Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Benzophenone, 99+%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Mercaptoacetic acid, 97+%
CAS: 68-11-1 Molecular Formula: C2H4O2S Molecular Weight (g/mol): 92.112 MDL Number: MFCD00004876 InChI Key: CWERGRDVMFNCDR-UHFFFAOYSA-N Synonym: mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio PubChem CID: 1133 ChEBI: CHEBI:30065 IUPAC Name: 2-sulfanylacetic acid SMILES: C(C(=O)O)S
| PubChem CID | 1133 |
|---|---|
| CAS | 68-11-1 |
| Molecular Weight (g/mol) | 92.112 |
| ChEBI | CHEBI:30065 |
| MDL Number | MFCD00004876 |
| SMILES | C(C(=O)O)S |
| Synonym | mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio |
| IUPAC Name | 2-sulfanylacetic acid |
| InChI Key | CWERGRDVMFNCDR-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2S |
1,1,1,3,3,3-Hexafluoro-2-propanol, 99+%
CAS: 920-66-1 Molecular Formula: C3H2F6O Molecular Weight (g/mol): 168.038 MDL Number: MFCD00011651 InChI Key: BYEAHWXPCBROCE-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol PubChem CID: 13529 ChEBI: CHEBI:63104 IUPAC Name: 1,1,1,3,3,3-hexafluoropropan-2-ol SMILES: C(C(F)(F)F)(C(F)(F)F)O
| PubChem CID | 13529 |
|---|---|
| CAS | 920-66-1 |
| Molecular Weight (g/mol) | 168.038 |
| ChEBI | CHEBI:63104 |
| MDL Number | MFCD00011651 |
| SMILES | C(C(F)(F)F)(C(F)(F)F)O |
| Synonym | 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChI Key | BYEAHWXPCBROCE-UHFFFAOYSA-N |
| Molecular Formula | C3H2F6O |
2,5-Norbornadiene, 97%, stab with 250 ppm BHT
CAS: 121-46-0 Molecular Formula: C7H8 Molecular Weight (g/mol): 92.14 MDL Number: MFCD00082301 InChI Key: SJYNFBVQFBRSIB-UHFFFAOYSA-N Synonym: 2,5-norbornadiene,bicyclo 2.2.1 hepta-2,5-diene,norbornadiene,unii-w9ztq75zus,bicyclo 2.2.1 heptadiene,8,9,10-trinorborna-2,5-diene,w9ztq75zus,dicycloheptadiene PubChem CID: 8473 IUPAC Name: bicyclo[2.2.1]hepta-2,5-diene SMILES: C1C2C=CC1C=C2
| PubChem CID | 8473 |
|---|---|
| CAS | 121-46-0 |
| Molecular Weight (g/mol) | 92.14 |
| MDL Number | MFCD00082301 |
| SMILES | C1C2C=CC1C=C2 |
| Synonym | 2,5-norbornadiene,bicyclo 2.2.1 hepta-2,5-diene,norbornadiene,unii-w9ztq75zus,bicyclo 2.2.1 heptadiene,8,9,10-trinorborna-2,5-diene,w9ztq75zus,dicycloheptadiene |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene |
| InChI Key | SJYNFBVQFBRSIB-UHFFFAOYSA-N |
| Molecular Formula | C7H8 |
2,4-Dichlorophenoxyacetic acid, 98%
CAS: 94-75-7 Molecular Formula: C8H6Cl2O3 Molecular Weight (g/mol): 221.033 MDL Number: MFCD00004300 InChI Key: OVSKIKFHRZPJSS-UHFFFAOYSA-N Synonym: 2,4-dichlorophenoxyacetic acid,2-2,4-dichlorophenoxy acetic acid,2,4-dichlorophenoxy acetic acid,hedonal,rhodia,agrotect,fernesta,fernimine,netagrone,tributon PubChem CID: 1486 ChEBI: CHEBI:28854 IUPAC Name: 2-(2,4-dichlorophenoxy)acetic acid SMILES: C1=CC(=C(C=C1Cl)Cl)OCC(=O)O
| PubChem CID | 1486 |
|---|---|
| CAS | 94-75-7 |
| Molecular Weight (g/mol) | 221.033 |
| ChEBI | CHEBI:28854 |
| MDL Number | MFCD00004300 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |
| Synonym | 2,4-dichlorophenoxyacetic acid,2-2,4-dichlorophenoxy acetic acid,2,4-dichlorophenoxy acetic acid,hedonal,rhodia,agrotect,fernesta,fernimine,netagrone,tributon |
| IUPAC Name | 2-(2,4-dichlorophenoxy)acetic acid |
