C(=O)O |
| Synonym | 4-nitrophthalic acid,5-nitrophthalic acid,4-nitrobenzene-1,2-dicarboxylic acid,1,2-benzenedicarboxylic acid, 4-nitro,phthalic acid, 4-nitro,4-nitrophthalicacid,p-nitrophthalic acid,4-nitro-phthalic acid,acmc-209mo8 |
| InChI Key | SLBQXWXKPNIVSQ-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO6 |
4-Methoxy-3-nitrobenzoic acid, 98%, Thermo Scientific™
CAS: 89-41-8 Molecular Formula: C8H7NO5 Molecular Weight (g/mol): 197.15 MDL Number: MFCD00007256 InChI Key: ANXBDAFDZSXOPQ-UHFFFAOYSA-N Synonym: 4-methoxy-3-nitrobenzoic acid,3-nitro-4-methoxybenzoic acid,3-nitro-p-anisic acid,benzoic acid, 4-methoxy-3-nitro,unii-dd71o31olz,p-anisic acid, 3-nitro,dd71o31olz,4-methoxy-3-nitro benzoic acid,4-methoxy-3-nitro-benzoic acid,4-methoxy-3-nitrobenzoicacid PubChem CID: 66640 SMILES: COC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
| PubChem CID | 66640 |
|---|---|
| CAS | 89-41-8 |
| Molecular Weight (g/mol) | 197.15 |
| MDL Number | MFCD00007256 |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
| Synonym | 4-methoxy-3-nitrobenzoic acid,3-nitro-4-methoxybenzoic acid,3-nitro-p-anisic acid,benzoic acid, 4-methoxy-3-nitro,unii-dd71o31olz,p-anisic acid, 3-nitro,dd71o31olz,4-methoxy-3-nitro benzoic acid,4-methoxy-3-nitro-benzoic acid,4-methoxy-3-nitrobenzoicacid |
| InChI Key | ANXBDAFDZSXOPQ-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO5 |
5-Amino-2-nitrobenzoic acid, 95%
CAS: 13280-60-9 Molecular Formula: C7H6N2O4 Molecular Weight (g/mol): 182.135 MDL Number: MFCD00035748 InChI Key: KZZWQCKYLNIOBT-UHFFFAOYSA-N Synonym: 5-amino-2-nitrobenzoic acid,2-nitro-5-aminobenzoic acid,benzoic acid, 5-amino-2-nitro,3-carboxy-4-nitroaniline,5-amino-2-nitro-benzoic acid,pubchem4983,acmc-1bxcb,intermediates-zcf02020,5-amino-2-nitrobenzoicacid,6-nitro-m-anthranilic acid PubChem CID: 83298 SMILES: C1=CC(=C(C=C1N)C(=O)O)[N+](=O)[O-]
| PubChem CID | 83298 |
|---|---|
| CAS | 13280-60-9 |
| Molecular Weight (g/mol) | 182.135 |
| MDL Number | MFCD00035748 |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)[N+](=O)[O-] |
| Synonym | 5-amino-2-nitrobenzoic acid,2-nitro-5-aminobenzoic acid,benzoic acid, 5-amino-2-nitro,3-carboxy-4-nitroaniline,5-amino-2-nitro-benzoic acid,pubchem4983,acmc-1bxcb,intermediates-zcf02020,5-amino-2-nitrobenzoicacid,6-nitro-m-anthranilic acid |
| InChI Key | KZZWQCKYLNIOBT-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2O4 |
3,4-Dinitrobenzoic acid, 98+%
CAS: 528-45-0 Molecular Formula: C7H4N2O6 Molecular Weight (g/mol): 212.12 MDL Number: MFCD00007255 InChI Key: OMVRRHJJQILIJX-UHFFFAOYSA-N Synonym: 3,4-dinitrobenzoic acid,benzoic acid, 3,4-dinitro,unii-0l3n4t0gpd,ccris 3128,3,4-dinitrobenzioc acid,0l3n4t0gpd,3,4-dinitrobenzoate,3,4-di-nitro-benzoic acid,zlchem 522,pubchem4956 PubChem CID: 10709 IUPAC Name: 3,4-dinitrobenzoic acid SMILES: OC(=O)C1=CC=C(C(=C1)[N+]([O-])=O)[N+]([O-])=O
| PubChem CID | 10709 |
|---|---|
| CAS | 528-45-0 |
| Molecular Weight (g/mol) | 212.12 |
| MDL Number | MFCD00007255 |
| SMILES | OC(=O)C1=CC=C(C(=C1)[N+]([O-])=O)[N+]([O-])=O |
| Synonym | 3,4-dinitrobenzoic acid,benzoic acid, 3,4-dinitro,unii-0l3n4t0gpd,ccris 3128,3,4-dinitrobenzioc acid,0l3n4t0gpd,3,4-dinitrobenzoate,3,4-di-nitro-benzoic acid,zlchem 522,pubchem4956 |
| IUPAC Name | 3,4-dinitrobenzoic acid |
| InChI Key | OMVRRHJJQILIJX-UHFFFAOYSA-N |
| Molecular Formula | C7H4N2O6 |
Loperamide hydrochloride, 98+%
CAS: 34552-83-5 Molecular Formula: C29H34Cl2N2O2 Molecular Weight (g/mol): 513.503 MDL Number: MFCD00058581 InChI Key: PGYPOBZJRVSMDS-UHFFFAOYSA-N Synonym: loperamide hydrochloride,loperamide hcl,imodium,suprasec,dissenten,fortasec,lopemid,lopemin,loperyl,imosec PubChem CID: 71420 ChEBI: CHEBI:6533 IUPAC Name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide;hydrochloride SMILES: CN(C)C(=O)C(CCN1CCC(CC1)(C2=CC=C(C=C2)Cl)O)(C3=CC=CC=C3)C4=CC=CC=C4.Cl
| PubChem CID | 71420 |
|---|---|
| CAS | 34552-83-5 |
| Molecular Weight (g/mol) | 513.503 |
| ChEBI | CHEBI:6533 |
| MDL Number | MFCD00058581 |
| SMILES | CN(C)C(=O)C(CCN1CCC(CC1)(C2=CC=C(C=C2)Cl)O)(C3=CC=CC=C3)C4=CC=CC=C4.Cl |
| Synonym | loperamide hydrochloride,loperamide hcl,imodium,suprasec,dissenten,fortasec,lopemid,lopemin,loperyl,imosec |
| IUPAC Name | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide;hydrochloride |
| InChI Key | PGYPOBZJRVSMDS-UHFFFAOYSA-N |
| Molecular Formula | C29H34Cl2N2O2 |