Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Methyl 4,6-dichloronicotinate, 95%
CAS: 65973-52-6 Molecular Formula: C7H5Cl2NO2 Molecular Weight (g/mol): 206.02 MDL Number: MFCD04125732 InChI Key: JEJMDUMJSZTJTI-UHFFFAOYSA-N PubChem CID: 2764083 IUPAC Name: methyl 4,6-dichloropyridine-3-carboxylate SMILES: COC(=O)C1=CN=C(Cl)C=C1Cl
| PubChem CID | 2764083 |
|---|---|
| CAS | 65973-52-6 |
| Molecular Weight (g/mol) | 206.02 |
| MDL Number | MFCD04125732 |
| SMILES | COC(=O)C1=CN=C(Cl)C=C1Cl |
| IUPAC Name | methyl 4,6-dichloropyridine-3-carboxylate |
| InChI Key | JEJMDUMJSZTJTI-UHFFFAOYSA-N |
| Molecular Formula | C7H5Cl2NO2 |
4-Chloro-2-methylpyridine, 95%
CAS: 3678-63-5 Molecular Formula: C6H6ClN Molecular Weight (g/mol): 127.571 MDL Number: MFCD00038833 InChI Key: DAOZBJCTEPJGES-UHFFFAOYSA-N Synonym: 4-chloro-2-picoline,2-methyl-4-chloropyridine,4-chloro-2-methyl-pyridine,pyridine, 4-chloro-2-methyl,p-chloropicoline,4-chloropicoline,4-chloro-2-picolin,acmc-20amln,pubchem2071 PubChem CID: 581392 IUPAC Name: 4-chloro-2-methylpyridine SMILES: CC1=NC=CC(=C1)Cl
| PubChem CID | 581392 |
|---|---|
| CAS | 3678-63-5 |
| Molecular Weight (g/mol) | 127.571 |
| MDL Number | MFCD00038833 |
| SMILES | CC1=NC=CC(=C1)Cl |
| Synonym | 4-chloro-2-picoline,2-methyl-4-chloropyridine,4-chloro-2-methyl-pyridine,pyridine, 4-chloro-2-methyl,p-chloropicoline,4-chloropicoline,4-chloro-2-picolin,acmc-20amln,pubchem2071 |
| IUPAC Name | 4-chloro-2-methylpyridine |
| InChI Key | DAOZBJCTEPJGES-UHFFFAOYSA-N |
| Molecular Formula | C6H6ClN |
Benzylhydrazine dihydrochloride, 97%
CAS: 20570-96-1 Molecular Formula: C7H12Cl2N2 Molecular Weight (g/mol): 195.087 MDL Number: MFCD00012921 InChI Key: MSJHOJKVMMEMNX-UHFFFAOYSA-N Synonym: benzylhydrazine dihydrochloride,benzylhydrazine.2hcl,1-benzylhydrazine dihydrochloride,benzyl-hydrazine dihydrochloride,hydrazine, phenylmethyl-, dihydrochloride,hydrazine, benzyl-, dihydrochloride,phenylmethyl hydrazine dihydrochloride,benzyl hydrazine di hcl,benzyl-hydrazine hydrochloride,benzylhydrazinedihydrochloride PubChem CID: 146540 IUPAC Name: benzylhydrazine;dihydrochloride SMILES: C1=CC=C(C=C1)CNN.Cl.Cl
| PubChem CID | 146540 |
|---|---|
| CAS | 20570-96-1 |
| Molecular Weight (g/mol) | 195.087 |
| MDL Number | MFCD00012921 |
| SMILES | C1=CC=C(C=C1)CNN.Cl.Cl |
| Synonym | benzylhydrazine dihydrochloride,benzylhydrazine.2hcl,1-benzylhydrazine dihydrochloride,benzyl-hydrazine dihydrochloride,hydrazine, phenylmethyl-, dihydrochloride,hydrazine, benzyl-, dihydrochloride,phenylmethyl hydrazine dihydrochloride,benzyl hydrazine di hcl,benzyl-hydrazine hydrochloride,benzylhydrazinedihydrochloride |
| IUPAC Name | benzylhydrazine;dihydrochloride |
| InChI Key | MSJHOJKVMMEMNX-UHFFFAOYSA-N |
| Molecular Formula | C7H12Cl2N2 |
5-Bromo-3-methoxyquinoline, 96%