| InChI Key | OVSKIKFHRZPJSS-UHFFFAOYSA-N |
| Molecular Formula | C8H6Cl2O3 |
Tetracycline Hydrochloride 98.0+%, TCI America™
CAS: 64-75-5 Molecular Formula: C22H25ClN2O8 Molecular Weight (g/mol): 480.898 MDL Number: MFCD00078142 InChI Key: HTXDZWDXSWLLLW-FMZCEJRJSA-N Synonym: tetracycline hydrochloride PubChem CID: 129628373 IUPAC Name: (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,11,12a-pentahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride SMILES: CC1(C2CC3C(C(=C(C(=O)C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)C(=O)N)O)N(C)C)O.Cl
| PubChem CID | 129628373 |
|---|---|
| CAS | 64-75-5 |
| Molecular Weight (g/mol) | 480.898 |
| MDL Number | MFCD00078142 |
| SMILES | CC1(C2CC3C(C(=C(C(=O)C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)C(=O)N)O)N(C)C)O.Cl |
| Synonym | tetracycline hydrochloride |
| IUPAC Name | (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,11,12a-pentahydroxy-6-methyl-1,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
| InChI Key | HTXDZWDXSWLLLW-FMZCEJRJSA-N |
| Molecular Formula | C22H25ClN2O8 |
Tetrabutylammonium hydrogen sulfate, 98%
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: hydrogen sulfate;tetrabutylazanium SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 94433 |
|---|---|
| CAS | 32503-27-8 |
| Molecular Weight (g/mol) | 339.54 |
| MDL Number | MFCD00011637 |
| SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
| IUPAC Name | hydrogen sulfate;tetrabutylazanium |
| InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO4S |
Allyl methacrylate, 98%, stabilized
CAS: 96-05-9 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00008592 InChI Key: FBCQUCJYYPMKRO-UHFFFAOYSA-N Synonym: allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech PubChem CID: 7274 IUPAC Name: prop-2-enyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC=C
| PubChem CID | 7274 |
|---|---|
| CAS | 96-05-9 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00008592 |
| SMILES | CC(=C)C(=O)OCC=C |
| Synonym | allyl methacrylate,ageflex ama,methacrylic acid, allyl ester,2-propenoic acid, 2-methyl-, 2-propenyl ester,allylmethacrylate,allyl 2-methylacrylate,allylester kyseliny methakrylove,methacrylic acid allyl ester,unii-g2ig50653z,allylester kyseliny methakrylove czech |
| IUPAC Name | prop-2-enyl 2-methylprop-2-enoate |
| InChI Key | FBCQUCJYYPMKRO-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene, 99%
CAS: 7128-64-5 Molecular Formula: C26H26N2O2S Molecular Weight (g/mol): 430.566 MDL Number: MFCD00005774 InChI Key: AIXZBGVLNVRQSS-UHFFFAOYSA-N Synonym: bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole PubChem CID: 292429 IUPAC Name: 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole SMILES: CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C
| PubChem CID | 292429 |
|---|---|
| CAS | 7128-64-5 |
| Molecular Weight (g/mol) | 430.566 |
| MDL Number | MFCD00005774 |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| Synonym | bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole |
| IUPAC Name | 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
| InChI Key | AIXZBGVLNVRQSS-UHFFFAOYSA-N |
| Molecular Formula | C26H26N2O2S |
Chitosan, 85% deacetylated
