Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Tributyl phosphate, 99+%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
Maleic anhydride, 98+%
CAS: 108-31-6 Molecular Formula: C4H2O3 Molecular Weight (g/mol): 98.06 MDL Number: MFCD00005518 InChI Key: FPYJFEHAWHCUMM-UHFFFAOYSA-N Synonym: maleic anhydride,2,5-furandione,maleic acid anhydride,toxilic anhydride,dihydro-2,5-dioxofuran,cis-butenedioic anhydride,2,5-dihydrofuran-2,5-dione,polymaleic anhydride,maleinanhydrid,rcra waste number u147 PubChem CID: 7923 ChEBI: CHEBI:474859 IUPAC Name: furan-2,5-dione SMILES: O=C1OC(=O)C=C1
| PubChem CID | 7923 |
|---|---|
| CAS | 108-31-6 |
| Molecular Weight (g/mol) | 98.06 |
| ChEBI | CHEBI:474859 |
| MDL Number | MFCD00005518 |
| SMILES | O=C1OC(=O)C=C1 |
| Synonym | maleic anhydride,2,5-furandione,maleic acid anhydride,toxilic anhydride,dihydro-2,5-dioxofuran,cis-butenedioic anhydride,2,5-dihydrofuran-2,5-dione,polymaleic anhydride,maleinanhydrid,rcra waste number u147 |
| IUPAC Name | furan-2,5-dione |
| InChI Key | FPYJFEHAWHCUMM-UHFFFAOYSA-N |
| Molecular Formula | C4H2O3 |
Maleic anhydride, 99%, pastilles
CAS: 108-31-6 Molecular Formula: C4H2O3 Molecular Weight (g/mol): 98.06 MDL Number: MFCD00005518 InChI Key: FPYJFEHAWHCUMM-UHFFFAOYSA-N Synonym: maleic anhydride,2,5-furandione,maleic acid anhydride,toxilic anhydride,dihydro-2,5-dioxofuran,cis-butenedioic anhydride,2,5-dihydrofuran-2,5-dione,polymaleic anhydride,maleinanhydrid,rcra waste number u147 PubChem CID: 7923 ChEBI: CHEBI:474859 SMILES: O=C1OC(=O)C=C1
| PubChem CID | 7923 |
|---|---|
| CAS | 108-31-6 |
| Molecular Weight (g/mol) | 98.06 |
| ChEBI | CHEBI:474859 |
| MDL Number | MFCD00005518 |
| SMILES | O=C1OC(=O)C=C1 |
| Synonym | maleic anhydride,2,5-furandione,maleic acid anhydride,toxilic anhydride,dihydro-2,5-dioxofuran,cis-butenedioic anhydride,2,5-dihydrofuran-2,5-dione,polymaleic anhydride,maleinanhydrid,rcra waste number u147 |
| InChI Key | FPYJFEHAWHCUMM-UHFFFAOYSA-N |
| Molecular Formula | C4H2O3 |
p-Toluenesulfonyl chloride, 99+%
CAS: 98-59-9 Molecular Formula: C7H7ClO2S Molecular Weight (g/mol): 190.64 MDL Number: MFCD00007450 InChI Key: YYROPELSRYBVMQ-UHFFFAOYSA-N Synonym: tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride PubChem CID: 7397 IUPAC Name: 4-methylbenzenesulfonyl chloride SMILES: CC1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 7397 |
|---|---|
| CAS | 98-59-9 |
| Molecular Weight (g/mol) | 190.64 |
| MDL Number | MFCD00007450 |
| SMILES | CC1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride |
| IUPAC Name | 4-methylbenzenesulfonyl chloride |
| InChI Key | YYROPELSRYBVMQ-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO2S |
Isopropyl acetate, 99+%
CAS: 108-21-4 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00008877 InChI Key: JMMWKPVZQRWMSS-UHFFFAOYSA-N Synonym: isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester PubChem CID: 7915 IUPAC Name: propan-2-yl acetate SMILES: CC(C)OC(=O)C
| PubChem CID | 7915 |
|---|---|
| CAS | 108-21-4 |
| Molecular Weight (g/mol) | 102.133 |
| MDL Number | MFCD00008877 |
| SMILES | CC(C)OC(=O)C |
| Synonym | isopropyl acetate,2-propyl acetate,2-acetoxypropane,acetic acid, 1-methylethyl ester,isopropyl ethanoate,isopropylacetat,paracetat,isopropylacetaat,1-methylethyl acetate,acetic acid, isopropyl ester |
| IUPAC Name | propan-2-yl acetate |
| InChI Key | JMMWKPVZQRWMSS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Poly(ethylene glycol), average M.W. 400