CAS: 776296-12-9 Molecular Formula: C10H8BrNO Molecular Weight (g/mol): 238.084 MDL Number: MFCD16038652 InChI Key: YNVIAXULFXXTLV-UHFFFAOYSA-N Synonym: 5-bromo-3-methoxy-quinoline,5-bromo-3-methyoxy-quinoline,quinoline, 5-bromo-3-methoxy PubChem CID: 58227851 IUPAC Name: 5-bromo-3-methoxyquinoline SMILES: COC1=CN=C2C=CC=C(C2=C1)Br
| PubChem CID | 58227851 |
|---|---|
| CAS | 776296-12-9 |
| Molecular Weight (g/mol) | 238.084 |
| MDL Number | MFCD16038652 |
| SMILES | COC1=CN=C2C=CC=C(C2=C1)Br |
| Synonym | 5-bromo-3-methoxy-quinoline,5-bromo-3-methyoxy-quinoline,quinoline, 5-bromo-3-methoxy |
| IUPAC Name | 5-bromo-3-methoxyquinoline |
| InChI Key | YNVIAXULFXXTLV-UHFFFAOYSA-N |
| Molecular Formula | C10H8BrNO |
1,3-Dichloro-2-iodobenzene, 98%
CAS: 19230-28-5 Molecular Formula: C6H3Cl2I Molecular Weight (g/mol): 272.89 MDL Number: MFCD00060658 InChI Key: ZMPGXSFTXBOKFM-UHFFFAOYSA-N PubChem CID: 140498 IUPAC Name: 1,3-dichloro-2-iodobenzene SMILES: ClC1=CC=CC(Cl)=C1I
| PubChem CID | 140498 |
|---|---|
| CAS | 19230-28-5 |
| Molecular Weight (g/mol) | 272.89 |
| MDL Number | MFCD00060658 |
| SMILES | ClC1=CC=CC(Cl)=C1I |
| IUPAC Name | 1,3-dichloro-2-iodobenzene |
| InChI Key | ZMPGXSFTXBOKFM-UHFFFAOYSA-N |
| Molecular Formula | C6H3Cl2I |
Bis(2-aminophenyl) ether, 98%
CAS: 24878-25-9 Molecular Formula: C12H12N2O Molecular Weight (g/mol): 200.241 MDL Number: MFCD00792533 InChI Key: GOJFAKBEASOYNM-UHFFFAOYSA-N Synonym: 2,2'-oxydianiline,2-2-aminophenoxy aniline,2,2 inverted exclamation marka-oxydianiline,aminophenyl ether,o,o'-oxydianiline,2-aminophenyl ether,bis 2-aminophenyl ether,2,2'-oxybis benzenamine,benzenamine,2,2'-oxybis,2,2'-diaminodiphenyl ether PubChem CID: 458824 IUPAC Name: 2-(2-aminophenoxy)aniline SMILES: C1=CC=C(C(=C1)N)OC2=CC=CC=C2N
| PubChem CID | 458824 |
|---|---|
| CAS | 24878-25-9 |
| Molecular Weight (g/mol) | 200.241 |
| MDL Number | MFCD00792533 |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC=CC=C2N |
| Synonym | 2,2'-oxydianiline,2-2-aminophenoxy aniline,2,2 inverted exclamation marka-oxydianiline,aminophenyl ether,o,o'-oxydianiline,2-aminophenyl ether,bis 2-aminophenyl ether,2,2'-oxybis benzenamine,benzenamine,2,2'-oxybis,2,2'-diaminodiphenyl ether |
| IUPAC Name | 2-(2-aminophenoxy)aniline |
| InChI Key | GOJFAKBEASOYNM-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O |
2,7-Di-tert-butylfluorene, 97+%
CAS: 58775-05-6 Molecular Formula: C21H26 Molecular Weight (g/mol): 278.439 MDL Number: MFCD03093998 InChI Key: DFZYPLLGAQIQTD-UHFFFAOYSA-N Synonym: 2,7-di-tert-butylfluorene,2,7-di-tert-butyl-9h-fluorene,2,7-di-t-butylfluorene,9h-fluorene, 2,7-bis 1,1-dimethylethyl,pubchem15066,2,7-di-tert-butyl fluorene,2,7-di-tert-butyl-fluorene,ksc491i2b PubChem CID: 4090082 IUPAC Name: 2,7-ditert-butyl-9H-fluorene SMILES: CC(C)(C)C1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)C(C)(C)C
| PubChem CID | 4090082 |
|---|---|
| CAS | 58775-05-6 |
| Molecular Weight (g/mol) | 278.439 |
| MDL Number | MFCD03093998 |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)C(C)(C)C |
| Synonym | 2,7-di-tert-butylfluorene,2,7-di-tert-butyl-9h-fluorene,2,7-di-t-butylfluorene,9h-fluorene, 2,7-bis 1,1-dimethylethyl,pubchem15066,2,7-di-tert-butyl fluorene,2,7-di-tert-butyl-fluorene,ksc491i2b |
| IUPAC Name | 2,7-ditert-butyl-9H-fluorene |
| InChI Key | DFZYPLLGAQIQTD-UHFFFAOYSA-N |
| Molecular Formula | C21H26 |
4-(4-Pyridyl)benzaldehyde, 97%
CAS: 99163-12-9 Molecular Formula: C12H9NO Molecular Weight (g/mol): 183.21 MDL Number: MFCD02684110 InChI Key: MBJXDIYHLGBQOT-UHFFFAOYSA-N Synonym: 4-pyridin-4-yl-benzaldehyde,4-pyridin-4-yl benzaldehyde,4-4-pyridyl benzaldehyde,4-4-pyridinyl benzaldehyde,4-4-formylphenyl pyridine,akos bar-0607,benzaldehyde, 4-4-pyridinyl,acmc-209sbt PubChem CID: 639673 IUPAC Name: 4-pyridin-4-ylbenzaldehyde SMILES: C1=CC(=CC=C1C=O)C2=CC=NC=C2
| PubChem CID | 639673 |
|---|---|
| CAS | 99163-12-9 |
| Molecular Weight (g/mol) | 183.21 |
| MDL Number | MFCD02684110 |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=NC=C2 |
| Synonym | 4-pyridin-4-yl-benzaldehyde,4-pyridin-4-yl benzaldehyde,4-4-pyridyl benzaldehyde,4-4-pyridinyl benzaldehyde,4-4-formylphenyl pyridine,akos bar-0607,benzaldehyde, 4-4-pyridinyl,acmc-209sbt |
| IUPAC Name | 4-pyridin-4-ylbenzaldehyde |
| InChI Key | MBJXDIYHLGBQOT-UHFFFAOYSA-N |
| Molecular Formula | C12H9NO |
3-Aminopropane-1-sulfonic acid, 97%
CAS: 3687-18-1 Molecular Formula: C3H9NO3S Molecular Weight (g/mol): 139.17 MDL Number: MFCD00008225 InChI Key: SNKZJIOFVMKAOJ-UHFFFAOYSA-N Synonym: homotaurine,3-amino-1-propanesulfonic acid,tramiprosate,alzhemed,3-aminopropanesulphonic acid,3aps,1-propanesulfonic acid, 3-amino,cerebril,3-aminopropanesulfonic acid,3-aminopropane sulfonic acid PubChem CID: 1646 ChEBI: CHEBI:1457 IUPAC Name: 3-aminopropane-1-sulfonic acid SMILES: NCCCS(O)(=O)=O
| PubChem CID | 1646 |
|---|---|
| CAS | 3687-18-1 |
| Molecular Weight (g/mol) | 139.17 |
| ChEBI | CHEBI:1457 |
| MDL Number | MFCD00008225 |
| SMILES | NCCCS(O)(=O)=O |
| Synonym | homotaurine,3-amino-1-propanesulfonic acid,tramiprosate,alzhemed,3-aminopropanesulphonic acid,3aps,1-propanesulfonic acid, 3-amino,cerebril,3-aminopropanesulfonic acid,3-aminopropane sulfonic acid |
| IUPAC Name | 3-aminopropane-1-sulfonic acid |
| InChI Key | SNKZJIOFVMKAOJ-UHFFFAOYSA-N |
| Molecular Formula | C3H9NO3S |
4-Bromothiobenzamide, 97%
CAS: 26197-93-3 Molecular Formula: C7H6BrNS Molecular Weight (g/mol): 216.096 MDL Number: MFCD04114360 InChI Key: AIPANIYQEBQYGC-UHFFFAOYSA-N Synonym: 4-bromothiobenzamide,4-bromo-thiobenzamide,p-bromothiobenzamide,4-bromobenzothioamide,benzenecarbothioamide, 4-bromo,4-bromobenzene-1-carbothioamide,amino 4-bromophenyl methane-1-thione,acmc-1cehr,4-bromanylbenzenecarbothioamide PubChem CID: 1549289 IUPAC Name: 4-bromobenzenecarbothioamide SMILES: C1=CC(=CC=C1C(=S)N)Br
| PubChem CID | 1549289 |
|---|---|
| CAS | 26197-93-3 |
| Molecular Weight (g/mol) | 216.096 |
| MDL Number | MFCD04114360 |
| SMILES | C1=CC(=CC=C1C(=S)N)Br |
| Synonym | 4-bromothiobenzamide,4-bromo-thiobenzamide,p-bromothiobenzamide,4-bromobenzothioamide,benzenecarbothioamide, 4-bromo,4-bromobenzene-1-carbothioamide,amino 4-bromophenyl methane-1-thione,acmc-1cehr,4-bromanylbenzenecarbothioamide |
| IUPAC Name | 4-bromobenzenecarbothioamide |
| InChI Key | AIPANIYQEBQYGC-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrNS |
2-Acetyl-6-bromopyridine, 97%
CAS: 49669-13-8 Molecular Formula: C7H6BrNO Molecular Weight (g/mol): 200.035 MDL Number: MFCD00272200 InChI Key: RUJTWTUYVOEEFW-UHFFFAOYSA-N Synonym: 2-acetyl-6-bromopyridine,2-bromo-6-acetylpyridine,1-6-bromopyridin-2-yl ethanone,1-6-bromopyridin-2-yl ethan-1-one,1-6-bromo-2-pyridinyl-1-ethanone,ethanone, 1-6-bromo-2-pyridinyl,bromopyridinylethanone,pubchem13351,acmc-1ap21,ksc490s1f PubChem CID: 11298578 IUPAC Name: 1-(6-bromopyridin-2-yl)ethanone SMILES: CC(=O)C1=NC(=CC=C1)Br
| PubChem CID | 11298578 |
|---|---|
| CAS | 49669-13-8 |
| Molecular Weight (g/mol) | 200.035 |
| MDL Number | MFCD00272200 |
| SMILES | CC(=O)C1=NC(=CC=C1)Br |
| Synonym | 2-acetyl-6-bromopyridine,2-bromo-6-acetylpyridine,1-6-bromopyridin-2-yl ethanone,1-6-bromopyridin-2-yl ethan-1-one,1-6-bromo-2-pyridinyl-1-ethanone,ethanone, 1-6-bromo-2-pyridinyl,bromopyridinylethanone,pubchem13351,acmc-1ap21,ksc490s1f |
| IUPAC Name | 1-(6-bromopyridin-2-yl)ethanone |
| InChI Key | RUJTWTUYVOEEFW-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrNO |
Phenyl methanesulfonate, 98%
CAS: 16156-59-5 Molecular Formula: C7H8O3S Molecular Weight (g/mol): 172.20 MDL Number: MFCD00095143 InChI Key: WXVUCMFEGJUVTN-UHFFFAOYSA-N Synonym: phenyl methylsulfonate,phenyl methyl sulfonate,acmc-1bs7l,phenylmethanesulfonate 4,phenyl methanesulfonate,methanesulfonic acid,phenyl ester,methanesulfonic acid phenyl ester,methanesulfonic acid, phenyl ester PubChem CID: 316170 IUPAC Name: phenyl methanesulfonate SMILES: CS(=O)(=O)OC1=CC=CC=C1
| PubChem CID | 316170 |
|---|---|
| CAS | 16156-59-5 |
| Molecular Weight (g/mol) | 172.20 |
| MDL Number | MFCD00095143 |
| SMILES | CS(=O)(=O)OC1=CC=CC=C1 |
| Synonym | phenyl methylsulfonate,phenyl methyl sulfonate,acmc-1bs7l,phenylmethanesulfonate 4,phenyl methanesulfonate,methanesulfonic acid,phenyl ester,methanesulfonic acid phenyl ester,methanesulfonic acid, phenyl ester |
| IUPAC Name | phenyl methanesulfonate |
| InChI Key | WXVUCMFEGJUVTN-UHFFFAOYSA-N |
| Molecular Formula | C7H8O3S |
1-Oxa-6-azaspiro[3.4]octane oxalate, 96%
CAS: 1408074-51-0 Molecular Formula: C8H13NO5 Molecular Weight (g/mol): 203.19 MDL Number: MFCD19982774 InChI Key: ZKTJFOHJBNDMDS-UHFFFAOYNA-N Synonym: 1-oxa-6-azaspiro 3.4 octane oxalate,1-oxa-6-azaspiro 3.4 octane; oxalic acid PubChem CID: 71432930 IUPAC Name: 1-oxa-7-azaspiro[3.4]octane;oxalic acid SMILES: OC(=O)C(O)=O.C1CC2(CCNC2)O1
| PubChem CID | 71432930 |
|---|---|
| CAS | 1408074-51-0 |
| Molecular Weight (g/mol) | 203.19 |
| MDL Number | MFCD19982774 |
| SMILES | OC(=O)C(O)=O.C1CC2(CCNC2)O1 |
| Synonym | 1-oxa-6-azaspiro 3.4 octane oxalate,1-oxa-6-azaspiro 3.4 octane; oxalic acid |