CAS: 9012-76-4 Molecular Formula: C56H103N9O39 Molecular Weight (g/mol): 1526.464 MDL Number: MFCD00161512 InChI Key: FLASNYPZGWUPSU-SICDJOISSA-N Synonym: chitosan,poliglusam,deacetylchitin,chicol,flonac c,flonac n,sea cure plus,kytex h,kytex m,kimitsu chitosan f PubChem CID: 71853 IUPAC Name: methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hy SMILES: COC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)N)OC3C(OC(C(C3O)N)O)CO)CO)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)N)O)N)O)N)O)N)O)N)O)N)O
| PubChem CID | 71853 |
|---|---|
| CAS | 9012-76-4 |
| Molecular Weight (g/mol) | 1526.464 |
| MDL Number | MFCD00161512 |
| SMILES | COC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)N)OC3C(OC(C(C3O)N)O)CO)CO)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)N)O)N)O)N)O)N)O)N)O)N)O |
| Synonym | chitosan,poliglusam,deacetylchitin,chicol,flonac c,flonac n,sea cure plus,kytex h,kytex m,kimitsu chitosan f |
| IUPAC Name | methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hy |
| InChI Key | FLASNYPZGWUPSU-SICDJOISSA-N |
| Molecular Formula | C56H103N9O39 |
Ferrocene, 99%
CAS: 102-54-5 Molecular Formula: C10H10Fe Molecular Weight (g/mol): 186.04 MDL Number: MFCD00001427 InChI Key: DFRHTHSZMBROSH-UHFFFAOYSA-N Synonym: ferrocene,bis cyclopentadienyl iron PubChem CID: 25199998 IUPAC Name: cyclopenta-1,3-diene;iron SMILES: [Fe].c1cccc1.c1cccc1
| PubChem CID | 25199998 |
|---|---|
| CAS | 102-54-5 |
| Molecular Weight (g/mol) | 186.04 |
| MDL Number | MFCD00001427 |
| SMILES | [Fe].c1cccc1.c1cccc1 |
| Synonym | ferrocene,bis cyclopentadienyl iron |
| IUPAC Name | cyclopenta-1,3-diene;iron |
| InChI Key | DFRHTHSZMBROSH-UHFFFAOYSA-N |
| Molecular Formula | C10H10Fe |
Carbon powder, activated
CAS: 7440-44-0 Molecular Formula: C MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
Urea, ultrapure, 99%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Alginic acid sodium salt, low viscosity
CAS: 9005-38-3 Molecular Formula: (C6H7O7)A(C6H7O7)BNa MDL Number: MFCD00081310 Synonym: Algin; Polymannuronic acid sodium salt
| CAS | 9005-38-3 |
|---|---|
| MDL Number | MFCD00081310 |
| Synonym | Algin; Polymannuronic acid sodium salt |
| Molecular Formula | (C6H7O7)A(C6H7O7)BNa |
Phenylhydrazine Hydrochloride, 99+%
CAS: 59-88-1 Molecular Formula: C6H9ClN2 Molecular Weight (g/mol): 144.60 MDL Number: MFCD00012924 InChI Key: JOVOSQBPPZZESK-UHFFFAOYSA-N Synonym: phenylhydrazine hydrochloride,phenylhydrazinium chloride,phenylhydrazine-hcl,phenylhydrazine monohydrochloride,phenylhydrazine hcl,hydrazine, phenyl-, monohydrochloride,unii-h7qfk49svd,phenylhydrazin hydrochlorid,phenylhydrazine.hcl,ccris 5707 PubChem CID: 60962 IUPAC Name: phenylhydrazine;hydrochloride SMILES: [H+].[Cl-].NNC1=CC=CC=C1
| PubChem CID | 60962 |
|---|---|
| CAS | 59-88-1 |
| Molecular Weight (g/mol) | 144.60 |
| MDL Number | MFCD00012924 |
| SMILES | [H+].[Cl-].NNC1=CC=CC=C1 |
| Synonym | phenylhydrazine hydrochloride,phenylhydrazinium chloride,phenylhydrazine-hcl,phenylhydrazine monohydrochloride,phenylhydrazine hcl,hydrazine, phenyl-, monohydrochloride,unii-h7qfk49svd,phenylhydrazin hydrochlorid,phenylhydrazine.hcl,ccris 5707 |
| IUPAC Name | phenylhydrazine;hydrochloride |
| InChI Key | JOVOSQBPPZZESK-UHFFFAOYSA-N |
| Molecular Formula | C6H9ClN2 |