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Berberine chloride
CAS: 633-65-8 Molecular Formula: C20H18ClNO4 Molecular Weight (g/mol): 371.817 MDL Number: MFCD00011939 InChI Key: VKJGBAJNNALVAV-UHFFFAOYSA-M Synonym: berberine chloride,berberine hydrochloride,natural yellow 18,benzodioxide,berberinium chloride,berberine hcl,unii-uot4o1byv8,berberine chloride jan,uot4o1byv8 PubChem CID: 12456 ChEBI: CHEBI:31271 SMILES: COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-]
| PubChem CID | 12456 |
|---|---|
| CAS | 633-65-8 |
| Molecular Weight (g/mol) | 371.817 |
| ChEBI | CHEBI:31271 |
| MDL Number | MFCD00011939 |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
| Synonym | berberine chloride,berberine hydrochloride,natural yellow 18,benzodioxide,berberinium chloride,berberine hcl,unii-uot4o1byv8,berberine chloride jan,uot4o1byv8 |
| InChI Key | VKJGBAJNNALVAV-UHFFFAOYSA-M |
| Molecular Formula | C20H18ClNO4 |
Poly(ethylene oxide), approx. M.W. 600,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEO IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
n-Butyllithium, 1.6M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00009414 InChI Key: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| PubChem CID | 61028 |
|---|---|
| CAS | 109-72-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00009414 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| InChI Key | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |
Thermo Scientific Chemicals Thiazolyl Blue tetrazolium bromide, 98%
CAS: 298-93-1 Molecular Formula: C18H16BrN5S Molecular Weight (g/mol): 414.33 MDL Number: MFCD00011964,MFCD00066662 InChI Key: AZKSAVLVSZKNRD-UHFFFAOYSA-M Synonym: thiazolyl blue,thiazolyl blue tetrazolium bromide,mmt tetrazolium,methylthiazoletetrazolium,mtt,thiazolyl blue monotetrazolium,thiazole blue,3-4,5-dimethylthiazol-2-yl-2,5-diphenyltetrazolium bromide,mtt van,unii-euy85h477i PubChem CID: 64965 ChEBI: CHEBI:53233 IUPAC Name: 2-(3,5-diphenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole;bromide SMILES: [Br-].CC1=C(C)N=C(S1)[N+]1=NC(=NN1C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 64965 |
|---|---|
| CAS | 298-93-1 |
| Molecular Weight (g/mol) | 414.33 |
| ChEBI | CHEBI:53233 |
| MDL Number | MFCD00011964,MFCD00066662 |
| SMILES | [Br-].CC1=C(C)N=C(S1)[N+]1=NC(=NN1C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | thiazolyl blue,thiazolyl blue tetrazolium bromide,mmt tetrazolium,methylthiazoletetrazolium,mtt,thiazolyl blue monotetrazolium,thiazole blue,3-4,5-dimethylthiazol-2-yl-2,5-diphenyltetrazolium bromide,mtt van,unii-euy85h477i |
| IUPAC Name | 2-(3,5-diphenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole;bromide |
| InChI Key | AZKSAVLVSZKNRD-UHFFFAOYSA-M |
| Molecular Formula | C18H16BrN5S |
| CAS | 9004-34-6 |
|---|---|
| MDL Number | MFCD00081512 |
Thermo Scientific Chemicals Glyoxal, pure, 40 wt.% solution in water
CAS: 107-22-2 | C2H2O2 | 58.04 g/mol
| Viscosity | 8 mPa.s (20°C) |
|---|---|
| Linear Formula | HCOCHO |
| Molecular Weight (g/mol) | 58.04 |
| ChEBI | CHEBI:34779 |
| InChI Key | LEQAOMBKQFMDFZ-UHFFFAOYSA-N |
| Density | 1.2650g/mL |
| PubChem CID | 7860 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 39 to 41% (Titrimetry other) |
| Fieser | 01,413 |
| Formula Weight | 58.04 |
| Melting Point | -14.0°C |
| Boiling Point | 104.0°C |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Glyoxal |
| Grade | Pure |
| SMILES | C(=O)C=O |