| IUPAC Name | 1-oxa-7-azaspiro[3.4]octane;oxalic acid |
| InChI Key | ZKTJFOHJBNDMDS-UHFFFAOYNA-N |
| Molecular Formula | C8H13NO5 |
Methyl azetidine-3-carboxylate hydrochloride, 95%, Thermo Scientific Chemicals
CAS: 100202-39-9 Molecular Formula: C5H10ClNO2 Molecular Weight (g/mol): 151.59 MDL Number: MFCD01861758 InChI Key: UOCWTLBPYROHEF-UHFFFAOYSA-N Synonym: methyl azetidine-3-carboxylate hydrochloride,azetidine-3-methyl carboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hydrochloride,3-azetidinecarboxylic acid, methyl ester, hydrochloride,methyl azetidine-3-carboxylate hcl,methylazetidine-3-carboxylate hydrochloride,methyl 3-azetidinecarboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hcl,pubchem23516,acmc-209tka PubChem CID: 21100040 IUPAC Name: methyl azetidine-3-carboxylate;hydrochloride SMILES: Cl.COC(=O)C1CNC1
| PubChem CID | 21100040 |
|---|---|
| CAS | 100202-39-9 |
| Molecular Weight (g/mol) | 151.59 |
| MDL Number | MFCD01861758 |
| SMILES | Cl.COC(=O)C1CNC1 |
| Synonym | methyl azetidine-3-carboxylate hydrochloride,azetidine-3-methyl carboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hydrochloride,3-azetidinecarboxylic acid, methyl ester, hydrochloride,methyl azetidine-3-carboxylate hcl,methylazetidine-3-carboxylate hydrochloride,methyl 3-azetidinecarboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hcl,pubchem23516,acmc-209tka |
| IUPAC Name | methyl azetidine-3-carboxylate;hydrochloride |
| InChI Key | UOCWTLBPYROHEF-UHFFFAOYSA-N |
| Molecular Formula | C5H10ClNO2 |
1-Boc-3-(bromomethyl)azetidine, 95%
CAS: 253176-93-1 Molecular Formula: C9H16BrNO2 Molecular Weight (g/mol): 250.14 MDL Number: MFCD16556174 InChI Key: PUKCUGDJEPVLPR-UHFFFAOYSA-N Synonym: 1-boc-3-bromomethyl azetidine,tert-butyl 3-bromomethyl azetidine-1-carboxylate,1-boc-3-bromomethylazetidine,n-tert-butoxycarbonyl-3-bromomethylazetidine,3-bromomethyl-azetidine-1-carboxylic acid tert-butyl ester,acmc-209d8t,1-n-boc-3-bromomethyl azetidine,tert-butyl 3-bromomethyl-1-azetidinecarboxylate,tert-butyl 3-bromomethyl ;azetidine-1-carboxylate,2-methyl-2-propanyl 3-bromomethyl-1-azetidinecarboxylate PubChem CID: 53350331 IUPAC Name: tert-butyl 3-(bromomethyl)azetidine-1-carboxylate SMILES: CC(C)(C)OC(=O)N1CC(CBr)C1
| PubChem CID | 53350331 |
|---|---|
| CAS | 253176-93-1 |
| Molecular Weight (g/mol) | 250.14 |
| MDL Number | MFCD16556174 |
| SMILES | CC(C)(C)OC(=O)N1CC(CBr)C1 |
| Synonym | 1-boc-3-bromomethyl azetidine,tert-butyl 3-bromomethyl azetidine-1-carboxylate,1-boc-3-bromomethylazetidine,n-tert-butoxycarbonyl-3-bromomethylazetidine,3-bromomethyl-azetidine-1-carboxylic acid tert-butyl ester,acmc-209d8t,1-n-boc-3-bromomethyl azetidine,tert-butyl 3-bromomethyl-1-azetidinecarboxylate,tert-butyl 3-bromomethyl ;azetidine-1-carboxylate,2-methyl-2-propanyl 3-bromomethyl-1-azetidinecarboxylate |
| IUPAC Name | tert-butyl 3-(bromomethyl)azetidine-1-carboxylate |
| InChI Key | PUKCUGDJEPVLPR-UHFFFAOYSA-N |
| Molecular Formula | C9H16BrNO2 |