| Merck Index | 15, 4544 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. IF ON SKIN: Wash with plenty of soap and water. If skin irritatio |
| MDL Number | MFCD00006957 |
| Health Hazard 2 | GHS H Statement Suspected of causing genetic defects if inhaled. Harmful if inhaled. Causes serious eye irritation. Causes skin irritation. May cause an allergic skin reaction. May cause respiratory irritation. |
| Solubility Information | Solubility in water: miscible. |
| Flash Point | >104°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | glyoxal,ethanedial,oxalaldehyde,1,2-ethanedione,glyoxylaldehyde,biformal,biformyl,diformal,diformyl,aerotex glyoxal 40 |
| Recommended Storage | May darken during storage |
| IUPAC Name | oxaldehyde |
| Beilstein | 01, 759 |
| Molecular Formula | C2H2O2 |
| EINECS Number | 203-474-9 |
| Specific Gravity | 1.265 |
Rutin, 97+%
CAS: 207671-50-9 Molecular Formula: C27H30O16 Molecular Weight (g/mol): 610.52 MDL Number: MFCD01319140 InChI Key: IKGXIBQEEMLURG-NVPNHPEKSA-N Synonym: rutin,rutoside,phytomelin,quercetin 3-rutinoside,birutan,eldrin,myrticolorin,venoruton,3-rutinosyl quercetin,bioflavonoid PubChem CID: 5280805 ChEBI: CHEBI:28527 IUPAC Name: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one SMILES: C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](OC3=C(OC4=CC(O)=CC(O)=C4C3=O)C3=CC(O)=C(O)C=C3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O
| PubChem CID | 5280805 |
|---|---|
| CAS | 207671-50-9 |
| Molecular Weight (g/mol) | 610.52 |
| ChEBI | CHEBI:28527 |
| MDL Number | MFCD01319140 |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](OC3=C(OC4=CC(O)=CC(O)=C4C3=O)C3=CC(O)=C(O)C=C3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| Synonym | rutin,rutoside,phytomelin,quercetin 3-rutinoside,birutan,eldrin,myrticolorin,venoruton,3-rutinosyl quercetin,bioflavonoid |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| InChI Key | IKGXIBQEEMLURG-NVPNHPEKSA-N |
| Molecular Formula | C27H30O16 |
1,8-Cineole, 99%
CAS: 470-82-6 Molecular Formula: C10H18O Molecular Weight (g/mol): 154.25 MDL Number: MFCD00167977 InChI Key: WEEGYLXZBRQIMU-UHFFFAOYSA-N Synonym: eucalyptol,cineole,1,8-cineole,1,8-cineol,cajeputol,1,8-epoxy-p-menthane,eucalyptole,zineol,eucapur,terpan PubChem CID: 2758 IUPAC Name: 2,2,4-trimethyl-3-oxabicyclo[2.2.2]octane SMILES: CC12CCC(CC1)C(C)(C)O2
| PubChem CID | 2758 |
|---|---|
| CAS | 470-82-6 |
| Molecular Weight (g/mol) | 154.25 |
| MDL Number | MFCD00167977 |
| SMILES | CC12CCC(CC1)C(C)(C)O2 |
| Synonym | eucalyptol,cineole,1,8-cineole,1,8-cineol,cajeputol,1,8-epoxy-p-menthane,eucalyptole,zineol,eucapur,terpan |
| IUPAC Name | 2,2,4-trimethyl-3-oxabicyclo[2.2.2]octane |
| InChI Key | WEEGYLXZBRQIMU-UHFFFAOYSA-N |
| Molecular Formula | C10H18O |
Anisole, 99%
CAS: 100-66-3 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00008354 InChI Key: RDOXTESZEPMUJZ-UHFFFAOYSA-N Synonym: methoxybenzene,methyl phenyl ether,benzene, methoxy,anisol,phenyl methyl ether,phenoxymethane,anizol,phenol methyl ether,methoxy-benzene PubChem CID: 7519 ChEBI: CHEBI:16579 IUPAC Name: anisole SMILES: COC1=CC=CC=C1
| PubChem CID | 7519 |
|---|---|
| CAS | 100-66-3 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:16579 |
| MDL Number | MFCD00008354 |
| SMILES | COC1=CC=CC=C1 |
| Synonym | methoxybenzene,methyl phenyl ether,benzene, methoxy,anisol,phenyl methyl ether,phenoxymethane,anizol,phenol methyl ether,methoxy-benzene |
| IUPAC Name | anisole |
| InChI Key | RDOXTESZEPMUJZ-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |